diff --git a/libs/screenshot-dev.js b/libs/screenshot-dev.js index edbc5c93..d94a6947 100644 --- a/libs/screenshot-dev.js +++ b/libs/screenshot-dev.js @@ -1,4 +1,4 @@ -// Last time updated at Sep 10, 2015, 08:32:23 +// Last time updated at July 28, 2016, 08:32:23 // Muaz Khan - https://github.com/muaz-khan // MIT License - https://www.webrtc-experiment.com/licence/ @@ -7,417 +7,1181 @@ // Note: All libraries listed in this file are "external libraries" // ---- and has their own copyrights. Taken from "html2canvas" project. -/* Core -------------------- */ +/* + html2canvas 0.5.0-alpha1 + Copyright (c) 2015 Niklas von Hertzen -"use strict"; + Released under MIT License +*/ -var _html2canvas = {}, -previousElement, -computedCSS, -html2canvas; +(function(window, document, exports, global, define, undefined){ -function h2clog(a) { - if (_html2canvas.logging && window.console && window.console.log) { - window.console.log(a); - } +/*! + * @overview es6-promise - a tiny implementation of Promises/A+. + * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald) + * @license Licensed under MIT license + * See https://raw.githubusercontent.com/jakearchibald/es6-promise/master/LICENSE + * @version 2.0.1 + */ + +(function(){function r(a,b){n[l]=a;n[l+1]=b;l+=2;2===l&&A()}function s(a){return"function"===typeof a}function F(){return function(){process.nextTick(t)}}function G(){var a=0,b=new B(t),c=document.createTextNode("");b.observe(c,{characterData:!0});return function(){c.data=a=++a%2}}function H(){var a=new MessageChannel;a.port1.onmessage=t;return function(){a.port2.postMessage(0)}}function I(){return function(){setTimeout(t,1)}}function t(){for(var a=0;a 0) { - prefix = method.substr( 0, prefix_i); - method = method.substr( prefix_i ); - } - results.push({ - prefix: prefix, - method: method.toLowerCase(), - value: block, - args: args - }); - } - args = []; //for some odd reason, setting .length = 0 didn't work in safari - method = - prefix = - definition = - block = ''; - }; + /** + * The `punycode` object. + * @name punycode + * @type Object + */ + var punycode, + + /** Highest positive signed 32-bit float value */ + maxInt = 2147483647, // aka. 0x7FFFFFFF or 2^31-1 + + /** Bootstring parameters */ + base = 36, + tMin = 1, + tMax = 26, + skew = 38, + damp = 700, + initialBias = 72, + initialN = 128, // 0x80 + delimiter = '-', // '\x2D' + + /** Regular expressions */ + regexPunycode = /^xn--/, + regexNonASCII = /[^\x20-\x7E]/, // unprintable ASCII chars + non-ASCII chars + regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g, // RFC 3490 separators + + /** Error messages */ + errors = { + 'overflow': 'Overflow: input needs wider integers to process', + 'not-basic': 'Illegal input >= 0x80 (not a basic code point)', + 'invalid-input': 'Invalid input' + }, - appendResult(); - for(var i = 0, ii = value.length; i -1){ - continue; - } - switch(c) { - case '"': - if(!quote) { - quote = c; - } - else if(quote === c) { - quote = null; - } - break; + /** Convenience shortcuts */ + baseMinusTMin = base - tMin, + floor = Math.floor, + stringFromCharCode = String.fromCharCode, - case '(': - if(quote) { break; } - else if(mode === 0) { - mode = 1; - block += c; - continue; - } else { - numParen++; - } - break; + /** Temporary variable */ + key; - case ')': - if(quote) { break; } - else if(mode === 1) { - if(numParen === 0) { - mode = 0; - block += c; - appendResult(); - continue; - } else { - numParen--; - } - } - break; + /*--------------------------------------------------------------------------*/ - case ',': - if(quote) { break; } - else if(mode === 0) { - appendResult(); - continue; - } - else if (mode === 1) { - if(numParen === 0 && !method.match(/^url$/i)) { - args.push(definition); - definition = ''; - block += c; - continue; - } - } - break; - } + /** + * A generic error utility function. + * @private + * @param {String} type The error type. + * @returns {Error} Throws a `RangeError` with the applicable error message. + */ + function error(type) { + throw RangeError(errors[type]); + } - block += c; - if(mode === 0) { method += c; } - else { definition += c; } + /** + * A generic `Array#map` utility function. + * @private + * @param {Array} array The array to iterate over. + * @param {Function} callback The function that gets called for every array + * item. + * @returns {Array} A new array of values returned by the callback function. + */ + function map(array, fn) { + var length = array.length; + var result = []; + while (length--) { + result[length] = fn(array[length]); } - appendResult(); + return result; + } - return results; -}; + /** + * A simple `Array#map`-like wrapper to work with domain name strings or email + * addresses. + * @private + * @param {String} domain The domain name or email address. + * @param {Function} callback The function that gets called for every + * character. + * @returns {Array} A new string of characters returned by the callback + * function. + */ + function mapDomain(string, fn) { + var parts = string.split('@'); + var result = ''; + if (parts.length > 1) { + // In email addresses, only the domain name should be punycoded. Leave + // the local part (i.e. everything up to `@`) intact. + result = parts[0] + '@'; + string = parts[1]; + } + var labels = string.split(regexSeparators); + var encoded = map(labels, fn).join('.'); + return result + encoded; + } + + /** + * Creates an array containing the numeric code points of each Unicode + * character in the string. While JavaScript uses UCS-2 internally, + * this function will convert a pair of surrogate halves (each of which + * UCS-2 exposes as separate characters) into a single code point, + * matching UTF-16. + * @see `punycode.ucs2.encode` + * @see + * @memberOf punycode.ucs2 + * @name decode + * @param {String} string The Unicode input string (UCS-2). + * @returns {Array} The new array of code points. + */ + function ucs2decode(string) { + var output = [], + counter = 0, + length = string.length, + value, + extra; + while (counter < length) { + value = string.charCodeAt(counter++); + if (value >= 0xD800 && value <= 0xDBFF && counter < length) { + // high surrogate, and there is a next character + extra = string.charCodeAt(counter++); + if ((extra & 0xFC00) == 0xDC00) { // low surrogate + output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000); + } else { + // unmatched surrogate; only append this code unit, in case the next + // code unit is the high surrogate of a surrogate pair + output.push(value); + counter--; + } + } else { + output.push(value); + } + } + return output; + } + + /** + * Creates a string based on an array of numeric code points. + * @see `punycode.ucs2.decode` + * @memberOf punycode.ucs2 + * @name encode + * @param {Array} codePoints The array of numeric code points. + * @returns {String} The new Unicode string (UCS-2). + */ + function ucs2encode(array) { + return map(array, function(value) { + var output = ''; + if (value > 0xFFFF) { + value -= 0x10000; + output += stringFromCharCode(value >>> 10 & 0x3FF | 0xD800); + value = 0xDC00 | value & 0x3FF; + } + output += stringFromCharCode(value); + return output; + }).join(''); + } + + /** + * Converts a basic code point into a digit/integer. + * @see `digitToBasic()` + * @private + * @param {Number} codePoint The basic numeric code point value. + * @returns {Number} The numeric value of a basic code point (for use in + * representing integers) in the range `0` to `base - 1`, or `base` if + * the code point does not represent a value. + */ + function basicToDigit(codePoint) { + if (codePoint - 48 < 10) { + return codePoint - 22; + } + if (codePoint - 65 < 26) { + return codePoint - 65; + } + if (codePoint - 97 < 26) { + return codePoint - 97; + } + return base; + } -_html2canvas.Util.Bounds = function getBounds (el) { - var clientRect, - bounds = {}; + /** + * Converts a digit/integer into a basic code point. + * @see `basicToDigit()` + * @private + * @param {Number} digit The numeric value of a basic code point. + * @returns {Number} The basic code point whose value (when used for + * representing integers) is `digit`, which needs to be in the range + * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is + * used; else, the lowercase form is used. The behavior is undefined + * if `flag` is non-zero and `digit` has no uppercase form. + */ + function digitToBasic(digit, flag) { + // 0..25 map to ASCII a..z or A..Z + // 26..35 map to ASCII 0..9 + return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); + } - if (el.getBoundingClientRect){ - clientRect = el.getBoundingClientRect(); + /** + * Bias adaptation function as per section 3.4 of RFC 3492. + * http://tools.ietf.org/html/rfc3492#section-3.4 + * @private + */ + function adapt(delta, numPoints, firstTime) { + var k = 0; + delta = firstTime ? floor(delta / damp) : delta >> 1; + delta += floor(delta / numPoints); + for (/* no initialization */; delta > baseMinusTMin * tMax >> 1; k += base) { + delta = floor(delta / baseMinusTMin); + } + return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); + } + /** + * Converts a Punycode string of ASCII-only symbols to a string of Unicode + * symbols. + * @memberOf punycode + * @param {String} input The Punycode string of ASCII-only symbols. + * @returns {String} The resulting string of Unicode symbols. + */ + function decode(input) { + // Don't use UCS-2 + var output = [], + inputLength = input.length, + out, + i = 0, + n = initialN, + bias = initialBias, + basic, + j, + index, + oldi, + w, + k, + digit, + t, + /** Cached calculation results */ + baseMinusT; + + // Handle the basic code points: let `basic` be the number of input code + // points before the last delimiter, or `0` if there is none, then copy + // the first basic code points to the output. + + basic = input.lastIndexOf(delimiter); + if (basic < 0) { + basic = 0; + } - // TODO add scroll position to bounds, so no scrolling of window necessary - bounds.top = clientRect.top; - bounds.bottom = clientRect.bottom || (clientRect.top + clientRect.height); - bounds.left = clientRect.left; + for (j = 0; j < basic; ++j) { + // if it's not a basic code point + if (input.charCodeAt(j) >= 0x80) { + error('not-basic'); + } + output.push(input.charCodeAt(j)); + } - // older IE doesn't have width/height, but top/bottom instead - bounds.width = clientRect.width || (clientRect.right - clientRect.left); - bounds.height = clientRect.height || (clientRect.bottom - clientRect.top); + // Main decoding loop: start just after the last delimiter if any basic code + // points were copied; start at the beginning otherwise. - return bounds; + for (index = basic > 0 ? basic + 1 : 0; index < inputLength; /* no final expression */) { - } -}; + // `index` is the index of the next character to be consumed. + // Decode a generalized variable-length integer into `delta`, + // which gets added to `i`. The overflow checking is easier + // if we increase `i` as we go, then subtract off its starting + // value at the end to obtain `delta`. + for (oldi = i, w = 1, k = base; /* no condition */; k += base) { -_html2canvas.Util.getCSS = function (el, attribute, index) { - // return $(el).css(attribute); + if (index >= inputLength) { + error('invalid-input'); + } - var val, - isBackgroundSizePosition = attribute.match( /^background(Size|Position)$/ ); + digit = basicToDigit(input.charCodeAt(index++)); - function toPX( attribute, val ) { - var rsLeft = el.runtimeStyle && el.runtimeStyle[ attribute ], - left, - style = el.style; + if (digit >= base || digit > floor((maxInt - i) / w)) { + error('overflow'); + } - // Check if we are not dealing with pixels, (Opera has issues with this) - // Ported from jQuery css.js - // From the awesome hack by Dean Edwards - // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + i += digit * w; + t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias); - // If we're not dealing with a regular pixel number - // but a number that has a weird ending, we need to convert it to pixels + if (digit < t) { + break; + } - if ( !/^-?[0-9]+\.?[0-9]*(?:px)?$/i.test( val ) && /^-?\d/.test( val ) ) { + baseMinusT = base - t; + if (w > floor(maxInt / baseMinusT)) { + error('overflow'); + } - // Remember the original values - left = style.left; + w *= baseMinusT; - // Put in the new values to get a computed value out - if ( rsLeft ) { - el.runtimeStyle.left = el.currentStyle.left; } - style.left = attribute === "fontSize" ? "1em" : (val || 0); - val = style.pixelLeft + "px"; - // Revert the changed values - style.left = left; - if ( rsLeft ) { - el.runtimeStyle.left = rsLeft; + out = output.length + 1; + bias = adapt(i - oldi, out, oldi == 0); + + // `i` was supposed to wrap around from `out` to `0`, + // incrementing `n` each time, so we'll fix that now: + if (floor(i / out) > maxInt - n) { + error('overflow'); } - } + n += floor(i / out); + i %= out; + + // Insert `n` at position `i` of the output + output.splice(i++, 0, n); - if (!/^(thin|medium|thick)$/i.test( val )) { - return Math.round(parseFloat( val )) + "px"; } - return val; + return ucs2encode(output); } - if (previousElement !== el) { - computedCSS = document.defaultView.getComputedStyle(el, null); + /** + * Converts a string of Unicode symbols (e.g. a domain name label) to a + * Punycode string of ASCII-only symbols. + * @memberOf punycode + * @param {String} input The string of Unicode symbols. + * @returns {String} The resulting Punycode string of ASCII-only symbols. + */ + function encode(input) { + var n, + delta, + handledCPCount, + basicLength, + bias, + j, + m, + q, + k, + t, + currentValue, + output = [], + /** `inputLength` will hold the number of code points in `input`. */ + inputLength, + /** Cached calculation results */ + handledCPCountPlusOne, + baseMinusT, + qMinusT; + + // Convert the input in UCS-2 to Unicode + input = ucs2decode(input); + + // Cache the length + inputLength = input.length; + + // Initialize the state + n = initialN; + delta = 0; + bias = initialBias; + + // Handle the basic code points + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue < 0x80) { + output.push(stringFromCharCode(currentValue)); + } } - val = computedCSS[attribute]; - if (isBackgroundSizePosition) { - val = (val || '').split( ',' ); - val = val[index || 0] || val[0] || 'auto'; - val = _html2canvas.Util.trimText(val).split(' '); + handledCPCount = basicLength = output.length; - if(attribute === 'backgroundSize' && (!val[ 0 ] || val[ 0 ].match( /cover|contain|auto/ ))) { - //these values will be handled in the parent function + // `handledCPCount` is the number of code points that have been handled; + // `basicLength` is the number of basic code points. - } else { - val[ 0 ] = ( val[ 0 ].indexOf( "%" ) === -1 ) ? toPX( attribute + "X", val[ 0 ] ) : val[ 0 ]; - if(val[ 1 ] === undefined) { - if(attribute === 'backgroundSize') { - val[ 1 ] = 'auto'; - return val; - } - else { - // IE 9 doesn't return double digit always - val[ 1 ] = val[ 0 ]; - } + // Finish the basic string - if it is not empty - with a delimiter + if (basicLength) { + output.push(delimiter); + } + + // Main encoding loop: + while (handledCPCount < inputLength) { + + // All non-basic code points < n have been handled already. Find the next + // larger one: + for (m = maxInt, j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue >= n && currentValue < m) { + m = currentValue; } - val[ 1 ] = ( val[ 1 ].indexOf( "%" ) === -1 ) ? toPX( attribute + "Y", val[ 1 ] ) : val[ 1 ]; } - } else if ( /border(Top|Bottom)(Left|Right)Radius/.test( attribute) ) { - var arr = val.split(" "); - if ( arr.length <= 1 ) { - arr[ 1 ] = arr[ 0 ]; + + // Increase `delta` enough to advance the decoder's state to , + // but guard against overflow + handledCPCountPlusOne = handledCPCount + 1; + if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { + error('overflow'); } - arr[ 0 ] = parseInt( arr[ 0 ], 10 ); - arr[ 1 ] = parseInt( arr[ 1 ], 10 ); - val = arr; - } - return val; -}; + delta += (m - n) * handledCPCountPlusOne; + n = m; -_html2canvas.Util.resizeBounds = function( current_width, current_height, target_width, target_height, stretch_mode ){ - var target_ratio = target_width / target_height, - current_ratio = current_width / current_height, - output_width, output_height; + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; - if(!stretch_mode || stretch_mode === 'auto') { - output_width = target_width; - output_height = target_height; + if (currentValue < n && ++delta > maxInt) { + error('overflow'); + } + + if (currentValue == n) { + // Represent delta as a generalized variable-length integer + for (q = delta, k = base; /* no condition */; k += base) { + t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias); + if (q < t) { + break; + } + qMinusT = q - t; + baseMinusT = base - t; + output.push( + stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0)) + ); + q = floor(qMinusT / baseMinusT); + } + + output.push(stringFromCharCode(digitToBasic(q, 0))); + bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); + delta = 0; + ++handledCPCount; + } + } + + ++delta; + ++n; - } else { - if(target_ratio < current_ratio ^ stretch_mode === 'contain') { - output_height = target_height; - output_width = target_height * current_ratio; - } else { - output_width = target_width; - output_height = target_width / current_ratio; } + return output.join(''); } - return { width: output_width, height: output_height }; -}; + /** + * Converts a Punycode string representing a domain name or an email address + * to Unicode. Only the Punycoded parts of the input will be converted, i.e. + * it doesn't matter if you call it on a string that has already been + * converted to Unicode. + * @memberOf punycode + * @param {String} input The Punycoded domain name or email address to + * convert to Unicode. + * @returns {String} The Unicode representation of the given Punycode + * string. + */ + function toUnicode(input) { + return mapDomain(input, function(string) { + return regexPunycode.test(string) + ? decode(string.slice(4).toLowerCase()) + : string; + }); + } + + /** + * Converts a Unicode string representing a domain name or an email address to + * Punycode. Only the non-ASCII parts of the domain name will be converted, + * i.e. it doesn't matter if you call it with a domain that's already in + * ASCII. + * @memberOf punycode + * @param {String} input The domain name or email address to convert, as a + * Unicode string. + * @returns {String} The Punycode representation of the given domain name or + * email address. + */ + function toASCII(input) { + return mapDomain(input, function(string) { + return regexNonASCII.test(string) + ? 'xn--' + encode(string) + : string; + }); + } + + /*--------------------------------------------------------------------------*/ + + /** Define the public API */ + punycode = { + /** + * A string representing the current Punycode.js version number. + * @memberOf punycode + * @type String + */ + 'version': '1.3.1', + /** + * An object of methods to convert from JavaScript's internal character + * representation (UCS-2) to Unicode code points, and back. + * @see + * @memberOf punycode + * @type Object + */ + 'ucs2': { + 'decode': ucs2decode, + 'encode': ucs2encode + }, + 'decode': decode, + 'encode': encode, + 'toASCII': toASCII, + 'toUnicode': toUnicode + }; + + /** Expose `punycode` */ + // Some AMD build optimizers, like r.js, check for specific condition patterns + // like the following: + if ( + typeof define == 'function' && + typeof define.amd == 'object' && + define.amd + ) { + define('punycode', function() { + return punycode; + }); + } else if (freeExports && freeModule) { + if (module.exports == freeExports) { // in Node.js or RingoJS v0.8.0+ + freeModule.exports = punycode; + } else { // in Narwhal or RingoJS v0.7.0- + for (key in punycode) { + punycode.hasOwnProperty(key) && (freeExports[key] = punycode[key]); + } + } + } else { // in Rhino or a web browser + root.punycode = punycode; + } -function backgroundBoundsFactory( prop, el, bounds, image, imageIndex, backgroundSize ) { - var bgposition = _html2canvas.Util.getCSS( el, prop, imageIndex ) , - topPos, - left, - percentage, - val; +}(this)); - if (bgposition.length === 1){ - val = bgposition[0]; +var html2canvasNodeAttribute = "data-html2canvas-node"; +var html2canvasCanvasCloneAttribute = "data-html2canvas-canvas-clone"; +var html2canvasCanvasCloneIndex = 0; +var html2canvasCloneIndex = 0; - bgposition = []; +window.html2canvas = function(nodeList, options) { + var index = html2canvasCloneIndex++; + options = options || {}; + if (options.logging) { + window.html2canvas.logging = true; + window.html2canvas.start = Date.now(); + } - bgposition[0] = val; - bgposition[1] = val; + options.async = typeof(options.async) === "undefined" ? true : options.async; + options.allowTaint = typeof(options.allowTaint) === "undefined" ? false : options.allowTaint; + options.removeContainer = typeof(options.removeContainer) === "undefined" ? true : options.removeContainer; + options.javascriptEnabled = typeof(options.javascriptEnabled) === "undefined" ? false : options.javascriptEnabled; + options.imageTimeout = typeof(options.imageTimeout) === "undefined" ? 10000 : options.imageTimeout; + options.renderer = typeof(options.renderer) === "function" ? options.renderer : CanvasRenderer; + options.strict = !!options.strict; + + if (typeof(nodeList) === "string") { + if (typeof(options.proxy) !== "string") { + return Promise.reject("Proxy must be used when rendering url"); + } + var width = options.width != null ? options.width : window.innerWidth; + var height = options.height != null ? options.height : window.innerHeight; + return loadUrlDocument(absoluteUrl(nodeList), options.proxy, document, width, height, options).then(function(container) { + return renderWindow(container.contentWindow.document.documentElement, container, options, width, height); + }); } - if (bgposition[0].toString().indexOf("%") !== -1){ - percentage = (parseFloat(bgposition[0])/100); - left = bounds.width * percentage; - if(prop !== 'backgroundSize') { - left -= (backgroundSize || image).width*percentage; - } + var node = ((nodeList === undefined) ? [document.documentElement] : ((nodeList.length) ? nodeList : [nodeList]))[0]; + node.setAttribute(html2canvasNodeAttribute + index, index); + return renderDocument(node.ownerDocument, options, node.ownerDocument.defaultView.innerWidth, node.ownerDocument.defaultView.innerHeight, index).then(function(canvas) { + if (typeof(options.onrendered) === "function") { + log("options.onrendered is deprecated, html2canvas returns a Promise containing the canvas"); + if(typeof options.grabMouse != 'undefined' && !options.grabMouse) { + options.onrendered( canvas ); + } + else { + // this code block is added by Muaz Khan. + // it is used to render cursor icon in the resulting drawing. + var cursorImage = new Image(25, 25); + cursorImage.onload = function() { + canvas.getContext('2d').drawImage(cursorImage, coordX, coordY, 25, 25); + options.onrendered( canvas ); + }; + cursorImage.src = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABQAAAAZCAYAAAAxFw7TAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAadEVYdFNvZnR3YXJlAFBhaW50Lk5FVCB2My41LjExR/NCNwAAAzZJREFUSEut1EtME1EUANBiTTFaivRDKbaFFgiILgxx0bQllYItYKFIgEYoC2oEwqeCC4gG1xg2dmEwEQMJujIxwQ24wA2uCFAB3SBBfqWuyqd/CuV634QSPgOFxElu+mZye+a++948BgAw/mccYAwGIyY7O1vR3NzSiuMLX5GiDoO8tLQ0QzAYDLW1tT2/qEgHJslk8rKtLU9odzcMTU3N7RdB6UBhRkZG6fz8QrCuzgJutwfq6xtazovSgunp6SUOhzPI5XJBr9fD9nYojHjDeVA6MJH0EMGARCIBRKC8vJygO2ZzrSUaSgumpqY+cDjWAlJpCgWSMJlMiO6EqqpMtWehtKBUKi1eXV3zI3wAEhQrJJUGseJHp6G0IE61CKfsl8lkR0CCWiyPAXeU32AwVNChdKAAwUIEfXK5/ARI0IaGRkS3vXp9ofE4SguKxWL92tpfH642LUjQ1lYr+P0Bt1abX3wYPQv04n48FSRoe/sz8Pn8G7m5uboISgfyk5OT72OF3szMzBMgk8k88qyjowPW1zddCoVCS1BaUCQSEdCTlZV18GcOh0ONq6trYGbmJ0xMTO3Z7dMwPj4B4XAYXC7XhkqlKqAFBQJBAS6KB08dClEqlTA8/JUak5cEAkHo6nppMxqN7ZWVVZ0GQ0lnRUXlC6VSVXoamI+gm/RQKEyChYU/u5gYUqvVFDo09AVsNttrHMdh3MAQYyRhxNIeX3y+QLu0tLKlVufC5OQU9Pa+/TgwMPCpv7+fAouKigG/pFX81qV4H4PBwrh8Wg95eOUtLi5vLi+v4FSHRzExRafTNZJ7NptNobOzs2C1Wp+eZx/yEhIS8jwer99ut//icOJvk+mwWCzF3NzvebPZTIF4+ILd/mMcx1ei7UOeUCjUjY19n8YvRYPJVzG4GGk9PT3vRkZGKJDH44PT6STTfxgNjGez4+4idg8Tr+8nx+KvNCcnx4y926mpMUNf33vY2wPo7n71JhpImszer4x5KFmE4zujo98m3W6ve3Dww2eNRvMEW3GLrG4kj26Vj/c5ch+Pg5t4ApXhopFWSDASMcjzg+siIKmWVJm839Nr+Hvp+Nsj4D+5Hdf43ZzjNQAAAABJRU5ErkJggg=='; + } + } + return canvas; + }); +}; - } else { - if(prop === 'backgroundSize') { - if(bgposition[0] === 'auto') { - left = image.width; +window.html2canvas.punycode = this.punycode; +window.html2canvas.proxy = {}; + +function renderDocument(document, options, windowWidth, windowHeight, html2canvasIndex) { + return createWindowClone(document, document, windowWidth, windowHeight, options, document.defaultView.pageXOffset, document.defaultView.pageYOffset).then(function(container) { + log("Document cloned"); + var attributeName = html2canvasNodeAttribute + html2canvasIndex; + var selector = "[" + attributeName + "='" + html2canvasIndex + "']"; + document.querySelector(selector).removeAttribute(attributeName); + var clonedWindow = container.contentWindow; + var node = clonedWindow.document.querySelector(selector); + var oncloneHandler = (typeof(options.onclone) === "function") ? Promise.resolve(options.onclone(clonedWindow.document)) : Promise.resolve(true); + return oncloneHandler.then(function() { + return renderWindow(node, container, options, windowWidth, windowHeight); + }); + }); +} +function renderWindow(node, container, options, windowWidth, windowHeight) { + var clonedWindow = container.contentWindow; + var support = new Support(clonedWindow.document); + var imageLoader = new ImageLoader(options, support); + var bounds = getBounds(node); + var width = options.type === "view" ? windowWidth : documentWidth(clonedWindow.document); + var height = options.type === "view" ? windowHeight : documentHeight(clonedWindow.document); + var renderer = new options.renderer(width, height, imageLoader, options, document); + var parser = new NodeParser(node, renderer, support, imageLoader, options); + return parser.ready.then(function() { + log("Finished rendering"); + var canvas; + + if (options.type === "view") { + canvas = crop(renderer.canvas, {width: renderer.canvas.width, height: renderer.canvas.height, top: 0, left: 0, x: 0, y: 0}); + } else if (node === clonedWindow.document.body || node === clonedWindow.document.documentElement || options.canvas != null) { + canvas = renderer.canvas; } else { - if(bgposition[0].match(/contain|cover/)) { - var resized = _html2canvas.Util.resizeBounds( image.width, image.height, bounds.width, bounds.height, bgposition[0] ); - left = resized.width; - topPos = resized.height; - } else { - left = parseInt (bgposition[0], 10 ); - } + canvas = crop(renderer.canvas, {width: options.width != null ? options.width : bounds.width, height: options.height != null ? options.height : bounds.height, top: bounds.top, left: bounds.left, x: clonedWindow.pageXOffset, y: clonedWindow.pageYOffset}); } - } else { - left = parseInt( bgposition[0], 10 ); - } + cleanupContainer(container, options); + return canvas; + }); +} + +function cleanupContainer(container, options) { + if (options.removeContainer) { + container.parentNode.removeChild(container); + log("Cleaned up container"); } +} +function crop(canvas, bounds) { + var croppedCanvas = document.createElement("canvas"); + var x1 = Math.min(canvas.width - 1, Math.max(0, bounds.left)); + var x2 = Math.min(canvas.width, Math.max(1, bounds.left + bounds.width)); + var y1 = Math.min(canvas.height - 1, Math.max(0, bounds.top)); + var y2 = Math.min(canvas.height, Math.max(1, bounds.top + bounds.height)); + croppedCanvas.width = bounds.width; + croppedCanvas.height = bounds.height; + log("Cropping canvas at:", "left:", bounds.left, "top:", bounds.top, "width:", (x2-x1), "height:", (y2-y1)); + log("Resulting crop with width", bounds.width, "and height", bounds.height, " with x", x1, "and y", y1); + croppedCanvas.getContext("2d").drawImage(canvas, x1, y1, x2-x1, y2-y1, bounds.x, bounds.y, x2-x1, y2-y1); + return croppedCanvas; +} - if(bgposition[1] === 'auto') { - topPos = left / image.width * image.height; - } else if (bgposition[1].toString().indexOf("%") !== -1){ - percentage = (parseFloat(bgposition[1])/100); - topPos = bounds.height * percentage; - if(prop !== 'backgroundSize') { - topPos -= (backgroundSize || image).height * percentage; - } +function documentWidth (doc) { + return Math.max( + Math.max(doc.body.scrollWidth, doc.documentElement.scrollWidth), + Math.max(doc.body.offsetWidth, doc.documentElement.offsetWidth), + Math.max(doc.body.clientWidth, doc.documentElement.clientWidth) + ); +} - } else { - topPos = parseInt(bgposition[1],10); - } +function documentHeight (doc) { + return Math.max( + Math.max(doc.body.scrollHeight, doc.documentElement.scrollHeight), + Math.max(doc.body.offsetHeight, doc.documentElement.offsetHeight), + Math.max(doc.body.clientHeight, doc.documentElement.clientHeight) + ); +} - return [left, topPos]; +function smallImage() { + return "data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7"; } -_html2canvas.Util.BackgroundPosition = function( el, bounds, image, imageIndex, backgroundSize ) { - var result = backgroundBoundsFactory( 'backgroundPosition', el, bounds, image, imageIndex, backgroundSize ); - return { left: result[0], top: result[1] }; -}; -_html2canvas.Util.BackgroundSize = function( el, bounds, image, imageIndex ) { - var result = backgroundBoundsFactory( 'backgroundSize', el, bounds, image, imageIndex ); - return { width: result[0], height: result[1] }; -}; +function isIE9() { + return document.documentMode && document.documentMode <= 9; +} -_html2canvas.Util.Extend = function (options, defaults) { - for (var key in options) { - if (options.hasOwnProperty(key)) { - defaults[key] = options[key]; +// https://github.com/niklasvh/html2canvas/issues/503 +function cloneNodeIE9(node, javascriptEnabled) { + var clone = node.nodeType === 3 ? document.createTextNode(node.nodeValue) : node.cloneNode(false); + + var child = node.firstChild; + while(child) { + if (javascriptEnabled === true || child.nodeType !== 1 || child.nodeName !== 'SCRIPT') { + clone.appendChild(cloneNodeIE9(child, javascriptEnabled)); + } + child = child.nextSibling; } - } - return defaults; -}; + return clone; +} -/* - * Derived from jQuery.contents() - * Copyright 2010, John Resig - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - */ -_html2canvas.Util.Children = function( elem ) { +function createWindowClone(ownerDocument, containerDocument, width, height, options, x ,y) { + labelCanvasElements(ownerDocument); + var documentElement = isIE9() ? cloneNodeIE9(ownerDocument.documentElement, options.javascriptEnabled) : ownerDocument.documentElement.cloneNode(true); + var container = containerDocument.createElement("iframe"); + container.className = "html2canvas-container"; + container.style.visibility = "hidden"; + container.style.position = "fixed"; + container.style.left = "-10000px"; + container.style.top = "0px"; + container.style.border = "0"; + container.width = width; + container.height = height; + container.scrolling = "no"; // ios won't scroll without it + containerDocument.body.appendChild(container); + + return new Promise(function(resolve) { + var documentClone = container.contentWindow.document; + + cloneNodeValues(ownerDocument.documentElement, documentElement, "textarea"); + cloneNodeValues(ownerDocument.documentElement, documentElement, "select"); + + /* Chrome doesn't detect relative background-images assigned in inline '); + + function getFontSizeInPixels(el, value) { + return getSizeInPixels(el, /(?:em|ex|%)$/i.test(value) ? '1em' : value); + } + + // Original by Dead Edwards. + // Combined with getFontSizeInPixels it also works with relative units. + function getSizeInPixels(el, value) { + if (/px$/i.test(value)) return parseFloat(value); + var style = el.style.left, runtimeStyle = el.runtimeStyle.left; + el.runtimeStyle.left = el.currentStyle.left; + el.style.left = value; + var result = el.style.pixelLeft; + el.style.left = style; + el.runtimeStyle.left = runtimeStyle; + return result; + } + + return function(font, text, style, options, node, el, hasNext) { + var redraw = (text === null); + + if (redraw) text = node.alt; + + // @todo word-spacing, text-decoration + + var viewBox = font.viewBox; + + var size = style.computedFontSize || + (style.computedFontSize = new Cufon.CSS.Size(getFontSizeInPixels(el, style.get('fontSize')) + 'px', font.baseSize)); + + var letterSpacing = style.computedLSpacing; + + if (letterSpacing == undefined) { + letterSpacing = style.get('letterSpacing'); + style.computedLSpacing = letterSpacing = + (letterSpacing == 'normal') ? 0 : ~~size.convertFrom(getSizeInPixels(el, letterSpacing)); + } + + var wrapper, canvas; + + if (redraw) { + wrapper = node; + canvas = node.firstChild; + } + else { + wrapper = fabric.document.createElement('span'); + wrapper.className = 'cufon cufon-vml'; + wrapper.alt = text; + + canvas = fabric.document.createElement('span'); + canvas.className = 'cufon-vml-canvas'; + wrapper.appendChild(canvas); + + if (options.printable) { + var print = fabric.document.createElement('span'); + print.className = 'cufon-alt'; + print.appendChild(fabric.document.createTextNode(text)); + wrapper.appendChild(print); + } + + // ie6, for some reason, has trouble rendering the last VML element in the document. + // we can work around this by injecting a dummy element where needed. + // @todo find a better solution + if (!hasNext) wrapper.appendChild(fabric.document.createElement('cvml:shape')); + } + + var wStyle = wrapper.style; + var cStyle = canvas.style; + + var height = size.convert(viewBox.height), roundedHeight = Math.ceil(height); + var roundingFactor = roundedHeight / height; + var minX = viewBox.minX, minY = viewBox.minY; + + cStyle.height = roundedHeight; + cStyle.top = Math.round(size.convert(minY - font.ascent)); + cStyle.left = Math.round(size.convert(minX)); + + wStyle.height = size.convert(font.height) + 'px'; + + var textDecoration = Cufon.getTextDecoration(options); + + var color = style.get('color'); + + var chars = Cufon.CSS.textTransform(text, style).split(''); + + var width = 0, offsetX = 0, advance = null; + + var glyph, shape, shadows = options.textShadow; + + // pre-calculate width + for (var i = 0, k = 0, l = chars.length; i < l; ++i) { + glyph = font.glyphs[chars[i]] || font.missingGlyph; + if (glyph) width += advance = ~~(glyph.w || font.w) + letterSpacing; + } + + if (advance === null) return null; + + var fullWidth = -minX + width + (viewBox.width - advance); + + var shapeWidth = size.convert(fullWidth * roundingFactor), roundedShapeWidth = Math.round(shapeWidth); + + var coordSize = fullWidth + ',' + viewBox.height, coordOrigin; + var stretch = 'r' + coordSize + 'nsnf'; + + for (i = 0; i < l; ++i) { + + glyph = font.glyphs[chars[i]] || font.missingGlyph; + if (!glyph) continue; + + if (redraw) { + // some glyphs may be missing so we can't use i + shape = canvas.childNodes[k]; + if (shape.firstChild) shape.removeChild(shape.firstChild); // shadow + } + else { + shape = fabric.document.createElement('cvml:shape'); + canvas.appendChild(shape); + } + + shape.stroked = 'f'; + shape.coordsize = coordSize; + shape.coordorigin = coordOrigin = (minX - offsetX) + ',' + minY; + shape.path = (glyph.d ? 'm' + glyph.d + 'xe' : '') + 'm' + coordOrigin + stretch; + shape.fillcolor = color; + + // it's important to not set top/left or IE8 will grind to a halt + var sStyle = shape.style; + sStyle.width = roundedShapeWidth; + sStyle.height = roundedHeight; + + if (shadows) { + // due to the limitations of the VML shadow element there + // can only be two visible shadows. opacity is shared + // for all shadows. + var shadow1 = shadows[0], shadow2 = shadows[1]; + var color1 = Cufon.CSS.color(shadow1.color), color2; + var shadow = fabric.document.createElement('cvml:shadow'); + shadow.on = 't'; + shadow.color = color1.color; + shadow.offset = shadow1.offX + ',' + shadow1.offY; + if (shadow2) { + color2 = Cufon.CSS.color(shadow2.color); + shadow.type = 'double'; + shadow.color2 = color2.color; + shadow.offset2 = shadow2.offX + ',' + shadow2.offY; + } + shadow.opacity = color1.opacity || (color2 && color2.opacity) || 1; + shape.appendChild(shadow); + } + + offsetX += ~~(glyph.w || font.w) + letterSpacing; + + ++k; + + } + + wStyle.width = Math.max(Math.ceil(size.convert(width * roundingFactor)), 0); + + return wrapper; + + }; + +})()); + +Cufon.getTextDecoration = function(options) { + return { + underline: options.textDecoration === 'underline', + overline: options.textDecoration === 'overline', + 'line-through': options.textDecoration === 'line-through' + }; +}; + +if (typeof exports != 'undefined') { + exports.Cufon = Cufon; +} + + +/* + json2.js + 2014-02-04 + + Public Domain. + + NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK. + + See http://www.JSON.org/js.html + + + This code should be minified before deployment. + See http://javascript.crockford.com/jsmin.html + + USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO + NOT CONTROL. + + + This file creates a global JSON object containing two methods: stringify + and parse. + + JSON.stringify(value, replacer, space) + value any JavaScript value, usually an object or array. + + replacer an optional parameter that determines how object + values are stringified for objects. It can be a + function or an array of strings. + + space an optional parameter that specifies the indentation + of nested structures. If it is omitted, the text will + be packed without extra whitespace. If it is a number, + it will specify the number of spaces to indent at each + level. If it is a string (such as '\t' or ' '), + it contains the characters used to indent at each level. + + This method produces a JSON text from a JavaScript value. + + When an object value is found, if the object contains a toJSON + method, its toJSON method will be called and the result will be + stringified. A toJSON method does not serialize: it returns the + value represented by the name/value pair that should be serialized, + or undefined if nothing should be serialized. The toJSON method + will be passed the key associated with the value, and this will be + bound to the value + + For example, this would serialize Dates as ISO strings. + + Date.prototype.toJSON = function (key) { + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + return this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z'; + }; + + You can provide an optional replacer method. It will be passed the + key and value of each member, with this bound to the containing + object. The value that is returned from your method will be + serialized. If your method returns undefined, then the member will + be excluded from the serialization. + + If the replacer parameter is an array of strings, then it will be + used to select the members to be serialized. It filters the results + such that only members with keys listed in the replacer array are + stringified. + + Values that do not have JSON representations, such as undefined or + functions, will not be serialized. Such values in objects will be + dropped; in arrays they will be replaced with null. You can use + a replacer function to replace those with JSON values. + JSON.stringify(undefined) returns undefined. + + The optional space parameter produces a stringification of the + value that is filled with line breaks and indentation to make it + easier to read. + + If the space parameter is a non-empty string, then that string will + be used for indentation. If the space parameter is a number, then + the indentation will be that many spaces. + + Example: + + text = JSON.stringify(['e', {pluribus: 'unum'}]); + // text is '["e",{"pluribus":"unum"}]' + + + text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t'); + // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]' + + text = JSON.stringify([new Date()], function (key, value) { + return this[key] instanceof Date ? + 'Date(' + this[key] + ')' : value; + }); + // text is '["Date(---current time---)"]' + + + JSON.parse(text, reviver) + This method parses a JSON text to produce an object or array. + It can throw a SyntaxError exception. + + The optional reviver parameter is a function that can filter and + transform the results. It receives each of the keys and values, + and its return value is used instead of the original value. + If it returns what it received, then the structure is not modified. + If it returns undefined then the member is deleted. + + Example: + + // Parse the text. Values that look like ISO date strings will + // be converted to Date objects. + + myData = JSON.parse(text, function (key, value) { + var a; + if (typeof value === 'string') { + a = +/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value); + if (a) { + return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4], + +a[5], +a[6])); + } + } + return value; + }); + + myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) { + var d; + if (typeof value === 'string' && + value.slice(0, 5) === 'Date(' && + value.slice(-1) === ')') { + d = new Date(value.slice(5, -1)); + if (d) { + return d; + } + } + return value; + }); + + + This is a reference implementation. You are free to copy, modify, or + redistribute. +*/ + +/*jslint evil: true, regexp: true */ + +/*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply, + call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours, + getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join, + lastIndex, length, parse, prototype, push, replace, slice, stringify, + test, toJSON, toString, valueOf +*/ + + +// Create a JSON object only if one does not already exist. We create the +// methods in a closure to avoid creating global variables. + +if (typeof JSON !== 'object') { + JSON = {}; +} + +(function () { + 'use strict'; + + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + if (typeof Date.prototype.toJSON !== 'function') { + + Date.prototype.toJSON = function () { + + return isFinite(this.valueOf()) + ? this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z' + : null; + }; + + String.prototype.toJSON = + Number.prototype.toJSON = + Boolean.prototype.toJSON = function () { + return this.valueOf(); + }; + } + + var cx, + escapable, + gap, + indent, + meta, + rep; + + + function quote(string) { + +// If the string contains no control characters, no quote characters, and no +// backslash characters, then we can safely slap some quotes around it. +// Otherwise we must also replace the offending characters with safe escape +// sequences. + + escapable.lastIndex = 0; + return escapable.test(string) ? '"' + string.replace(escapable, function (a) { + var c = meta[a]; + return typeof c === 'string' + ? c + : '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }) + '"' : '"' + string + '"'; + } + + + function str(key, holder) { + +// Produce a string from holder[key]. + + var i, // The loop counter. + k, // The member key. + v, // The member value. + length, + mind = gap, + partial, + value = holder[key]; + +// If the value has a toJSON method, call it to obtain a replacement value. + + if (value && typeof value === 'object' && + typeof value.toJSON === 'function') { + value = value.toJSON(key); + } + +// If we were called with a replacer function, then call the replacer to +// obtain a replacement value. + + if (typeof rep === 'function') { + value = rep.call(holder, key, value); + } + +// What happens next depends on the value's type. + + switch (typeof value) { + case 'string': + return quote(value); + + case 'number': + +// JSON numbers must be finite. Encode non-finite numbers as null. + + return isFinite(value) ? String(value) : 'null'; + + case 'boolean': + case 'null': + +// If the value is a boolean or null, convert it to a string. Note: +// typeof null does not produce 'null'. The case is included here in +// the remote chance that this gets fixed someday. + + return String(value); + +// If the type is 'object', we might be dealing with an object or an array or +// null. + + case 'object': + +// Due to a specification blunder in ECMAScript, typeof null is 'object', +// so watch out for that case. + + if (!value) { + return 'null'; + } + +// Make an array to hold the partial results of stringifying this object value. + + gap += indent; + partial = []; + +// Is the value an array? + + if (Object.prototype.toString.apply(value) === '[object Array]') { + +// The value is an array. Stringify every element. Use null as a placeholder +// for non-JSON values. + + length = value.length; + for (i = 0; i < length; i += 1) { + partial[i] = str(i, value) || 'null'; + } + +// Join all of the elements together, separated with commas, and wrap them in +// brackets. + + v = partial.length === 0 + ? '[]' + : gap + ? '[\n' + gap + partial.join(',\n' + gap) + '\n' + mind + ']' + : '[' + partial.join(',') + ']'; + gap = mind; + return v; + } + +// If the replacer is an array, use it to select the members to be stringified. + + if (rep && typeof rep === 'object') { + length = rep.length; + for (i = 0; i < length; i += 1) { + if (typeof rep[i] === 'string') { + k = rep[i]; + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } else { + +// Otherwise, iterate through all of the keys in the object. + + for (k in value) { + if (Object.prototype.hasOwnProperty.call(value, k)) { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } + +// Join all of the member texts together, separated with commas, +// and wrap them in braces. + + v = partial.length === 0 + ? '{}' + : gap + ? '{\n' + gap + partial.join(',\n' + gap) + '\n' + mind + '}' + : '{' + partial.join(',') + '}'; + gap = mind; + return v; + } + } + +// If the JSON object does not yet have a stringify method, give it one. + + if (typeof JSON.stringify !== 'function') { + escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g; + meta = { // table of character substitutions + '\b': '\\b', + '\t': '\\t', + '\n': '\\n', + '\f': '\\f', + '\r': '\\r', + '"' : '\\"', + '\\': '\\\\' + }; + JSON.stringify = function (value, replacer, space) { + +// The stringify method takes a value and an optional replacer, and an optional +// space parameter, and returns a JSON text. The replacer can be a function +// that can replace values, or an array of strings that will select the keys. +// A default replacer method can be provided. Use of the space parameter can +// produce text that is more easily readable. + + var i; + gap = ''; + indent = ''; + +// If the space parameter is a number, make an indent string containing that +// many spaces. + + if (typeof space === 'number') { + for (i = 0; i < space; i += 1) { + indent += ' '; + } + +// If the space parameter is a string, it will be used as the indent string. + + } else if (typeof space === 'string') { + indent = space; + } + +// If there is a replacer, it must be a function or an array. +// Otherwise, throw an error. + + rep = replacer; + if (replacer && typeof replacer !== 'function' && + (typeof replacer !== 'object' || + typeof replacer.length !== 'number')) { + throw new Error('JSON.stringify'); + } + +// Make a fake root object containing our value under the key of ''. +// Return the result of stringifying the value. + + return str('', {'': value}); + }; + } + + +// If the JSON object does not yet have a parse method, give it one. + + if (typeof JSON.parse !== 'function') { + cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g; + JSON.parse = function (text, reviver) { + +// The parse method takes a text and an optional reviver function, and returns +// a JavaScript value if the text is a valid JSON text. + + var j; + + function walk(holder, key) { + +// The walk method is used to recursively walk the resulting structure so +// that modifications can be made. + + var k, v, value = holder[key]; + if (value && typeof value === 'object') { + for (k in value) { + if (Object.prototype.hasOwnProperty.call(value, k)) { + v = walk(value, k); + if (v !== undefined) { + value[k] = v; + } else { + delete value[k]; + } + } + } + } + return reviver.call(holder, key, value); + } + + +// Parsing happens in four stages. In the first stage, we replace certain +// Unicode characters with escape sequences. JavaScript handles many characters +// incorrectly, either silently deleting them, or treating them as line endings. + + text = String(text); + cx.lastIndex = 0; + if (cx.test(text)) { + text = text.replace(cx, function (a) { + return '\\u' + + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }); + } + +// In the second stage, we run the text against regular expressions that look +// for non-JSON patterns. We are especially concerned with '()' and 'new' +// because they can cause invocation, and '=' because it can cause mutation. +// But just to be safe, we want to reject all unexpected forms. + +// We split the second stage into 4 regexp operations in order to work around +// crippling inefficiencies in IE's and Safari's regexp engines. First we +// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we +// replace all simple value tokens with ']' characters. Third, we delete all +// open brackets that follow a colon or comma or that begin the text. Finally, +// we look to see that the remaining characters are only whitespace or ']' or +// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval. + + if (/^[\],:{}\s]*$/ + .test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@') + .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']') + .replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) { + +// In the third stage we use the eval function to compile the text into a +// JavaScript structure. The '{' operator is subject to a syntactic ambiguity +// in JavaScript: it can begin a block or an object literal. We wrap the text +// in parens to eliminate the ambiguity. + + j = eval('(' + text + ')'); + +// In the optional fourth stage, we recursively walk the new structure, passing +// each name/value pair to a reviver function for possible transformation. + + return typeof reviver === 'function' + ? walk({'': j}, '') + : j; + } + +// If the text is not JSON parseable, then a SyntaxError is thrown. + + throw new SyntaxError('JSON.parse'); + }; + } +}()); + + +(function(){ + + /** + * @private + * @param {String} eventName + * @param {Function} handler + */ + function _removeEventListener(eventName, handler) { + if (!this.__eventListeners[eventName]) { + return; + } + + if (handler) { + fabric.util.removeFromArray(this.__eventListeners[eventName], handler); + } + else { + this.__eventListeners[eventName].length = 0; + } + } + + /** + * Observes specified event + * @deprecated `observe` deprecated since 0.8.34 (use `on` instead) + * @memberOf fabric.Observable + * @alias on + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function that receives a notification when an event of the specified type occurs + * @return {Self} thisArg + * @chainable + */ + function observe(eventName, handler) { + if (!this.__eventListeners) { + this.__eventListeners = { }; + } + // one object with key/value pairs was passed + if (arguments.length === 1) { + for (var prop in eventName) { + this.on(prop, eventName[prop]); + } + } + else { + if (!this.__eventListeners[eventName]) { + this.__eventListeners[eventName] = [ ]; + } + this.__eventListeners[eventName].push(handler); + } + return this; + } + + /** + * Stops event observing for a particular event handler. Calling this method + * without arguments removes all handlers for all events + * @deprecated `stopObserving` deprecated since 0.8.34 (use `off` instead) + * @memberOf fabric.Observable + * @alias off + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function to be deleted from EventListeners + * @return {Self} thisArg + * @chainable + */ + function stopObserving(eventName, handler) { + if (!this.__eventListeners) { + return; + } + + // remove all key/value pairs (event name -> event handler) + if (arguments.length === 0) { + this.__eventListeners = { }; + } + // one object with key/value pairs was passed + else if (arguments.length === 1 && typeof arguments[0] === 'object') { + for (var prop in eventName) { + _removeEventListener.call(this, prop, eventName[prop]); + } + } + else { + _removeEventListener.call(this, eventName, handler); + } + return this; + } + + /** + * Fires event with an optional options object + * @deprecated `fire` deprecated since 1.0.7 (use `trigger` instead) + * @memberOf fabric.Observable + * @alias trigger + * @param {String} eventName Event name to fire + * @param {Object} [options] Options object + * @return {Self} thisArg + * @chainable + */ + function fire(eventName, options) { + if (!this.__eventListeners) { + return; + } + + var listenersForEvent = this.__eventListeners[eventName]; + if (!listenersForEvent) { + return; + } + + for (var i = 0, len = listenersForEvent.length; i < len; i++) { + // avoiding try/catch for perf. reasons + listenersForEvent[i].call(this, options || { }); + } + return this; + } + + /** + * @namespace fabric.Observable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#events} + * @see {@link http://fabricjs.com/events/|Events demo} + */ + fabric.Observable = { + observe: observe, + stopObserving: stopObserving, + fire: fire, + + on: observe, + off: stopObserving, + trigger: fire + }; +})(); + + +/** + * @namespace fabric.Collection + */ +fabric.Collection = { + + /** + * Adds objects to collection, then renders canvas (if `renderOnAddRemove` is not `false`) + * Objects should be instances of (or inherit from) fabric.Object + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + */ + add: function () { + this._objects.push.apply(this._objects, arguments); + for (var i = 0, length = arguments.length; i < length; i++) { + this._onObjectAdded(arguments[i]); + } + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Inserts an object into collection at specified index, then renders canvas (if `renderOnAddRemove` is not `false`) + * An object should be an instance of (or inherit from) fabric.Object + * @param {Object} object Object to insert + * @param {Number} index Index to insert object at + * @param {Boolean} nonSplicing When `true`, no splicing (shifting) of objects occurs + * @return {Self} thisArg + * @chainable + */ + insertAt: function (object, index, nonSplicing) { + var objects = this.getObjects(); + if (nonSplicing) { + objects[index] = object; + } + else { + objects.splice(index, 0, object); + } + this._onObjectAdded(object); + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Removes objects from a collection, then renders canvas (if `renderOnAddRemove` is not `false`) + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + remove: function() { + var objects = this.getObjects(), + index; + + for (var i = 0, length = arguments.length; i < length; i++) { + index = objects.indexOf(arguments[i]); + + // only call onObjectRemoved if an object was actually removed + if (index !== -1) { + objects.splice(index, 1); + this._onObjectRemoved(arguments[i]); + } + } + + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Executes given function for each object in this group + * @param {Function} callback + * Callback invoked with current object as first argument, + * index - as second and an array of all objects - as third. + * Iteration happens in reverse order (for performance reasons). + * Callback is invoked in a context of Global Object (e.g. `window`) + * when no `context` argument is given + * + * @param {Object} context Context (aka thisObject) + * @return {Self} thisArg + */ + forEachObject: function(callback, context) { + var objects = this.getObjects(), + i = objects.length; + while (i--) { + callback.call(context, objects[i], i, objects); + } + return this; + }, + + /** + * Returns an array of children objects of this instance + * Type parameter introduced in 1.3.10 + * @param {String} [type] When specified, only objects of this type are returned + * @return {Array} + */ + getObjects: function(type) { + if (typeof type === 'undefined') { + return this._objects; + } + return this._objects.filter(function(o) { + return o.type === type; + }); + }, + + /** + * Returns object at specified index + * @param {Number} index + * @return {Self} thisArg + */ + item: function (index) { + return this.getObjects()[index]; + }, + + /** + * Returns true if collection contains no objects + * @return {Boolean} true if collection is empty + */ + isEmpty: function () { + return this.getObjects().length === 0; + }, + + /** + * Returns a size of a collection (i.e: length of an array containing its objects) + * @return {Number} Collection size + */ + size: function() { + return this.getObjects().length; + }, + + /** + * Returns true if collection contains an object + * @param {Object} object Object to check against + * @return {Boolean} `true` if collection contains an object + */ + contains: function(object) { + return this.getObjects().indexOf(object) > -1; + }, + + /** + * Returns number representation of a collection complexity + * @return {Number} complexity + */ + complexity: function () { + return this.getObjects().reduce(function (memo, current) { + memo += current.complexity ? current.complexity() : 0; + return memo; + }, 0); + } +}; + + +(function(global) { + + var sqrt = Math.sqrt, + atan2 = Math.atan2, + PiBy180 = Math.PI / 180; + + /** + * @namespace fabric.util + */ + fabric.util = { + + /** + * Removes value from an array. + * Presence of value (and its position in an array) is determined via `Array.prototype.indexOf` + * @static + * @memberOf fabric.util + * @param {Array} array + * @param {Any} value + * @return {Array} original array + */ + removeFromArray: function(array, value) { + var idx = array.indexOf(value); + if (idx !== -1) { + array.splice(idx, 1); + } + return array; + }, + + /** + * Returns random number between 2 specified ones. + * @static + * @memberOf fabric.util + * @param {Number} min lower limit + * @param {Number} max upper limit + * @return {Number} random value (between min and max) + */ + getRandomInt: function(min, max) { + return Math.floor(Math.random() * (max - min + 1)) + min; + }, + + /** + * Transforms degrees to radians. + * @static + * @memberOf fabric.util + * @param {Number} degrees value in degrees + * @return {Number} value in radians + */ + degreesToRadians: function(degrees) { + return degrees * PiBy180; + }, + + /** + * Transforms radians to degrees. + * @static + * @memberOf fabric.util + * @param {Number} radians value in radians + * @return {Number} value in degrees + */ + radiansToDegrees: function(radians) { + return radians / PiBy180; + }, + + /** + * Rotates `point` around `origin` with `radians` + * @static + * @memberOf fabric.util + * @param {fabric.Point} point The point to rotate + * @param {fabric.Point} origin The origin of the rotation + * @param {Number} radians The radians of the angle for the rotation + * @return {fabric.Point} The new rotated point + */ + rotatePoint: function(point, origin, radians) { + var sin = Math.sin(radians), + cos = Math.cos(radians); + + point.subtractEquals(origin); + + var rx = point.x * cos - point.y * sin, + ry = point.x * sin + point.y * cos; + + return new fabric.Point(rx, ry).addEquals(origin); + }, + + /** + * Apply transform t to point p + * @static + * @memberOf fabric.util + * @param {fabric.Point} p The point to transform + * @param {Array} t The transform + * @param {Boolean} [ignoreOffset] Indicates that the offset should not be applied + * @return {fabric.Point} The transformed point + */ + transformPoint: function(p, t, ignoreOffset) { + if (ignoreOffset) { + return new fabric.Point( + t[0] * p.x + t[1] * p.y, + t[2] * p.x + t[3] * p.y + ); + } + return new fabric.Point( + t[0] * p.x + t[1] * p.y + t[4], + t[2] * p.x + t[3] * p.y + t[5] + ); + }, + + /** + * Invert transformation t + * @static + * @memberOf fabric.util + * @param {Array} t The transform + * @return {Array} The inverted transform + */ + invertTransform: function(t) { + var r = t.slice(), + a = 1 / (t[0] * t[3] - t[1] * t[2]); + r = [a * t[3], -a * t[1], -a * t[2], a * t[0], 0, 0]; + var o = fabric.util.transformPoint({ x: t[4], y: t[5] }, r); + r[4] = -o.x; + r[5] = -o.y; + return r; + }, + + /** + * A wrapper around Number#toFixed, which contrary to native method returns number, not string. + * @static + * @memberOf fabric.util + * @param {Number|String} number number to operate on + * @param {Number} fractionDigits number of fraction digits to "leave" + * @return {Number} + */ + toFixed: function(number, fractionDigits) { + return parseFloat(Number(number).toFixed(fractionDigits)); + }, + + /** + * Converts from attribute value to pixel value if applicable. + * Returns converted pixels or original value not converted. + * @param {Number|String} value number to operate on + * @return {Number|String} + */ + parseUnit: function(value) { + var unit = /\D{0,2}$/.exec(value), + number = parseFloat(value); + + switch (unit[0]) { + case 'mm': + return number * fabric.DPI / 25.4; + + case 'cm': + return number * fabric.DPI / 2.54; + + case 'in': + return number * fabric.DPI; + + case 'pt': + return number * fabric.DPI / 72; // or * 4 / 3 + + case 'pc': + return number * fabric.DPI / 72 * 12; // or * 16 + + default: + return number; + } + }, + + /** + * Function which always returns `false`. + * @static + * @memberOf fabric.util + * @return {Boolean} + */ + falseFunction: function() { + return false; + }, + + /** + * Returns klass "Class" object of given namespace + * @memberOf fabric.util + * @param {String} type Type of object (eg. 'circle') + * @param {String} namespace Namespace to get klass "Class" object from + * @return {Object} klass "Class" + */ + getKlass: function(type, namespace) { + // capitalize first letter only + type = fabric.util.string.camelize(type.charAt(0).toUpperCase() + type.slice(1)); + return fabric.util.resolveNamespace(namespace)[type]; + }, + + /** + * Returns object of given namespace + * @memberOf fabric.util + * @param {String} namespace Namespace string e.g. 'fabric.Image.filter' or 'fabric' + * @return {Object} Object for given namespace (default fabric) + */ + resolveNamespace: function(namespace) { + if (!namespace) { + return fabric; + } + + var parts = namespace.split('.'), + len = parts.length, + obj = global || fabric.window; + + for (var i = 0; i < len; ++i) { + obj = obj[parts[i]]; + } + + return obj; + }, + + /** + * Loads image element from given url and passes it to a callback + * @memberOf fabric.util + * @param {String} url URL representing an image + * @param {Function} callback Callback; invoked with loaded image + * @param {Any} [context] Context to invoke callback in + * @param {Object} [crossOrigin] crossOrigin value to set image element to + */ + loadImage: function(url, callback, context, crossOrigin) { + if (!url) { + callback && callback.call(context, url); + return; + } + + var img = fabric.util.createImage(); + + /** @ignore */ + img.onload = function () { + callback && callback.call(context, img); + img = img.onload = img.onerror = null; + }; + + /** @ignore */ + img.onerror = function() { + fabric.log('Error loading ' + img.src); + callback && callback.call(context, null, true); + img = img.onload = img.onerror = null; + }; + + // data-urls appear to be buggy with crossOrigin + // https://github.com/kangax/fabric.js/commit/d0abb90f1cd5c5ef9d2a94d3fb21a22330da3e0a#commitcomment-4513767 + // see https://code.google.com/p/chromium/issues/detail?id=315152 + // https://bugzilla.mozilla.org/show_bug.cgi?id=935069 + if (url.indexOf('data') !== 0 && typeof crossOrigin !== 'undefined') { + img.crossOrigin = crossOrigin; + } + + img.src = url; + }, + + /** + * Creates corresponding fabric instances from their object representations + * @static + * @memberOf fabric.util + * @param {Array} objects Objects to enliven + * @param {Function} callback Callback to invoke when all objects are created + * @param {String} namespace Namespace to get klass "Class" object from + * @param {Function} reviver Method for further parsing of object elements, + * called after each fabric object created. + */ + enlivenObjects: function(objects, callback, namespace, reviver) { + objects = objects || [ ]; + + function onLoaded() { + if (++numLoadedObjects === numTotalObjects) { + callback && callback(enlivenedObjects); + } + } + + var enlivenedObjects = [ ], + numLoadedObjects = 0, + numTotalObjects = objects.length; + + if (!numTotalObjects) { + callback && callback(enlivenedObjects); + return; + } + + objects.forEach(function (o, index) { + // if sparse array + if (!o || !o.type) { + onLoaded(); + return; + } + var klass = fabric.util.getKlass(o.type, namespace); + if (klass.async) { + klass.fromObject(o, function (obj, error) { + if (!error) { + enlivenedObjects[index] = obj; + reviver && reviver(o, enlivenedObjects[index]); + } + onLoaded(); + }); + } + else { + enlivenedObjects[index] = klass.fromObject(o); + reviver && reviver(o, enlivenedObjects[index]); + onLoaded(); + } + }); + }, + + /** + * Groups SVG elements (usually those retrieved from SVG document) + * @static + * @memberOf fabric.util + * @param {Array} elements SVG elements to group + * @param {Object} [options] Options object + * @return {fabric.Object|fabric.PathGroup} + */ + groupSVGElements: function(elements, options, path) { + var object; + + object = new fabric.PathGroup(elements, options); + + if (typeof path !== 'undefined') { + object.setSourcePath(path); + } + return object; + }, + + /** + * Populates an object with properties of another object + * @static + * @memberOf fabric.util + * @param {Object} source Source object + * @param {Object} destination Destination object + * @return {Array} properties Propertie names to include + */ + populateWithProperties: function(source, destination, properties) { + if (properties && Object.prototype.toString.call(properties) === '[object Array]') { + for (var i = 0, len = properties.length; i < len; i++) { + if (properties[i] in source) { + destination[properties[i]] = source[properties[i]]; + } + } + } + }, + + /** + * Draws a dashed line between two points + * + * This method is used to draw dashed line around selection area. + * See dotted stroke in canvas + * + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x start x coordinate + * @param {Number} y start y coordinate + * @param {Number} x2 end x coordinate + * @param {Number} y2 end y coordinate + * @param {Array} da dash array pattern + */ + drawDashedLine: function(ctx, x, y, x2, y2, da) { + var dx = x2 - x, + dy = y2 - y, + len = sqrt(dx * dx + dy * dy), + rot = atan2(dy, dx), + dc = da.length, + di = 0, + draw = true; + + ctx.save(); + ctx.translate(x, y); + ctx.moveTo(0, 0); + ctx.rotate(rot); + + x = 0; + while (len > x) { + x += da[di++ % dc]; + if (x > len) { + x = len; + } + ctx[draw ? 'lineTo' : 'moveTo'](x, 0); + draw = !draw; + } + + ctx.restore(); + }, + + /** + * Creates canvas element and initializes it via excanvas if necessary + * @static + * @memberOf fabric.util + * @param {CanvasElement} [canvasEl] optional canvas element to initialize; + * when not given, element is created implicitly + * @return {CanvasElement} initialized canvas element + */ + createCanvasElement: function(canvasEl) { + canvasEl || (canvasEl = fabric.document.createElement('canvas')); + //jscs:disable requireCamelCaseOrUpperCaseIdentifiers + if (!canvasEl.getContext && typeof G_vmlCanvasManager !== 'undefined') { + G_vmlCanvasManager.initElement(canvasEl); + } + //jscs:enable requireCamelCaseOrUpperCaseIdentifiers + return canvasEl; + }, + + /** + * Creates image element (works on client and node) + * @static + * @memberOf fabric.util + * @return {HTMLImageElement} HTML image element + */ + createImage: function() { + return fabric.isLikelyNode + ? new (require('canvas').Image)() + : fabric.document.createElement('img'); + }, + + /** + * Creates accessors (getXXX, setXXX) for a "class", based on "stateProperties" array + * @static + * @memberOf fabric.util + * @param {Object} klass "Class" to create accessors for + */ + createAccessors: function(klass) { + var proto = klass.prototype; + + for (var i = proto.stateProperties.length; i--; ) { + + var propName = proto.stateProperties[i], + capitalizedPropName = propName.charAt(0).toUpperCase() + propName.slice(1), + setterName = 'set' + capitalizedPropName, + getterName = 'get' + capitalizedPropName; + + // using `new Function` for better introspection + if (!proto[getterName]) { + proto[getterName] = (function(property) { + return new Function('return this.get("' + property + '")'); + })(propName); + } + if (!proto[setterName]) { + proto[setterName] = (function(property) { + return new Function('value', 'return this.set("' + property + '", value)'); + })(propName); + } + } + }, + + /** + * @static + * @memberOf fabric.util + * @param {fabric.Object} receiver Object implementing `clipTo` method + * @param {CanvasRenderingContext2D} ctx Context to clip + */ + clipContext: function(receiver, ctx) { + ctx.save(); + ctx.beginPath(); + receiver.clipTo(ctx); + ctx.clip(); + }, + + /** + * Multiply matrix A by matrix B to nest transformations + * @static + * @memberOf fabric.util + * @param {Array} matrixA First transformMatrix + * @param {Array} matrixB Second transformMatrix + * @return {Array} The product of the two transform matrices + */ + multiplyTransformMatrices: function(matrixA, matrixB) { + // Matrix multiply matrixA * matrixB + var a = [ + [matrixA[0], matrixA[2], matrixA[4]], + [matrixA[1], matrixA[3], matrixA[5]], + [0, 0, 1 ] + ], + + b = [ + [matrixB[0], matrixB[2], matrixB[4]], + [matrixB[1], matrixB[3], matrixB[5]], + [0, 0, 1 ] + ], + + result = []; + + for (var r = 0; r < 3; r++) { + result[r] = []; + for (var c = 0; c < 3; c++) { + var sum = 0; + for (var k = 0; k < 3; k++) { + sum += a[r][k] * b[k][c]; + } + + result[r][c] = sum; + } + } + + return [ + result[0][0], + result[1][0], + result[0][1], + result[1][1], + result[0][2], + result[1][2] + ]; + }, + + /** + * Returns string representation of function body + * @param {Function} fn Function to get body of + * @return {String} Function body + */ + getFunctionBody: function(fn) { + return (String(fn).match(/function[^{]*\{([\s\S]*)\}/) || {})[1]; + }, + + /** + * Returns true if context has transparent pixel + * at specified location (taking tolerance into account) + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x x coordinate + * @param {Number} y y coordinate + * @param {Number} tolerance Tolerance + */ + isTransparent: function(ctx, x, y, tolerance) { + + // If tolerance is > 0 adjust start coords to take into account. + // If moves off Canvas fix to 0 + if (tolerance > 0) { + if (x > tolerance) { + x -= tolerance; + } + else { + x = 0; + } + if (y > tolerance) { + y -= tolerance; + } + else { + y = 0; + } + } + + var _isTransparent = true, + imageData = ctx.getImageData(x, y, (tolerance * 2) || 1, (tolerance * 2) || 1); + + // Split image data - for tolerance > 1, pixelDataSize = 4; + for (var i = 3, l = imageData.data.length; i < l; i += 4) { + var temp = imageData.data[i]; + _isTransparent = temp <= 0; + if (_isTransparent === false) { + break; // Stop if colour found + } + } + + imageData = null; + + return _isTransparent; + } + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var arcToSegmentsCache = { }, + segmentToBezierCache = { }, + _join = Array.prototype.join; + + /* Adapted from http://dxr.mozilla.org/mozilla-central/source/content/svg/content/src/nsSVGPathDataParser.cpp + * by Andrea Bogazzi code is under MPL. if you don't have a copy of the license you can take it here + * http://mozilla.org/MPL/2.0/ + */ + function arcToSegments(toX, toY, rx, ry, large, sweep, rotateX) { + var argsString = _join.call(arguments); + if (arcToSegmentsCache[argsString]) { + return arcToSegmentsCache[argsString]; + } + + var PI = Math.PI, th = rotateX * (PI / 180), + sinTh = Math.sin(th), + cosTh = Math.cos(th), + fromX = 0, fromY = 0; + + rx = Math.abs(rx); + ry = Math.abs(ry); + + var px = -cosTh * toX - sinTh * toY, + py = -cosTh * toY + sinTh * toX, + rx2 = rx * rx, ry2 = ry * ry, py2 = py * py, px2 = px * px, + pl = 4 * rx2 * ry2 - rx2 * py2 - ry2 * px2, + root = 0; + + if (pl < 0) { + var s = Math.sqrt(1 - 0.25 * pl/(rx2 * ry2)); + rx *= s; + ry *= s; + } + else { + root = (large === sweep ? -0.5 : 0.5) * + Math.sqrt( pl /(rx2 * py2 + ry2 * px2)); + } + + var cx = root * rx * py / ry, + cy = -root * ry * px / rx, + cx1 = cosTh * cx - sinTh * cy + toX / 2, + cy1 = sinTh * cx + cosTh * cy + toY / 2, + mTheta = calcVectorAngle(1, 0, (px - cx) / rx, (py - cy) / ry), + dtheta = calcVectorAngle((px - cx) / rx, (py - cy) / ry, (-px - cx) / rx, (-py - cy) / ry); + + if (sweep === 0 && dtheta > 0) { + dtheta -= 2 * PI; + } + else if (sweep === 1 && dtheta < 0) { + dtheta += 2 * PI; + } + + // Convert into cubic bezier segments <= 90deg + var segments = Math.ceil(Math.abs(dtheta / (PI * 0.5))), + result = [], mDelta = dtheta / segments, + mT = 8 / 3 * Math.sin(mDelta / 4) * Math.sin(mDelta / 4) / Math.sin(mDelta / 2), + th3 = mTheta + mDelta; + + for (var i = 0; i < segments; i++) { + result[i] = segmentToBezier(mTheta, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY); + fromX = result[i][4]; + fromY = result[i][5]; + mTheta += mDelta; + th3 += mDelta; + } + arcToSegmentsCache[argsString] = result; + return result; + } + + function segmentToBezier(th2, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY) { + var argsString2 = _join.call(arguments); + if (segmentToBezierCache[argsString2]) { + return segmentToBezierCache[argsString2]; + } + + var costh2 = Math.cos(th2), + sinth2 = Math.sin(th2), + costh3 = Math.cos(th3), + sinth3 = Math.sin(th3), + toX = cosTh * rx * costh3 - sinTh * ry * sinth3 + cx1, + toY = sinTh * rx * costh3 + cosTh * ry * sinth3 + cy1, + cp1X = fromX + mT * ( - cosTh * rx * sinth2 - sinTh * ry * costh2), + cp1Y = fromY + mT * ( - sinTh * rx * sinth2 + cosTh * ry * costh2), + cp2X = toX + mT * ( cosTh * rx * sinth3 + sinTh * ry * costh3), + cp2Y = toY + mT * ( sinTh * rx * sinth3 - cosTh * ry * costh3); + + segmentToBezierCache[argsString2] = [ + cp1X, cp1Y, + cp2X, cp2Y, + toX, toY + ]; + return segmentToBezierCache[argsString2]; + } + + /* + * Private + */ + function calcVectorAngle(ux, uy, vx, vy) { + var ta = Math.atan2(uy, ux), + tb = Math.atan2(vy, vx); + if (tb >= ta) { + return tb - ta; + } + else { + return 2 * Math.PI - (ta - tb); + } + } + + /** + * Draws arc + * @param {CanvasRenderingContext2D} ctx + * @param {Number} fx + * @param {Number} fy + * @param {Array} coords + */ + fabric.util.drawArc = function(ctx, fx, fy, coords) { + var rx = coords[0], + ry = coords[1], + rot = coords[2], + large = coords[3], + sweep = coords[4], + tx = coords[5], + ty = coords[6], + segs = [[ ], [ ], [ ], [ ]], + segsNorm = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segsNorm.length; i < len; i++) { + segs[i][0] = segsNorm[i][0] + fx; + segs[i][1] = segsNorm[i][1] + fy; + segs[i][2] = segsNorm[i][2] + fx; + segs[i][3] = segsNorm[i][3] + fy; + segs[i][4] = segsNorm[i][4] + fx; + segs[i][5] = segsNorm[i][5] + fy; + ctx.bezierCurveTo.apply(ctx, segs[i]); + } + }; +})(); + + +(function() { + + var slice = Array.prototype.slice; + + + + /** + * Invokes method on all items in a given array + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} method Name of a method to invoke + * @return {Array} + */ + function invoke(array, method) { + var args = slice.call(arguments, 2), result = [ ]; + for (var i = 0, len = array.length; i < len; i++) { + result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]); + } + return result; + } + + /** + * Finds maximum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {Any} + */ + function max(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 >= value2; + }); + } + + /** + * Finds minimum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {Any} + */ + function min(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 < value2; + }); + } + + /** + * @private + */ + function find(array, byProperty, condition) { + if (!array || array.length === 0) { + return; + } + + var i = array.length - 1, + result = byProperty ? array[i][byProperty] : array[i]; + if (byProperty) { + while (i--) { + if (condition(array[i][byProperty], result)) { + result = array[i][byProperty]; + } + } + } + else { + while (i--) { + if (condition(array[i], result)) { + result = array[i]; + } + } + } + return result; + } + + /** + * @namespace fabric.util.array + */ + fabric.util.array = { + invoke: invoke, + min: min, + max: max + }; + +})(); + + +(function(){ + + /** + * Copies all enumerable properties of one object to another + * @memberOf fabric.util.object + * @param {Object} destination Where to copy to + * @param {Object} source Where to copy from + * @return {Object} + */ + function extend(destination, source) { + // JScript DontEnum bug is not taken care of + for (var property in source) { + destination[property] = source[property]; + } + return destination; + } + + /** + * Creates an empty object and copies all enumerable properties of another object to it + * @memberOf fabric.util.object + * @param {Object} object Object to clone + * @return {Object} + */ + function clone(object) { + return extend({ }, object); + } + + /** @namespace fabric.util.object */ + fabric.util.object = { + extend: extend, + clone: clone + }; + +})(); + + +(function() { + + + + /** + * Camelizes a string + * @memberOf fabric.util.string + * @param {String} string String to camelize + * @return {String} Camelized version of a string + */ + function camelize(string) { + return string.replace(/-+(.)?/g, function(match, character) { + return character ? character.toUpperCase() : ''; + }); + } + + /** + * Capitalizes a string + * @memberOf fabric.util.string + * @param {String} string String to capitalize + * @param {Boolean} [firstLetterOnly] If true only first letter is capitalized + * and other letters stay untouched, if false first letter is capitalized + * and other letters are converted to lowercase. + * @return {String} Capitalized version of a string + */ + function capitalize(string, firstLetterOnly) { + return string.charAt(0).toUpperCase() + + (firstLetterOnly ? string.slice(1) : string.slice(1).toLowerCase()); + } + + /** + * Escapes XML in a string + * @memberOf fabric.util.string + * @param {String} string String to escape + * @return {String} Escaped version of a string + */ + function escapeXml(string) { + return string.replace(/&/g, '&') + .replace(/"/g, '"') + .replace(/'/g, ''') + .replace(//g, '>'); + } + + /** + * String utilities + * @namespace fabric.util.string + */ + fabric.util.string = { + camelize: camelize, + capitalize: capitalize, + escapeXml: escapeXml + }; +}()); + + + + + +(function() { + + var slice = Array.prototype.slice, emptyFunction = function() { }, + + IS_DONTENUM_BUGGY = (function(){ + for (var p in { toString: 1 }) { + if (p === 'toString') { + return false; + } + } + return true; + })(), + + /** @ignore */ + addMethods = function(klass, source, parent) { + for (var property in source) { + + if (property in klass.prototype && + typeof klass.prototype[property] === 'function' && + (source[property] + '').indexOf('callSuper') > -1) { + + klass.prototype[property] = (function(property) { + return function() { + + var superclass = this.constructor.superclass; + this.constructor.superclass = parent; + var returnValue = source[property].apply(this, arguments); + this.constructor.superclass = superclass; + + if (property !== 'initialize') { + return returnValue; + } + }; + })(property); + } + else { + klass.prototype[property] = source[property]; + } + + if (IS_DONTENUM_BUGGY) { + if (source.toString !== Object.prototype.toString) { + klass.prototype.toString = source.toString; + } + if (source.valueOf !== Object.prototype.valueOf) { + klass.prototype.valueOf = source.valueOf; + } + } + } + }; + + function Subclass() { } + + function callSuper(methodName) { + var fn = this.constructor.superclass.prototype[methodName]; + return (arguments.length > 1) + ? fn.apply(this, slice.call(arguments, 1)) + : fn.call(this); + } + + /** + * Helper for creation of "classes". + * @memberOf fabric.util + * @param {Function} [parent] optional "Class" to inherit from + * @param {Object} [properties] Properties shared by all instances of this class + * (be careful modifying objects defined here as this would affect all instances) + */ + function createClass() { + var parent = null, + properties = slice.call(arguments, 0); + + if (typeof properties[0] === 'function') { + parent = properties.shift(); + } + function klass() { + this.initialize.apply(this, arguments); + } + + klass.superclass = parent; + klass.subclasses = [ ]; + + if (parent) { + Subclass.prototype = parent.prototype; + klass.prototype = new Subclass(); + parent.subclasses.push(klass); + } + for (var i = 0, length = properties.length; i < length; i++) { + addMethods(klass, properties[i], parent); + } + if (!klass.prototype.initialize) { + klass.prototype.initialize = emptyFunction; + } + klass.prototype.constructor = klass; + klass.prototype.callSuper = callSuper; + return klass; + } + + fabric.util.createClass = createClass; +})(); + + +(function () { + + var unknown = 'unknown'; + + /* EVENT HANDLING */ + + function areHostMethods(object) { + var methodNames = Array.prototype.slice.call(arguments, 1), + t, i, len = methodNames.length; + for (i = 0; i < len; i++) { + t = typeof object[methodNames[i]]; + if (!(/^(?:function|object|unknown)$/).test(t)) { + return false; + } + } + return true; + } + + /** @ignore */ + var getElement, + setElement, + getUniqueId = (function () { + var uid = 0; + return function (element) { + return element.__uniqueID || (element.__uniqueID = 'uniqueID__' + uid++); + }; + })(); + + (function () { + var elements = { }; + /** @ignore */ + getElement = function (uid) { + return elements[uid]; + }; + /** @ignore */ + setElement = function (uid, element) { + elements[uid] = element; + }; + })(); + + function createListener(uid, handler) { + return { + handler: handler, + wrappedHandler: createWrappedHandler(uid, handler) + }; + } + + function createWrappedHandler(uid, handler) { + return function (e) { + handler.call(getElement(uid), e || fabric.window.event); + }; + } + + function createDispatcher(uid, eventName) { + return function (e) { + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + handlersForEvent[i].call(this, e || fabric.window.event); + } + } + }; + } + + var shouldUseAddListenerRemoveListener = ( + areHostMethods(fabric.document.documentElement, 'addEventListener', 'removeEventListener') && + areHostMethods(fabric.window, 'addEventListener', 'removeEventListener')), + + shouldUseAttachEventDetachEvent = ( + areHostMethods(fabric.document.documentElement, 'attachEvent', 'detachEvent') && + areHostMethods(fabric.window, 'attachEvent', 'detachEvent')), + + // IE branch + listeners = { }, + + // DOM L0 branch + handlers = { }, + + addListener, removeListener; + + if (shouldUseAddListenerRemoveListener) { + /** @ignore */ + addListener = function (element, eventName, handler) { + element.addEventListener(eventName, handler, false); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + element.removeEventListener(eventName, handler, false); + }; + } + + else if (shouldUseAttachEventDetachEvent) { + /** @ignore */ + addListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + setElement(uid, element); + if (!listeners[uid]) { + listeners[uid] = { }; + } + if (!listeners[uid][eventName]) { + listeners[uid][eventName] = [ ]; + + } + var listener = createListener(uid, handler); + listeners[uid][eventName].push(listener); + element.attachEvent('on' + eventName, listener.wrappedHandler); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + var uid = getUniqueId(element), listener; + if (listeners[uid] && listeners[uid][eventName]) { + for (var i = 0, len = listeners[uid][eventName].length; i < len; i++) { + listener = listeners[uid][eventName][i]; + if (listener && listener.handler === handler) { + element.detachEvent('on' + eventName, listener.wrappedHandler); + listeners[uid][eventName][i] = null; + } + } + } + }; + } + else { + /** @ignore */ + addListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + if (!handlers[uid]) { + handlers[uid] = { }; + } + if (!handlers[uid][eventName]) { + handlers[uid][eventName] = [ ]; + var existingHandler = element['on' + eventName]; + if (existingHandler) { + handlers[uid][eventName].push(existingHandler); + } + element['on' + eventName] = createDispatcher(uid, eventName); + } + handlers[uid][eventName].push(handler); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + if (handlersForEvent[i] === handler) { + handlersForEvent.splice(i, 1); + } + } + } + }; + } + + /** + * Adds an event listener to an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.addListener = addListener; + + /** + * Removes an event listener from an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.removeListener = removeListener; + + /** + * Cross-browser wrapper for getting event's coordinates + * @memberOf fabric.util + * @param {Event} event Event object + * @param {HTMLCanvasElement} upperCanvasEl <canvas> element on which object selection is drawn + */ + function getPointer(event, upperCanvasEl) { + event || (event = fabric.window.event); + + var element = event.target || + (typeof event.srcElement !== unknown ? event.srcElement : null), + + scroll = fabric.util.getScrollLeftTop(element, upperCanvasEl); + + return { + x: pointerX(event) + scroll.left, + y: pointerY(event) + scroll.top + }; + } + + var pointerX = function(event) { + // looks like in IE (<9) clientX at certain point (apparently when mouseup fires on VML element) + // is represented as COM object, with all the consequences, like "unknown" type and error on [[Get]] + // need to investigate later + return (typeof event.clientX !== unknown ? event.clientX : 0); + }, + + pointerY = function(event) { + return (typeof event.clientY !== unknown ? event.clientY : 0); + }; + + function _getPointer(event, pageProp, clientProp) { + var touchProp = event.type === 'touchend' ? 'changedTouches' : 'touches'; + + return (event[touchProp] && event[touchProp][0] + ? (event[touchProp][0][pageProp] - (event[touchProp][0][pageProp] - event[touchProp][0][clientProp])) + || event[clientProp] + : event[clientProp]); + } + + if (fabric.isTouchSupported) { + pointerX = function(event) { + return _getPointer(event, 'pageX', 'clientX'); + }; + pointerY = function(event) { + return _getPointer(event, 'pageY', 'clientY'); + }; + } + + fabric.util.getPointer = getPointer; + + fabric.util.object.extend(fabric.util, fabric.Observable); + +})(); + + +(function () { + + /** + * Cross-browser wrapper for setting element's style + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {Object} styles + * @return {HTMLElement} Element that was passed as a first argument + */ + function setStyle(element, styles) { + var elementStyle = element.style; + if (!elementStyle) { + return element; + } + if (typeof styles === 'string') { + element.style.cssText += ';' + styles; + return styles.indexOf('opacity') > -1 + ? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) + : element; + } + for (var property in styles) { + if (property === 'opacity') { + setOpacity(element, styles[property]); + } + else { + var normalizedProperty = (property === 'float' || property === 'cssFloat') + ? (typeof elementStyle.styleFloat === 'undefined' ? 'cssFloat' : 'styleFloat') + : property; + elementStyle[normalizedProperty] = styles[property]; + } + } + return element; + } + + var parseEl = fabric.document.createElement('div'), + supportsOpacity = typeof parseEl.style.opacity === 'string', + supportsFilters = typeof parseEl.style.filter === 'string', + reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/, + + /** @ignore */ + setOpacity = function (element) { return element; }; + + if (supportsOpacity) { + /** @ignore */ + setOpacity = function(element, value) { + element.style.opacity = value; + return element; + }; + } + else if (supportsFilters) { + /** @ignore */ + setOpacity = function(element, value) { + var es = element.style; + if (element.currentStyle && !element.currentStyle.hasLayout) { + es.zoom = 1; + } + if (reOpacity.test(es.filter)) { + value = value >= 0.9999 ? '' : ('alpha(opacity=' + (value * 100) + ')'); + es.filter = es.filter.replace(reOpacity, value); + } + else { + es.filter += ' alpha(opacity=' + (value * 100) + ')'; + } + return element; + }; + } + + fabric.util.setStyle = setStyle; + +})(); + + +(function() { + + var _slice = Array.prototype.slice; + + /** + * Takes id and returns an element with that id (if one exists in a document) + * @memberOf fabric.util + * @param {String|HTMLElement} id + * @return {HTMLElement|null} + */ + function getById(id) { + return typeof id === 'string' ? fabric.document.getElementById(id) : id; + } + + var sliceCanConvertNodelists, + /** + * Converts an array-like object (e.g. arguments or NodeList) to an array + * @memberOf fabric.util + * @param {Object} arrayLike + * @return {Array} + */ + toArray = function(arrayLike) { + return _slice.call(arrayLike, 0); + }; + + try { + sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array; + } + catch (err) { } + + if (!sliceCanConvertNodelists) { + toArray = function(arrayLike) { + var arr = new Array(arrayLike.length), i = arrayLike.length; + while (i--) { + arr[i] = arrayLike[i]; + } + return arr; + }; + } + + /** + * Creates specified element with specified attributes + * @memberOf fabric.util + * @param {String} tagName Type of an element to create + * @param {Object} [attributes] Attributes to set on an element + * @return {HTMLElement} Newly created element + */ + function makeElement(tagName, attributes) { + var el = fabric.document.createElement(tagName); + for (var prop in attributes) { + if (prop === 'class') { + el.className = attributes[prop]; + } + else if (prop === 'for') { + el.htmlFor = attributes[prop]; + } + else { + el.setAttribute(prop, attributes[prop]); + } + } + return el; + } + + /** + * Adds class to an element + * @memberOf fabric.util + * @param {HTMLElement} element Element to add class to + * @param {String} className Class to add to an element + */ + function addClass(element, className) { + if (element && (' ' + element.className + ' ').indexOf(' ' + className + ' ') === -1) { + element.className += (element.className ? ' ' : '') + className; + } + } + + /** + * Wraps element with another element + * @memberOf fabric.util + * @param {HTMLElement} element Element to wrap + * @param {HTMLElement|String} wrapper Element to wrap with + * @param {Object} [attributes] Attributes to set on a wrapper + * @return {HTMLElement} wrapper + */ + function wrapElement(element, wrapper, attributes) { + if (typeof wrapper === 'string') { + wrapper = makeElement(wrapper, attributes); + } + if (element.parentNode) { + element.parentNode.replaceChild(wrapper, element); + } + wrapper.appendChild(element); + return wrapper; + } + + /** + * Returns element scroll offsets + * @memberOf fabric.util + * @param {HTMLElement} element Element to operate on + * @param {HTMLElement} upperCanvasEl Upper canvas element + * @return {Object} Object with left/top values + */ + function getScrollLeftTop(element, upperCanvasEl) { + + var firstFixedAncestor, + origElement, + left = 0, + top = 0, + docElement = fabric.document.documentElement, + body = fabric.document.body || { + scrollLeft: 0, scrollTop: 0 + }; + + origElement = element; + + while (element && element.parentNode && !firstFixedAncestor) { + + element = element.parentNode; + + if (element !== fabric.document && + fabric.util.getElementStyle(element, 'position') === 'fixed') { + firstFixedAncestor = element; + } + + if (element !== fabric.document && + origElement !== upperCanvasEl && + fabric.util.getElementStyle(element, 'position') === 'absolute') { + left = 0; + top = 0; + } + else if (element === fabric.document) { + left = body.scrollLeft || docElement.scrollLeft || 0; + top = body.scrollTop || docElement.scrollTop || 0; + } + else { + left += element.scrollLeft || 0; + top += element.scrollTop || 0; + } + } + + return { left: left, top: top }; + } + + /** + * Returns offset for a given element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element Element to get offset for + * @return {Object} Object with "left" and "top" properties + */ + function getElementOffset(element) { + var docElem, + doc = element && element.ownerDocument, + box = { left: 0, top: 0 }, + offset = { left: 0, top: 0 }, + scrollLeftTop, + offsetAttributes = { + borderLeftWidth: 'left', + borderTopWidth: 'top', + paddingLeft: 'left', + paddingTop: 'top' + }; + + if (!doc) { + return { left: 0, top: 0 }; + } + + for (var attr in offsetAttributes) { + offset[offsetAttributes[attr]] += parseInt(getElementStyle(element, attr), 10) || 0; + } + + docElem = doc.documentElement; + if ( typeof element.getBoundingClientRect !== 'undefined' ) { + box = element.getBoundingClientRect(); + } + + scrollLeftTop = fabric.util.getScrollLeftTop(element, null); + + return { + left: box.left + scrollLeftTop.left - (docElem.clientLeft || 0) + offset.left, + top: box.top + scrollLeftTop.top - (docElem.clientTop || 0) + offset.top + }; + } + + /** + * Returns style attribute value of a given element + * @memberOf fabric.util + * @param {HTMLElement} element Element to get style attribute for + * @param {String} attr Style attribute to get for element + * @return {String} Style attribute value of the given element. + */ + var getElementStyle; + if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) { + getElementStyle = function(element, attr) { + return fabric.document.defaultView.getComputedStyle(element, null)[attr]; + }; + } + else { + getElementStyle = function(element, attr) { + var value = element.style[attr]; + if (!value && element.currentStyle) { + value = element.currentStyle[attr]; + } + return value; + }; + } + + (function () { + var style = fabric.document.documentElement.style, + selectProp = 'userSelect' in style + ? 'userSelect' + : 'MozUserSelect' in style + ? 'MozUserSelect' + : 'WebkitUserSelect' in style + ? 'WebkitUserSelect' + : 'KhtmlUserSelect' in style + ? 'KhtmlUserSelect' + : ''; + + /** + * Makes element unselectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make unselectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementUnselectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = fabric.util.falseFunction; + } + if (selectProp) { + element.style[selectProp] = 'none'; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = 'on'; + } + return element; + } + + /** + * Makes element selectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make selectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementSelectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = null; + } + if (selectProp) { + element.style[selectProp] = ''; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = ''; + } + return element; + } + + fabric.util.makeElementUnselectable = makeElementUnselectable; + fabric.util.makeElementSelectable = makeElementSelectable; + })(); + + (function() { + + /** + * Inserts a script element with a given url into a document; invokes callback, when that script is finished loading + * @memberOf fabric.util + * @param {String} url URL of a script to load + * @param {Function} callback Callback to execute when script is finished loading + */ + function getScript(url, callback) { + var headEl = fabric.document.getElementsByTagName('head')[0], + scriptEl = fabric.document.createElement('script'), + loading = true; + + /** @ignore */ + scriptEl.onload = /** @ignore */ scriptEl.onreadystatechange = function(e) { + if (loading) { + if (typeof this.readyState === 'string' && + this.readyState !== 'loaded' && + this.readyState !== 'complete') { + return; + } + loading = false; + callback(e || fabric.window.event); + scriptEl = scriptEl.onload = scriptEl.onreadystatechange = null; + } + }; + scriptEl.src = url; + headEl.appendChild(scriptEl); + // causes issue in Opera + // headEl.removeChild(scriptEl); + } + + fabric.util.getScript = getScript; + })(); + + fabric.util.getById = getById; + fabric.util.toArray = toArray; + fabric.util.makeElement = makeElement; + fabric.util.addClass = addClass; + fabric.util.wrapElement = wrapElement; + fabric.util.getScrollLeftTop = getScrollLeftTop; + fabric.util.getElementOffset = getElementOffset; + fabric.util.getElementStyle = getElementStyle; + +})(); + + +(function(){ + + function addParamToUrl(url, param) { + return url + (/\?/.test(url) ? '&' : '?') + param; + } + + var makeXHR = (function() { + var factories = [ + function() { return new ActiveXObject('Microsoft.XMLHTTP'); }, + function() { return new ActiveXObject('Msxml2.XMLHTTP'); }, + function() { return new ActiveXObject('Msxml2.XMLHTTP.3.0'); }, + function() { return new XMLHttpRequest(); } + ]; + for (var i = factories.length; i--; ) { + try { + var req = factories[i](); + if (req) { + return factories[i]; + } + } + catch (err) { } + } + })(); + + function emptyFn() { } + + /** + * Cross-browser abstraction for sending XMLHttpRequest + * @memberOf fabric.util + * @param {String} url URL to send XMLHttpRequest to + * @param {Object} [options] Options object + * @param {String} [options.method="GET"] + * @param {Function} options.onComplete Callback to invoke when request is completed + * @return {XMLHttpRequest} request + */ + function request(url, options) { + + options || (options = { }); + + var method = options.method ? options.method.toUpperCase() : 'GET', + onComplete = options.onComplete || function() { }, + xhr = makeXHR(), + body; + + /** @ignore */ + xhr.onreadystatechange = function() { + if (xhr.readyState === 4) { + onComplete(xhr); + xhr.onreadystatechange = emptyFn; + } + }; + + if (method === 'GET') { + body = null; + if (typeof options.parameters === 'string') { + url = addParamToUrl(url, options.parameters); + } + } + + xhr.open(method, url, true); + + if (method === 'POST' || method === 'PUT') { + xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded'); + } + + xhr.send(body); + return xhr; + } + + fabric.util.request = request; +})(); + + +/** + * Wrapper around `console.log` (when available) + * @param {Any} [values] Values to log + */ +fabric.log = function() { }; + +/** + * Wrapper around `console.warn` (when available) + * @param {Any} [values] Values to log as a warning + */ +fabric.warn = function() { }; + +if (typeof console !== 'undefined') { + ['log', 'warn'].forEach(function(methodName) { + if (typeof console[methodName] !== 'undefined' && console[methodName].apply) { + fabric[methodName] = function() { + return console[methodName].apply(console, arguments); + }; + } + }); +} + + +(function(global) { + + 'use strict'; + + /** + * @name fabric + * @namespace + */ + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + capitalize = fabric.util.string.capitalize, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + parseUnit = fabric.util.parseUnit, + multiplyTransformMatrices = fabric.util.multiplyTransformMatrices, + + attributesMap = { + cx: 'left', + x: 'left', + r: 'radius', + cy: 'top', + y: 'top', + display: 'visible', + visibility: 'visible', + transform: 'transformMatrix', + 'fill-opacity': 'fillOpacity', + 'fill-rule': 'fillRule', + 'font-family': 'fontFamily', + 'font-size': 'fontSize', + 'font-style': 'fontStyle', + 'font-weight': 'fontWeight', + 'stroke-dasharray': 'strokeDashArray', + 'stroke-linecap': 'strokeLineCap', + 'stroke-linejoin': 'strokeLineJoin', + 'stroke-miterlimit': 'strokeMiterLimit', + 'stroke-opacity': 'strokeOpacity', + 'stroke-width': 'strokeWidth', + 'text-decoration': 'textDecoration', + 'text-anchor': 'originX' + }, + + colorAttributes = { + stroke: 'strokeOpacity', + fill: 'fillOpacity' + }; + + function normalizeAttr(attr) { + // transform attribute names + if (attr in attributesMap) { + return attributesMap[attr]; + } + return attr; + } + + function normalizeValue(attr, value, parentAttributes) { + var isArray = Object.prototype.toString.call(value) === '[object Array]', + parsed; + + if ((attr === 'fill' || attr === 'stroke') && value === 'none') { + value = ''; + } + else if (attr === 'fillRule') { + value = (value === 'evenodd') ? 'destination-over' : value; + } + else if (attr === 'strokeDashArray') { + value = value.replace(/,/g, ' ').split(/\s+/).map(function(n) { + return parseInt(n); + }); + } + else if (attr === 'transformMatrix') { + if (parentAttributes && parentAttributes.transformMatrix) { + value = multiplyTransformMatrices( + parentAttributes.transformMatrix, fabric.parseTransformAttribute(value)); + } + else { + value = fabric.parseTransformAttribute(value); + } + } + else if (attr === 'visible') { + value = (value === 'none' || value === 'hidden') ? false : true; + // display=none on parent element always takes precedence over child element + if (parentAttributes && parentAttributes.visible === false) { + value = false; + } + } + else if (attr === 'originX' /* text-anchor */) { + value = value === 'start' ? 'left' : value === 'end' ? 'right' : 'center'; + } + else { + parsed = isArray ? value.map(parseUnit) : parseUnit(value); + } + + return (!isArray && isNaN(parsed) ? value : parsed); + } + + /** + * @private + * @param {Object} attributes Array of attributes to parse + */ + function _setStrokeFillOpacity(attributes) { + for (var attr in colorAttributes) { + + if (!attributes[attr] || typeof attributes[colorAttributes[attr]] === 'undefined') { + continue; + } + + if (attributes[attr].indexOf('url(') === 0) { + continue; + } + + var color = new fabric.Color(attributes[attr]); + attributes[attr] = color.setAlpha(toFixed(color.getAlpha() * attributes[colorAttributes[attr]], 2)).toRgba(); + } + return attributes; + } + + /** + * Parses "transform" attribute, returning an array of values + * @static + * @function + * @memberOf fabric + * @param {String} attributeValue String containing attribute value + * @return {Array} Array of 6 elements representing transformation matrix + */ + fabric.parseTransformAttribute = (function() { + function rotateMatrix(matrix, args) { + var angle = args[0]; + + matrix[0] = Math.cos(angle); + matrix[1] = Math.sin(angle); + matrix[2] = -Math.sin(angle); + matrix[3] = Math.cos(angle); + } + + function scaleMatrix(matrix, args) { + var multiplierX = args[0], + multiplierY = (args.length === 2) ? args[1] : args[0]; + + matrix[0] = multiplierX; + matrix[3] = multiplierY; + } + + function skewXMatrix(matrix, args) { + matrix[2] = args[0]; + } + + function skewYMatrix(matrix, args) { + matrix[1] = args[0]; + } + + function translateMatrix(matrix, args) { + matrix[4] = args[0]; + if (args.length === 2) { + matrix[5] = args[1]; + } + } + + // identity matrix + var iMatrix = [ + 1, // a + 0, // b + 0, // c + 1, // d + 0, // e + 0 // f + ], + + // == begin transform regexp + number = '(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:e[-+]?\\d+)?)', + + commaWsp = '(?:\\s+,?\\s*|,\\s*)', + + skewX = '(?:(skewX)\\s*\\(\\s*(' + number + ')\\s*\\))', + + skewY = '(?:(skewY)\\s*\\(\\s*(' + number + ')\\s*\\))', + + rotate = '(?:(rotate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + ')' + + commaWsp + '(' + number + '))?\\s*\\))', + + scale = '(?:(scale)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + translate = '(?:(translate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + matrix = '(?:(matrix)\\s*\\(\\s*' + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + + '\\s*\\))', + + transform = '(?:' + + matrix + '|' + + translate + '|' + + scale + '|' + + rotate + '|' + + skewX + '|' + + skewY + + ')', + + transforms = '(?:' + transform + '(?:' + commaWsp + transform + ')*' + ')', + + transformList = '^\\s*(?:' + transforms + '?)\\s*$', + + // http://www.w3.org/TR/SVG/coords.html#TransformAttribute + reTransformList = new RegExp(transformList), + // == end transform regexp + + reTransform = new RegExp(transform, 'g'); + + return function(attributeValue) { + + // start with identity matrix + var matrix = iMatrix.concat(), + matrices = [ ]; + + // return if no argument was given or + // an argument does not match transform attribute regexp + if (!attributeValue || (attributeValue && !reTransformList.test(attributeValue))) { + return matrix; + } + + attributeValue.replace(reTransform, function(match) { + + var m = new RegExp(transform).exec(match).filter(function (match) { + return (match !== '' && match != null); + }), + operation = m[1], + args = m.slice(2).map(parseFloat); + + switch (operation) { + case 'translate': + translateMatrix(matrix, args); + break; + case 'rotate': + args[0] = fabric.util.degreesToRadians(args[0]); + rotateMatrix(matrix, args); + break; + case 'scale': + scaleMatrix(matrix, args); + break; + case 'skewX': + skewXMatrix(matrix, args); + break; + case 'skewY': + skewYMatrix(matrix, args); + break; + case 'matrix': + matrix = args; + break; + } + + // snapshot current matrix into matrices array + matrices.push(matrix.concat()); + // reset + matrix = iMatrix.concat(); + }); + + var combinedMatrix = matrices[0]; + while (matrices.length > 1) { + matrices.shift(); + combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]); + } + return combinedMatrix; + }; + })(); + + function parseFontDeclaration(value, oStyle) { + + // TODO: support non-px font size + var match = value.match(/(normal|italic)?\s*(normal|small-caps)?\s*(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\s*(\d+)px(?:\/(normal|[\d\.]+))?\s+(.*)/); + + if (!match) { + return; + } + + var fontStyle = match[1], + // font variant is not used + // fontVariant = match[2], + fontWeight = match[3], + fontSize = match[4], + lineHeight = match[5], + fontFamily = match[6]; + + if (fontStyle) { + oStyle.fontStyle = fontStyle; + } + if (fontWeight) { + oStyle.fontWeight = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight); + } + if (fontSize) { + oStyle.fontSize = parseFloat(fontSize); + } + if (fontFamily) { + oStyle.fontFamily = fontFamily; + } + if (lineHeight) { + oStyle.lineHeight = lineHeight === 'normal' ? 1 : lineHeight; + } + } + + /** + * @private + */ + function parseStyleString(style, oStyle) { + var attr, value; + style.replace(/;$/, '').split(';').forEach(function (chunk) { + var pair = chunk.split(':'); + + attr = normalizeAttr(pair[0].trim().toLowerCase()); + value = normalizeValue(attr, pair[1].trim()); + + if (attr === 'font') { + parseFontDeclaration(value, oStyle); + } + else { + oStyle[attr] = value; + } + }); + } + + /** + * @private + */ + function parseStyleObject(style, oStyle) { + var attr, value; + for (var prop in style) { + if (typeof style[prop] === 'undefined') { + continue; + } + + attr = normalizeAttr(prop.toLowerCase()); + value = normalizeValue(attr, style[prop]); + + if (attr === 'font') { + parseFontDeclaration(value, oStyle); + } + else { + oStyle[attr] = value; + } + } + } + + /** + * @private + */ + function getGlobalStylesForElement(element) { + var styles = { }; + + for (var rule in fabric.cssRules) { + if (elementMatchesRule(element, rule.split(' '))) { + for (var property in fabric.cssRules[rule]) { + styles[property] = fabric.cssRules[rule][property]; + } + } + } + return styles; + } + + /** + * @private + */ + function elementMatchesRule(element, selectors) { + var firstMatching, parentMatching = true; + //start from rightmost selector. + firstMatching = selectorMatches(element, selectors.pop()); + if (firstMatching && selectors.length) { + parentMatching = doesSomeParentMatch(element, selectors); + } + return firstMatching && parentMatching && (selectors.length === 0); + } + + function doesSomeParentMatch(element, selectors) { + var selector, parentMatching = true; + while (element.parentNode && element.parentNode.nodeType === 1 && selectors.length) { + if (parentMatching) { + selector = selectors.pop(); + } + element = element.parentNode; + parentMatching = selectorMatches(element, selector); + } + return selectors.length === 0; + } + /** + * @private + */ + function selectorMatches(element, selector) { + var nodeName = element.nodeName, + classNames = element.getAttribute('class'), + id = element.getAttribute('id'), matcher; + // i check if a selector matches slicing away part from it. + // if i get empty string i should match + matcher = new RegExp('^' + nodeName, 'i'); + selector = selector.replace(matcher, ''); + if (id && selector.length) { + matcher = new RegExp('#' + id + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + if (classNames && selector.length) { + classNames = classNames.split(' '); + for (var i = classNames.length; i--;) { + matcher = new RegExp('\\.' + classNames[i] + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + } + return selector.length === 0; + } + + /** + * @private + */ + function parseUseDirectives(doc) { + var nodelist = doc.getElementsByTagName('use'); + while (nodelist.length) { + var el = nodelist[0], + xlink = el.getAttribute('xlink:href').substr(1), + x = el.getAttribute('x') || 0, + y = el.getAttribute('y') || 0, + el2 = doc.getElementById(xlink).cloneNode(true), + currentTrans = (el.getAttribute('transform') || '') + ' translate(' + x + ', ' + y + ')', + parentNode; + + for (var j = 0, attrs = el.attributes, l = attrs.length; j < l; j++) { + var attr = attrs.item(j); + if (attr.nodeName === 'x' || attr.nodeName === 'y' || attr.nodeName === 'xlink:href') { + continue; + } + + if (attr.nodeName === 'transform') { + currentTrans = currentTrans + ' ' + attr.nodeValue; + } + else { + el2.setAttribute(attr.nodeName, attr.nodeValue); + } + } + + el2.setAttribute('transform', currentTrans); + el2.removeAttribute('id'); + parentNode = el.parentNode; + parentNode.replaceChild(el2, el); + } + } + + /** + * Add a element that envelop all SCG elements and makes the viewbox transformMatrix descend on all elements + */ + function addSvgTransform(doc, matrix) { + matrix[3] = matrix[0] = (matrix[0] > matrix[3] ? matrix[3] : matrix[0]); + if (!(matrix[0] !== 1 || matrix[3] !== 1 || matrix[4] !== 0 || matrix[5] !== 0)) { + return; + } + // default is to preserve aspect ratio + // preserveAspectRatio attribute to be implemented + var el = doc.ownerDocument.createElement('g'); + while (doc.firstChild != null) { + el.appendChild(doc.firstChild); + } + el.setAttribute('transform','matrix(' + matrix[0] + ' ' + matrix[1] + ' ' + matrix[2] + ' ' + matrix[3] + ' ' + matrix[4] + ' ' + matrix[5] + ')'); + doc.appendChild(el); + } + + /** + * Parses an SVG document, converts it to an array of corresponding fabric.* instances and passes them to a callback + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @param {Function} callback Callback to call when parsing is finished; It's being passed an array of elements (parsed from a document). + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + fabric.parseSVGDocument = (function() { + + var reAllowedSVGTagNames = /^(path|circle|polygon|polyline|ellipse|rect|line|image|text)$/, + + // http://www.w3.org/TR/SVG/coords.html#ViewBoxAttribute + // \d doesn't quite cut it (as we need to match an actual float number) + + // matches, e.g.: +14.56e-12, etc. + reNum = '(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:e[-+]?\\d+)?)', + + reViewBoxAttrValue = new RegExp( + '^' + + '\\s*(' + reNum + '+)\\s*,?' + + '\\s*(' + reNum + '+)\\s*,?' + + '\\s*(' + reNum + '+)\\s*,?' + + '\\s*(' + reNum + '+)\\s*' + + '$' + ); + + function hasAncestorWithNodeName(element, nodeName) { + while (element && (element = element.parentNode)) { + if (nodeName.test(element.nodeName)) { + return true; + } + } + return false; + } + + return function(doc, callback, reviver) { + if (!doc) { + return; + } + var startTime = new Date(); + + parseUseDirectives(doc); + /* http://www.w3.org/TR/SVG/struct.html#SVGElementWidthAttribute + * as per spec, width and height attributes are to be considered + * 100% if no value is specified. + */ + var viewBoxAttr = doc.getAttribute('viewBox'), + widthAttr = parseUnit(doc.getAttribute('width') || '100%'), + heightAttr = parseUnit(doc.getAttribute('height') || '100%'), + viewBoxWidth, + viewBoxHeight; + + if (viewBoxAttr && (viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))) { + var minX = parseFloat(viewBoxAttr[1]), + minY = parseFloat(viewBoxAttr[2]), + scaleX = 1, scaleY = 1; + viewBoxWidth = parseFloat(viewBoxAttr[3]); + viewBoxHeight = parseFloat(viewBoxAttr[4]); + if (widthAttr && widthAttr !== viewBoxWidth ) { + scaleX = widthAttr / viewBoxWidth; + } + if (heightAttr && heightAttr !== viewBoxHeight) { + scaleY = heightAttr / viewBoxHeight; + } + addSvgTransform(doc, [scaleX, 0, 0, scaleY, scaleX * -minX, scaleY * -minY]); + } + + var descendants = fabric.util.toArray(doc.getElementsByTagName('*')); + + if (descendants.length === 0 && fabric.isLikelyNode) { + // we're likely in node, where "o3-xml" library fails to gEBTN("*") + // https://github.com/ajaxorg/node-o3-xml/issues/21 + descendants = doc.selectNodes('//*[name(.)!="svg"]'); + var arr = [ ]; + for (var i = 0, len = descendants.length; i < len; i++) { + arr[i] = descendants[i]; + } + descendants = arr; + } + + var elements = descendants.filter(function(el) { + return reAllowedSVGTagNames.test(el.tagName) && + !hasAncestorWithNodeName(el, /^(?:pattern|defs)$/); // http://www.w3.org/TR/SVG/struct.html#DefsElement + }); + + if (!elements || (elements && !elements.length)) { + callback && callback([], {}); + return; + } + + var options = { + width: widthAttr ? widthAttr : viewBoxWidth, + height: heightAttr ? heightAttr : viewBoxHeight, + widthAttr: widthAttr, + heightAttr: heightAttr + }; + + fabric.gradientDefs = fabric.getGradientDefs(doc); + fabric.cssRules = fabric.getCSSRules(doc); + // Precedence of rules: style > class > attribute + + fabric.parseElements(elements, function(instances) { + fabric.documentParsingTime = new Date() - startTime; + if (callback) { + callback(instances, options); + } + }, clone(options), reviver); + }; + })(); + + /** + * Used for caching SVG documents (loaded via `fabric.Canvas#loadSVGFromURL`) + * @namespace + */ + var svgCache = { + + /** + * @param {String} name + * @param {Function} callback + */ + has: function (name, callback) { + callback(false); + }, + + get: function () { + /* NOOP */ + }, + + set: function () { + /* NOOP */ + } + }; + + /** + * @private + */ + function _enlivenCachedObject(cachedObject) { + + var objects = cachedObject.objects, + options = cachedObject.options; + + objects = objects.map(function (o) { + return fabric[capitalize(o.type)].fromObject(o); + }); + + return ({ objects: objects, options: options }); + } + + /** + * @private + */ + function _createSVGPattern(markup, canvas, property) { + if (canvas[property] && canvas[property].toSVG) { + markup.push( + '', + '' + ); + } + } + + extend(fabric, { + + /** + * Parses an SVG document, returning all of the gradient declarations found in it + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} Gradient definitions; key corresponds to element id, value -- to gradient definition element + */ + getGradientDefs: function(doc) { + var linearGradientEls = doc.getElementsByTagName('linearGradient'), + radialGradientEls = doc.getElementsByTagName('radialGradient'), + el, i, j = 0, id, xlink, elList = [ ], + gradientDefs = { }, idsToXlinkMap = { }; + + elList.length = linearGradientEls.length + radialGradientEls.length; + i = linearGradientEls.length; + while (i--) { + elList[j++] = linearGradientEls[i]; + } + i = radialGradientEls.length; + while (i--) { + elList[j++] = radialGradientEls[i]; + } + + while (j--) { + el = elList[j]; + xlink = el.getAttribute('xlink:href'); + id = el.getAttribute('id'); + if (xlink) { + idsToXlinkMap[id] = xlink.substr(1); + } + gradientDefs[id] = el; + } + + for (id in idsToXlinkMap) { + var el2 = gradientDefs[idsToXlinkMap[id]].cloneNode(true); + el = gradientDefs[id]; + while (el2.firstChild) { + el.appendChild(el2.firstChild); + } + } + return gradientDefs; + }, + + /** + * Returns an object of attributes' name/value, given element and an array of attribute names; + * Parses parent "g" nodes recursively upwards. + * @static + * @memberOf fabric + * @param {DOMElement} element Element to parse + * @param {Array} attributes Array of attributes to parse + * @return {Object} object containing parsed attributes' names/values + */ + parseAttributes: function(element, attributes) { + + if (!element) { + return; + } + + var value, + parentAttributes = { }; + + // if there's a parent container (`g` or `a` or `symbol` node), parse its attributes recursively upwards + if (element.parentNode && /^symbol|[g|a]$/i.test(element.parentNode.nodeName)) { + parentAttributes = fabric.parseAttributes(element.parentNode, attributes); + } + + var ownAttributes = attributes.reduce(function(memo, attr) { + value = element.getAttribute(attr); + if (value) { + attr = normalizeAttr(attr); + value = normalizeValue(attr, value, parentAttributes); + + memo[attr] = value; + } + return memo; + }, { }); + + // add values parsed from style, which take precedence over attributes + // (see: http://www.w3.org/TR/SVG/styling.html#UsingPresentationAttributes) + ownAttributes = extend(ownAttributes, + extend(getGlobalStylesForElement(element), fabric.parseStyleAttribute(element))); + + return _setStrokeFillOpacity(extend(parentAttributes, ownAttributes)); + }, + + /** + * Transforms an array of svg elements to corresponding fabric.* instances + * @static + * @memberOf fabric + * @param {Array} elements Array of elements to parse + * @param {Function} callback Being passed an array of fabric instances (transformed from SVG elements) + * @param {Object} [options] Options object + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + parseElements: function(elements, callback, options, reviver) { + new fabric.ElementsParser(elements, callback, options, reviver).parse(); + }, + + /** + * Parses "style" attribute, retuning an object with values + * @static + * @memberOf fabric + * @param {SVGElement} element Element to parse + * @return {Object} Objects with values parsed from style attribute of an element + */ + parseStyleAttribute: function(element) { + var oStyle = { }, + style = element.getAttribute('style'); + + if (!style) { + return oStyle; + } + + if (typeof style === 'string') { + parseStyleString(style, oStyle); + } + else { + parseStyleObject(style, oStyle); + } + + return oStyle; + }, + + /** + * Parses "points" attribute, returning an array of values + * @static + * @memberOf fabric + * @param {String} points points attribute string + * @return {Array} array of points + */ + parsePointsAttribute: function(points) { + + // points attribute is required and must not be empty + if (!points) { + return null; + } + + // replace commas with whitespace and remove bookending whitespace + points = points.replace(/,/g, ' ').trim(); + + points = points.split(/\s+/); + var parsedPoints = [ ], i, len; + + i = 0; + len = points.length; + for (; i < len; i+=2) { + parsedPoints.push({ + x: parseFloat(points[i]), + y: parseFloat(points[i + 1]) + }); + } + + // odd number of points is an error + // if (parsedPoints.length % 2 !== 0) { + // return null; + // } + + return parsedPoints; + }, + + /** + * Returns CSS rules for a given SVG document + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} CSS rules of this document + */ + getCSSRules: function(doc) { + var styles = doc.getElementsByTagName('style'), + allRules = { }, rules; + + // very crude parsing of style contents + for (var i = 0, len = styles.length; i < len; i++) { + var styleContents = styles[0].textContent; + + // remove comments + styleContents = styleContents.replace(/\/\*[\s\S]*?\*\//g, ''); + + rules = styleContents.match(/[^{]*\{[\s\S]*?\}/g); + rules = rules.map(function(rule) { return rule.trim(); }); + + rules.forEach(function(rule) { + + var match = rule.match(/([\s\S]*?)\s*\{([^}]*)\}/), + ruleObj = { }, declaration = match[2].trim(), + propertyValuePairs = declaration.replace(/;$/, '').split(/\s*;\s*/); + + for (var i = 0, len = propertyValuePairs.length; i < len; i++) { + var pair = propertyValuePairs[i].split(/\s*:\s*/), + property = normalizeAttr(pair[0]), + value = normalizeValue(property,pair[1],pair[0]); + ruleObj[property] = value; + } + rule = match[1]; + rule.split(',').forEach(function(_rule) { + allRules[_rule.trim()] = fabric.util.object.clone(ruleObj); + }); + }); + } + return allRules; + }, + + /** + * Takes url corresponding to an SVG document, and parses it into a set of fabric objects. Note that SVG is fetched via XMLHttpRequest, so it needs to conform to SOP (Same Origin Policy) + * @memberof fabric + * @param {String} url + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + loadSVGFromURL: function(url, callback, reviver) { + + url = url.replace(/^\n\s*/, '').trim(); + svgCache.has(url, function (hasUrl) { + if (hasUrl) { + svgCache.get(url, function (value) { + var enlivedRecord = _enlivenCachedObject(value); + callback(enlivedRecord.objects, enlivedRecord.options); + }); + } + else { + new fabric.util.request(url, { + method: 'get', + onComplete: onComplete + }); + } + }); + + function onComplete(r) { + + var xml = r.responseXML; + if (xml && !xml.documentElement && fabric.window.ActiveXObject && r.responseText) { + xml = new ActiveXObject('Microsoft.XMLDOM'); + xml.async = 'false'; + //IE chokes on DOCTYPE + xml.loadXML(r.responseText.replace(//i,'')); + } + if (!xml || !xml.documentElement) { + return; + } + + fabric.parseSVGDocument(xml.documentElement, function (results, options) { + svgCache.set(url, { + objects: fabric.util.array.invoke(results, 'toObject'), + options: options + }); + callback(results, options); + }, reviver); + } + }, + + /** + * Takes string corresponding to an SVG document, and parses it into a set of fabric objects + * @memberof fabric + * @param {String} string + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + loadSVGFromString: function(string, callback, reviver) { + string = string.trim(); + var doc; + if (typeof DOMParser !== 'undefined') { + var parser = new DOMParser(); + if (parser && parser.parseFromString) { + doc = parser.parseFromString(string, 'text/xml'); + } + } + else if (fabric.window.ActiveXObject) { + doc = new ActiveXObject('Microsoft.XMLDOM'); + doc.async = 'false'; + //IE chokes on DOCTYPE + doc.loadXML(string.replace(//i,'')); + } + + fabric.parseSVGDocument(doc.documentElement, function (results, options) { + callback(results, options); + }, reviver); + }, + + /** + * Creates markup containing SVG font faces + * @param {Array} objects Array of fabric objects + * @return {String} + */ + createSVGFontFacesMarkup: function(objects) { + var markup = ''; + + for (var i = 0, len = objects.length; i < len; i++) { + if (objects[i].type !== 'text' || !objects[i].path) { + continue; + } + + markup += [ + //jscs:disable validateIndentation + '@font-face {', + 'font-family: ', objects[i].fontFamily, '; ', + 'src: url(\'', objects[i].path, '\')', + '}' + //jscs:enable validateIndentation + ].join(''); + } + + if (markup) { + markup = [ + //jscs:disable validateIndentation + '' + //jscs:enable validateIndentation + ].join(''); + } + + return markup; + }, + + /** + * Creates markup containing SVG referenced elements like patterns, gradients etc. + * @param {fabric.Canvas} canvas instance of fabric.Canvas + * @return {String} + */ + createSVGRefElementsMarkup: function(canvas) { + var markup = [ ]; + + _createSVGPattern(markup, canvas, 'backgroundColor'); + _createSVGPattern(markup, canvas, 'overlayColor'); + + return markup.join(''); + } + }); + +})(typeof exports !== 'undefined' ? exports : this); + + +fabric.ElementsParser = function(elements, callback, options, reviver) { + this.elements = elements; + this.callback = callback; + this.options = options; + this.reviver = reviver; +}; + +fabric.ElementsParser.prototype.parse = function() { + this.instances = new Array(this.elements.length); + this.numElements = this.elements.length; + + this.createObjects(); +}; + +fabric.ElementsParser.prototype.createObjects = function() { + for (var i = 0, len = this.elements.length; i < len; i++) { + (function(_this, i) { + setTimeout(function() { + _this.createObject(_this.elements[i], i); + }, 0); + })(this, i); + } +}; + +fabric.ElementsParser.prototype.createObject = function(el, index) { + var klass = fabric[fabric.util.string.capitalize(el.tagName)]; + if (klass && klass.fromElement) { + try { + this._createObject(klass, el, index); + } + catch (err) { + fabric.log(err); + } + } + else { + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype._createObject = function(klass, el, index) { + if (klass.async) { + klass.fromElement(el, this.createCallback(index, el), this.options); + } + else { + var obj = klass.fromElement(el, this.options); + this.resolveGradient(obj, 'fill'); + this.resolveGradient(obj, 'stroke'); + this.reviver && this.reviver(el, obj); + this.instances[index] = obj; + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype.createCallback = function(index, el) { + var _this = this; + return function(obj) { + _this.resolveGradient(obj, 'fill'); + _this.resolveGradient(obj, 'stroke'); + _this.reviver && _this.reviver(el, obj); + _this.instances[index] = obj; + _this.checkIfDone(); + }; +}; + +fabric.ElementsParser.prototype.resolveGradient = function(obj, property) { + + var instanceFillValue = obj.get(property); + if (!(/^url\(/).test(instanceFillValue)) { + return; + } + var gradientId = instanceFillValue.slice(5, instanceFillValue.length - 1); + if (fabric.gradientDefs[gradientId]) { + obj.set(property, + fabric.Gradient.fromElement(fabric.gradientDefs[gradientId], obj)); + } +}; + +fabric.ElementsParser.prototype.checkIfDone = function() { + if (--this.numElements === 0) { + this.instances = this.instances.filter(function(el) { + return el != null; + }); + this.callback(this.instances); + } +}; + + +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Point) { + fabric.warn('fabric.Point is already defined'); + return; + } + + fabric.Point = Point; + + /** + * Point class + * @class fabric.Point + * @memberOf fabric + * @constructor + * @param {Number} x + * @param {Number} y + * @return {fabric.Point} thisArg + */ + function Point(x, y) { + this.x = x; + this.y = y; + } + + Point.prototype = /** @lends fabric.Point.prototype */ { + + constructor: Point, + + /** + * Adds another point to this one and returns another one + * @param {fabric.Point} that + * @return {fabric.Point} new Point instance with added values + */ + add: function (that) { + return new Point(this.x + that.x, this.y + that.y); + }, + + /** + * Adds another point to this one + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + */ + addEquals: function (that) { + this.x += that.x; + this.y += that.y; + return this; + }, + + /** + * Adds value to this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} new Point with added value + */ + scalarAdd: function (scalar) { + return new Point(this.x + scalar, this.y + scalar); + }, + + /** + * Adds value to this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + scalarAddEquals: function (scalar) { + this.x += scalar; + this.y += scalar; + return this; + }, + + /** + * Subtracts another point from this point and returns a new one + * @param {fabric.Point} that + * @return {fabric.Point} new Point object with subtracted values + */ + subtract: function (that) { + return new Point(this.x - that.x, this.y - that.y); + }, + + /** + * Subtracts another point from this point + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + */ + subtractEquals: function (that) { + this.x -= that.x; + this.y -= that.y; + return this; + }, + + /** + * Subtracts value from this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + scalarSubtract: function (scalar) { + return new Point(this.x - scalar, this.y - scalar); + }, + + /** + * Subtracts value from this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + scalarSubtractEquals: function (scalar) { + this.x -= scalar; + this.y -= scalar; + return this; + }, + + /** + * Miltiplies this point by a value and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + multiply: function (scalar) { + return new Point(this.x * scalar, this.y * scalar); + }, + + /** + * Miltiplies this point by a value + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + multiplyEquals: function (scalar) { + this.x *= scalar; + this.y *= scalar; + return this; + }, + + /** + * Divides this point by a value and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + divide: function (scalar) { + return new Point(this.x / scalar, this.y / scalar); + }, + + /** + * Divides this point by a value + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + divideEquals: function (scalar) { + this.x /= scalar; + this.y /= scalar; + return this; + }, + + /** + * Returns true if this point is equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + eq: function (that) { + return (this.x === that.x && this.y === that.y); + }, + + /** + * Returns true if this point is less than another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lt: function (that) { + return (this.x < that.x && this.y < that.y); + }, + + /** + * Returns true if this point is less than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lte: function (that) { + return (this.x <= that.x && this.y <= that.y); + }, + + /** + + * Returns true if this point is greater another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gt: function (that) { + return (this.x > that.x && this.y > that.y); + }, + + /** + * Returns true if this point is greater than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gte: function (that) { + return (this.x >= that.x && this.y >= that.y); + }, + + /** + * Returns new point which is the result of linear interpolation with this one and another one + * @param {fabric.Point} that + * @param {Number} t + * @return {fabric.Point} + */ + lerp: function (that, t) { + return new Point(this.x + (that.x - this.x) * t, this.y + (that.y - this.y) * t); + }, + + /** + * Returns distance from this point and another one + * @param {fabric.Point} that + * @return {Number} + */ + distanceFrom: function (that) { + var dx = this.x - that.x, + dy = this.y - that.y; + return Math.sqrt(dx * dx + dy * dy); + }, + + /** + * Returns the point between this point and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + midPointFrom: function (that) { + return new Point(this.x + (that.x - this.x)/2, this.y + (that.y - this.y)/2); + }, + + /** + * Returns a new point which is the min of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + min: function (that) { + return new Point(Math.min(this.x, that.x), Math.min(this.y, that.y)); + }, + + /** + * Returns a new point which is the max of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + max: function (that) { + return new Point(Math.max(this.x, that.x), Math.max(this.y, that.y)); + }, + + /** + * Returns string representation of this point + * @return {String} + */ + toString: function () { + return this.x + ',' + this.y; + }, + + /** + * Sets x/y of this point + * @param {Number} x + * @return {Number} y + */ + setXY: function (x, y) { + this.x = x; + this.y = y; + }, + + /** + * Sets x/y of this point from another point + * @param {fabric.Point} that + */ + setFromPoint: function (that) { + this.x = that.x; + this.y = that.y; + }, + + /** + * Swaps x/y of this point and another point + * @param {fabric.Point} that + */ + swap: function (that) { + var x = this.x, + y = this.y; + this.x = that.x; + this.y = that.y; + that.x = x; + that.y = y; + } + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Intersection) { + fabric.warn('fabric.Intersection is already defined'); + return; + } + + /** + * Intersection class + * @class fabric.Intersection + * @memberOf fabric + * @constructor + */ + function Intersection(status) { + this.status = status; + this.points = []; + } + + fabric.Intersection = Intersection; + + fabric.Intersection.prototype = /** @lends fabric.Intersection.prototype */ { + + /** + * Appends a point to intersection + * @param {fabric.Point} point + */ + appendPoint: function (point) { + this.points.push(point); + }, + + /** + * Appends points to intersection + * @param {Array} points + */ + appendPoints: function (points) { + this.points = this.points.concat(points); + } + }; + + /** + * Checks if one line intersects another + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {fabric.Point} b1 + * @param {fabric.Point} b2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLineLine = function (a1, a2, b1, b2) { + var result, + uaT = (b2.x - b1.x) * (a1.y - b1.y) - (b2.y - b1.y) * (a1.x - b1.x), + ubT = (a2.x - a1.x) * (a1.y - b1.y) - (a2.y - a1.y) * (a1.x - b1.x), + uB = (b2.y - b1.y) * (a2.x - a1.x) - (b2.x - b1.x) * (a2.y - a1.y); + if (uB !== 0) { + var ua = uaT / uB, + ub = ubT / uB; + if (0 <= ua && ua <= 1 && 0 <= ub && ub <= 1) { + result = new Intersection('Intersection'); + result.points.push(new fabric.Point(a1.x + ua * (a2.x - a1.x), a1.y + ua * (a2.y - a1.y))); + } + else { + result = new Intersection(); + } + } + else { + if (uaT === 0 || ubT === 0) { + result = new Intersection('Coincident'); + } + else { + result = new Intersection('Parallel'); + } + } + return result; + }; + + /** + * Checks if line intersects polygon + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {Array} points + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLinePolygon = function(a1,a2,points){ + var result = new Intersection(), + length = points.length; + + for (var i = 0; i < length; i++) { + var b1 = points[i], + b2 = points[(i + 1) % length], + inter = Intersection.intersectLineLine(a1, a2, b1, b2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects another polygon + * @static + * @param {Array} points1 + * @param {Array} points2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonPolygon = function (points1, points2) { + var result = new Intersection(), + length = points1.length; + + for (var i = 0; i < length; i++) { + var a1 = points1[i], + a2 = points1[(i + 1) % length], + inter = Intersection.intersectLinePolygon(a1, a2, points2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects rectangle + * @static + * @param {Array} points + * @param {Number} r1 + * @param {Number} r2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonRectangle = function (points, r1, r2) { + var min = r1.min(r2), + max = r1.max(r2), + topRight = new fabric.Point(max.x, min.y), + bottomLeft = new fabric.Point(min.x, max.y), + inter1 = Intersection.intersectLinePolygon(min, topRight, points), + inter2 = Intersection.intersectLinePolygon(topRight, max, points), + inter3 = Intersection.intersectLinePolygon(max, bottomLeft, points), + inter4 = Intersection.intersectLinePolygon(bottomLeft, min, points), + result = new Intersection(); + + result.appendPoints(inter1.points); + result.appendPoints(inter2.points); + result.appendPoints(inter3.points); + result.appendPoints(inter4.points); + + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Color) { + fabric.warn('fabric.Color is already defined.'); + return; + } + + /** + * Color class + * The purpose of {@link fabric.Color} is to abstract and encapsulate common color operations; + * {@link fabric.Color} is a constructor and creates instances of {@link fabric.Color} objects. + * + * @class fabric.Color + * @param {String} color optional in hex or rgb(a) format + * @return {fabric.Color} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#colors} + */ + function Color(color) { + if (!color) { + this.setSource([0, 0, 0, 1]); + } + else { + this._tryParsingColor(color); + } + } + + fabric.Color = Color; + + fabric.Color.prototype = /** @lends fabric.Color.prototype */ { + + /** + * @private + * @param {String|Array} color Color value to parse + */ + _tryParsingColor: function(color) { + var source; + + if (color in Color.colorNameMap) { + color = Color.colorNameMap[color]; + } + + if (color === 'transparent') { + this.setSource([255,255,255,0]); + return; + } + + source = Color.sourceFromHex(color); + + if (!source) { + source = Color.sourceFromRgb(color); + } + if (!source) { + source = Color.sourceFromHsl(color); + } + if (source) { + this.setSource(source); + } + }, + + /** + * Adapted from https://github.com/mjijackson + * @private + * @param {Number} r Red color value + * @param {Number} g Green color value + * @param {Number} b Blue color value + * @return {Array} Hsl color + */ + _rgbToHsl: function(r, g, b) { + r /= 255, g /= 255, b /= 255; + + var h, s, l, + max = fabric.util.array.max([r, g, b]), + min = fabric.util.array.min([r, g, b]); + + l = (max + min) / 2; + + if (max === min) { + h = s = 0; // achromatic + } + else { + var d = max - min; + s = l > 0.5 ? d / (2 - max - min) : d / (max + min); + switch (max) { + case r: + h = (g - b) / d + (g < b ? 6 : 0); + break; + case g: + h = (b - r) / d + 2; + break; + case b: + h = (r - g) / d + 4; + break; + } + h /= 6; + } + + return [ + Math.round(h * 360), + Math.round(s * 100), + Math.round(l * 100) + ]; + }, + + /** + * Returns source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @return {Array} + */ + getSource: function() { + return this._source; + }, + + /** + * Sets source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @param {Array} source + */ + setSource: function(source) { + this._source = source; + }, + + /** + * Returns color represenation in RGB format + * @return {String} ex: rgb(0-255,0-255,0-255) + */ + toRgb: function() { + var source = this.getSource(); + return 'rgb(' + source[0] + ',' + source[1] + ',' + source[2] + ')'; + }, + + /** + * Returns color represenation in RGBA format + * @return {String} ex: rgba(0-255,0-255,0-255,0-1) + */ + toRgba: function() { + var source = this.getSource(); + return 'rgba(' + source[0] + ',' + source[1] + ',' + source[2] + ',' + source[3] + ')'; + }, + + /** + * Returns color represenation in HSL format + * @return {String} ex: hsl(0-360,0%-100%,0%-100%) + */ + toHsl: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsl(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%)'; + }, + + /** + * Returns color represenation in HSLA format + * @return {String} ex: hsla(0-360,0%-100%,0%-100%,0-1) + */ + toHsla: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsla(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%,' + source[3] + ')'; + }, + + /** + * Returns color represenation in HEX format + * @return {String} ex: FF5555 + */ + toHex: function() { + var source = this.getSource(), r, g, b; + + r = source[0].toString(16); + r = (r.length === 1) ? ('0' + r) : r; + + g = source[1].toString(16); + g = (g.length === 1) ? ('0' + g) : g; + + b = source[2].toString(16); + b = (b.length === 1) ? ('0' + b) : b; + + return r.toUpperCase() + g.toUpperCase() + b.toUpperCase(); + }, + + /** + * Gets value of alpha channel for this color + * @return {Number} 0-1 + */ + getAlpha: function() { + return this.getSource()[3]; + }, + + /** + * Sets value of alpha channel for this color + * @param {Number} alpha Alpha value 0-1 + * @return {fabric.Color} thisArg + */ + setAlpha: function(alpha) { + var source = this.getSource(); + source[3] = alpha; + this.setSource(source); + return this; + }, + + /** + * Transforms color to its grayscale representation + * @return {fabric.Color} thisArg + */ + toGrayscale: function() { + var source = this.getSource(), + average = parseInt((source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), 10), + currentAlpha = source[3]; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Transforms color to its black and white representation + * @param {Number} threshold + * @return {fabric.Color} thisArg + */ + toBlackWhite: function(threshold) { + var source = this.getSource(), + average = (source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), + currentAlpha = source[3]; + + threshold = threshold || 127; + + average = (Number(average) < Number(threshold)) ? 0 : 255; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Overlays color with another color + * @param {String|fabric.Color} otherColor + * @return {fabric.Color} thisArg + */ + overlayWith: function(otherColor) { + if (!(otherColor instanceof Color)) { + otherColor = new Color(otherColor); + } + + var result = [], + alpha = this.getAlpha(), + otherAlpha = 0.5, + source = this.getSource(), + otherSource = otherColor.getSource(); + + for (var i = 0; i < 3; i++) { + result.push(Math.round((source[i] * (1 - otherAlpha)) + (otherSource[i] * otherAlpha))); + } + + result[3] = alpha; + this.setSource(result); + return this; + } + }; + + /** + * Regex matching color in RGB or RGBA formats (ex: rgb(0, 0, 0), rgba(255, 100, 10, 0.5), rgba( 255 , 100 , 10 , 0.5 ), rgb(1,1,1), rgba(100%, 60%, 10%, 0.5)) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reRGBa = /^rgba?\(\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + + /** + * Regex matching color in HSL or HSLA formats (ex: hsl(200, 80%, 10%), hsla(300, 50%, 80%, 0.5), hsla( 300 , 50% , 80% , 0.5 )) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHSLa = /^hsla?\(\s*(\d{1,3})\s*,\s*(\d{1,3}\%)\s*,\s*(\d{1,3}\%)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + + /** + * Regex matching color in HEX format (ex: #FF5555, 010155, aff) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHex = /^#?([0-9a-f]{6}|[0-9a-f]{3})$/i; + + /** + * Map of the 17 basic color names with HEX code + * @static + * @field + * @memberOf fabric.Color + * @see: http://www.w3.org/TR/CSS2/syndata.html#color-units + */ + fabric.Color.colorNameMap = { + aqua: '#00FFFF', + black: '#000000', + blue: '#0000FF', + fuchsia: '#FF00FF', + gray: '#808080', + green: '#008000', + lime: '#00FF00', + maroon: '#800000', + navy: '#000080', + olive: '#808000', + orange: '#FFA500', + purple: '#800080', + red: '#FF0000', + silver: '#C0C0C0', + teal: '#008080', + white: '#FFFFFF', + yellow: '#FFFF00' + }; + + /** + * @private + * @param {Number} p + * @param {Number} q + * @param {Number} t + * @return {Number} + */ + function hue2rgb(p, q, t){ + if (t < 0) { + t += 1; + } + if (t > 1) { + t -= 1; + } + if (t < 1/6) { + return p + (q - p) * 6 * t; + } + if (t < 1/2) { + return q; + } + if (t < 2/3) { + return p + (q - p) * (2/3 - t) * 6; + } + return p; + } + + /** + * Returns new color object, when given a color in RGB format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255) + * @return {fabric.Color} + */ + fabric.Color.fromRgb = function(color) { + return Color.fromSource(Color.sourceFromRgb(color)); + }; + + /** + * Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in RGB or RGBA format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255), rgb(0%-100%,0%-100%,0%-100%) + * @return {Array} source + */ + fabric.Color.sourceFromRgb = function(color) { + var match = color.match(Color.reRGBa); + if (match) { + var r = parseInt(match[1], 10) / (/%$/.test(match[1]) ? 100 : 1) * (/%$/.test(match[1]) ? 255 : 1), + g = parseInt(match[2], 10) / (/%$/.test(match[2]) ? 100 : 1) * (/%$/.test(match[2]) ? 255 : 1), + b = parseInt(match[3], 10) / (/%$/.test(match[3]) ? 100 : 1) * (/%$/.test(match[3]) ? 255 : 1); + + return [ + parseInt(r, 10), + parseInt(g, 10), + parseInt(b, 10), + match[4] ? parseFloat(match[4]) : 1 + ]; + } + }; + + /** + * Returns new color object, when given a color in RGBA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromRgba = Color.fromRgb; + + /** + * Returns new color object, when given a color in HSL format + * @param {String} color Color value ex: hsl(0-260,0%-100%,0%-100%) + * @memberOf fabric.Color + * @return {fabric.Color} + */ + fabric.Color.fromHsl = function(color) { + return Color.fromSource(Color.sourceFromHsl(color)); + }; + + /** + * Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in HSL or HSLA format. + * Adapted from https://github.com/mjijackson + * @memberOf fabric.Color + * @param {String} color Color value ex: hsl(0-360,0%-100%,0%-100%) or hsla(0-360,0%-100%,0%-100%, 0-1) + * @return {Array} source + * @see http://http://www.w3.org/TR/css3-color/#hsl-color + */ + fabric.Color.sourceFromHsl = function(color) { + var match = color.match(Color.reHSLa); + if (!match) { + return; + } + + var h = (((parseFloat(match[1]) % 360) + 360) % 360) / 360, + s = parseFloat(match[2]) / (/%$/.test(match[2]) ? 100 : 1), + l = parseFloat(match[3]) / (/%$/.test(match[3]) ? 100 : 1), + r, g, b; + + if (s === 0) { + r = g = b = l; + } + else { + var q = l <= 0.5 ? l * (s + 1) : l + s - l * s, + p = l * 2 - q; + + r = hue2rgb(p, q, h + 1/3); + g = hue2rgb(p, q, h); + b = hue2rgb(p, q, h - 1/3); + } + + return [ + Math.round(r * 255), + Math.round(g * 255), + Math.round(b * 255), + match[4] ? parseFloat(match[4]) : 1 + ]; + }; + + /** + * Returns new color object, when given a color in HSLA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromHsla = Color.fromHsl; + + /** + * Returns new color object, when given a color in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color Color value ex: FF5555 + * @return {fabric.Color} + */ + fabric.Color.fromHex = function(color) { + return Color.fromSource(Color.sourceFromHex(color)); + }; + + /** + * Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color ex: FF5555 + * @return {Array} source + */ + fabric.Color.sourceFromHex = function(color) { + if (color.match(Color.reHex)) { + var value = color.slice(color.indexOf('#') + 1), + isShortNotation = (value.length === 3), + r = isShortNotation ? (value.charAt(0) + value.charAt(0)) : value.substring(0, 2), + g = isShortNotation ? (value.charAt(1) + value.charAt(1)) : value.substring(2, 4), + b = isShortNotation ? (value.charAt(2) + value.charAt(2)) : value.substring(4, 6); + + return [ + parseInt(r, 16), + parseInt(g, 16), + parseInt(b, 16), + 1 + ]; + } + }; + + /** + * Returns new color object, when given color in array representation (ex: [200, 100, 100, 0.5]) + * @static + * @memberOf fabric.Color + * @param {Array} source + * @return {fabric.Color} + */ + fabric.Color.fromSource = function(source) { + var oColor = new Color(); + oColor.setSource(source); + return oColor; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + /* _FROM_SVG_START_ */ + function getColorStop(el) { + var style = el.getAttribute('style'), + offset = el.getAttribute('offset'), + color, colorAlpha, opacity; + + // convert percents to absolute values + offset = parseFloat(offset) / (/%$/.test(offset) ? 100 : 1); + offset = offset < 0 ? 0 : offset > 1 ? 1 : offset; + if (style) { + var keyValuePairs = style.split(/\s*;\s*/); + + if (keyValuePairs[keyValuePairs.length - 1] === '') { + keyValuePairs.pop(); + } + + for (var i = keyValuePairs.length; i--; ) { + + var split = keyValuePairs[i].split(/\s*:\s*/), + key = split[0].trim(), + value = split[1].trim(); + + if (key === 'stop-color') { + color = value; + } + else if (key === 'stop-opacity') { + opacity = value; + } + } + } + + if (!color) { + color = el.getAttribute('stop-color') || 'rgb(0,0,0)'; + } + if (!opacity) { + opacity = el.getAttribute('stop-opacity'); + } + + color = new fabric.Color(color); + colorAlpha = color.getAlpha(); + opacity = isNaN(parseFloat(opacity)) ? 1 : parseFloat(opacity); + opacity *= colorAlpha; + + return { + offset: offset, + color: color.toRgb(), + opacity: opacity + }; + } + + function getLinearCoords(el) { + return { + x1: el.getAttribute('x1') || 0, + y1: el.getAttribute('y1') || 0, + x2: el.getAttribute('x2') || '100%', + y2: el.getAttribute('y2') || 0 + }; + } + + function getRadialCoords(el) { + return { + x1: el.getAttribute('fx') || el.getAttribute('cx') || '50%', + y1: el.getAttribute('fy') || el.getAttribute('cy') || '50%', + r1: 0, + x2: el.getAttribute('cx') || '50%', + y2: el.getAttribute('cy') || '50%', + r2: el.getAttribute('r') || '50%' + }; + } + /* _FROM_SVG_END_ */ + + /** + * Gradient class + * @class fabric.Gradient + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#gradients} + * @see {@link fabric.Gradient#initialize} for constructor definition + */ + fabric.Gradient = fabric.util.createClass(/** @lends fabric.Gradient.prototype */ { + + /** + * Horizontal offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetX: 0, + + /** + * Vertical offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetY: 0, + + /** + * Constructor + * @param {Object} [options] Options object with type, coords, gradientUnits and colorStops + * @return {fabric.Gradient} thisArg + */ + initialize: function(options) { + options || (options = { }); + + var coords = { }; + + this.id = fabric.Object.__uid++; + this.type = options.type || 'linear'; + + coords = { + x1: options.coords.x1 || 0, + y1: options.coords.y1 || 0, + x2: options.coords.x2 || 0, + y2: options.coords.y2 || 0 + }; + + if (this.type === 'radial') { + coords.r1 = options.coords.r1 || 0; + coords.r2 = options.coords.r2 || 0; + } + this.coords = coords; + this.colorStops = options.colorStops.slice(); + if (options.gradientTransform) { + this.gradientTransform = options.gradientTransform; + } + this.offsetX = options.offsetX || this.offsetX; + this.offsetY = options.offsetY || this.offsetY; + }, + + /** + * Adds another colorStop + * @param {Object} colorStop Object with offset and color + * @return {fabric.Gradient} thisArg + */ + addColorStop: function(colorStop) { + for (var position in colorStop) { + var color = new fabric.Color(colorStop[position]); + this.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + return this; + }, + + /** + * Returns object representation of a gradient + * @return {Object} + */ + toObject: function() { + return { + type: this.type, + coords: this.coords, + colorStops: this.colorStops, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an gradient + * @param {Object} object Object to create a gradient for + * @param {Boolean} normalize Whether coords should be normalized + * @return {String} SVG representation of an gradient (linear/radial) + */ + toSVG: function(object) { + var coords = fabric.util.object.clone(this.coords), + markup, commonAttributes; + + // colorStops must be sorted ascending + this.colorStops.sort(function(a, b) { + return a.offset - b.offset; + }); + + if (!(object.group && object.group.type === 'path-group')) { + for (var prop in coords) { + if (prop === 'x1' || prop === 'x2' || prop === 'r2') { + coords[prop] += this.offsetX - object.width / 2; + } + else if (prop === 'y1' || prop === 'y2') { + coords[prop] += this.offsetY - object.height / 2; + } + } + } + + commonAttributes = 'id="SVGID_' + this.id + + '" gradientUnits="userSpaceOnUse"'; + if (this.gradientTransform) { + commonAttributes += ' gradientTransform="matrix(' + this.gradientTransform.join(' ') + ')" '; + } + if (this.type === 'linear') { + markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + } + else if (this.type === 'radial') { + markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + } + + for (var i = 0; i < this.colorStops.length; i++) { + markup.push( + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ); + } + + markup.push((this.type === 'linear' ? '\n' : '\n')); + + return markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns an instance of CanvasGradient + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {CanvasGradient} + */ + toLive: function(ctx) { + var gradient; + + if (!this.type) { + return; + } + + if (this.type === 'linear') { + gradient = ctx.createLinearGradient( + this.coords.x1, this.coords.y1, this.coords.x2, this.coords.y2); + } + else if (this.type === 'radial') { + gradient = ctx.createRadialGradient( + this.coords.x1, this.coords.y1, this.coords.r1, this.coords.x2, this.coords.y2, this.coords.r2); + } + + for (var i = 0, len = this.colorStops.length; i < len; i++) { + var color = this.colorStops[i].color, + opacity = this.colorStops[i].opacity, + offset = this.colorStops[i].offset; + + if (typeof opacity !== 'undefined') { + color = new fabric.Color(color).setAlpha(opacity).toRgba(); + } + gradient.addColorStop(parseFloat(offset), color); + } + + return gradient; + } + }); + + fabric.util.object.extend(fabric.Gradient, { + + /* _FROM_SVG_START_ */ + /** + * Returns {@link fabric.Gradient} instance from an SVG element + * @static + * @memberof fabric.Gradient + * @param {SVGGradientElement} el SVG gradient element + * @param {fabric.Object} instance + * @return {fabric.Gradient} Gradient instance + * @see http://www.w3.org/TR/SVG/pservers.html#LinearGradientElement + * @see http://www.w3.org/TR/SVG/pservers.html#RadialGradientElement + */ + fromElement: function(el, instance) { + + /** + * @example: + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + */ + + var colorStopEls = el.getElementsByTagName('stop'), + type = (el.nodeName === 'linearGradient' ? 'linear' : 'radial'), + gradientUnits = el.getAttribute('gradientUnits') || 'objectBoundingBox', + gradientTransform = el.getAttribute('gradientTransform'), + colorStops = [], + coords = { }, ellipseMatrix; + + if (type === 'linear') { + coords = getLinearCoords(el); + } + else if (type === 'radial') { + coords = getRadialCoords(el); + } + + for (var i = colorStopEls.length; i--; ) { + colorStops.push(getColorStop(colorStopEls[i])); + } + + ellipseMatrix = _convertPercentUnitsToValues(instance, coords, gradientUnits); + + var gradient = new fabric.Gradient({ + type: type, + coords: coords, + colorStops: colorStops, + offsetX: -instance.left, + offsetY: -instance.top + }); + + if (gradientTransform || ellipseMatrix !== '') { + gradient.gradientTransform = fabric.parseTransformAttribute((gradientTransform || '') + ellipseMatrix); + } + return gradient; + }, + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Gradient} instance from its object representation + * @static + * @memberof fabric.Gradient + * @param {Object} obj + * @param {Object} [options] Options object + */ + forObject: function(obj, options) { + options || (options = { }); + _convertPercentUnitsToValues(obj, options.coords, 'userSpaceOnUse'); + return new fabric.Gradient(options); + } + }); + + /** + * @private + */ + function _convertPercentUnitsToValues(object, options, gradientUnits) { + var propValue, addFactor = 0, multFactor = 1, ellipseMatrix = ''; + for (var prop in options) { + propValue = parseFloat(options[prop], 10); + if (typeof options[prop] === 'string' && /^\d+%$/.test(options[prop])) { + multFactor = 0.01; + } + else { + multFactor = 1; + } + if (prop === 'x1' || prop === 'x2' || prop === 'r2') { + multFactor *= gradientUnits === 'objectBoundingBox' ? object.width : 1; + addFactor = gradientUnits === 'objectBoundingBox' ? object.left || 0 : 0; + } + else if (prop === 'y1' || prop === 'y2') { + multFactor *= gradientUnits === 'objectBoundingBox' ? object.height : 1; + addFactor = gradientUnits === 'objectBoundingBox' ? object.top || 0 : 0; + } + options[prop] = propValue * multFactor + addFactor; + } + if (object.type === 'ellipse' && options.r2 !== null && gradientUnits === 'objectBoundingBox' && object.rx !== object.ry) { + var scaleFactor = object.ry/object.rx; + ellipseMatrix = ' scale(1, ' + scaleFactor + ')'; + if (options.y1) { + options.y1 /= scaleFactor; + } + if (options.y2) { + options.y2 /= scaleFactor; + } + } + return ellipseMatrix; + } +})(); + + +/** + * Pattern class + * @class fabric.Pattern + * @see {@link http://fabricjs.com/patterns/|Pattern demo} + * @see {@link http://fabricjs.com/dynamic-patterns/|DynamicPattern demo} + * @see {@link fabric.Pattern#initialize} for constructor definition + */ +fabric.Pattern = fabric.util.createClass(/** @lends fabric.Pattern.prototype */ { + + /** + * Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @type String + * @default + */ + repeat: 'repeat', + + /** + * Pattern horizontal offset from object's left/top corner + * @type Number + * @default + */ + offsetX: 0, + + /** + * Pattern vertical offset from object's left/top corner + * @type Number + * @default + */ + offsetY: 0, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Pattern} thisArg + */ + initialize: function(options) { + options || (options = { }); + + this.id = fabric.Object.__uid++; + + if (options.source) { + if (typeof options.source === 'string') { + // function string + if (typeof fabric.util.getFunctionBody(options.source) !== 'undefined') { + this.source = new Function(fabric.util.getFunctionBody(options.source)); + } + else { + // img src string + var _this = this; + this.source = fabric.util.createImage(); + fabric.util.loadImage(options.source, function(img) { + _this.source = img; + }); + } + } + else { + // img element + this.source = options.source; + } + } + if (options.repeat) { + this.repeat = options.repeat; + } + if (options.offsetX) { + this.offsetX = options.offsetX; + } + if (options.offsetY) { + this.offsetY = options.offsetY; + } + }, + + /** + * Returns object representation of a pattern + * @return {Object} Object representation of a pattern instance + */ + toObject: function() { + + var source; + + // callback + if (typeof this.source === 'function') { + source = String(this.source); + } + // element + else if (typeof this.source.src === 'string') { + source = this.source.src; + } + + return { + source: source, + repeat: this.repeat, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a pattern + * @param {fabric.Object} object + * @return {String} SVG representation of a pattern + */ + toSVG: function(object) { + var patternSource = typeof this.source === 'function' ? this.source() : this.source, + patternWidth = patternSource.width / object.getWidth(), + patternHeight = patternSource.height / object.getHeight(), + patternImgSrc = ''; + + if (patternSource.src) { + patternImgSrc = patternSource.src; + } + else if (patternSource.toDataURL) { + patternImgSrc = patternSource.toDataURL(); + } + + return '' + + '' + + ''; + }, + /* _TO_SVG_END_ */ + + /** + * Returns an instance of CanvasPattern + * @param {CanvasRenderingContext2D} ctx Context to create pattern + * @return {CanvasPattern} + */ + toLive: function(ctx) { + var source = typeof this.source === 'function' + ? this.source() + : this.source; + + // if the image failed to load, return, and allow rest to continue loading + if (!source) { + return ''; + } + + // if an image + if (typeof source.src !== 'undefined') { + if (!source.complete) { + return ''; + } + if (source.naturalWidth === 0 || source.naturalHeight === 0) { + return ''; + } + } + return ctx.createPattern(source, this.repeat); + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Shadow) { + fabric.warn('fabric.Shadow is already defined.'); + return; + } + + /** + * Shadow class + * @class fabric.Shadow + * @see {@link http://fabricjs.com/shadows/|Shadow demo} + * @see {@link fabric.Shadow#initialize} for constructor definition + */ + fabric.Shadow = fabric.util.createClass(/** @lends fabric.Shadow.prototype */ { + + /** + * Shadow color + * @type String + * @default + */ + color: 'rgb(0,0,0)', + + /** + * Shadow blur + * @type Number + */ + blur: 0, + + /** + * Shadow horizontal offset + * @type Number + * @default + */ + offsetX: 0, + + /** + * Shadow vertical offset + * @type Number + * @default + */ + offsetY: 0, + + /** + * Whether the shadow should affect stroke operations + * @type Boolean + * @default + */ + affectStroke: false, + + /** + * Indicates whether toObject should include default values + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Constructor + * @param {Object|String} [options] Options object with any of color, blur, offsetX, offsetX properties or string (e.g. "rgba(0,0,0,0.2) 2px 2px 10px, "2px 2px 10px rgba(0,0,0,0.2)") + * @return {fabric.Shadow} thisArg + */ + initialize: function(options) { + + if (typeof options === 'string') { + options = this._parseShadow(options); + } + + for (var prop in options) { + this[prop] = options[prop]; + } + + this.id = fabric.Object.__uid++; + }, + + /** + * @private + * @param {String} shadow Shadow value to parse + * @return {Object} Shadow object with color, offsetX, offsetY and blur + */ + _parseShadow: function(shadow) { + var shadowStr = shadow.trim(), + offsetsAndBlur = fabric.Shadow.reOffsetsAndBlur.exec(shadowStr) || [ ], + color = shadowStr.replace(fabric.Shadow.reOffsetsAndBlur, '') || 'rgb(0,0,0)'; + + return { + color: color.trim(), + offsetX: parseInt(offsetsAndBlur[1], 10) || 0, + offsetY: parseInt(offsetsAndBlur[2], 10) || 0, + blur: parseInt(offsetsAndBlur[3], 10) || 0 + }; + }, + + /** + * Returns a string representation of an instance + * @see http://www.w3.org/TR/css-text-decor-3/#text-shadow + * @return {String} Returns CSS3 text-shadow declaration + */ + toString: function() { + return [this.offsetX, this.offsetY, this.blur, this.color].join('px '); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a shadow + * @param {fabric.Object} object + * @return {String} SVG representation of a shadow + */ + toSVG: function(object) { + var mode = 'SourceAlpha'; + + if (object && (object.fill === this.color || object.stroke === this.color)) { + mode = 'SourceGraphic'; + } + + return ( + '' + + '' + + '' + + '' + + '' + + '' + + '' + + ''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns object representation of a shadow + * @return {Object} Object representation of a shadow instance + */ + toObject: function() { + if (this.includeDefaultValues) { + return { + color: this.color, + blur: this.blur, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + } + var obj = { }, proto = fabric.Shadow.prototype; + if (this.color !== proto.color) { + obj.color = this.color; + } + if (this.blur !== proto.blur) { + obj.blur = this.blur; + } + if (this.offsetX !== proto.offsetX) { + obj.offsetX = this.offsetX; + } + if (this.offsetY !== proto.offsetY) { + obj.offsetY = this.offsetY; + } + return obj; + } + }); + + /** + * Regex matching shadow offsetX, offsetY and blur (ex: "2px 2px 10px rgba(0,0,0,0.2)", "rgb(0,255,0) 2px 2px") + * @static + * @field + * @memberOf fabric.Shadow + */ + fabric.Shadow.reOffsetsAndBlur = /(?:\s|^)(-?\d+(?:px)?(?:\s?|$))?(-?\d+(?:px)?(?:\s?|$))?(\d+(?:px)?)?(?:\s?|$)(?:$|\s)/; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function () { + + 'use strict'; + + if (fabric.StaticCanvas) { + fabric.warn('fabric.StaticCanvas is already defined.'); + return; + } + + // aliases for faster resolution + var extend = fabric.util.object.extend, + getElementOffset = fabric.util.getElementOffset, + removeFromArray = fabric.util.removeFromArray, + + CANVAS_INIT_ERROR = new Error('Could not initialize `canvas` element'); + + /** + * Static canvas class + * @class fabric.StaticCanvas + * @mixes fabric.Collection + * @mixes fabric.Observable + * @see {@link http://fabricjs.com/static_canvas/|StaticCanvas demo} + * @see {@link fabric.StaticCanvas#initialize} for constructor definition + * @fires before:render + * @fires after:render + * @fires canvas:cleared + * @fires object:added + * @fires object:removed + */ + fabric.StaticCanvas = fabric.util.createClass(/** @lends fabric.StaticCanvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + + this._initStatic(el, options); + fabric.StaticCanvas.activeInstance = this; + }, + + /** + * Background color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundColor}. + * @type {(String|fabric.Pattern)} + * @default + */ + backgroundColor: '', + + /** + * Background image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundImage}. + * Backwards incompatibility note: The "backgroundImageOpacity" + * and "backgroundImageStretch" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#opacity}, {@link fabric.Image#width} and {@link fabric.Image#height}. + * @type fabric.Image + * @default + */ + backgroundImage: null, + + /** + * Overlay color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayColor} + * @since 1.3.9 + * @type {(String|fabric.Pattern)} + * @default + */ + overlayColor: '', + + /** + * Overlay image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayImage}. + * Backwards incompatibility note: The "overlayImageLeft" + * and "overlayImageTop" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#left} and {@link fabric.Image#top}. + * @type fabric.Image + * @default + */ + overlayImage: null, + + /** + * Indicates whether toObject/toDatalessObject should include default values + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Indicates whether objects' state should be saved + * @type Boolean + * @default + */ + stateful: true, + + /** + * Indicates whether {@link fabric.Collection.add}, {@link fabric.Collection.insertAt} and {@link fabric.Collection.remove} should also re-render canvas. + * Disabling this option could give a great performance boost when adding/removing a lot of objects to/from canvas at once + * (followed by a manual rendering after addition/deletion) + * @type Boolean + * @default + */ + renderOnAddRemove: true, + + /** + * Function that determines clipping of entire canvas area + * Being passed context as first argument. See clipping canvas area in {@link https://github.com/kangax/fabric.js/wiki/FAQ} + * @type Function + * @default + */ + clipTo: null, + + /** + * Indicates whether object controls (borders/controls) are rendered above overlay image + * @type Boolean + * @default + */ + controlsAboveOverlay: false, + + /** + * Indicates whether the browser can be scrolled when using a touchscreen and dragging on the canvas + * @type Boolean + * @default + */ + allowTouchScrolling: false, + + /** + * Indicates whether this canvas will use image smoothing, this is on by default in browsers + * @type Boolean + * @default + */ + imageSmoothingEnabled: true, + + /** + * The transformation (in the format of Canvas transform) which focuses the viewport + * @type Array + * @default + */ + viewportTransform: [1, 0, 0, 1, 0, 0], + + /** + * Callback; invoked right before object is about to be scaled/rotated + */ + onBeforeScaleRotate: function () { + /* NOOP */ + }, + + /** + * @private + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + */ + _initStatic: function(el, options) { + this._objects = []; + + this._createLowerCanvas(el); + this._initOptions(options); + this._setImageSmoothing(); + + if (options.overlayImage) { + this.setOverlayImage(options.overlayImage, this.renderAll.bind(this)); + } + if (options.backgroundImage) { + this.setBackgroundImage(options.backgroundImage, this.renderAll.bind(this)); + } + if (options.backgroundColor) { + this.setBackgroundColor(options.backgroundColor, this.renderAll.bind(this)); + } + if (options.overlayColor) { + this.setOverlayColor(options.overlayColor, this.renderAll.bind(this)); + } + this.calcOffset(); + }, + + /** + * Calculates canvas element offset relative to the document + * This method is also attached as "resize" event handler of window + * @return {fabric.Canvas} instance + * @chainable + */ + calcOffset: function () { + this._offset = getElementOffset(this.lowerCanvasEl); + return this; + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayImage|overlay image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set overlay to + * @param {Function} callback callback to invoke when image is loaded and set as an overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|overlay image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/MnzHT/|jsFiddle demo} + * @example Normal overlayImage with left/top = 0 + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example overlayImage with different properties + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched overlayImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/jail_cell_bars.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setOverlayImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched overlayImage #2 - width/height correspond to canvas width/height + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + */ + setOverlayImage: function (image, callback, options) { + return this.__setBgOverlayImage('overlayImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundImage|background image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set background to + * @param {Function} callback Callback to invoke when image is loaded and set as background + * @param {Object} [options] Optional options to set for the {@link fabric.Image|background image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/YH9yD/|jsFiddle demo} + * @example Normal backgroundImage with left/top = 0 + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example backgroundImage with different properties + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched backgroundImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/honey_im_subtle.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setBackgroundImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched backgroundImage #2 - width/height correspond to canvas width/height + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + */ + setBackgroundImage: function (image, callback, options) { + return this.__setBgOverlayImage('backgroundImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayColor|background color} for this canvas + * @param {(String|fabric.Pattern)} overlayColor Color or pattern to set background color to + * @param {Function} callback Callback to invoke when background color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/pB55h/|jsFiddle demo} + * @example Normal overlayColor - color value + * canvas.setOverlayColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor with repeat and offset + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setOverlayColor: function(overlayColor, callback) { + return this.__setBgOverlayColor('overlayColor', overlayColor, callback); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundColor|background color} for this canvas + * @param {(String|fabric.Pattern)} backgroundColor Color or pattern to set background color to + * @param {Function} callback Callback to invoke when background color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/hXzvk/|jsFiddle demo} + * @example Normal backgroundColor - color value + * canvas.setBackgroundColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor with repeat and offset + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setBackgroundColor: function(backgroundColor, callback) { + return this.__setBgOverlayColor('backgroundColor', backgroundColor, callback); + }, + + /** + * @private + * @see {@link http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-imagesmoothingenabled|WhatWG Canvas Standard} + */ + _setImageSmoothing: function(){ + var ctx = this.getContext(); + + ctx.imageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.webkitImageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.mozImageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.msImageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.oImageSmoothingEnabled = this.imageSmoothingEnabled; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundImage|backgroundImage} + * or {@link fabric.StaticCanvas#overlayImage|overlayImage}) + * @param {(fabric.Image|String|null)} image fabric.Image instance, URL of an image or null to set background or overlay to + * @param {Function} callback Callback to invoke when image is loaded and set as background or overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|image}. + */ + __setBgOverlayImage: function(property, image, callback, options) { + if (typeof image === 'string') { + fabric.util.loadImage(image, function(img) { + this[property] = new fabric.Image(img, options); + callback && callback(); + }, this); + } + else { + this[property] = image; + callback && callback(); + } + + return this; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundColor|backgroundColor} + * or {@link fabric.StaticCanvas#overlayColor|overlayColor}) + * @param {(Object|String|null)} color Object with pattern information, color value or null + * @param {Function} [callback] Callback is invoked when color is set + */ + __setBgOverlayColor: function(property, color, callback) { + if (color && color.source) { + var _this = this; + fabric.util.loadImage(color.source, function(img) { + _this[property] = new fabric.Pattern({ + source: img, + repeat: color.repeat, + offsetX: color.offsetX, + offsetY: color.offsetY + }); + callback && callback(); + }); + } + else { + this[property] = color; + callback && callback(); + } + + return this; + }, + + /** + * @private + */ + _createCanvasElement: function() { + var element = fabric.document.createElement('canvas'); + if (!element.style) { + element.style = { }; + } + if (!element) { + throw CANVAS_INIT_ERROR; + } + this._initCanvasElement(element); + return element; + }, + + /** + * @private + * @param {HTMLElement} element + */ + _initCanvasElement: function(element) { + fabric.util.createCanvasElement(element); + + if (typeof element.getContext === 'undefined') { + throw CANVAS_INIT_ERROR; + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initOptions: function (options) { + for (var prop in options) { + this[prop] = options[prop]; + } + + this.width = this.width || parseInt(this.lowerCanvasEl.width, 10) || 0; + this.height = this.height || parseInt(this.lowerCanvasEl.height, 10) || 0; + + if (!this.lowerCanvasEl.style) { + return; + } + + this.lowerCanvasEl.width = this.width; + this.lowerCanvasEl.height = this.height; + + this.lowerCanvasEl.style.width = this.width + 'px'; + this.lowerCanvasEl.style.height = this.height + 'px'; + + this.viewportTransform = this.viewportTransform.slice(); + }, + + /** + * Creates a bottom canvas + * @private + * @param {HTMLElement} [canvasEl] + */ + _createLowerCanvas: function (canvasEl) { + this.lowerCanvasEl = fabric.util.getById(canvasEl) || this._createCanvasElement(); + this._initCanvasElement(this.lowerCanvasEl); + + fabric.util.addClass(this.lowerCanvasEl, 'lower-canvas'); + + if (this.interactive) { + this._applyCanvasStyle(this.lowerCanvasEl); + } + + this.contextContainer = this.lowerCanvasEl.getContext('2d'); + }, + + /** + * Returns canvas width (in px) + * @return {Number} + */ + getWidth: function () { + return this.width; + }, + + /** + * Returns canvas height (in px) + * @return {Number} + */ + getHeight: function () { + return this.height; + }, + + /** + * Sets width of this canvas instance + * @param {Number|String} value Value to set width to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setWidth: function (value, options) { + return this.setDimensions({ width: value }, options); + }, + + /** + * Sets height of this canvas instance + * @param {Number|String} value Value to set height to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setHeight: function (value, options) { + return this.setDimensions({ height: value }, options); + }, + + /** + * Sets dimensions (width, height) of this canvas instance. when options.cssOnly flag active you should also supply the unit of measure (px/%/em) + * @param {Object} dimensions Object with width/height properties + * @param {Number|String} [dimensions.width] Width of canvas element + * @param {Number|String} [dimensions.height] Height of canvas element + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} thisArg + * @chainable + */ + setDimensions: function (dimensions, options) { + var cssValue; + + options = options || {}; + + for (var prop in dimensions) { + cssValue = dimensions[prop]; + + if (!options.cssOnly) { + this._setBackstoreDimension(prop, dimensions[prop]); + cssValue += 'px'; + } + + if (!options.backstoreOnly) { + this._setCssDimension(prop, cssValue); + } + } + + if (!options.cssOnly) { + this.renderAll(); + } + + this.calcOffset(); + + return this; + }, + + /** + * Helper for setting width/height + * @private + * @param {String} prop property (width|height) + * @param {Number} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setBackstoreDimension: function (prop, value) { + this.lowerCanvasEl[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl[prop] = value; + } + + if (this.cacheCanvasEl) { + this.cacheCanvasEl[prop] = value; + } + + this[prop] = value; + + return this; + }, + + /** + * Helper for setting css width/height + * @private + * @param {String} prop property (width|height) + * @param {String} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setCssDimension: function (prop, value) { + this.lowerCanvasEl.style[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl.style[prop] = value; + } + + if (this.wrapperEl) { + this.wrapperEl.style[prop] = value; + } + + return this; + }, + + /** + * Returns canvas zoom level + * @return {Number} + */ + getZoom: function () { + return Math.sqrt(this.viewportTransform[0] * this.viewportTransform[3]); + }, + + /** + * Sets viewport transform of this canvas instance + * @param {Array} vpt the transform in the form of context.transform + * @return {fabric.Canvas} instance + * @chainable true + */ + setViewportTransform: function (vpt) { + this.viewportTransform = vpt; + this.renderAll(); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].setCoords(); + } + return this; + }, + + /** + * Sets zoom level of this canvas instance, zoom centered around point + * @param {fabric.Point} point to zoom with respect to + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + zoomToPoint: function (point, value) { + // TODO: just change the scale, preserve other transformations + var before = point; + point = fabric.util.transformPoint(point, fabric.util.invertTransform(this.viewportTransform)); + this.viewportTransform[0] = value; + this.viewportTransform[3] = value; + var after = fabric.util.transformPoint(point, this.viewportTransform); + this.viewportTransform[4] += before.x - after.x; + this.viewportTransform[5] += before.y - after.y; + this.renderAll(); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].setCoords(); + } + return this; + }, + + /** + * Sets zoom level of this canvas instance + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + setZoom: function (value) { + this.zoomToPoint(new fabric.Point(0, 0), value); + return this; + }, + + /** + * Pan viewport so as to place point at top left corner of canvas + * @param {fabric.Point} point to move to + * @return {fabric.Canvas} instance + * @chainable true + */ + absolutePan: function (point) { + this.viewportTransform[4] = -point.x; + this.viewportTransform[5] = -point.y; + this.renderAll(); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].setCoords(); + } + return this; + }, + + /** + * Pans viewpoint relatively + * @param {fabric.Point} point (position vector) to move by + * @return {fabric.Canvas} instance + * @chainable true + */ + relativePan: function (point) { + return this.absolutePan(new fabric.Point( + -point.x - this.viewportTransform[4], + -point.y - this.viewportTransform[5] + )); + }, + + /** + * Returns <canvas> element corresponding to this instance + * @return {HTMLCanvasElement} + */ + getElement: function () { + return this.lowerCanvasEl; + }, + + /** + * Returns currently selected object, if any + * @return {fabric.Object} + */ + getActiveObject: function() { + return null; + }, + + /** + * Returns currently selected group of object, if any + * @return {fabric.Group} + */ + getActiveGroup: function() { + return null; + }, + + /** + * Given a context, renders an object on that context + * @param {CanvasRenderingContext2D} ctx Context to render object on + * @param {fabric.Object} object Object to render + * @private + */ + _draw: function (ctx, object) { + if (!object) { + return; + } + + ctx.save(); + var v = this.viewportTransform; + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + object.render(ctx); + ctx.restore(); + if (!this.controlsAboveOverlay) { + object._renderControls(ctx); + } + }, + + /** + * @private + * @param {fabric.Object} obj Object that was added + */ + _onObjectAdded: function(obj) { + this.stateful && obj.setupState(); + obj.canvas = this; + obj.setCoords(); + this.fire('object:added', { target: obj }); + obj.fire('added'); + }, + + /** + * @private + * @param {fabric.Object} obj Object that was removed + */ + _onObjectRemoved: function(obj) { + // removing active object should fire "selection:cleared" events + if (this.getActiveObject() === obj) { + this.fire('before:selection:cleared', { target: obj }); + this._discardActiveObject(); + this.fire('selection:cleared'); + } + + this.fire('object:removed', { target: obj }); + obj.fire('removed'); + }, + + /** + * Clears specified context of canvas element + * @param {CanvasRenderingContext2D} ctx Context to clear + * @return {fabric.Canvas} thisArg + * @chainable + */ + clearContext: function(ctx) { + ctx.clearRect(0, 0, this.width, this.height); + return this; + }, + + /** + * Returns context of canvas where objects are drawn + * @return {CanvasRenderingContext2D} + */ + getContext: function () { + return this.contextContainer; + }, + + /** + * Clears all contexts (background, main, top) of an instance + * @return {fabric.Canvas} thisArg + * @chainable + */ + clear: function () { + this._objects.length = 0; + if (this.discardActiveGroup) { + this.discardActiveGroup(); + } + if (this.discardActiveObject) { + this.discardActiveObject(); + } + this.clearContext(this.contextContainer); + if (this.contextTop) { + this.clearContext(this.contextTop); + } + this.fire('canvas:cleared'); + this.renderAll(); + return this; + }, + + /** + * Renders both the top canvas and the secondary container canvas. + * @param {Boolean} [allOnTop] Whether we want to force all images to be rendered on the top canvas + * @return {fabric.Canvas} instance + * @chainable + */ + renderAll: function (allOnTop) { + var canvasToDrawOn = this[(allOnTop === true && this.interactive) ? 'contextTop' : 'contextContainer'], + activeGroup = this.getActiveGroup(); + + if (this.contextTop && this.selection && !this._groupSelector) { + this.clearContext(this.contextTop); + } + + if (!allOnTop) { + this.clearContext(canvasToDrawOn); + } + + this.fire('before:render'); + + if (this.clipTo) { + fabric.util.clipContext(this, canvasToDrawOn); + } + + this._renderBackground(canvasToDrawOn); + this._renderObjects(canvasToDrawOn, activeGroup); + this._renderActiveGroup(canvasToDrawOn, activeGroup); + + if (this.clipTo) { + canvasToDrawOn.restore(); + } + + this._renderOverlay(canvasToDrawOn); + + if (this.controlsAboveOverlay && this.interactive) { + this.drawControls(canvasToDrawOn); + } + + this.fire('after:render'); + + return this; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {fabric.Group} activeGroup + */ + _renderObjects: function(ctx, activeGroup) { + var i, length; + + // fast path + if (!activeGroup) { + for (i = 0, length = this._objects.length; i < length; ++i) { + this._draw(ctx, this._objects[i]); + } + } + else { + for (i = 0, length = this._objects.length; i < length; ++i) { + if (this._objects[i] && !activeGroup.contains(this._objects[i])) { + this._draw(ctx, this._objects[i]); + } + } + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {fabric.Group} activeGroup + */ + _renderActiveGroup: function(ctx, activeGroup) { + + // delegate rendering to group selection (if one exists) + if (activeGroup) { + + //Store objects in group preserving order, then replace + var sortedObjects = []; + this.forEachObject(function (object) { + if (activeGroup.contains(object)) { + sortedObjects.push(object); + } + }); + activeGroup._set('objects', sortedObjects); + this._draw(ctx, activeGroup); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderBackground: function(ctx) { + if (this.backgroundColor) { + ctx.fillStyle = this.backgroundColor.toLive + ? this.backgroundColor.toLive(ctx) + : this.backgroundColor; + + ctx.fillRect( + this.backgroundColor.offsetX || 0, + this.backgroundColor.offsetY || 0, + this.width, + this.height); + } + if (this.backgroundImage) { + this._draw(ctx, this.backgroundImage); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderOverlay: function(ctx) { + if (this.overlayColor) { + ctx.fillStyle = this.overlayColor.toLive + ? this.overlayColor.toLive(ctx) + : this.overlayColor; + + ctx.fillRect( + this.overlayColor.offsetX || 0, + this.overlayColor.offsetY || 0, + this.width, + this.height); + } + if (this.overlayImage) { + this._draw(ctx, this.overlayImage); + } + }, + + /** + * Method to render only the top canvas. + * Also used to render the group selection box. + * @return {fabric.Canvas} thisArg + * @chainable + */ + renderTop: function () { + var ctx = this.contextTop || this.contextContainer; + this.clearContext(ctx); + + // we render the top context - last object + if (this.selection && this._groupSelector) { + this._drawSelection(); + } + + // delegate rendering to group selection if one exists + // used for drawing selection borders/controls + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + activeGroup.render(ctx); + } + + this._renderOverlay(ctx); + + this.fire('after:render'); + + return this; + }, + + /** + * Returns coordinates of a center of canvas. + * Returned value is an object with top and left properties + * @return {Object} object with "top" and "left" number values + */ + getCenter: function () { + return { + top: this.getHeight() / 2, + left: this.getWidth() / 2 + }; + }, + + /** + * Centers object horizontally. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center horizontally + * @return {fabric.Canvas} thisArg + */ + centerObjectH: function (object) { + this._centerObject(object, new fabric.Point(this.getCenter().left, object.getCenterPoint().y)); + this.renderAll(); + return this; + }, + + /** + * Centers object vertically. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObjectV: function (object) { + this._centerObject(object, new fabric.Point(object.getCenterPoint().x, this.getCenter().top)); + this.renderAll(); + return this; + }, + + /** + * Centers object vertically and horizontally. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObject: function(object) { + var center = this.getCenter(); + + this._centerObject(object, new fabric.Point(center.left, center.top)); + this.renderAll(); + return this; + }, + + /** + * @private + * @param {fabric.Object} object Object to center + * @param {fabric.Point} center Center point + * @return {fabric.Canvas} thisArg + * @chainable + */ + _centerObject: function(object, center) { + object.setPositionByOrigin(center, 'center', 'center'); + return this; + }, + + /** + * Returs dataless JSON representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} json string + */ + toDatalessJSON: function (propertiesToInclude) { + return this.toDatalessObject(propertiesToInclude); + }, + + /** + * Returns object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function (propertiesToInclude) { + return this._toObjectMethod('toObject', propertiesToInclude); + }, + + /** + * Returns dataless object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function (propertiesToInclude) { + return this._toObjectMethod('toDatalessObject', propertiesToInclude); + }, + + /** + * @private + */ + _toObjectMethod: function (methodName, propertiesToInclude) { + + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + this.discardActiveGroup(); + } + + var data = { + objects: this._toObjects(methodName, propertiesToInclude) + }; + + extend(data, this.__serializeBgOverlay()); + + fabric.util.populateWithProperties(this, data, propertiesToInclude); + + if (activeGroup) { + this.setActiveGroup(new fabric.Group(activeGroup.getObjects(), { + originX: 'center', + originY: 'center' + })); + activeGroup.forEachObject(function(o) { + o.set('active', true); + }); + + if (this._currentTransform) { + this._currentTransform.target = this.getActiveGroup(); + } + } + + return data; + }, + + /** + * @private + */ + _toObjects: function(methodName, propertiesToInclude) { + return this.getObjects().map(function(instance) { + return this._toObject(instance, methodName, propertiesToInclude); + }, this); + }, + + /** + * @private + */ + _toObject: function(instance, methodName, propertiesToInclude) { + var originalValue; + + if (!this.includeDefaultValues) { + originalValue = instance.includeDefaultValues; + instance.includeDefaultValues = false; + } + var object = instance[methodName](propertiesToInclude); + if (!this.includeDefaultValues) { + instance.includeDefaultValues = originalValue; + } + return object; + }, + + /** + * @private + */ + __serializeBgOverlay: function() { + var data = { + background: (this.backgroundColor && this.backgroundColor.toObject) + ? this.backgroundColor.toObject() + : this.backgroundColor + }; + + if (this.overlayColor) { + data.overlay = this.overlayColor.toObject + ? this.overlayColor.toObject() + : this.overlayColor; + } + if (this.backgroundImage) { + data.backgroundImage = this.backgroundImage.toObject(); + } + if (this.overlayImage) { + data.overlayImage = this.overlayImage.toObject(); + } + + return data; + }, + + /* _TO_SVG_START_ */ + /** + * When true, getSvgTransform() will apply the StaticCanvas.viewportTransform to the SVG transformation. When true, + * a zoomed canvas will then produce zoomed SVG output. + * @type Boolean + * @default + */ + svgViewportTransformation: true, + + /** + * Returns SVG representation of canvas + * @function + * @param {Object} [options] Options object for SVG output + * @param {Boolean} [options.suppressPreamble=false] If true xml tag is not included + * @param {Object} [options.viewBox] SVG viewbox object + * @param {Number} [options.viewBox.x] x-cooridnate of viewbox + * @param {Number} [options.viewBox.y] y-coordinate of viewbox + * @param {Number} [options.viewBox.width] Width of viewbox + * @param {Number} [options.viewBox.height] Height of viewbox + * @param {String} [options.encoding=UTF-8] Encoding of SVG output + * @param {Function} [reviver] Method for further parsing of svg elements, called after each fabric object converted into svg representation. + * @return {String} SVG string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#serialization} + * @see {@link http://jsfiddle.net/fabricjs/jQ3ZZ/|jsFiddle demo} + * @example Normal SVG output + * var svg = canvas.toSVG(); + * @example SVG output without preamble (without <?xml ../>) + * var svg = canvas.toSVG({suppressPreamble: true}); + * @example SVG output with viewBox attribute + * var svg = canvas.toSVG({ + * viewBox: { + * x: 100, + * y: 100, + * width: 200, + * height: 300 + * } + * }); + * @example SVG output with different encoding (default: UTF-8) + * var svg = canvas.toSVG({encoding: 'ISO-8859-1'}); + * @example Modify SVG output with reviver function + * var svg = canvas.toSVG(null, function(svg) { + * return svg.replace('stroke-dasharray: ; stroke-linecap: butt; stroke-linejoin: miter; stroke-miterlimit: 10; ', ''); + * }); + */ + toSVG: function(options, reviver) { + options || (options = { }); + + var markup = []; + + this._setSVGPreamble(markup, options); + this._setSVGHeader(markup, options); + + this._setSVGBgOverlayColor(markup, 'backgroundColor'); + this._setSVGBgOverlayImage(markup, 'backgroundImage'); + + this._setSVGObjects(markup, reviver); + + this._setSVGBgOverlayColor(markup, 'overlayColor'); + this._setSVGBgOverlayImage(markup, 'overlayImage'); + + markup.push(''); + + return markup.join(''); + }, + + /** + * @private + */ + _setSVGPreamble: function(markup, options) { + if (!options.suppressPreamble) { + markup.push( + '', + '\n' + ); + } + }, + + /** + * @private + */ + _setSVGHeader: function(markup, options) { + var width, height, vpt; + + if (options.viewBox) { + width = options.viewBox.width; + height = options.viewBox.height; + } + else { + width = this.width; + height = this.height; + if (!this.svgViewportTransformation) { + vpt = this.viewportTransform; + width /= vpt[0]; + height /= vpt[3]; + } + } + + markup.push( + '', + 'Created with Fabric.js ', fabric.version, '', + '', + fabric.createSVGFontFacesMarkup(this.getObjects()), + fabric.createSVGRefElementsMarkup(this), + '' + ); + }, + + /** + * @private + */ + _setSVGObjects: function(markup, reviver) { + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + this.discardActiveGroup(); + } + for (var i = 0, objects = this.getObjects(), len = objects.length; i < len; i++) { + markup.push(objects[i].toSVG(reviver)); + } + if (activeGroup) { + this.setActiveGroup(new fabric.Group(activeGroup.getObjects())); + activeGroup.forEachObject(function(o) { + o.set('active', true); + }); + } + }, + + /** + * @private + */ + _setSVGBgOverlayImage: function(markup, property) { + if (this[property] && this[property].toSVG) { + markup.push(this[property].toSVG()); + } + }, + + /** + * @private + */ + _setSVGBgOverlayColor: function(markup, property) { + if (this[property] && this[property].source) { + markup.push( + '' + ); + } + else if (this[property] && property === 'overlayColor') { + markup.push( + '' + ); + } + }, + /* _TO_SVG_END_ */ + + /** + * Moves an object to the bottom of the stack of drawn objects + * @param {fabric.Object} object Object to send to back + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendToBack: function (object) { + removeFromArray(this._objects, object); + this._objects.unshift(object); + return this.renderAll && this.renderAll(); + }, + + /** + * Moves an object to the top of the stack of drawn objects + * @param {fabric.Object} object Object to send + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringToFront: function (object) { + removeFromArray(this._objects, object); + this._objects.push(object); + return this.renderAll && this.renderAll(); + }, + + /** + * Moves an object down in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendBackwards: function (object, intersecting) { + var idx = this._objects.indexOf(object); + + // if object is not on the bottom of stack + if (idx !== 0) { + var newIdx = this._findNewLowerIndex(object, idx, intersecting); + + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + this.renderAll && this.renderAll(); + } + return this; + }, + + /** + * @private + */ + _findNewLowerIndex: function(object, idx, intersecting) { + var newIdx; + + if (intersecting) { + newIdx = idx; + + // traverse down the stack looking for the nearest intersecting object + for (var i = idx - 1; i >= 0; --i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx - 1; + } + + return newIdx; + }, + + /** + * Moves an object up in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringForward: function (object, intersecting) { + var idx = this._objects.indexOf(object); + + // if object is not on top of stack (last item in an array) + if (idx !== this._objects.length - 1) { + var newIdx = this._findNewUpperIndex(object, idx, intersecting); + + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + this.renderAll && this.renderAll(); + } + return this; + }, + + /** + * @private + */ + _findNewUpperIndex: function(object, idx, intersecting) { + var newIdx; + + if (intersecting) { + newIdx = idx; + + // traverse up the stack looking for the nearest intersecting object + for (var i = idx + 1; i < this._objects.length; ++i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx + 1; + } + + return newIdx; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Number} index Position to move to + * @return {fabric.Canvas} thisArg + * @chainable + */ + moveTo: function (object, index) { + removeFromArray(this._objects, object); + this._objects.splice(index, 0, object); + return this.renderAll && this.renderAll(); + }, + + /** + * Clears a canvas element and removes all event listeners + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + this.clear(); + this.interactive && this.removeListeners(); + return this; + }, + + /** + * Returns a string representation of an instance + * @return {String} string representation of an instance + */ + toString: function () { + return '#'; + } + }); + + extend(fabric.StaticCanvas.prototype, fabric.Observable); + extend(fabric.StaticCanvas.prototype, fabric.Collection); + extend(fabric.StaticCanvas.prototype, fabric.DataURLExporter); + + extend(fabric.StaticCanvas, /** @lends fabric.StaticCanvas */ { + + /** + * @static + * @type String + * @default + */ + EMPTY_JSON: '{"objects": [], "background": "white"}', + + /** + * Provides a way to check support of some of the canvas methods + * (either those of HTMLCanvasElement itself, or rendering context) + * + * @param {String} methodName Method to check support for; + * Could be one of "getImageData", "toDataURL", "toDataURLWithQuality" or "setLineDash" + * @return {Boolean | null} `true` if method is supported (or at least exists), + * `null` if canvas element or context can not be initialized + */ + supports: function (methodName) { + var el = fabric.util.createCanvasElement(); + + if (!el || !el.getContext) { + return null; + } + + var ctx = el.getContext('2d'); + if (!ctx) { + return null; + } + + switch (methodName) { + + case 'getImageData': + return typeof ctx.getImageData !== 'undefined'; + + case 'setLineDash': + return typeof ctx.setLineDash !== 'undefined'; + + case 'toDataURL': + return typeof el.toDataURL !== 'undefined'; + + case 'toDataURLWithQuality': + try { + el.toDataURL('image/jpeg', 0); + return true; + } + catch (e) { } + return false; + + default: + return null; + } + } + }); + + /** + * Returns JSON representation of canvas + * @function + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} JSON string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#serialization} + * @see {@link http://jsfiddle.net/fabricjs/pec86/|jsFiddle demo} + * @example JSON without additional properties + * var json = canvas.toJSON(); + * @example JSON with additional properties included + * var json = canvas.toJSON(['lockMovementX', 'lockMovementY', 'lockRotation', 'lockScalingX', 'lockScalingY', 'lockUniScaling']); + * @example JSON without default values + * canvas.includeDefaultValues = false; + * var json = canvas.toJSON(); + */ + fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject; + +})(); + + +/** + * BaseBrush class + * @class fabric.BaseBrush + * @see {@link http://fabricjs.com/freedrawing/|Freedrawing demo} + */ +fabric.BaseBrush = fabric.util.createClass(/** @lends fabric.BaseBrush.prototype */ { + + /** + * Color of a brush + * @type String + * @default + */ + color: 'rgb(0, 0, 0)', + + /** + * Width of a brush + * @type Number + * @default + */ + width: 1, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property replaces "shadowColor" (String), "shadowOffsetX" (Number), + * "shadowOffsetY" (Number) and "shadowBlur" (Number) since v1.2.12 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Line endings style of a brush (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'round', + + /** + * Corner style of a brush (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'round', + + /** + * Sets shadow of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @return {fabric.Object} thisArg + * @chainable + */ + setShadow: function(options) { + this.shadow = new fabric.Shadow(options); + return this; + }, + + /** + * Sets brush styles + * @private + */ + _setBrushStyles: function() { + var ctx = this.canvas.contextTop; + + ctx.strokeStyle = this.color; + ctx.lineWidth = this.width; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + }, + + /** + * Sets brush shadow styles + * @private + */ + _setShadow: function() { + if (!this.shadow) { + return; + } + + var ctx = this.canvas.contextTop; + + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur; + ctx.shadowOffsetX = this.shadow.offsetX; + ctx.shadowOffsetY = this.shadow.offsetY; + }, + + /** + * Removes brush shadow styles + * @private + */ + _resetShadow: function() { + var ctx = this.canvas.contextTop; + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + } +}); + + +(function() { + + var utilMin = fabric.util.array.min, + utilMax = fabric.util.array.max; + + /** + * PencilBrush class + * @class fabric.PencilBrush + * @extends fabric.BaseBrush + */ + fabric.PencilBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.PencilBrush.prototype */ { + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.PencilBrush} Instance of a pencil brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this._points = [ ]; + }, + + /** + * Inovoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this._prepareForDrawing(pointer); + // capture coordinates immediately + // this allows to draw dots (when movement never occurs) + this._captureDrawingPath(pointer); + this._render(); + }, + + /** + * Inovoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this._captureDrawingPath(pointer); + // redraw curve + // clear top canvas + this.canvas.clearContext(this.canvas.contextTop); + this._render(); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + this._finalizeAndAddPath(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _prepareForDrawing: function(pointer) { + + var p = new fabric.Point(pointer.x, pointer.y); + + this._reset(); + this._addPoint(p); + + this.canvas.contextTop.moveTo(p.x, p.y); + }, + + /** + * @private + * @param {fabric.Point} point Point to be added to points array + */ + _addPoint: function(point) { + this._points.push(point); + }, + + /** + * Clear points array and set contextTop canvas style. + * @private + */ + _reset: function() { + this._points.length = 0; + + this._setBrushStyles(); + this._setShadow(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _captureDrawingPath: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y); + this._addPoint(pointerPoint); + }, + + /** + * Draw a smooth path on the topCanvas using quadraticCurveTo + * @private + */ + _render: function() { + var ctx = this.canvas.contextTop, + v = this.canvas.viewportTransform, + p1 = this._points[0], + p2 = this._points[1]; + + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + ctx.beginPath(); + + //if we only have 2 points in the path and they are the same + //it means that the user only clicked the canvas without moving the mouse + //then we should be drawing a dot. A path isn't drawn between two identical dots + //that's why we set them apart a bit + if (this._points.length === 2 && p1.x === p2.x && p1.y === p2.y) { + p1.x -= 0.5; + p2.x += 0.5; + } + ctx.moveTo(p1.x, p1.y); + + for (var i = 1, len = this._points.length; i < len; i++) { + // we pick the point between pi + 1 & pi + 2 as the + // end point and p1 as our control point. + var midPoint = p1.midPointFrom(p2); + ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y); + + p1 = this._points[i]; + p2 = this._points[i + 1]; + } + // Draw last line as a straight line while + // we wait for the next point to be able to calculate + // the bezier control point + ctx.lineTo(p1.x, p1.y); + ctx.stroke(); + ctx.restore(); + }, + + /** + * Return an SVG path based on our captured points and their bounding box + * @private + */ + _getSVGPathData: function() { + this.box = this.getPathBoundingBox(this._points); + return this.convertPointsToSVGPath( + this._points, this.box.minX, this.box.minY); + }, + + /** + * Returns bounding box of a path based on given points + * @param {Array} points Array of points + * @return {Object} Object with minX, minY, maxX, maxY + */ + getPathBoundingBox: function(points) { + var xBounds = [], + yBounds = [], + p1 = points[0], + p2 = points[1], + startPoint = p1; + + for (var i = 1, len = points.length; i < len; i++) { + var midPoint = p1.midPointFrom(p2); + // with startPoint, p1 as control point, midpoint as end point + xBounds.push(startPoint.x); + xBounds.push(midPoint.x); + yBounds.push(startPoint.y); + yBounds.push(midPoint.y); + + p1 = points[i]; + p2 = points[i + 1]; + startPoint = midPoint; + } + + xBounds.push(p1.x); + yBounds.push(p1.y); + + return { + minX: utilMin(xBounds), + minY: utilMin(yBounds), + maxX: utilMax(xBounds), + maxY: utilMax(yBounds) + }; + }, + + /** + * Converts points to SVG path + * @param {Array} points Array of points + * @param {Number} minX + * @param {Number} minY + * @return {String} SVG path + */ + convertPointsToSVGPath: function(points, minX, minY) { + var path = [], + p1 = new fabric.Point(points[0].x - minX, points[0].y - minY), + p2 = new fabric.Point(points[1].x - minX, points[1].y - minY); + + path.push('M ', points[0].x - minX, ' ', points[0].y - minY, ' '); + for (var i = 1, len = points.length; i < len; i++) { + var midPoint = p1.midPointFrom(p2); + // p1 is our bezier control point + // midpoint is our endpoint + // start point is p(i-1) value. + path.push('Q ', p1.x, ' ', p1.y, ' ', midPoint.x, ' ', midPoint.y, ' '); + p1 = new fabric.Point(points[i].x - minX, points[i].y - minY); + if ((i + 1) < points.length) { + p2 = new fabric.Point(points[i + 1].x - minX, points[i + 1].y - minY); + } + } + path.push('L ', p1.x, ' ', p1.y, ' '); + return path; + }, + + /** + * Creates fabric.Path object to add on canvas + * @param {String} pathData Path data + * @return {fabric.Path} Path to add on canvas + */ + createPath: function(pathData) { + var path = new fabric.Path(pathData); + path.fill = null; + path.stroke = this.color; + path.strokeWidth = this.width; + path.strokeLineCap = this.strokeLineCap; + path.strokeLineJoin = this.strokeLineJoin; + + if (this.shadow) { + this.shadow.affectStroke = true; + path.setShadow(this.shadow); + } + + return path; + }, + + /** + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. + */ + _finalizeAndAddPath: function() { + var ctx = this.canvas.contextTop; + ctx.closePath(); + + var pathData = this._getSVGPathData().join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.renderAll(); + return; + } + + // set path origin coordinates based on our bounding box + var originLeft = this.box.minX + (this.box.maxX - this.box.minX) / 2, + originTop = this.box.minY + (this.box.maxY - this.box.minY) / 2; + + this.canvas.contextTop.arc(originLeft, originTop, 3, 0, Math.PI * 2, false); + + var path = this.createPath(pathData); + path.set({ + left: originLeft, + top: originTop, + originX: 'center', + originY: 'center' + }); + + this.canvas.add(path); + path.setCoords(); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderAll(); + + // fire event 'path' created + this.canvas.fire('path:created', { path: path }); + } + }); +})(); + + +/** + * CircleBrush class + * @class fabric.CircleBrush + */ +fabric.CircleBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.CircleBrush.prototype */ { + + /** + * Width of a brush + * @type Number + * @default + */ + width: 10, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.CircleBrush} Instance of a circle brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.points = [ ]; + }, + /** + * Invoked inside on mouse down and mouse move + * @param {Object} pointer + */ + drawDot: function(pointer) { + var point = this.addPoint(pointer), + ctx = this.canvas.contextTop, + v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + + ctx.fillStyle = point.fill; + ctx.beginPath(); + ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false); + ctx.closePath(); + ctx.fill(); + + ctx.restore(); + }, + + /** + * Invoked on mouse down + */ + onMouseDown: function(pointer) { + this.points.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + this.drawDot(pointer); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.drawDot(pointer); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var circles = [ ]; + + for (var i = 0, len = this.points.length; i < len; i++) { + var point = this.points[i], + circle = new fabric.Circle({ + radius: point.radius, + left: point.x, + top: point.y, + originX: 'center', + originY: 'center', + fill: point.fill + }); + + this.shadow && circle.setShadow(this.shadow); + + circles.push(circle); + } + var group = new fabric.Group(circles, { originX: 'center', originY: 'center' }); + group.canvas = this.canvas; + + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + + /** + * @param {Object} pointer + * @return {fabric.Point} Just added pointer point + */ + addPoint: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y), + + circleRadius = fabric.util.getRandomInt( + Math.max(0, this.width - 20), this.width + 20) / 2, + + circleColor = new fabric.Color(this.color) + .setAlpha(fabric.util.getRandomInt(0, 100) / 100) + .toRgba(); + + pointerPoint.radius = circleRadius; + pointerPoint.fill = circleColor; + + this.points.push(pointerPoint); + + return pointerPoint; + } +}); + + +/** + * SprayBrush class + * @class fabric.SprayBrush + */ +fabric.SprayBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.SprayBrush.prototype */ { + + /** + * Width of a spray + * @type Number + * @default + */ + width: 10, + + /** + * Density of a spray (number of dots per chunk) + * @type Number + * @default + */ + density: 20, + + /** + * Width of spray dots + * @type Number + * @default + */ + dotWidth: 1, + + /** + * Width variance of spray dots + * @type Number + * @default + */ + dotWidthVariance: 1, + + /** + * Whether opacity of a dot should be random + * @type Boolean + * @default + */ + randomOpacity: false, + + /** + * Whether overlapping dots (rectangles) should be removed (for performance reasons) + * @type Boolean + * @default + */ + optimizeOverlapping: true, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.SprayBrush} Instance of a spray brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.sprayChunks = [ ]; + }, + + /** + * Invoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this.sprayChunks.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + + this.addSprayChunk(pointer); + this.render(); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.addSprayChunk(pointer); + this.render(); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var rects = [ ]; + + for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + var sprayChunk = this.sprayChunks[i]; + + for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) { + + var rect = new fabric.Rect({ + width: sprayChunk[j].width, + height: sprayChunk[j].width, + left: sprayChunk[j].x + 1, + top: sprayChunk[j].y + 1, + originX: 'center', + originY: 'center', + fill: this.color + }); + + this.shadow && rect.setShadow(this.shadow); + rects.push(rect); + } + } + + if (this.optimizeOverlapping) { + rects = this._getOptimizedRects(rects); + } + + var group = new fabric.Group(rects, { originX: 'center', originY: 'center' }); + group.canvas = this.canvas; + + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + + /** + * @private + * @param {Array} rects + */ + _getOptimizedRects: function(rects) { + + // avoid creating duplicate rects at the same coordinates + var uniqueRects = { }, key; + + for (var i = 0, len = rects.length; i < len; i++) { + key = rects[i].left + '' + rects[i].top; + if (!uniqueRects[key]) { + uniqueRects[key] = rects[i]; + } + } + var uniqueRectsArray = [ ]; + for (key in uniqueRects) { + uniqueRectsArray.push(uniqueRects[key]); + } + + return uniqueRectsArray; + }, + + /** + * Renders brush + */ + render: function() { + var ctx = this.canvas.contextTop; + ctx.fillStyle = this.color; + + var v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + + for (var i = 0, len = this.sprayChunkPoints.length; i < len; i++) { + var point = this.sprayChunkPoints[i]; + if (typeof point.opacity !== 'undefined') { + ctx.globalAlpha = point.opacity; + } + ctx.fillRect(point.x, point.y, point.width, point.width); + } + ctx.restore(); + }, + + /** + * @param {Object} pointer + */ + addSprayChunk: function(pointer) { + this.sprayChunkPoints = [ ]; + + var x, y, width, radius = this.width / 2; + + for (var i = 0; i < this.density; i++) { + + x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius); + y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius); + + if (this.dotWidthVariance) { + width = fabric.util.getRandomInt( + // bottom clamp width to 1 + Math.max(1, this.dotWidth - this.dotWidthVariance), + this.dotWidth + this.dotWidthVariance); + } + else { + width = this.dotWidth; + } + + var point = new fabric.Point(x, y); + point.width = width; + + if (this.randomOpacity) { + point.opacity = fabric.util.getRandomInt(0, 100) / 100; + } + + this.sprayChunkPoints.push(point); + } + + this.sprayChunks.push(this.sprayChunkPoints); + } +}); + + +/** + * PatternBrush class + * @class fabric.PatternBrush + * @extends fabric.BaseBrush + */ +fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, /** @lends fabric.PatternBrush.prototype */ { + + getPatternSrc: function() { + + var dotWidth = 20, + dotDistance = 5, + patternCanvas = fabric.document.createElement('canvas'), + patternCtx = patternCanvas.getContext('2d'); + + patternCanvas.width = patternCanvas.height = dotWidth + dotDistance; + + patternCtx.fillStyle = this.color; + patternCtx.beginPath(); + patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false); + patternCtx.closePath(); + patternCtx.fill(); + + return patternCanvas; + }, + + getPatternSrcFunction: function() { + return String(this.getPatternSrc).replace('this.color', '"' + this.color + '"'); + }, + + /** + * Creates "pattern" instance property + */ + getPattern: function() { + return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), 'repeat'); + }, + + /** + * Sets brush styles + */ + _setBrushStyles: function() { + this.callSuper('_setBrushStyles'); + this.canvas.contextTop.strokeStyle = this.getPattern(); + }, + + /** + * Creates path + */ + createPath: function(pathData) { + var path = this.callSuper('createPath', pathData); + path.stroke = new fabric.Pattern({ + source: this.source || this.getPatternSrcFunction() + }); + return path; + } +}); + + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Exports canvas element to a dataurl image. Note that when multiplier is used, cropping is scaled appropriately + * @param {Object} [options] Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + * @see {@link http://jsfiddle.net/fabricjs/NfZVb/|jsFiddle demo} + * @example Generate jpeg dataURL with lower quality + * var dataURL = canvas.toDataURL({ + * format: 'jpeg', + * quality: 0.8 + * }); + * @example Generate cropped png dataURL (clipping of canvas) + * var dataURL = canvas.toDataURL({ + * format: 'png', + * left: 100, + * top: 100, + * width: 200, + * height: 200 + * }); + * @example Generate double scaled png dataURL + * var dataURL = canvas.toDataURL({ + * format: 'png', + * multiplier: 2 + * }); + */ + toDataURL: function (options) { + options || (options = { }); + + var format = options.format || 'png', + quality = options.quality || 1, + multiplier = options.multiplier || 1, + cropping = { + left: options.left, + top: options.top, + width: options.width, + height: options.height + }; + + if (multiplier !== 1) { + return this.__toDataURLWithMultiplier(format, quality, cropping, multiplier); + } + else { + return this.__toDataURL(format, quality, cropping); + } + }, + + /** + * @private + */ + __toDataURL: function(format, quality, cropping) { + + this.renderAll(true); + + var canvasEl = this.upperCanvasEl || this.lowerCanvasEl, + croppedCanvasEl = this.__getCroppedCanvas(canvasEl, cropping); + + // to avoid common confusion https://github.com/kangax/fabric.js/issues/806 + if (format === 'jpg') { + format = 'jpeg'; + } + + var data = (fabric.StaticCanvas.supports('toDataURLWithQuality')) + ? (croppedCanvasEl || canvasEl).toDataURL('image/' + format, quality) + : (croppedCanvasEl || canvasEl).toDataURL('image/' + format); + + this.contextTop && this.clearContext(this.contextTop); + this.renderAll(); + + if (croppedCanvasEl) { + croppedCanvasEl = null; + } + + return data; + }, + + /** + * @private + */ + __getCroppedCanvas: function(canvasEl, cropping) { + + var croppedCanvasEl, + croppedCtx, + shouldCrop = 'left' in cropping || + 'top' in cropping || + 'width' in cropping || + 'height' in cropping; + + if (shouldCrop) { + + croppedCanvasEl = fabric.util.createCanvasElement(); + croppedCtx = croppedCanvasEl.getContext('2d'); + + croppedCanvasEl.width = cropping.width || this.width; + croppedCanvasEl.height = cropping.height || this.height; + + croppedCtx.drawImage(canvasEl, -cropping.left || 0, -cropping.top || 0); + } + + return croppedCanvasEl; + }, + + /** + * @private + */ + __toDataURLWithMultiplier: function(format, quality, cropping, multiplier) { + + var origWidth = this.getWidth(), + origHeight = this.getHeight(), + scaledWidth = origWidth * multiplier, + scaledHeight = origHeight * multiplier, + activeObject = this.getActiveObject(), + activeGroup = this.getActiveGroup(), + + ctx = this.contextTop || this.contextContainer; + + if (multiplier > 1) { + this.setWidth(scaledWidth).setHeight(scaledHeight); + } + ctx.scale(multiplier, multiplier); + + if (cropping.left) { + cropping.left *= multiplier; + } + if (cropping.top) { + cropping.top *= multiplier; + } + if (cropping.width) { + cropping.width *= multiplier; + } + else if (multiplier < 1) { + cropping.width = scaledWidth; + } + if (cropping.height) { + cropping.height *= multiplier; + } + else if (multiplier < 1) { + cropping.height = scaledHeight; + } + + if (activeGroup) { + // not removing group due to complications with restoring it with correct state afterwords + this._tempRemoveBordersControlsFromGroup(activeGroup); + } + else if (activeObject && this.deactivateAll) { + this.deactivateAll(); + } + + this.renderAll(true); + + var data = this.__toDataURL(format, quality, cropping); + + // restoring width, height for `renderAll` to draw + // background properly (while context is scaled) + this.width = origWidth; + this.height = origHeight; + + ctx.scale(1 / multiplier, 1 / multiplier); + this.setWidth(origWidth).setHeight(origHeight); + + if (activeGroup) { + this._restoreBordersControlsOnGroup(activeGroup); + } + else if (activeObject && this.setActiveObject) { + this.setActiveObject(activeObject); + } + + this.contextTop && this.clearContext(this.contextTop); + this.renderAll(); + + return data; + }, + + /** + * Exports canvas element to a dataurl image (allowing to change image size via multiplier). + * @deprecated since 1.0.13 + * @param {String} format (png|jpeg) + * @param {Number} multiplier + * @param {Number} quality (0..1) + * @return {String} + */ + toDataURLWithMultiplier: function (format, multiplier, quality) { + return this.toDataURL({ + format: format, + multiplier: multiplier, + quality: quality + }); + }, + + /** + * @private + */ + _tempRemoveBordersControlsFromGroup: function(group) { + group.origHasControls = group.hasControls; + group.origBorderColor = group.borderColor; + + group.hasControls = true; + group.borderColor = 'rgba(0,0,0,0)'; + + group.forEachObject(function(o) { + o.origBorderColor = o.borderColor; + o.borderColor = 'rgba(0,0,0,0)'; + }); + }, + + /** + * @private + */ + _restoreBordersControlsOnGroup: function(group) { + group.hideControls = group.origHideControls; + group.borderColor = group.origBorderColor; + + group.forEachObject(function(o) { + o.borderColor = o.origBorderColor; + delete o.origBorderColor; + }); + } +}); + + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Populates canvas with data from the specified dataless JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toDatalessJSON} + * @deprecated since 1.2.2 + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#deserialization} + */ + loadFromDatalessJSON: function (json, callback, reviver) { + return this.loadFromJSON(json, callback, reviver); + }, + + /** + * Populates canvas with data from the specified JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toJSON} + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#deserialization} + * @see {@link http://jsfiddle.net/fabricjs/fmgXt/|jsFiddle demo} + * @example loadFromJSON + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas)); + * @example loadFromJSON with reviver + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas), function(o, object) { + * // `o` = json object + * // `object` = fabric.Object instance + * // ... do some stuff ... + * }); + */ + loadFromJSON: function (json, callback, reviver) { + if (!json) { + return; + } + + // serialize if it wasn't already + var serialized = (typeof json === 'string') + ? JSON.parse(json) + : json; + + this.clear(); + + var _this = this; + this._enlivenObjects(serialized.objects, function () { + _this._setBgOverlay(serialized, callback); + }, reviver); + + return this; + }, + + /** + * @private + * @param {Object} serialized Object with background and overlay information + * @param {Function} callback Invoked after all background and overlay images/patterns loaded + */ + _setBgOverlay: function(serialized, callback) { + var _this = this, + loaded = { + backgroundColor: false, + overlayColor: false, + backgroundImage: false, + overlayImage: false + }; + + if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background && !serialized.overlay) { + callback && callback(); + return; + } + + var cbIfLoaded = function () { + if (loaded.backgroundImage && loaded.overlayImage && loaded.backgroundColor && loaded.overlayColor) { + _this.renderAll(); + callback && callback(); + } + }; + + this.__setBgOverlay('backgroundImage', serialized.backgroundImage, loaded, cbIfLoaded); + this.__setBgOverlay('overlayImage', serialized.overlayImage, loaded, cbIfLoaded); + this.__setBgOverlay('backgroundColor', serialized.background, loaded, cbIfLoaded); + this.__setBgOverlay('overlayColor', serialized.overlay, loaded, cbIfLoaded); + + cbIfLoaded(); + }, + + /** + * @private + * @param {String} property Property to set (backgroundImage, overlayImage, backgroundColor, overlayColor) + * @param {(Object|String)} value Value to set + * @param {Object} loaded Set loaded property to true if property is set + * @param {Object} callback Callback function to invoke after property is set + */ + __setBgOverlay: function(property, value, loaded, callback) { + var _this = this; + + if (!value) { + loaded[property] = true; + return; + } + + if (property === 'backgroundImage' || property === 'overlayImage') { + fabric.Image.fromObject(value, function(img) { + _this[property] = img; + loaded[property] = true; + callback && callback(); + }); + } + else { + this['set' + fabric.util.string.capitalize(property, true)](value, function() { + loaded[property] = true; + callback && callback(); + }); + } + }, + + /** + * @private + * @param {Array} objects + * @param {Function} callback + * @param {Function} [reviver] + */ + _enlivenObjects: function (objects, callback, reviver) { + var _this = this; + + if (!objects || objects.length === 0) { + callback && callback(); + return; + } + + var renderOnAddRemove = this.renderOnAddRemove; + this.renderOnAddRemove = false; + + fabric.util.enlivenObjects(objects, function(enlivenedObjects) { + enlivenedObjects.forEach(function(obj, index) { + _this.insertAt(obj, index, true); + }); + + _this.renderOnAddRemove = renderOnAddRemove; + callback && callback(); + }, null, reviver); + }, + + /** + * @private + * @param {String} format + * @param {Function} callback + */ + _toDataURL: function (format, callback) { + this.clone(function (clone) { + callback(clone.toDataURL(format)); + }); + }, + + /** + * @private + * @param {String} format + * @param {Number} multiplier + * @param {Function} callback + */ + _toDataURLWithMultiplier: function (format, multiplier, callback) { + this.clone(function (clone) { + callback(clone.toDataURLWithMultiplier(format, multiplier)); + }); + }, + + /** + * Clones canvas instance + * @param {Object} [callback] Receives cloned instance as a first argument + * @param {Array} [properties] Array of properties to include in the cloned canvas and children + */ + clone: function (callback, properties) { + var data = JSON.stringify(this.toJSON(properties)); + this.cloneWithoutData(function(clone) { + clone.loadFromJSON(data, function() { + callback && callback(clone); + }); + }); + }, + + /** + * Clones canvas instance without cloning existing data. + * This essentially copies canvas dimensions, clipping properties, etc. + * but leaves data empty (so that you can populate it with your own) + * @param {Object} [callback] Receives cloned instance as a first argument + */ + cloneWithoutData: function(callback) { + var el = fabric.document.createElement('canvas'); + + el.width = this.getWidth(); + el.height = this.getHeight(); + + var clone = new fabric.Canvas(el); + clone.clipTo = this.clipTo; + if (this.backgroundImage) { + clone.setBackgroundImage(this.backgroundImage.src, function() { + clone.renderAll(); + callback && callback(clone); + }); + clone.backgroundImageOpacity = this.backgroundImageOpacity; + clone.backgroundImageStretch = this.backgroundImageStretch; + } + else { + callback && callback(clone); + } + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + toFixed = fabric.util.toFixed, + capitalize = fabric.util.string.capitalize, + degreesToRadians = fabric.util.degreesToRadians, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Object) { + return; + } + + /** + * Root object class from which all 2d shape classes inherit from + * @class fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#objects} + * @see {@link fabric.Object#initialize} for constructor definition + * + * @fires added + * @fires removed + * + * @fires selected + * @fires modified + * @fires rotating + * @fires scaling + * @fires moving + * + * @fires mousedown + * @fires mouseup + */ + fabric.Object = fabric.util.createClass(/** @lends fabric.Object.prototype */ { + + /** + * Retrieves object's {@link fabric.Object#clipTo|clipping function} + * @method getClipTo + * @memberOf fabric.Object.prototype + * @return {Function} + */ + + /** + * Sets object's {@link fabric.Object#clipTo|clipping function} + * @method setClipTo + * @memberOf fabric.Object.prototype + * @param {Function} clipTo Clipping function + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method getTransformMatrix + * @memberOf fabric.Object.prototype + * @return {Array} transformMatrix + */ + + /** + * Sets object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method setTransformMatrix + * @memberOf fabric.Object.prototype + * @param {Array} transformMatrix + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#visible|visible} state + * @method getVisible + * @memberOf fabric.Object.prototype + * @return {Boolean} True if visible + */ + + /** + * Sets object's {@link fabric.Object#visible|visible} state + * @method setVisible + * @memberOf fabric.Object.prototype + * @param {Boolean} value visible value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#shadow|shadow} + * @method getShadow + * @memberOf fabric.Object.prototype + * @return {Object} Shadow instance + */ + + /** + * Retrieves object's {@link fabric.Object#stroke|stroke} + * @method getStroke + * @memberOf fabric.Object.prototype + * @return {String} stroke value + */ + + /** + * Sets object's {@link fabric.Object#stroke|stroke} + * @method setStroke + * @memberOf fabric.Object.prototype + * @param {String} value stroke value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method getStrokeWidth + * @memberOf fabric.Object.prototype + * @return {Number} strokeWidth value + */ + + /** + * Sets object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method setStrokeWidth + * @memberOf fabric.Object.prototype + * @param {Number} value strokeWidth value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originX|originX} + * @method getOriginX + * @memberOf fabric.Object.prototype + * @return {String} originX value + */ + + /** + * Sets object's {@link fabric.Object#originX|originX} + * @method setOriginX + * @memberOf fabric.Object.prototype + * @param {String} value originX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originY|originY} + * @method getOriginY + * @memberOf fabric.Object.prototype + * @return {String} originY value + */ + + /** + * Sets object's {@link fabric.Object#originY|originY} + * @method setOriginY + * @memberOf fabric.Object.prototype + * @param {String} value originY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#fill|fill} + * @method getFill + * @memberOf fabric.Object.prototype + * @return {String} Fill value + */ + + /** + * Sets object's {@link fabric.Object#fill|fill} + * @method setFill + * @memberOf fabric.Object.prototype + * @param {String} value Fill value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#opacity|opacity} + * @method getOpacity + * @memberOf fabric.Object.prototype + * @return {Number} Opacity value (0-1) + */ + + /** + * Sets object's {@link fabric.Object#opacity|opacity} + * @method setOpacity + * @memberOf fabric.Object.prototype + * @param {Number} value Opacity value (0-1) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#angle|angle} (in degrees) + * @method getAngle + * @memberOf fabric.Object.prototype + * @return {Number} + */ + + /** + * Sets object's {@link fabric.Object#angle|angle} + * @method setAngle + * @memberOf fabric.Object.prototype + * @param {Number} value Angle value (in degrees) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#top|top position} + * @method getTop + * @memberOf fabric.Object.prototype + * @return {Number} Top value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#top|top position} + * @method setTop + * @memberOf fabric.Object.prototype + * @param {Number} value Top value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#left|left position} + * @method getLeft + * @memberOf fabric.Object.prototype + * @return {Number} Left value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#left|left position} + * @method setLeft + * @memberOf fabric.Object.prototype + * @param {Number} value Left value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleX|scaleX} value + * @method getScaleX + * @memberOf fabric.Object.prototype + * @return {Number} scaleX value + */ + + /** + * Sets object's {@link fabric.Object#scaleX|scaleX} value + * @method setScaleX + * @memberOf fabric.Object.prototype + * @param {Number} value scaleX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleY|scaleY} value + * @method getScaleY + * @memberOf fabric.Object.prototype + * @return {Number} scaleY value + */ + + /** + * Sets object's {@link fabric.Object#scaleY|scaleY} value + * @method setScaleY + * @memberOf fabric.Object.prototype + * @param {Number} value scaleY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipX|flipX} value + * @method getFlipX + * @memberOf fabric.Object.prototype + * @return {Boolean} flipX value + */ + + /** + * Sets object's {@link fabric.Object#flipX|flipX} value + * @method setFlipX + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipY|flipY} value + * @method getFlipY + * @memberOf fabric.Object.prototype + * @return {Boolean} flipY value + */ + + /** + * Sets object's {@link fabric.Object#flipY|flipY} value + * @method setFlipY + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Type of an object (rect, circle, path, etc.) + * @type String + * @default + */ + type: 'object', + + /** + * Horizontal origin of transformation of an object (one of "left", "right", "center") + * @type String + * @default + */ + originX: 'left', + + /** + * Vertical origin of transformation of an object (one of "top", "bottom", "center") + * @type String + * @default + */ + originY: 'top', + + /** + * Top position of an object. Note that by default it's relative to object center. You can change this by setting originY={top/center/bottom} + * @type Number + * @default + */ + top: 0, + + /** + * Left position of an object. Note that by default it's relative to object center. You can change this by setting originX={left/center/right} + * @type Number + * @default + */ + left: 0, + + /** + * Object width + * @type Number + * @default + */ + width: 0, + + /** + * Object height + * @type Number + * @default + */ + height: 0, + + /** + * Object scale factor (horizontal) + * @type Number + * @default + */ + scaleX: 1, + + /** + * Object scale factor (vertical) + * @type Number + * @default + */ + scaleY: 1, + + /** + * When true, an object is rendered as flipped horizontally + * @type Boolean + * @default + */ + flipX: false, + + /** + * When true, an object is rendered as flipped vertically + * @type Boolean + * @default + */ + flipY: false, + + /** + * Opacity of an object + * @type Number + * @default + */ + opacity: 1, + + /** + * Angle of rotation of an object (in degrees) + * @type Number + * @default + */ + angle: 0, + + /** + * Size of object's controlling corners (in pixels) + * @type Number + * @default + */ + cornerSize: 12, + + /** + * When true, object's controlling corners are rendered as transparent inside (i.e. stroke instead of fill) + * @type Boolean + * @default + */ + transparentCorners: true, + + /** + * Default cursor value used when hovering over this object on canvas + * @type String + * @default + */ + hoverCursor: null, + + /** + * Padding between object and its controlling borders (in pixels) + * @type Number + * @default + */ + padding: 0, + + /** + * Color of controlling borders of an object (when it's active) + * @type String + * @default + */ + borderColor: 'rgba(102,153,255,0.75)', + + /** + * Color of controlling corners of an object (when it's active) + * @type String + * @default + */ + cornerColor: 'rgba(102,153,255,0.5)', + + /** + * When true, this object will use center point as the origin of transformation + * when being scaled via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, this object will use center point as the origin of transformation + * when being rotated via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: true, + + /** + * Color of object's fill + * @type String + * @default + */ + fill: 'rgb(0,0,0)', + + /** + * Fill rule used to fill an object + * @type String + * @default + */ + fillRule: 'source-over', + + /** + * Background color of an object. Only works with text objects at the moment. + * @type String + * @default + */ + backgroundColor: '', + + /** + * When defined, an object is rendered via stroke and this property specifies its color + * @type String + * @default + */ + stroke: null, + + /** + * Width of a stroke used to render this object + * @type Number + * @default + */ + strokeWidth: 1, + + /** + * Array specifying dash pattern of an object's stroke (stroke must be defined) + * @type Array + */ + strokeDashArray: null, + + /** + * Line endings style of an object's stroke (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'butt', + + /** + * Corner style of an object's stroke (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'miter', + + /** + * Maximum miter length (used for strokeLineJoin = "miter") of an object's stroke + * @type Number + * @default + */ + strokeMiterLimit: 10, + + /** + * Shadow object representing shadow of this shape + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Opacity of object's controlling borders when object is active and moving + * @type Number + * @default + */ + borderOpacityWhenMoving: 0.4, + + /** + * Scale factor of object's controlling borders + * @type Number + * @default + */ + borderScaleFactor: 1, + + /** + * Transform matrix (similar to SVG's transform matrix) + * @type Array + */ + transformMatrix: null, + + /** + * Minimum allowed scale value of an object + * @type Number + * @default + */ + minScaleLimit: 0.01, + + /** + * When set to `false`, an object can not be selected for modification (using either point-click-based or group-based selection). + * But events still fire on it. + * @type Boolean + * @default + */ + selectable: true, + + /** + * When set to `false`, an object can not be a target of events. All events propagate through it. Introduced in v1.3.4 + * @type Boolean + * @default + */ + evented: true, + + /** + * When set to `false`, an object is not rendered on canvas + * @type Boolean + * @default + */ + visible: true, + + /** + * When set to `false`, object's controls are not displayed and can not be used to manipulate object + * @type Boolean + * @default + */ + hasControls: true, + + /** + * When set to `false`, object's controlling borders are not rendered + * @type Boolean + * @default + */ + hasBorders: true, + + /** + * When set to `false`, object's controlling rotating point will not be visible or selectable + * @type Boolean + * @default + */ + hasRotatingPoint: true, + + /** + * Offset for object's controlling rotating point (when enabled via `hasRotatingPoint`) + * @type Number + * @default + */ + rotatingPointOffset: 40, + + /** + * When set to `true`, objects are "found" on canvas on per-pixel basis rather than according to bounding box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * When `false`, default object's values are not included in its serialization + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Function that determines clipping of an object (context is passed as a first argument) + * Note that context origin is at the object's center point (not left/top corner) + * @type Function + */ + clipTo: null, + + /** + * When `true`, object horizontal movement is locked + * @type Boolean + * @default + */ + lockMovementX: false, + + /** + * When `true`, object vertical movement is locked + * @type Boolean + * @default + */ + lockMovementY: false, + + /** + * When `true`, object rotation is locked + * @type Boolean + * @default + */ + lockRotation: false, + + /** + * When `true`, object horizontal scaling is locked + * @type Boolean + * @default + */ + lockScalingX: false, + + /** + * When `true`, object vertical scaling is locked + * @type Boolean + * @default + */ + lockScalingY: false, + + /** + * When `true`, object non-uniform scaling is locked + * @type Boolean + * @default + */ + lockUniScaling: false, + + /** + * When `true`, object cannot be flipped by scaling into negative values + * @type Boolean + * @default + */ + + lockScalingFlip: false, + /** + * List of properties to consider when checking if state + * of an object is changed (fabric.Object#hasStateChanged) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: ( + 'top left width height scaleX scaleY flipX flipY originX originY transformMatrix ' + + 'stroke strokeWidth strokeDashArray strokeLineCap strokeLineJoin strokeMiterLimit ' + + 'angle opacity fill fillRule shadow clipTo visible backgroundColor' + ).split(' '), + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initGradient: function(options) { + if (options.fill && options.fill.colorStops && !(options.fill instanceof fabric.Gradient)) { + this.set('fill', new fabric.Gradient(options.fill)); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initPattern: function(options) { + if (options.fill && options.fill.source && !(options.fill instanceof fabric.Pattern)) { + this.set('fill', new fabric.Pattern(options.fill)); + } + if (options.stroke && options.stroke.source && !(options.stroke instanceof fabric.Pattern)) { + this.set('stroke', new fabric.Pattern(options.stroke)); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initClipping: function(options) { + if (!options.clipTo || typeof options.clipTo !== 'string') { + return; + } + + var functionBody = fabric.util.getFunctionBody(options.clipTo); + if (typeof functionBody !== 'undefined') { + this.clipTo = new Function('ctx', functionBody); + } + }, + + /** + * Sets object's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + for (var prop in options) { + this.set(prop, options[prop]); + } + this._initGradient(options); + this._initPattern(options); + this._initClipping(options); + }, + + /** + * Transforms context when rendering an object + * @param {CanvasRenderingContext2D} ctx Context + * @param {Boolean} fromLeft When true, context is transformed to object's top/left corner. This is used when rendering text on Node + */ + transform: function(ctx, fromLeft) { + if (this.group) { + this.group.transform(ctx, fromLeft); + } + ctx.globalAlpha = this.opacity; + + var center = fromLeft ? this._getLeftTopCoords() : this.getCenterPoint(); + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.angle)); + ctx.scale( + this.scaleX * (this.flipX ? -1 : 1), + this.scaleY * (this.flipY ? -1 : 1) + ); + }, + + /** + * Returns an object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + object = { + type: this.type, + originX: this.originX, + originY: this.originY, + left: toFixed(this.left, NUM_FRACTION_DIGITS), + top: toFixed(this.top, NUM_FRACTION_DIGITS), + width: toFixed(this.width, NUM_FRACTION_DIGITS), + height: toFixed(this.height, NUM_FRACTION_DIGITS), + fill: (this.fill && this.fill.toObject) ? this.fill.toObject() : this.fill, + stroke: (this.stroke && this.stroke.toObject) ? this.stroke.toObject() : this.stroke, + strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS), + strokeDashArray: this.strokeDashArray, + strokeLineCap: this.strokeLineCap, + strokeLineJoin: this.strokeLineJoin, + strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS), + scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS), + scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS), + angle: toFixed(this.getAngle(), NUM_FRACTION_DIGITS), + flipX: this.flipX, + flipY: this.flipY, + opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS), + shadow: (this.shadow && this.shadow.toObject) ? this.shadow.toObject() : this.shadow, + visible: this.visible, + clipTo: this.clipTo && String(this.clipTo), + backgroundColor: this.backgroundColor + }; + + if (!this.includeDefaultValues) { + object = this._removeDefaultValues(object); + } + + fabric.util.populateWithProperties(this, object, propertiesToInclude); + + return object; + }, + + /** + * Returns (dataless) object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + // will be overwritten by subclasses + return this.toObject(propertiesToInclude); + }, + + /** + * @private + * @param {Object} object + */ + _removeDefaultValues: function(object) { + var prototype = fabric.util.getKlass(object.type).prototype, + stateProperties = prototype.stateProperties; + + stateProperties.forEach(function(prop) { + if (object[prop] === prototype[prop]) { + delete object[prop]; + } + }); + + return object; + }, + + /** + * Returns a string representation of an instance + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Basic getter + * @param {String} property Property name + * @return {Any} value of a property + */ + get: function(property) { + return this[property]; + }, + + /** + * @private + */ + _setObject: function(obj) { + for (var prop in obj) { + this._set(prop, obj[prop]); + } + }, + + /** + * Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`. + * @param {String|Object} key Property name or object (if object, iterate over the object properties) + * @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one) + * @return {fabric.Object} thisArg + * @chainable + */ + set: function(key, value) { + if (typeof key === 'object') { + this._setObject(key); + } + else { + if (typeof value === 'function' && key !== 'clipTo') { + this._set(key, value(this.get(key))); + } + else { + this._set(key, value); + } + } + return this; + }, + + /** + * @private + * @param {String} key + * @param {Any} value + * @return {fabric.Object} thisArg + */ + _set: function(key, value) { + var shouldConstrainValue = (key === 'scaleX' || key === 'scaleY'); + + if (shouldConstrainValue) { + value = this._constrainScale(value); + } + if (key === 'scaleX' && value < 0) { + this.flipX = !this.flipX; + value *= -1; + } + else if (key === 'scaleY' && value < 0) { + this.flipY = !this.flipY; + value *= -1; + } + else if (key === 'width' || key === 'height') { + this.minScaleLimit = toFixed(Math.min(0.1, 1/Math.max(this.width, this.height)), 2); + } + else if (key === 'shadow' && value && !(value instanceof fabric.Shadow)) { + value = new fabric.Shadow(value); + } + + this[key] = value; + + return this; + }, + + /** + * Toggles specified property from `true` to `false` or from `false` to `true` + * @param {String} property Property to toggle + * @return {fabric.Object} thisArg + * @chainable + */ + toggle: function(property) { + var value = this.get(property); + if (typeof value === 'boolean') { + this.set(property, !value); + } + return this; + }, + + /** + * Sets sourcePath of an object + * @param {String} value Value to set sourcePath to + * @return {fabric.Object} thisArg + * @chainable + */ + setSourcePath: function(value) { + this.sourcePath = value; + return this; + }, + + /** + * Retrieves viewportTransform from Object's canvas if possible + * @method getViewportTransform + * @memberOf fabric.Object.prototype + * @return {Boolean} flipY value // TODO + */ + getViewportTransform: function() { + if (this.canvas && this.canvas.viewportTransform) { + return this.canvas.viewportTransform; + } + return [1, 0, 0, 1, 0, 0]; + }, + + /** + * Renders an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + render: function(ctx, noTransform) { + // do not render if width/height are zeros or object is not visible + if (this.width === 0 || this.height === 0 || !this.visible) { + return; + } + + ctx.save(); + + //setup fill rule for current object + this._setupFillRule(ctx); + + this._transform(ctx, noTransform); + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + + if (this.group && this.group.type === 'path-group') { + ctx.translate(-this.group.width/2, -this.group.height/2); + var m = this.transformMatrix; + if (m) { + ctx.transform.apply(ctx, m); + } + } + ctx.globalAlpha = this.group ? (ctx.globalAlpha * this.opacity) : this.opacity; + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + this._render(ctx, noTransform); + this.clipTo && ctx.restore(); + this._removeShadow(ctx); + this._restoreFillRule(ctx); + + ctx.restore(); + }, + + _transform: function(ctx, noTransform) { + var m = this.transformMatrix; + + if (m && !this.group) { + ctx.setTransform.apply(ctx, m); + } + if (!noTransform) { + this.transform(ctx); + } + }, + + _setStrokeStyles: function(ctx) { + if (this.stroke) { + ctx.lineWidth = this.strokeWidth; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + ctx.miterLimit = this.strokeMiterLimit; + ctx.strokeStyle = this.stroke.toLive + ? this.stroke.toLive(ctx) + : this.stroke; + } + }, + + _setFillStyles: function(ctx) { + if (this.fill) { + ctx.fillStyle = this.fill.toLive + ? this.fill.toLive(ctx) + : this.fill; + } + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _renderControls: function(ctx, noTransform) { + var vpt = this.getViewportTransform(); + + ctx.save(); + if (this.active && !noTransform) { + var center; + if (this.group) { + center = fabric.util.transformPoint(this.group.getCenterPoint(), vpt); + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.group.angle)); + } + center = fabric.util.transformPoint(this.getCenterPoint(), vpt, null != this.group); + if (this.group) { + center.x *= this.group.scaleX; + center.y *= this.group.scaleY; + } + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.angle)); + this.drawBorders(ctx); + this.drawControls(ctx); + } + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setShadow: function(ctx) { + if (!this.shadow) { + return; + } + + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur; + ctx.shadowOffsetX = this.shadow.offsetX; + ctx.shadowOffsetY = this.shadow.offsetY; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _removeShadow: function(ctx) { + if (!this.shadow) { + return; + } + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderFill: function(ctx) { + if (!this.fill) { + return; + } + + ctx.save(); + if (this.fill.toLive) { + ctx.translate( + -this.width / 2 + this.fill.offsetX || 0, + -this.height / 2 + this.fill.offsetY || 0); + } + if (this.fill.gradientTransform) { + var g = this.fill.gradientTransform; + ctx.transform.apply(ctx, g); + } + if (this.fillRule === 'destination-over') { + ctx.fill('evenodd'); + } + else { + ctx.fill(); + } + ctx.restore(); + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderStroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + + ctx.save(); + if (this.strokeDashArray) { + // Spec requires the concatenation of two copies the dash list when the number of elements is odd + if (1 & this.strokeDashArray.length) { + this.strokeDashArray.push.apply(this.strokeDashArray, this.strokeDashArray); + } + + if (supportsLineDash) { + ctx.setLineDash(this.strokeDashArray); + this._stroke && this._stroke(ctx); + } + else { + this._renderDashedStroke && this._renderDashedStroke(ctx); + } + ctx.stroke(); + } + else { + if (this.stroke.gradientTransform) { + var g = this.stroke.gradientTransform; + ctx.transform.apply(ctx, g); + } + this._stroke ? this._stroke(ctx) : ctx.stroke(); + } + this._removeShadow(ctx); + ctx.restore(); + }, + + /** + * Clones an instance + * @param {Function} callback Callback is invoked with a clone as a first argument + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {fabric.Object} clone of an instance + */ + clone: function(callback, propertiesToInclude) { + if (this.constructor.fromObject) { + return this.constructor.fromObject(this.toObject(propertiesToInclude), callback); + } + return new fabric.Object(this.toObject(propertiesToInclude)); + }, + + /** + * Creates an instance of fabric.Image out of an object + * @param {Function} callback callback, invoked with an instance as a first argument + * @return {fabric.Object} thisArg + */ + cloneAsImage: function(callback) { + var dataUrl = this.toDataURL(); + fabric.util.loadImage(dataUrl, function(img) { + if (callback) { + callback(new fabric.Image(img)); + } + }); + return this; + }, + + /** + * Converts an object into a data-url-like string + * @param {Object} options Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + */ + toDataURL: function(options) { + options || (options = { }); + + var el = fabric.util.createCanvasElement(), + boundingRect = this.getBoundingRect(); + + el.width = boundingRect.width; + el.height = boundingRect.height; + + fabric.util.wrapElement(el, 'div'); + var canvas = new fabric.Canvas(el); + + // to avoid common confusion https://github.com/kangax/fabric.js/issues/806 + if (options.format === 'jpg') { + options.format = 'jpeg'; + } + + if (options.format === 'jpeg') { + canvas.backgroundColor = '#fff'; + } + + var origParams = { + active: this.get('active'), + left: this.getLeft(), + top: this.getTop() + }; + + this.set('active', false); + this.setPositionByOrigin(new fabric.Point(el.width / 2, el.height / 2), 'center', 'center'); + + var originalCanvas = this.canvas; + canvas.add(this); + var data = canvas.toDataURL(options); + + this.set(origParams).setCoords(); + this.canvas = originalCanvas; + + canvas.dispose(); + canvas = null; + + return data; + }, + + /** + * Returns true if specified type is identical to the type of an instance + * @param {String} type Type to check against + * @return {Boolean} + */ + isType: function(type) { + return this.type === type; + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 0; + }, + + /** + * Returns a JSON representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} JSON + */ + toJSON: function(propertiesToInclude) { + // delegate, not alias + return this.toObject(propertiesToInclude); + }, + + /** + * Sets gradient (fill or stroke) of an object + * Backwards incompatibility note: This method was named "setGradientFill" until v1.1.0 + * @param {String} property Property name 'stroke' or 'fill' + * @param {Object} [options] Options object + * @param {String} [options.type] Type of gradient 'radial' or 'linear' + * @param {Number} [options.x1=0] x-coordinate of start point + * @param {Number} [options.y1=0] y-coordinate of start point + * @param {Number} [options.x2=0] x-coordinate of end point + * @param {Number} [options.y2=0] y-coordinate of end point + * @param {Number} [options.r1=0] Radius of start point (only for radial gradients) + * @param {Number} [options.r2=0] Radius of end point (only for radial gradients) + * @param {Object} [options.colorStops] Color stops object eg. {0: 'ff0000', 1: '000000'} + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/58y8b/|jsFiddle demo} + * @example Set linear gradient + * object.setGradient('fill', { + * type: 'linear', + * x1: -object.width / 2, + * y1: 0, + * x2: object.width / 2, + * y2: 0, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + * @example Set radial gradient + * object.setGradient('fill', { + * type: 'radial', + * x1: 0, + * y1: 0, + * x2: 0, + * y2: 0, + * r1: object.width / 2, + * r2: 10, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + */ + setGradient: function(property, options) { + options || (options = { }); + + var gradient = { colorStops: [] }; + + gradient.type = options.type || (options.r1 || options.r2 ? 'radial' : 'linear'); + gradient.coords = { + x1: options.x1, + y1: options.y1, + x2: options.x2, + y2: options.y2 + }; + + if (options.r1 || options.r2) { + gradient.coords.r1 = options.r1; + gradient.coords.r2 = options.r2; + } + + for (var position in options.colorStops) { + var color = new fabric.Color(options.colorStops[position]); + gradient.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + + return this.set(property, fabric.Gradient.forObject(this, gradient)); + }, + + /** + * Sets pattern fill of an object + * @param {Object} options Options object + * @param {(String|HTMLImageElement)} options.source Pattern source + * @param {String} [options.repeat=repeat] Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @param {Number} [options.offsetX=0] Pattern horizontal offset from object's left/top corner + * @param {Number} [options.offsetY=0] Pattern vertical offset from object's left/top corner + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/QT3pa/|jsFiddle demo} + * @example Set pattern + * fabric.util.loadImage('http://fabricjs.com/assets/escheresque_ste.png', function(img) { + * object.setPatternFill({ + * source: img, + * repeat: 'repeat' + * }); + * canvas.renderAll(); + * }); + */ + setPatternFill: function(options) { + return this.set('fill', new fabric.Pattern(options)); + }, + + /** + * Sets {@link fabric.Object#shadow|shadow} of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @param {String} [options.color=rgb(0,0,0)] Shadow color + * @param {Number} [options.blur=0] Shadow blur + * @param {Number} [options.offsetX=0] Shadow horizontal offset + * @param {Number} [options.offsetY=0] Shadow vertical offset + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/7gvJG/|jsFiddle demo} + * @example Set shadow with string notation + * object.setShadow('2px 2px 10px rgba(0,0,0,0.2)'); + * canvas.renderAll(); + * @example Set shadow with object notation + * object.setShadow({ + * color: 'red', + * blur: 10, + * offsetX: 20, + * offsetY: 20 + * }); + * canvas.renderAll(); + */ + setShadow: function(options) { + return this.set('shadow', options ? new fabric.Shadow(options) : null); + }, + + /** + * Sets "color" of an instance (alias of `set('fill', …)`) + * @param {String} color Color value + * @return {fabric.Object} thisArg + * @chainable + */ + setColor: function(color) { + this.set('fill', color); + return this; + }, + + /** + * Sets "angle" of an instance + * @param {Number} angle Angle value + * @return {fabric.Object} thisArg + * @chainable + */ + setAngle: function(angle) { + var shouldCenterOrigin = (this.originX !== 'center' || this.originY !== 'center') && this.centeredRotation; + + if (shouldCenterOrigin) { + this._setOriginToCenter(); + } + + this.set('angle', angle); + + if (shouldCenterOrigin) { + this._resetOrigin(); + } + + return this; + }, + + /** + * Centers object horizontally on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerH: function () { + this.canvas.centerObjectH(this); + return this; + }, + + /** + * Centers object vertically on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerV: function () { + this.canvas.centerObjectV(this); + return this; + }, + + /** + * Centers object vertically and horizontally on canvas to which is was added last + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + center: function () { + this.canvas.centerObject(this); + return this; + }, + + /** + * Removes object from canvas to which it was added last + * @return {fabric.Object} thisArg + * @chainable + */ + remove: function() { + this.canvas.remove(this); + return this; + }, + + /** + * Returns coordinates of a pointer relative to an object + * @param {Event} e Event to operate upon + * @param {Object} [pointer] Pointer to operate upon (instead of event) + * @return {Object} Coordinates of a pointer (x, y) + */ + getLocalPointer: function(e, pointer) { + pointer = pointer || this.canvas.getPointer(e); + var objectLeftTop = this.translateToOriginPoint(this.getCenterPoint(), 'left', 'top'); + return { + x: pointer.x - objectLeftTop.x, + y: pointer.y - objectLeftTop.y + }; + }, + + /** + * Sets canvas globalCompositeOperation for specific object + * custom composition operation for the particular object can be specifed using fillRule property + * @param {CanvasRenderingContext2D} ctx Rendering canvas context + */ + _setupFillRule: function (ctx) { + if (this.fillRule) { + this._prevFillRule = ctx.globalCompositeOperation; + ctx.globalCompositeOperation = this.fillRule; + } + }, + + /** + * Restores previously saved canvas globalCompositeOperation after obeject rendering + * @param {CanvasRenderingContext2D} ctx Rendering canvas context + */ + _restoreFillRule: function (ctx) { + if (this.fillRule && this._prevFillRule) { + ctx.globalCompositeOperation = this._prevFillRule; + } + } + }); + + fabric.util.createAccessors(fabric.Object); + + /** + * Alias for {@link fabric.Object.prototype.setAngle} + * @alias rotate -> setAngle + * @memberof fabric.Object + */ + fabric.Object.prototype.rotate = fabric.Object.prototype.setAngle; + + extend(fabric.Object.prototype, fabric.Observable); + + /** + * Defines the number of fraction digits to use when serializing object values. + * You can use it to increase/decrease precision of such values like left, top, scaleX, scaleY, etc. + * @static + * @memberof fabric.Object + * @constant + * @type Number + */ + fabric.Object.NUM_FRACTION_DIGITS = 2; + + /** + * Unique id used internally when creating SVG elements + * @static + * @memberof fabric.Object + * @type Number + */ + fabric.Object.__uid = 0; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var degreesToRadians = fabric.util.degreesToRadians; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Translates the coordinates from origin to center coordinates (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToCenterPoint: function(point, originX, originY) { + var cx = point.x, + cy = point.y, + strokeWidth = this.stroke ? this.strokeWidth : 0; + + if (originX === 'left') { + cx = point.x + (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else if (originX === 'right') { + cx = point.x - (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + + if (originY === 'top') { + cy = point.y + (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else if (originY === 'bottom') { + cy = point.y - (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + + // Apply the reverse rotation to the point (it's already scaled properly) + return fabric.util.rotatePoint(new fabric.Point(cx, cy), point, degreesToRadians(this.angle)); + }, + + /** + * Translates the coordinates from center to origin coordinates (based on the object's dimensions) + * @param {fabric.Point} center The point which corresponds to center of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToOriginPoint: function(center, originX, originY) { + var x = center.x, + y = center.y, + strokeWidth = this.stroke ? this.strokeWidth : 0; + + // Get the point coordinates + if (originX === 'left') { + x = center.x - (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else if (originX === 'right') { + x = center.x + (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + if (originY === 'top') { + y = center.y - (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else if (originY === 'bottom') { + y = center.y + (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + + // Apply the rotation to the point (it's already scaled properly) + return fabric.util.rotatePoint(new fabric.Point(x, y), center, degreesToRadians(this.angle)); + }, + + /** + * Returns the real center coordinates of the object + * @return {fabric.Point} + */ + getCenterPoint: function() { + var leftTop = new fabric.Point(this.left, this.top); + return this.translateToCenterPoint(leftTop, this.originX, this.originY); + }, + + /** + * Returns the coordinates of the object based on center coordinates + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @return {fabric.Point} + */ + // getOriginPoint: function(center) { + // return this.translateToOriginPoint(center, this.originX, this.originY); + // }, + + /** + * Returns the coordinates of the object as if it has a different origin + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + getPointByOrigin: function(originX, originY) { + var center = this.getCenterPoint(); + return this.translateToOriginPoint(center, originX, originY); + }, + + /** + * Returns the point in local coordinates + * @param {fabric.Point} point The point relative to the global coordinate system + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + toLocalPoint: function(point, originX, originY) { + var center = this.getCenterPoint(), + strokeWidth = this.stroke ? this.strokeWidth : 0, + x, y; + + if (originX && originY) { + if (originX === 'left') { + x = center.x - (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else if (originX === 'right') { + x = center.x + (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else { + x = center.x; + } + + if (originY === 'top') { + y = center.y - (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else if (originY === 'bottom') { + y = center.y + (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else { + y = center.y; + } + } + else { + x = this.left; + y = this.top; + } + + return fabric.util.rotatePoint(new fabric.Point(point.x, point.y), center, -degreesToRadians(this.angle)) + .subtractEquals(new fabric.Point(x, y)); + }, + + /** + * Returns the point in global coordinates + * @param {fabric.Point} The point relative to the local coordinate system + * @return {fabric.Point} + */ + // toGlobalPoint: function(point) { + // return fabric.util.rotatePoint(point, this.getCenterPoint(), degreesToRadians(this.angle)).addEquals(new fabric.Point(this.left, this.top)); + // }, + + /** + * Sets the position of the object taking into consideration the object's origin + * @param {fabric.Point} pos The new position of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {void} + */ + setPositionByOrigin: function(pos, originX, originY) { + var center = this.translateToCenterPoint(pos, originX, originY), + position = this.translateToOriginPoint(center, this.originX, this.originY); + + this.set('left', position.x); + this.set('top', position.y); + }, + + /** + * @param {String} to One of 'left', 'center', 'right' + */ + adjustPosition: function(to) { + var angle = degreesToRadians(this.angle), + hypotHalf = this.getWidth() / 2, + xHalf = Math.cos(angle) * hypotHalf, + yHalf = Math.sin(angle) * hypotHalf, + hypotFull = this.getWidth(), + xFull = Math.cos(angle) * hypotFull, + yFull = Math.sin(angle) * hypotFull; + + if (this.originX === 'center' && to === 'left' || + this.originX === 'right' && to === 'center') { + // move half left + this.left -= xHalf; + this.top -= yHalf; + } + else if (this.originX === 'left' && to === 'center' || + this.originX === 'center' && to === 'right') { + // move half right + this.left += xHalf; + this.top += yHalf; + } + else if (this.originX === 'left' && to === 'right') { + // move full right + this.left += xFull; + this.top += yFull; + } + else if (this.originX === 'right' && to === 'left') { + // move full left + this.left -= xFull; + this.top -= yFull; + } + + this.setCoords(); + this.originX = to; + }, + + /** + * Sets the origin/position of the object to it's center point + * @private + * @return {void} + */ + _setOriginToCenter: function() { + this._originalOriginX = this.originX; + this._originalOriginY = this.originY; + + var center = this.getCenterPoint(); + + this.originX = 'center'; + this.originY = 'center'; + + this.left = center.x; + this.top = center.y; + }, + + /** + * Resets the origin/position of the object to it's original origin + * @private + * @return {void} + */ + _resetOrigin: function() { + var originPoint = this.translateToOriginPoint( + this.getCenterPoint(), + this._originalOriginX, + this._originalOriginY); + + this.originX = this._originalOriginX; + this.originY = this._originalOriginY; + + this.left = originPoint.x; + this.top = originPoint.y; + + this._originalOriginX = null; + this._originalOriginY = null; + }, + + /** + * @private + */ + _getLeftTopCoords: function() { + return this.translateToOriginPoint(this.getCenterPoint(), 'left', 'center'); + } + }); + +})(); + + +(function() { + + var degreesToRadians = fabric.util.degreesToRadians; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Object containing coordinates of object's controls + * @type Object + * @default + */ + oCoords: null, + + /** + * Checks if object intersects with an area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @return {Boolean} true if object intersects with an area formed by 2 points + */ + intersectsWithRect: function(pointTL, pointBR) { + var oCoords = this.oCoords, + tl = new fabric.Point(oCoords.tl.x, oCoords.tl.y), + tr = new fabric.Point(oCoords.tr.x, oCoords.tr.y), + bl = new fabric.Point(oCoords.bl.x, oCoords.bl.y), + br = new fabric.Point(oCoords.br.x, oCoords.br.y), + intersection = fabric.Intersection.intersectPolygonRectangle( + [tl, tr, br, bl], + pointTL, + pointBR + ); + return intersection.status === 'Intersection'; + }, + + /** + * Checks if object intersects with another object + * @param {Object} other Object to test + * @return {Boolean} true if object intersects with another object + */ + intersectsWithObject: function(other) { + // extracts coords + function getCoords(oCoords) { + return { + tl: new fabric.Point(oCoords.tl.x, oCoords.tl.y), + tr: new fabric.Point(oCoords.tr.x, oCoords.tr.y), + bl: new fabric.Point(oCoords.bl.x, oCoords.bl.y), + br: new fabric.Point(oCoords.br.x, oCoords.br.y) + }; + } + var thisCoords = getCoords(this.oCoords), + otherCoords = getCoords(other.oCoords), + intersection = fabric.Intersection.intersectPolygonPolygon( + [thisCoords.tl, thisCoords.tr, thisCoords.br, thisCoords.bl], + [otherCoords.tl, otherCoords.tr, otherCoords.br, otherCoords.bl] + ); + + return intersection.status === 'Intersection'; + }, + + /** + * Checks if object is fully contained within area of another object + * @param {Object} other Object to test + * @return {Boolean} true if object is fully contained within area of another object + */ + isContainedWithinObject: function(other) { + var boundingRect = other.getBoundingRect(), + point1 = new fabric.Point(boundingRect.left, boundingRect.top), + point2 = new fabric.Point(boundingRect.left + boundingRect.width, boundingRect.top + boundingRect.height); + + return this.isContainedWithinRect(point1, point2); + }, + + /** + * Checks if object is fully contained within area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @return {Boolean} true if object is fully contained within area formed by 2 points + */ + isContainedWithinRect: function(pointTL, pointBR) { + var boundingRect = this.getBoundingRect(); + + return ( + boundingRect.left >= pointTL.x && + boundingRect.left + boundingRect.width <= pointBR.x && + boundingRect.top >= pointTL.y && + boundingRect.top + boundingRect.height <= pointBR.y + ); + }, + + /** + * Checks if point is inside the object + * @param {fabric.Point} point Point to check against + * @return {Boolean} true if point is inside the object + */ + containsPoint: function(point) { + var lines = this._getImageLines(this.oCoords), + xPoints = this._findCrossPoints(point, lines); + + // if xPoints is odd then point is inside the object + return (xPoints !== 0 && xPoints % 2 === 1); + }, + + /** + * Method that returns an object with the object edges in it, given the coordinates of the corners + * @private + * @param {Object} oCoords Coordinates of the object corners + */ + _getImageLines: function(oCoords) { + return { + topline: { + o: oCoords.tl, + d: oCoords.tr + }, + rightline: { + o: oCoords.tr, + d: oCoords.br + }, + bottomline: { + o: oCoords.br, + d: oCoords.bl + }, + leftline: { + o: oCoords.bl, + d: oCoords.tl + } + }; + }, + + /** + * Helper method to determine how many cross points are between the 4 object edges + * and the horizontal line determined by a point on canvas + * @private + * @param {fabric.Point} point Point to check + * @param {Object} oCoords Coordinates of the object being evaluated + */ + _findCrossPoints: function(point, oCoords) { + var b1, b2, a1, a2, xi, yi, + xcount = 0, + iLine; + + for (var lineKey in oCoords) { + iLine = oCoords[lineKey]; + // optimisation 1: line below point. no cross + if ((iLine.o.y < point.y) && (iLine.d.y < point.y)) { + continue; + } + // optimisation 2: line above point. no cross + if ((iLine.o.y >= point.y) && (iLine.d.y >= point.y)) { + continue; + } + // optimisation 3: vertical line case + if ((iLine.o.x === iLine.d.x) && (iLine.o.x >= point.x)) { + xi = iLine.o.x; + yi = point.y; + } + // calculate the intersection point + else { + b1 = 0; + b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x); + a1 = point.y - b1 * point.x; + a2 = iLine.o.y - b2 * iLine.o.x; + + xi = - (a1 - a2) / (b1 - b2); + yi = a1 + b1 * xi; + } + // dont count xi < point.x cases + if (xi >= point.x) { + xcount += 1; + } + // optimisation 4: specific for square images + if (xcount === 2) { + break; + } + } + return xcount; + }, + + /** + * Returns width of an object's bounding rectangle + * @deprecated since 1.0.4 + * @return {Number} width value + */ + getBoundingRectWidth: function() { + return this.getBoundingRect().width; + }, + + /** + * Returns height of an object's bounding rectangle + * @deprecated since 1.0.4 + * @return {Number} height value + */ + getBoundingRectHeight: function() { + return this.getBoundingRect().height; + }, + + /** + * Returns coordinates of object's bounding rectangle (left, top, width, height) + * @return {Object} Object with left, top, width, height properties + */ + getBoundingRect: function() { + this.oCoords || this.setCoords(); + + var xCoords = [this.oCoords.tl.x, this.oCoords.tr.x, this.oCoords.br.x, this.oCoords.bl.x], + minX = fabric.util.array.min(xCoords), + maxX = fabric.util.array.max(xCoords), + width = Math.abs(minX - maxX), + + yCoords = [this.oCoords.tl.y, this.oCoords.tr.y, this.oCoords.br.y, this.oCoords.bl.y], + minY = fabric.util.array.min(yCoords), + maxY = fabric.util.array.max(yCoords), + height = Math.abs(minY - maxY); + + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + + /** + * Returns width of an object + * @return {Number} width value + */ + getWidth: function() { + return this.width * this.scaleX; + }, + + /** + * Returns height of an object + * @return {Number} height value + */ + getHeight: function() { + return this.height * this.scaleY; + }, + + /** + * Makes sure the scale is valid and modifies it if necessary + * @private + * @param {Number} value + * @return {Number} + */ + _constrainScale: function(value) { + if (Math.abs(value) < this.minScaleLimit) { + if (value < 0) { + return -this.minScaleLimit; + } + else { + return this.minScaleLimit; + } + } + return value; + }, + + /** + * Scales an object (equally by x and y) + * @param {Number} value Scale factor + * @return {fabric.Object} thisArg + * @chainable + */ + scale: function(value) { + value = this._constrainScale(value); + + if (value < 0) { + this.flipX = !this.flipX; + this.flipY = !this.flipY; + value *= -1; + } + + this.scaleX = value; + this.scaleY = value; + this.setCoords(); + return this; + }, + + /** + * Scales an object to a given width, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New width value + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToWidth: function(value) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRectWidth() / this.getWidth(); + return this.scale(value / this.width / boundingRectFactor); + }, + + /** + * Scales an object to a given height, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New height value + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToHeight: function(value) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRectHeight() / this.getHeight(); + return this.scale(value / this.height / boundingRectFactor); + }, + + /** + * Sets corner position coordinates based on current angle, width and height + * @return {fabric.Object} thisArg + * @chainable + */ + setCoords: function() { + var strokeWidth = this.strokeWidth > 1 ? this.strokeWidth : 0, + theta = degreesToRadians(this.angle), + vpt = this.getViewportTransform(), + f = function (p) { + return fabric.util.transformPoint(p, vpt); + }, + w = this.width, + h = this.height, + capped = this.strokeLineCap === 'round' || this.strokeLineCap === 'square', + vLine = this.type === 'line' && this.width === 1, + hLine = this.type === 'line' && this.height === 1, + strokeW = (capped && hLine) || this.type !== 'line', + strokeH = (capped && vLine) || this.type !== 'line'; + + if (vLine) { + w = strokeWidth; + } + else if (hLine) { + h = strokeWidth; + } + if (strokeW) { + w += strokeWidth; + } + if (strokeH) { + h += strokeWidth; + } + this.currentWidth = w * this.scaleX; + this.currentHeight = h * this.scaleY; + + // If width is negative, make postive. Fixes path selection issue + if (this.currentWidth < 0) { + this.currentWidth = Math.abs(this.currentWidth); + } + + var _hypotenuse = Math.sqrt( + Math.pow(this.currentWidth / 2, 2) + + Math.pow(this.currentHeight / 2, 2)), + + _angle = Math.atan(isFinite(this.currentHeight / this.currentWidth) ? this.currentHeight / this.currentWidth : 0), + + // offset added for rotate and scale actions + offsetX = Math.cos(_angle + theta) * _hypotenuse, + offsetY = Math.sin(_angle + theta) * _hypotenuse, + sinTh = Math.sin(theta), + cosTh = Math.cos(theta), + coords = this.getCenterPoint(), + wh = new fabric.Point(this.currentWidth, this.currentHeight), + _tl = new fabric.Point(coords.x - offsetX, coords.y - offsetY), + _tr = new fabric.Point(_tl.x + (wh.x * cosTh), _tl.y + (wh.x * sinTh)), + _bl = new fabric.Point(_tl.x - (wh.y * sinTh), _tl.y + (wh.y * cosTh)), + _mt = new fabric.Point(_tl.x + (wh.x/2 * cosTh), _tl.y + (wh.x/2 * sinTh)), + tl = f(_tl), + tr = f(_tr), + br = f(new fabric.Point(_tr.x - (wh.y * sinTh), _tr.y + (wh.y * cosTh))), + bl = f(_bl), + ml = f(new fabric.Point(_tl.x - (wh.y/2 * sinTh), _tl.y + (wh.y/2 * cosTh))), + mt = f(_mt), + mr = f(new fabric.Point(_tr.x - (wh.y/2 * sinTh), _tr.y + (wh.y/2 * cosTh))), + mb = f(new fabric.Point(_bl.x + (wh.x/2 * cosTh), _bl.y + (wh.x/2 * sinTh))), + mtr = f(new fabric.Point(_mt.x, _mt.y)), + + // padding + padX = Math.cos(_angle + theta) * this.padding * Math.sqrt(2), + padY = Math.sin(_angle + theta) * this.padding * Math.sqrt(2); + + tl = tl.add(new fabric.Point(-padX, -padY)); + tr = tr.add(new fabric.Point(padY, -padX)); + br = br.add(new fabric.Point(padX, padY)); + bl = bl.add(new fabric.Point(-padY, padX)); + ml = ml.add(new fabric.Point((-padX - padY) / 2, (-padY + padX) / 2)); + mt = mt.add(new fabric.Point((padY - padX) / 2, -(padY + padX) / 2)); + mr = mr.add(new fabric.Point((padY + padX) / 2, (padY - padX) / 2)); + mb = mb.add(new fabric.Point((padX - padY) / 2, (padX + padY) / 2)); + mtr = mtr.add(new fabric.Point((padY - padX) / 2, -(padY + padX) / 2)); + + // debugging + + // setTimeout(function() { + // canvas.contextTop.fillStyle = 'green'; + // canvas.contextTop.fillRect(mb.x, mb.y, 3, 3); + // canvas.contextTop.fillRect(bl.x, bl.y, 3, 3); + // canvas.contextTop.fillRect(br.x, br.y, 3, 3); + // canvas.contextTop.fillRect(tl.x, tl.y, 3, 3); + // canvas.contextTop.fillRect(tr.x, tr.y, 3, 3); + // canvas.contextTop.fillRect(ml.x, ml.y, 3, 3); + // canvas.contextTop.fillRect(mr.x, mr.y, 3, 3); + // canvas.contextTop.fillRect(mt.x, mt.y, 3, 3); + // }, 50); + + this.oCoords = { + // corners + tl: tl, tr: tr, br: br, bl: bl, + // middle + ml: ml, mt: mt, mr: mr, mb: mb, + // rotating point + mtr: mtr + }; + + // set coordinates of the draggable boxes in the corners used to scale/rotate the image + this._setCornerCoords && this._setCornerCoords(); + + return this; + } + }); +})(); + + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Moves an object to the bottom of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + sendToBack: function() { + if (this.group) { + fabric.StaticCanvas.prototype.sendToBack.call(this.group, this); + } + else { + this.canvas.sendToBack(this); + } + return this; + }, + + /** + * Moves an object to the top of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + bringToFront: function() { + if (this.group) { + fabric.StaticCanvas.prototype.bringToFront.call(this.group, this); + } + else { + this.canvas.bringToFront(this); + } + return this; + }, + + /** + * Moves an object down in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + sendBackwards: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this, intersecting); + } + else { + this.canvas.sendBackwards(this, intersecting); + } + return this; + }, + + /** + * Moves an object up in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + bringForward: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.bringForward.call(this.group, this, intersecting); + } + else { + this.canvas.bringForward(this, intersecting); + } + return this; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {Number} index New position of object + * @return {fabric.Object} thisArg + * @chainable + */ + moveTo: function(index) { + if (this.group) { + fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index); + } + else { + this.canvas.moveTo(this, index); + } + return this; + } +}); + + +/* _TO_SVG_START_ */ +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Returns styles-string for svg-export + * @return {String} + */ + getSvgStyles: function() { + + var fill = this.fill + ? (this.fill.toLive ? 'url(#SVGID_' + this.fill.id + ')' : this.fill) + : 'none', + fillRule = (this.fillRule === 'destination-over' ? 'evenodd' : this.fillRule), + stroke = this.stroke + ? (this.stroke.toLive ? 'url(#SVGID_' + this.stroke.id + ')' : this.stroke) + : 'none', + + strokeWidth = this.strokeWidth ? this.strokeWidth : '0', + strokeDashArray = this.strokeDashArray ? this.strokeDashArray.join(' ') : '', + strokeLineCap = this.strokeLineCap ? this.strokeLineCap : 'butt', + strokeLineJoin = this.strokeLineJoin ? this.strokeLineJoin : 'miter', + strokeMiterLimit = this.strokeMiterLimit ? this.strokeMiterLimit : '4', + opacity = typeof this.opacity !== 'undefined' ? this.opacity : '1', + + visibility = this.visible ? '' : ' visibility: hidden;', + filter = this.shadow && this.type !== 'text' ? 'filter: url(#SVGID_' + this.shadow.id + ');' : ''; + + return [ + 'stroke: ', stroke, '; ', + 'stroke-width: ', strokeWidth, '; ', + 'stroke-dasharray: ', strokeDashArray, '; ', + 'stroke-linecap: ', strokeLineCap, '; ', + 'stroke-linejoin: ', strokeLineJoin, '; ', + 'stroke-miterlimit: ', strokeMiterLimit, '; ', + 'fill: ', fill, '; ', + 'fill-rule: ', fillRule, '; ', + 'opacity: ', opacity, ';', + filter, + visibility + ].join(''); + }, + + /** + * Returns transform-string for svg-export + * @return {String} + */ + getSvgTransform: function() { + if (this.group) { + return ''; + } + var toFixed = fabric.util.toFixed, + angle = this.getAngle(), + vpt = !this.canvas || this.canvas.svgViewportTransformation ? this.getViewportTransform() : [1, 0, 0, 1, 0, 0], + center = fabric.util.transformPoint(this.getCenterPoint(), vpt), + + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + translatePart = this.type === 'path-group' ? '' : 'translate(' + + toFixed(center.x, NUM_FRACTION_DIGITS) + + ' ' + + toFixed(center.y, NUM_FRACTION_DIGITS) + + ')', + + anglePart = angle !== 0 + ? (' rotate(' + toFixed(angle, NUM_FRACTION_DIGITS) + ')') + : '', + + scalePart = (this.scaleX === 1 && this.scaleY === 1 && vpt[0] === 1 && vpt[3] === 1) + ? '' : + (' scale(' + + toFixed(this.scaleX * vpt[0], NUM_FRACTION_DIGITS) + + ' ' + + toFixed(this.scaleY * vpt[3], NUM_FRACTION_DIGITS) + + ')'), + + addTranslateX = this.type === 'path-group' ? this.width * vpt[0] : 0, + + flipXPart = this.flipX ? ' matrix(-1 0 0 1 ' + addTranslateX + ' 0) ' : '', + + addTranslateY = this.type === 'path-group' ? this.height * vpt[3] : 0, + + flipYPart = this.flipY ? ' matrix(1 0 0 -1 0 ' + addTranslateY + ')' : ''; + + return [ + translatePart, anglePart, scalePart, flipXPart, flipYPart + ].join(''); + }, + + /** + * Returns transform-string for svg-export from the transform matrix of single elements + * @return {String} + */ + getSvgTransformMatrix: function() { + return this.transformMatrix ? ' matrix(' + this.transformMatrix.join(' ') + ')' : ''; + }, + + /** + * @private + */ + _createBaseSVGMarkup: function() { + var markup = [ ]; + + if (this.fill && this.fill.toLive) { + markup.push(this.fill.toSVG(this, false)); + } + if (this.stroke && this.stroke.toLive) { + markup.push(this.stroke.toSVG(this, false)); + } + if (this.shadow) { + markup.push(this.shadow.toSVG(this)); + } + return markup; + } +}); +/* _TO_SVG_END_ */ + + +/* + Depends on `stateProperties` +*/ +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Returns true if object state (one of its state properties) was changed + * @return {Boolean} true if instance' state has changed since `{@link fabric.Object#saveState}` was called + */ + hasStateChanged: function() { + return this.stateProperties.some(function(prop) { + return this.get(prop) !== this.originalState[prop]; + }, this); + }, + + /** + * Saves state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + saveState: function(options) { + this.stateProperties.forEach(function(prop) { + this.originalState[prop] = this.get(prop); + }, this); + + if (options && options.stateProperties) { + options.stateProperties.forEach(function(prop) { + this.originalState[prop] = this.get(prop); + }, this); + } + + return this; + }, + + /** + * Setups state of an object + * @return {fabric.Object} thisArg + */ + setupState: function() { + this.originalState = { }; + this.saveState(); + + return this; + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + coordProps = { x1: 1, x2: 1, y1: 1, y2: 1 }, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Line) { + fabric.warn('fabric.Line is already defined'); + return; + } + + /** + * Line class + * @class fabric.Line + * @extends fabric.Object + * @see {@link fabric.Line#initialize} for constructor definition + */ + fabric.Line = fabric.util.createClass(fabric.Object, /** @lends fabric.Line.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'line', + + /** + * x value or first line edge + * @type Number + * @default + */ + x1: 0, + + /** + * y value or first line edge + * @type Number + * @default + */ + y1: 0, + + /** + * x value or second line edge + * @type Number + * @default + */ + x2: 0, + + /** + * y value or second line edge + * @type Number + * @default + */ + y2: 0, + + /** + * Constructor + * @param {Array} [points] Array of points + * @param {Object} [options] Options object + * @return {fabric.Line} thisArg + */ + initialize: function(points, options) { + options = options || { }; + + if (!points) { + points = [0, 0, 0, 0]; + } + + this.callSuper('initialize', options); + + this.set('x1', points[0]); + this.set('y1', points[1]); + this.set('x2', points[2]); + this.set('y2', points[3]); + + this._setWidthHeight(options); + }, + + /** + * @private + * @param {Object} [options] Options + */ + _setWidthHeight: function(options) { + options || (options = { }); + + this.width = Math.abs(this.x2 - this.x1) || 1; + this.height = Math.abs(this.y2 - this.y1) || 1; + + this.left = 'left' in options + ? options.left + : this._getLeftToOriginX(); + + this.top = 'top' in options + ? options.top + : this._getTopToOriginY(); + }, + + /** + * @private + * @param {String} key + * @param {Any} value + */ + _set: function(key, value) { + this[key] = value; + if (typeof coordProps[key] !== 'undefined') { + this._setWidthHeight(); + } + return this; + }, + + /** + * @private + * @return {Number} leftToOriginX Distance from left edge of canvas to originX of Line. + */ + _getLeftToOriginX: makeEdgeToOriginGetter( + { // property names + origin: 'originX', + axis1: 'x1', + axis2: 'x2', + dimension: 'width' + }, + { // possible values of origin + nearest: 'left', + center: 'center', + farthest: 'right' + } + ), + + /** + * @private + * @return {Number} topToOriginY Distance from top edge of canvas to originY of Line. + */ + _getTopToOriginY: makeEdgeToOriginGetter( + { // property names + origin: 'originY', + axis1: 'y1', + axis2: 'y2', + dimension: 'height' + }, + { // possible values of origin + nearest: 'top', + center: 'center', + farthest: 'bottom' + } + ), + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + + if (noTransform) { + // Line coords are distances from left-top of canvas to origin of line. + // + // To render line in a path-group, we need to translate them to + // distances from center of path-group to center of line. + var cp = this.getCenterPoint(); + ctx.translate( + cp.x, + cp.y + ); + } + + if (!this.strokeDashArray || this.strokeDashArray && supportsLineDash) { + + // move from center (of virtual box) to its left/top corner + // we can't assume x1, y1 is top left and x2, y2 is bottom right + var xMult = this.x1 <= this.x2 ? -1 : 1, + yMult = this.y1 <= this.y2 ? -1 : 1; + + ctx.moveTo( + this.width === 1 ? 0 : (xMult * this.width / 2), + this.height === 1 ? 0 : (yMult * this.height / 2)); + + ctx.lineTo( + this.width === 1 ? 0 : (xMult * -1 * this.width / 2), + this.height === 1 ? 0 : (yMult * -1 * this.height / 2)); + } + + ctx.lineWidth = this.strokeWidth; + + // TODO: test this + // make sure setting "fill" changes color of a line + // (by copying fillStyle to strokeStyle, since line is stroked, not filled) + var origStrokeStyle = ctx.strokeStyle; + ctx.strokeStyle = this.stroke || ctx.fillStyle; + this.stroke && this._renderStroke(ctx); + ctx.strokeStyle = origStrokeStyle; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var + xMult = this.x1 <= this.x2 ? -1 : 1, + yMult = this.y1 <= this.y2 ? -1 : 1, + x = this.width === 1 ? 0 : xMult * this.width / 2, + y = this.height === 1 ? 0 : yMult * this.height / 2; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, -x, -y, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @methd toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + x1: this.get('x1'), + y1: this.get('y1'), + x2: this.get('x2'), + y2: this.get('y2') + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), addTranslate = ''; + if (!this.group) { + var x = - this.width / 2 - (this.x1 > this.x2 ? this.x2 : this.x1), + y = - this.height / 2 - (this.y1 > this.y2 ? this.y2 : this.y1); + addTranslate = 'translate(' + x + ', ' + y + ') '; + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Line.fromElement}) + * @static + * @memberOf fabric.Line + * @see http://www.w3.org/TR/SVG/shapes.html#LineElement + */ + fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x1 y1 x2 y2'.split(' ')); + + /** + * Returns fabric.Line instance from an SVG element + * @static + * @memberOf fabric.Line + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Line} instance of fabric.Line + */ + fabric.Line.fromElement = function(element, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES), + points = [ + parsedAttributes.x1 || 0, + parsedAttributes.y1 || 0, + parsedAttributes.x2 || 0, + parsedAttributes.y2 || 0 + ]; + return new fabric.Line(points, extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Line instance from an object representation + * @static + * @memberOf fabric.Line + * @param {Object} object Object to create an instance from + * @return {fabric.Line} instance of fabric.Line + */ + fabric.Line.fromObject = function(object) { + var points = [object.x1, object.y1, object.x2, object.y2]; + return new fabric.Line(points, object); + }; + + /** + * Produces a function that calculates distance from canvas edge to Line origin. + */ + function makeEdgeToOriginGetter(propertyNames, originValues) { + var origin = propertyNames.origin, + axis1 = propertyNames.axis1, + axis2 = propertyNames.axis2, + dimension = propertyNames.dimension, + nearest = originValues.nearest, + center = originValues.center, + farthest = originValues.farthest; + + return function() { + switch (this.get(origin)) { + case nearest: + return Math.min(this.get(axis1), this.get(axis2)); + case center: + return Math.min(this.get(axis1), this.get(axis2)) + (0.5 * this.get(dimension)); + case farthest: + return Math.max(this.get(axis1), this.get(axis2)); + } + }; + + } + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + piBy2 = Math.PI * 2, + extend = fabric.util.object.extend; + + if (fabric.Circle) { + fabric.warn('fabric.Circle is already defined.'); + return; + } + + /** + * Circle class + * @class fabric.Circle + * @extends fabric.Object + * @see {@link fabric.Circle#initialize} for constructor definition + */ + fabric.Circle = fabric.util.createClass(fabric.Object, /** @lends fabric.Circle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'circle', + + /** + * Radius of this circle + * @type Number + * @default + */ + radius: 0, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Circle} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + this.set('radius', options.radius || 0); + }, + + /** + * @private + * @param {String} key + * @param {Any} value + * @return {fabric.Circle} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + + if (key === 'radius') { + this.setRadius(value); + } + + return this; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + radius: this.get('radius') + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0; + if (this.group) { + x = this.left + this.radius; + y = this.top + this.radius; + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.arc(noTransform ? this.left + this.radius : 0, noTransform ? this.top + this.radius : 0, this.radius, 0, piBy2, false); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusX: function() { + return this.get('radius') * this.get('scaleX'); + }, + + /** + * Returns vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusY: function() { + return this.get('radius') * this.get('scaleY'); + }, + + /** + * Sets radius of an object (and updates width accordingly) + * @return {Number} + */ + setRadius: function(value) { + this.radius = value; + this.set('width', value * 2).set('height', value * 2); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Circle.fromElement}) + * @static + * @memberOf fabric.Circle + * @see: http://www.w3.org/TR/SVG/shapes.html#CircleElement + */ + fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy r'.split(' ')); + + /** + * Returns {@link fabric.Circle} instance from an SVG element + * @static + * @memberOf fabric.Circle + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @throws {Error} If value of `r` attribute is missing or invalid + * @return {fabric.Circle} Instance of fabric.Circle + */ + fabric.Circle.fromElement = function(element, options) { + options || (options = { }); + + var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES); + + if (!isValidRadius(parsedAttributes)) { + throw new Error('value of `r` attribute is required and can not be negative'); + } + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + + var obj = new fabric.Circle(extend(parsedAttributes, options)); + + obj.left -= obj.radius; + obj.top -= obj.radius; + return obj; + }; + + /** + * @private + */ + function isValidRadius(attributes) { + return (('radius' in attributes) && (attributes.radius > 0)); + } + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Circle} instance from an object representation + * @static + * @memberOf fabric.Circle + * @param {Object} object Object to create an instance from + * @return {Object} Instance of fabric.Circle + */ + fabric.Circle.fromObject = function(object) { + return new fabric.Circle(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Triangle) { + fabric.warn('fabric.Triangle is already defined'); + return; + } + + /** + * Triangle class + * @class fabric.Triangle + * @extends fabric.Object + * @return {fabric.Triangle} thisArg + * @see {@link fabric.Triangle#initialize} for constructor definition + */ + fabric.Triangle = fabric.util.createClass(fabric.Object, /** @lends fabric.Triangle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'triangle', + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + + this.set('width', options.width || 100) + .set('height', options.height || 100); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + ctx.moveTo(-widthBy2, heightBy2); + ctx.lineTo(0, -heightBy2); + ctx.lineTo(widthBy2, heightBy2); + ctx.closePath(); + + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, -widthBy2, heightBy2, 0, -heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, 0, -heightBy2, widthBy2, heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, widthBy2, heightBy2, -widthBy2, heightBy2, this.strokeDashArray); + ctx.closePath(); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), + widthBy2 = this.width / 2, + heightBy2 = this.height / 2, + points = [ + -widthBy2 + ' ' + heightBy2, + '0 ' + -heightBy2, + widthBy2 + ' ' + heightBy2 + ] + .join(','); + + markup.push( + '' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /** + * Returns fabric.Triangle instance from an object representation + * @static + * @memberOf fabric.Triangle + * @param {Object} object Object to create an instance from + * @return {Object} instance of Canvas.Triangle + */ + fabric.Triangle.fromObject = function(object) { + return new fabric.Triangle(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global){ + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + piBy2 = Math.PI * 2, + extend = fabric.util.object.extend; + + if (fabric.Ellipse) { + fabric.warn('fabric.Ellipse is already defined.'); + return; + } + + /** + * Ellipse class + * @class fabric.Ellipse + * @extends fabric.Object + * @return {fabric.Ellipse} thisArg + * @see {@link fabric.Ellipse#initialize} for constructor definition + */ + fabric.Ellipse = fabric.util.createClass(fabric.Object, /** @lends fabric.Ellipse.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'ellipse', + + /** + * Horizontal radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical radius + * @type Number + * @default + */ + ry: 0, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Ellipse} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + + this.set('rx', options.rx || 0); + this.set('ry', options.ry || 0); + + this.set('width', this.get('rx') * 2); + this.set('height', this.get('ry') * 2); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + rx: this.get('rx'), + ry: this.get('ry') + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0; + if (this.group) { + x = this.left + this.rx; + y = this.top + this.ry; + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.save(); + ctx.transform(1, 0, 0, this.ry/this.rx, 0, 0); + ctx.arc(noTransform ? this.left + this.rx : 0, noTransform ? (this.top + this.ry) * this.rx/this.ry : 0, this.rx, 0, piBy2, false); + ctx.restore(); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Ellipse.fromElement}) + * @static + * @memberOf fabric.Ellipse + * @see http://www.w3.org/TR/SVG/shapes.html#EllipseElement + */ + fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy rx ry'.split(' ')); + + /** + * Returns {@link fabric.Ellipse} instance from an SVG element + * @static + * @memberOf fabric.Ellipse + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromElement = function(element, options) { + options || (options = { }); + + var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES); + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + + var ellipse = new fabric.Ellipse(extend(parsedAttributes, options)); + + ellipse.top -= ellipse.ry; + ellipse.left -= ellipse.rx; + return ellipse; + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Ellipse} instance from an object representation + * @static + * @memberOf fabric.Ellipse + * @param {Object} object Object to create an instance from + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromObject = function(object) { + return new fabric.Ellipse(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + if (fabric.Rect) { + console.warn('fabric.Rect is already defined'); + return; + } + + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push('rx', 'ry', 'x', 'y'); + + /** + * Rectangle class + * @class fabric.Rect + * @extends fabric.Object + * @return {fabric.Rect} thisArg + * @see {@link fabric.Rect#initialize} for constructor definition + */ + fabric.Rect = fabric.util.createClass(fabric.Object, /** @lends fabric.Rect.prototype */ { + + /** + * List of properties to consider when checking if state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: stateProperties, + + /** + * Type of an object + * @type String + * @default + */ + type: 'rect', + + /** + * Horizontal border radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical border radius + * @type Number + * @default + */ + ry: 0, + + /** + * Used to specify dash pattern for stroke on this object + * @type Array + */ + strokeDashArray: null, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + this._initRxRy(); + + }, + + /** + * Initializes rx/ry attributes + * @private + */ + _initRxRy: function() { + if (this.rx && !this.ry) { + this.ry = this.rx; + } + else if (this.ry && !this.rx) { + this.rx = this.ry; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx, noTransform) { + + // optimize 1x1 case (used in spray brush) + if (this.width === 1 && this.height === 1) { + ctx.fillRect(0, 0, 1, 1); + return; + } + + var rx = this.rx ? Math.min(this.rx, this.width / 2) : 0, + ry = this.ry ? Math.min(this.ry, this.height / 2) : 0, + w = this.width, + h = this.height, + x = noTransform ? this.left : -this.width / 2, + y = noTransform ? this.top : -this.height / 2, + isRounded = rx !== 0 || ry !== 0, + k = 1 - 0.5522847498 /* "magic number" for bezier approximations of arcs (http://itc.ktu.lt/itc354/Riskus354.pdf) */; + + ctx.beginPath(); + + ctx.moveTo(x + rx, y); + + ctx.lineTo(x + w - rx, y); + isRounded && ctx.bezierCurveTo(x + w - k * rx, y, x + w, y + k * ry, x + w, y + ry); + + ctx.lineTo(x + w, y + h - ry); + isRounded && ctx.bezierCurveTo(x + w, y + h - k * ry, x + w - k * rx, y + h, x + w - rx, y + h); + + ctx.lineTo(x + rx, y + h); + isRounded && ctx.bezierCurveTo(x + k * rx, y + h, x, y + h - k * ry, x, y + h - ry); + + ctx.lineTo(x, y + ry); + isRounded && ctx.bezierCurveTo(x, y + k * ry, x + k * rx, y, x + rx, y); + + ctx.closePath(); + + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var object = extend(this.callSuper('toObject', propertiesToInclude), { + rx: this.get('rx') || 0, + ry: this.get('ry') || 0 + }); + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = this.left, y = this.top; + if (!this.group) { + x = -this.width / 2; + y = -this.height / 2; + } + markup.push( + '\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Rect.fromElement`) + * @static + * @memberOf fabric.Rect + * @see: http://www.w3.org/TR/SVG/shapes.html#RectElement + */ + fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y rx ry width height'.split(' ')); + + /** + * Returns {@link fabric.Rect} instance from an SVG element + * @static + * @memberOf fabric.Rect + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Rect} Instance of fabric.Rect + */ + fabric.Rect.fromElement = function(element, options) { + if (!element) { + return null; + } + options = options || { }; + + var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES); + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + + return new fabric.Rect(extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Rect} instance from an object representation + * @static + * @memberOf fabric.Rect + * @param {Object} object Object to create an instance from + * @return {Object} instance of fabric.Rect + */ + fabric.Rect.fromObject = function(object) { + return new fabric.Rect(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + toFixed = fabric.util.toFixed; + + if (fabric.Polyline) { + fabric.warn('fabric.Polyline is already defined'); + return; + } + + /** + * Polyline class + * @class fabric.Polyline + * @extends fabric.Object + * @see {@link fabric.Polyline#initialize} for constructor definition + */ + fabric.Polyline = fabric.util.createClass(fabric.Object, /** @lends fabric.Polyline.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polyline', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + /** + * Constructor + * @param {Array} points Array of points (where each point is an object with x and y) + * @param {Object} [options] Options object + * @param {Boolean} [skipOffset] Whether points offsetting should be skipped + * @return {fabric.Polyline} thisArg + * @example + * var poly = new fabric.Polyline([ + * { x: 10, y: 10 }, + * { x: 50, y: 30 }, + * { x: 40, y: 70 }, + * { x: 60, y: 50 }, + * { x: 100, y: 150 }, + * { x: 40, y: 100 } + * ], { + * stroke: 'red', + * left: 100, + * top: 100 + * }); + */ + initialize: function(points, options) { + options = options || { }; + this.set('points', points); + this.callSuper('initialize', options); + this._calcDimensions(); + }, + + /** + * @private + */ + _calcDimensions: function() { + return fabric.Polygon.prototype._calcDimensions.call(this); + }, + + /** + * @private + */ + _applyPointOffset: function() { + return fabric.Polygon.prototype._applyPointOffset.call(this); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return fabric.Polygon.prototype.toObject.call(this, propertiesToInclude); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var points = [], + markup = this._createBaseSVGMarkup(); + + for (var i = 0, len = this.points.length; i < len; i++) { + points.push(toFixed(this.points[i].x, 2), ',', toFixed(this.points[i].y, 2), ' '); + } + + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + var point; + ctx.beginPath(); + + if (this._applyPointOffset) { + if (!(this.group && this.group.type === 'path-group')) { + this._applyPointOffset(); + } + this._applyPointOffset = null; + } + + ctx.moveTo(this.points[0].x, this.points[0].y); + for (var i = 0, len = this.points.length; i < len; i++) { + point = this.points[i]; + ctx.lineTo(point.x, point.y); + } + + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p1, p2; + + ctx.beginPath(); + for (var i = 0, len = this.points.length; i < len; i++) { + p1 = this.points[i]; + p2 = this.points[i + 1] || p1; + fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray); + } + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.get('points').length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Polyline.fromElement}) + * @static + * @memberOf fabric.Polyline + * @see: http://www.w3.org/TR/SVG/shapes.html#PolylineElement + */ + fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns fabric.Polyline instance from an SVG element + * @static + * @memberOf fabric.Polyline + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Polyline} Instance of fabric.Polyline + */ + fabric.Polyline.fromElement = function(element, options) { + if (!element) { + return null; + } + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric.Polyline.ATTRIBUTE_NAMES); + + if (points === null) { + return null; + } + + return new fabric.Polyline(points, fabric.util.object.extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polyline instance from an object representation + * @static + * @memberOf fabric.Polyline + * @param {Object} object Object to create an instance from + * @return {fabric.Polyline} Instance of fabric.Polyline + */ + fabric.Polyline.fromObject = function(object) { + var points = object.points; + return new fabric.Polyline(points, object, true); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + toFixed = fabric.util.toFixed; + + if (fabric.Polygon) { + fabric.warn('fabric.Polygon is already defined'); + return; + } + + /** + * Polygon class + * @class fabric.Polygon + * @extends fabric.Object + * @see {@link fabric.Polygon#initialize} for constructor definition + */ + fabric.Polygon = fabric.util.createClass(fabric.Object, /** @lends fabric.Polygon.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polygon', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + /** + * Constructor + * @param {Array} points Array of points + * @param {Object} [options] Options object + * @return {fabric.Polygon} thisArg + */ + initialize: function(points, options) { + options = options || { }; + this.points = points; + this.callSuper('initialize', options); + this._calcDimensions(); + }, + + /** + * @private + */ + _calcDimensions: function() { + + var points = this.points, + minX = min(points, 'x'), + minY = min(points, 'y'), + maxX = max(points, 'x'), + maxY = max(points, 'y'); + + this.width = (maxX - minX) || 1; + this.height = (maxY - minY) || 1; + + this.left = minX, + this.top = minY; + }, + + /** + * @private + */ + _applyPointOffset: function() { + // change points to offset polygon into a bounding box + // executed one time + this.points.forEach(function(p) { + p.x -= (this.left + this.width / 2); + p.y -= (this.top + this.height / 2); + }, this); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + points: this.points.concat() + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var points = [], + markup = this._createBaseSVGMarkup(); + + for (var i = 0, len = this.points.length; i < len; i++) { + points.push(toFixed(this.points[i].x, 2), ',', toFixed(this.points[i].y, 2), ' '); + } + + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + var point; + ctx.beginPath(); + + if (this._applyPointOffset) { + if (!(this.group && this.group.type === 'path-group')) { + this._applyPointOffset(); + } + this._applyPointOffset = null; + } + + ctx.moveTo(this.points[0].x, this.points[0].y); + for (var i = 0, len = this.points.length; i < len; i++) { + point = this.points[i]; + ctx.lineTo(point.x, point.y); + } + this._renderFill(ctx); + if (this.stroke || this.strokeDashArray) { + ctx.closePath(); + this._renderStroke(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p1, p2; + + ctx.beginPath(); + for (var i = 0, len = this.points.length; i < len; i++) { + p1 = this.points[i]; + p2 = this.points[i + 1] || this.points[0]; + fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray); + } + ctx.closePath(); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.points.length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Polygon.fromElement`) + * @static + * @memberOf fabric.Polygon + * @see: http://www.w3.org/TR/SVG/shapes.html#PolygonElement + */ + fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns {@link fabric.Polygon} instance from an SVG element + * @static + * @memberOf fabric.Polygon + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Polygon} Instance of fabric.Polygon + */ + fabric.Polygon.fromElement = function(element, options) { + if (!element) { + return null; + } + + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric.Polygon.ATTRIBUTE_NAMES); + + if (points === null) { + return null; + } + + return new fabric.Polygon(points, extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polygon instance from an object representation + * @static + * @memberOf fabric.Polygon + * @param {Object} object Object to create an instance from + * @return {fabric.Polygon} Instance of fabric.Polygon + */ + fabric.Polygon.fromObject = function(object) { + return new fabric.Polygon(object.points, object, true); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + min = fabric.util.array.min, + max = fabric.util.array.max, + extend = fabric.util.object.extend, + _toString = Object.prototype.toString, + drawArc = fabric.util.drawArc, + commandLengths = { + m: 2, + l: 2, + h: 1, + v: 1, + c: 6, + s: 4, + q: 4, + t: 2, + a: 7 + }, + repeatedCommands = { + m: 'l', + M: 'L' + }; + + if (fabric.Path) { + fabric.warn('fabric.Path is already defined'); + return; + } + + /** + * @private + */ + function getX(item) { + if (item[0] === 'H') { + return item[1]; + } + return item[item.length - 2]; + } + + /** + * @private + */ + function getY(item) { + if (item[0] === 'V') { + return item[1]; + } + return item[item.length - 1]; + } + + /** + * Path class + * @class fabric.Path + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#path_and_pathgroup} + * @see {@link fabric.Path#initialize} for constructor definition + */ + fabric.Path = fabric.util.createClass(fabric.Object, /** @lends fabric.Path.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path', + + /** + * Array of path points + * @type Array + * @default + */ + path: null, + + /** + * Constructor + * @param {Array|String} path Path data (sequence of coordinates and corresponding "command" tokens) + * @param {Object} [options] Options object + * @return {fabric.Path} thisArg + */ + initialize: function(path, options) { + options = options || { }; + + this.setOptions(options); + + if (!path) { + throw new Error('`path` argument is required'); + } + + var fromArray = _toString.call(path) === '[object Array]'; + + this.path = fromArray + ? path + // one of commands (m,M,l,L,q,Q,c,C,etc.) followed by non-command characters (i.e. command values) + : path.match && path.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi); + + if (!this.path) { + return; + } + + if (!fromArray) { + this.path = this._parsePath(); + } + this._initializePath(options); + + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initializePath: function (options) { + var isWidthSet = 'width' in options && options.width != null, + isHeightSet = 'height' in options && options.width != null, + isLeftSet = 'left' in options, + isTopSet = 'top' in options, + origLeft = isLeftSet ? this.left : 0, + origTop = isTopSet ? this.top : 0; + + if (!isWidthSet || !isHeightSet) { + extend(this, this._parseDimensions()); + if (isWidthSet) { + this.width = options.width; + } + if (isHeightSet) { + this.height = options.height; + } + } + else { //Set center location relative to given height/width if not specified + if (!isTopSet) { + this.top = this.height / 2; + } + if (!isLeftSet) { + this.left = this.width / 2; + } + } + this.pathOffset = this.pathOffset || + // Save top-left coords as offset + this._calculatePathOffset(origLeft, origTop); + }, + + /** + * @private + * @param {Number} origLeft Original left position + * @param {Number} origTop Original top position + */ + _calculatePathOffset: function (origLeft, origTop) { + return { + x: this.left - origLeft - (this.width / 2), + y: this.top - origTop - (this.height / 2) + }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _render: function(ctx, noTransform) { + var current, // current instruction + previous = null, + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + tempX, + tempY, + tempControlX, + tempControlY, + l = -((this.width / 2) + this.pathOffset.x), + t = -((this.height / 2) + this.pathOffset.y); + + if (noTransform) { + l += this.width / 2; + t += this.height / 2; + } + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'l': // lineto, relative + x += current[1]; + y += current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'h': // horizontal lineto, relative + x += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'H': // horizontal lineto, absolute + x = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'v': // vertical lineto, relative + y += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'V': // verical lineto, absolute + y = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'm': // moveTo, relative + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'c': // bezierCurveTo, relative + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + ctx.bezierCurveTo( + x + current[1] + l, // x1 + y + current[2] + t, // y1 + controlX + l, // x2 + controlY + t, // y2 + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'C': // bezierCurveTo, absolute + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + ctx.bezierCurveTo( + current[1] + l, + current[2] + t, + controlX + l, + controlY + t, + x + l, + y + t + ); + break; + + case 's': // shorthand cubic bezierCurveTo, relative + + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + // calculate reflection of previous control points + controlX = controlX ? (2 * x - controlX) : x; + controlY = controlY ? (2 * y - controlY) : y; + + ctx.bezierCurveTo( + controlX + l, + controlY + t, + x + current[1] + l, + y + current[2] + t, + tempX + l, + tempY + t + ); + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = x + current[1]; + controlY = y + current[2]; + + x = tempX; + y = tempY; + break; + + case 'S': // shorthand cubic bezierCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + ctx.bezierCurveTo( + controlX + l, + controlY + t, + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = current[1]; + controlY = current[2]; + + break; + + case 'q': // quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + controlX = x + current[1]; + controlY = y + current[2]; + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'Q': // quadraticCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + + ctx.quadraticCurveTo( + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + controlX = current[1]; + controlY = current[2]; + break; + + case 't': // shorthand quadraticCurveTo, relative + + // transform to absolute x,y + tempX = x + current[1]; + tempY = y + current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else if (previous[0] === 't') { + // calculate reflection of previous control points for t + controlX = 2 * x - tempControlX; + controlY = 2 * y - tempControlY; + } + else if (previous[0] === 'q') { + // calculate reflection of previous control points for q + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + tempControlX = controlX; + tempControlY = controlY; + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + controlX = x + current[1]; + controlY = y + current[2]; + break; + + case 'T': + tempX = current[1]; + tempY = current[2]; + + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'a': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + x + l, + current[7] + y + t + ]); + x += current[6]; + y += current[7]; + break; + + case 'A': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + l, + current[7] + t + ]); + x = current[6]; + y = current[7]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + ctx.closePath(); + break; + } + previous = current; + } + }, + + /** + * Renders path on a specified context + * @param {CanvasRenderingContext2D} ctx context to render path on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + render: function(ctx, noTransform) { + // do not render if object is not visible + if (!this.visible) { + return; + } + + ctx.save(); + if (noTransform) { + ctx.translate(-this.width/2, -this.height/2); + } + var m = this.transformMatrix; + + if (m) { + ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]); + } + if (!noTransform) { + this.transform(ctx); + } + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + ctx.beginPath(); + ctx.globalAlpha = this.group ? (ctx.globalAlpha * this.opacity) : this.opacity; + this._render(ctx, noTransform); + this._renderFill(ctx); + this._renderStroke(ctx); + this.clipTo && ctx.restore(); + this._removeShadow(ctx); + ctx.restore(); + }, + + /** + * Returns string representation of an instance + * @return {String} string representation of an instance + */ + toString: function() { + return '#'; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var o = extend(this.callSuper('toObject', propertiesToInclude), { + path: this.path.map(function(item) { return item.slice() }), + pathOffset: this.pathOffset + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + if (this.transformMatrix) { + o.transformMatrix = this.transformMatrix; + } + return o; + }, + + /** + * Returns dataless object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.path = this.sourcePath; + } + delete o.sourcePath; + return o; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var chunks = [], + markup = this._createBaseSVGMarkup(); + + for (var i = 0, len = this.path.length; i < len; i++) { + chunks.push(this.path[i].join(' ')); + } + var path = chunks.join(' '); + + markup.push( + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns number representation of an instance complexity + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.path.length; + }, + + /** + * @private + */ + _parsePath: function() { + var result = [ ], + coords = [ ], + currentPath, + parsed, + re = /([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:e[-+]?\d+)?)/ig, + match, + coordsStr; + + for (var i = 0, coordsParsed, len = this.path.length; i < len; i++) { + currentPath = this.path[i]; + + coordsStr = currentPath.slice(1).trim(); + coords.length = 0; + + while ((match = re.exec(coordsStr))) { + coords.push(match[0]); + } + + coordsParsed = [ currentPath.charAt(0) ]; + + for (var j = 0, jlen = coords.length; j < jlen; j++) { + parsed = parseFloat(coords[j]); + if (!isNaN(parsed)) { + coordsParsed.push(parsed); + } + } + + var command = coordsParsed[0], + commandLength = commandLengths[command.toLowerCase()], + repeatedCommand = repeatedCommands[command] || command; + + if (coordsParsed.length - 1 > commandLength) { + for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) { + result.push([ command ].concat(coordsParsed.slice(k, k + commandLength))); + command = repeatedCommand; + } + } + else { + result.push(coordsParsed); + } + } + + return result; + }, + + /** + * @private + */ + _parseDimensions: function() { + var aX = [], + aY = [], + previous = { }; + + this.path.forEach(function(item, i) { + this._getCoordsFromCommand(item, i, aX, aY, previous); + }, this); + + var minX = min(aX), + minY = min(aY), + maxX = max(aX), + maxY = max(aY), + deltaX = maxX - minX, + deltaY = maxY - minY, + + o = { + left: this.left + (minX + deltaX / 2), + top: this.top + (minY + deltaY / 2), + width: deltaX, + height: deltaY + }; - if (text_decoration !== "none"){ - return _html2canvas.Util.Font(family, size, doc); - } - } + return o; + }, - function renderTextDecoration(ctx, text_decoration, bounds, metrics, color) { - switch(text_decoration) { - case "underline": - // Draws a line at the baseline of the font - // TODO As some browsers display the line as more than 1px if the font-size is big, need to take that into account both in position and size - renderRect(ctx, bounds.left, Math.round(bounds.top + metrics.baseline + metrics.lineWidth), bounds.width, 1, color); - break; - case "overline": - renderRect(ctx, bounds.left, Math.round(bounds.top), bounds.width, 1, color); - break; - case "line-through": - // TODO try and find exact position for line-through - renderRect(ctx, bounds.left, Math.ceil(bounds.top + metrics.middle + metrics.lineWidth), bounds.width, 1, color); - break; - } - } + _getCoordsFromCommand: function(item, i, aX, aY, previous) { + var isLowerCase = false; - function getTextBounds(state, text, textDecoration, isLast) { - var bounds; - if (support.rangeBounds) { - if (textDecoration !== "none" || _html2canvas.Util.trimText(text).length !== 0) { - bounds = textRangeBounds(text, state.node, state.textOffset); + if (item[0] !== 'H') { + previous.x = (i === 0) ? getX(item) : getX(this.path[i - 1]); + } + if (item[0] !== 'V') { + previous.y = (i === 0) ? getY(item) : getY(this.path[i - 1]); } - state.textOffset += text.length; - } else if (state.node && typeof state.node.nodeValue === "string" ){ - var newTextNode = (isLast) ? state.node.splitText(text.length) : null; - bounds = textWrapperBounds(state.node); - state.node = newTextNode; - } - return bounds; - } - - function textRangeBounds(text, textNode, textOffset) { - var range = doc.createRange(); - range.setStart(textNode, textOffset); - range.setEnd(textNode, textOffset + text.length); - return range.getBoundingClientRect(); - } - function textWrapperBounds(oldTextNode) { - var parent = oldTextNode.parentNode, - wrapElement = doc.createElement('wrapper'), - backupText = oldTextNode.cloneNode(true); + // lowercased letter denotes relative position; + // transform to absolute + if (item[0] === item[0].toLowerCase()) { + isLowerCase = true; + } - wrapElement.appendChild(oldTextNode.cloneNode(true)); - parent.replaceChild(wrapElement, oldTextNode); + var xy = this._getXY(item, isLowerCase, previous), + val; - var bounds = _html2canvas.Util.Bounds(wrapElement); - parent.replaceChild(backupText, wrapElement); - return bounds; - } + val = parseInt(xy.x, 10); + if (!isNaN(val)) { + aX.push(val); + } - function renderText(el, textNode, stack) { - var ctx = stack.ctx, - color = getCSS(el, "color"), - textDecoration = getCSS(el, "textDecoration"), - textAlign = getCSS(el, "textAlign"), - metrics, - textList, - state = { - node: textNode, - textOffset: 0 - }; + val = parseInt(xy.y, 10); + if (!isNaN(val)) { + aY.push(val); + } + }, - if (_html2canvas.Util.trimText(textNode.nodeValue).length > 0) { - textNode.nodeValue = textTransform(textNode.nodeValue, getCSS(el, "textTransform")); - textAlign = textAlign.replace(["-webkit-auto"],["auto"]); + _getXY: function(item, isLowerCase, previous) { - textList = (!options.letterRendering && /^(left|right|justify|auto)$/.test(textAlign) && noLetterSpacing(getCSS(el, "letterSpacing"))) ? - textNode.nodeValue.split(/(\b| )/) - : textNode.nodeValue.split(""); + // last 2 items in an array of coordinates are the actualy x/y (except H/V), collect them + // TODO (kangax): support relative h/v commands - metrics = setTextVariables(ctx, el, textDecoration, color); + var x = isLowerCase + ? previous.x + getX(item) + : item[0] === 'V' + ? previous.x + : getX(item), - if (options.chinese) { - textList.forEach(function(word, index) { - if (/.*[\u4E00-\u9FA5].*$/.test(word)) { - word = word.split(""); - word.unshift(index, 1); - textList.splice.apply(textList, word); - } - }); - } + y = isLowerCase + ? previous.y + getY(item) + : item[0] === 'H' + ? previous.y + : getY(item); - textList.forEach(function(text, index) { - var bounds = getTextBounds(state, text, textDecoration, (index < textList.length - 1)); - if (bounds) { - drawText(text, bounds.left, bounds.bottom, ctx); - renderTextDecoration(ctx, textDecoration, bounds, metrics, color); - } + return { x: x, y: y }; + } + }); + + /** + * Creates an instance of fabric.Path from an object + * @static + * @memberOf fabric.Path + * @param {Object} object + * @param {Function} callback Callback to invoke when an fabric.Path instance is created + */ + fabric.Path.fromObject = function(object, callback) { + if (typeof object.path === 'string') { + fabric.loadSVGFromURL(object.path, function (elements) { + var path = elements[0], + pathUrl = object.path; + + delete object.path; + + fabric.util.object.extend(path, object); + path.setSourcePath(pathUrl); + + callback(path); }); } - } + else { + callback(new fabric.Path(object.path, object)); + } + }; - function listPosition (element, val) { - var boundElement = doc.createElement( "boundelement" ), - originalType, - bounds; + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Path.fromElement`) + * @static + * @memberOf fabric.Path + * @see http://www.w3.org/TR/SVG/paths.html#PathElement + */ + fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(['d']); + + /** + * Creates an instance of fabric.Path from an SVG element + * @static + * @memberOf fabric.Path + * @param {SVGElement} element to parse + * @param {Function} callback Callback to invoke when an fabric.Path instance is created + * @param {Object} [options] Options object + */ + fabric.Path.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES); + callback && callback(new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options))); + }; + /* _FROM_SVG_END_ */ - boundElement.style.display = "inline"; + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.Path + * @type Boolean + * @default + */ + fabric.Path.async = true; - originalType = element.style.listStyleType; - element.style.listStyleType = "none"; +})(typeof exports !== 'undefined' ? exports : this); - boundElement.appendChild(doc.createTextNode(val)); - element.insertBefore(boundElement, element.firstChild); +(function(global) { - bounds = _html2canvas.Util.Bounds(boundElement); - element.removeChild(boundElement); - element.style.listStyleType = originalType; - return bounds; - } + 'use strict'; - function elementIndex( el ) { - var i = -1, - count = 1, - childs = el.parentNode.childNodes; + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + invoke = fabric.util.array.invoke, + parentToObject = fabric.Object.prototype.toObject; - if (el.parentNode) { - while( childs[ ++i ] !== el ) { - if ( childs[ i ].nodeType === 1 ) { - count++; - } - } - return count; - } else { - return -1; - } + if (fabric.PathGroup) { + fabric.warn('fabric.PathGroup is already defined'); + return; } - function listItemText(element, type) { - var currentIndex = elementIndex(element), - text; - switch(type){ - case "decimal": - text = currentIndex; - break; - case "decimal-leading-zero": - text = (currentIndex.toString().length === 1) ? currentIndex = "0" + currentIndex.toString() : currentIndex.toString(); - break; - case "upper-roman": - text = _html2canvas.Generate.ListRoman( currentIndex ); - break; - case "lower-roman": - text = _html2canvas.Generate.ListRoman( currentIndex ).toLowerCase(); - break; - case "lower-alpha": - text = _html2canvas.Generate.ListAlpha( currentIndex ).toLowerCase(); - break; - case "upper-alpha": - text = _html2canvas.Generate.ListAlpha( currentIndex ); - break; - } + /** + * Path group class + * @class fabric.PathGroup + * @extends fabric.Path + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#path_and_pathgroup} + * @see {@link fabric.PathGroup#initialize} for constructor definition + */ + fabric.PathGroup = fabric.util.createClass(fabric.Path, /** @lends fabric.PathGroup.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path-group', + + /** + * Fill value + * @type String + * @default + */ + fill: '', + + /** + * Constructor + * @param {Array} paths + * @param {Object} [options] Options object + * @return {fabric.PathGroup} thisArg + */ + initialize: function(paths, options) { + + options = options || { }; + this.paths = paths || [ ]; + + for (var i = this.paths.length; i--; ) { + this.paths[i].group = this; + } - text += ". "; - return text; - } + this.setOptions(options); - function renderListItem(element, stack, elBounds) { - var x, - text, - ctx = stack.ctx, - type = getCSS(element, "listStyleType"), - listBounds; + if (options.widthAttr) { + this.scaleX = options.widthAttr / options.width; + } + if (options.heightAttr) { + this.scaleY = options.heightAttr / options.height; + } - if (/^(decimal|decimal-leading-zero|upper-alpha|upper-latin|upper-roman|lower-alpha|lower-greek|lower-latin|lower-roman)$/i.test(type)) { - text = listItemText(element, type); - listBounds = listPosition(element, text); - setTextVariables(ctx, element, "none", getCSS(element, "color")); + this.setCoords(); - if (getCSS(element, "listStylePosition") === "inside") { - ctx.setVariable("textAlign", "left"); - x = elBounds.left; - } else { - return; + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); } + }, - drawText(text, x, listBounds.bottom, ctx); - } - } - - function loadImage (src){ - var img = images[src]; - if (img && img.succeeded === true) { - return img.img; - } else { - return false; - } - } + /** + * Renders this group on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render this instance on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } - function clipBounds(src, dst){ - var x = Math.max(src.left, dst.left), - y = Math.max(src.top, dst.top), - x2 = Math.min((src.left + src.width), (dst.left + dst.width)), - y2 = Math.min((src.top + src.height), (dst.top + dst.height)); + ctx.save(); - return { - left:x, - top:y, - width:x2-x, - height:y2-y - }; - } + var m = this.transformMatrix; - function setZ(zIndex, parentZ){ - // TODO fix static elements overlapping relative/absolute elements under same stack, if they are defined after them - var newContext; - if (!parentZ){ - newContext = h2czContext(0); - return newContext; - } + if (m) { + ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]); + } + this.transform(ctx); - if (zIndex !== "auto"){ - newContext = h2czContext(zIndex); - parentZ.children.push(newContext); - return newContext; + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + for (var i = 0, l = this.paths.length; i < l; ++i) { + this.paths[i].render(ctx, true); + } + this.clipTo && ctx.restore(); + this._removeShadow(ctx); + ctx.restore(); + }, - } + /** + * Sets certain property to a certain value + * @param {String} prop + * @param {Any} value + * @return {fabric.PathGroup} thisArg + */ + _set: function(prop, value) { + + if (prop === 'fill' && value && this.isSameColor()) { + var i = this.paths.length; + while (i--) { + this.paths[i]._set(prop, value); + } + } - return parentZ; - } + return this.callSuper('_set', prop, value); + }, - function renderImage(ctx, element, image, bounds, borders) { + /** + * Returns object representation of this path group + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var o = extend(parentToObject.call(this, propertiesToInclude), { + paths: invoke(this.getObjects(), 'toObject', propertiesToInclude) + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + return o; + }, - var paddingLeft = getCSSInt(element, 'paddingLeft'), - paddingTop = getCSSInt(element, 'paddingTop'), - paddingRight = getCSSInt(element, 'paddingRight'), - paddingBottom = getCSSInt(element, 'paddingBottom'); + /** + * Returns dataless object representation of this path group + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} dataless object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.paths = this.sourcePath; + } + return o; + }, - drawImage( - ctx, - image, - 0, //sx - 0, //sy - image.width, //sw - image.height, //sh - bounds.left + paddingLeft + borders[3].width, //dx - bounds.top + paddingTop + borders[0].width, // dy - bounds.width - (borders[1].width + borders[3].width + paddingLeft + paddingRight), //dw - bounds.height - (borders[0].width + borders[2].width + paddingTop + paddingBottom) //dh - ); - } + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var objects = this.getObjects(), + translatePart = 'translate(' + this.left + ' ' + this.top + ')', + markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + + for (var i = 0, len = objects.length; i < len; i++) { + markup.push(objects[i].toSVG(reviver)); + } + markup.push('\n'); - function getBorderData(element) { - return ["Top", "Right", "Bottom", "Left"].map(function(side) { - return { - width: getCSSInt(element, 'border' + side + 'Width'), - color: getCSS(element, 'border' + side + 'Color') - }; - }); - } + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns a string representation of this path group + * @return {String} string representation of an object + */ + toString: function() { + return '#'; + }, - function getBorderRadiusData(element) { - return ["TopLeft", "TopRight", "BottomRight", "BottomLeft"].map(function(side) { - return getCSS(element, 'border' + side + 'Radius'); - }); - } + /** + * Returns true if all paths in this group are of same color + * @return {Boolean} true if all paths are of the same color (`fill`) + */ + isSameColor: function() { + var firstPathFill = (this.getObjects()[0].get('fill') || '').toLowerCase(); + return this.getObjects().every(function(path) { + return (path.get('fill') || '').toLowerCase() === firstPathFill; + }); + }, - var getCurvePoints = (function(kappa) { + /** + * Returns number representation of object's complexity + * @return {Number} complexity + */ + complexity: function() { + return this.paths.reduce(function(total, path) { + return total + ((path && path.complexity) ? path.complexity() : 0); + }, 0); + }, - return function(x, y, r1, r2) { - var ox = (r1) * kappa, // control point offset horizontal - oy = (r2) * kappa, // control point offset vertical - xm = x + r1, // x-middle - ym = y + r2; // y-middle - return { - topLeft: bezierCurve({ - x:x, - y:ym - }, { - x:x, - y:ym - oy - }, { - x:xm - ox, - y:y - }, { - x:xm, - y:y - }), - topRight: bezierCurve({ - x:x, - y:y - }, { - x:x + ox, - y:y - }, { - x:xm, - y:ym - oy - }, { - x:xm, - y:ym - }), - bottomRight: bezierCurve({ - x:xm, - y:y - }, { - x:xm, - y:y + oy - }, { - x:x + ox, - y:ym - }, { - x:x, - y:ym - }), - bottomLeft: bezierCurve({ - x:xm, - y:ym - }, { - x:xm - ox, - y:ym - }, { - x:x, - y:y + oy - }, { - x:x, - y:y - }) - }; - }; - })(4 * ((Math.sqrt(2) - 1) / 3)); + /** + * Returns all paths in this path group + * @return {Array} array of path objects included in this path group + */ + getObjects: function() { + return this.paths; + } + }); - function bezierCurve(start, startControl, endControl, end) { + /** + * Creates fabric.PathGroup instance from an object representation + * @static + * @memberOf fabric.PathGroup + * @param {Object} object Object to create an instance from + * @param {Function} callback Callback to invoke when an fabric.PathGroup instance is created + */ + fabric.PathGroup.fromObject = function(object, callback) { + if (typeof object.paths === 'string') { + fabric.loadSVGFromURL(object.paths, function (elements) { - var lerp = function (a, b, t) { - return { - x:a.x + (b.x - a.x) * t, - y:a.y + (b.y - a.y) * t - }; - }; + var pathUrl = object.paths; + delete object.paths; - return { - start: start, - startControl: startControl, - endControl: endControl, - end: end, - subdivide: function(t) { - var ab = lerp(start, startControl, t), - bc = lerp(startControl, endControl, t), - cd = lerp(endControl, end, t), - abbc = lerp(ab, bc, t), - bccd = lerp(bc, cd, t), - dest = lerp(abbc, bccd, t); - return [bezierCurve(start, ab, abbc, dest), bezierCurve(dest, bccd, cd, end)]; - }, - curveTo: function(borderArgs) { - borderArgs.push(["bezierCurve", startControl.x, startControl.y, endControl.x, endControl.y, end.x, end.y]); - }, - curveToReversed: function(borderArgs) { - borderArgs.push(["bezierCurve", endControl.x, endControl.y, startControl.x, startControl.y, start.x, start.y]); - } - }; - } + var pathGroup = fabric.util.groupSVGElements(elements, object, pathUrl); - function parseCorner(borderArgs, radius1, radius2, corner1, corner2, x, y) { - if (radius1[0] > 0 || radius1[1] > 0) { - borderArgs.push(["line", corner1[0].start.x, corner1[0].start.y]); - corner1[0].curveTo(borderArgs); - corner1[1].curveTo(borderArgs); - } else { - borderArgs.push(["line", x, y]); + callback(pathGroup); + }); } - - if (radius2[0] > 0 || radius2[1] > 0) { - borderArgs.push(["line", corner2[0].start.x, corner2[0].start.y]); + else { + fabric.util.enlivenObjects(object.paths, function(enlivenedObjects) { + delete object.paths; + callback(new fabric.PathGroup(enlivenedObjects, object)); + }); } - } + }; - function drawSide(borderData, radius1, radius2, outer1, inner1, outer2, inner2) { - var borderArgs = []; + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.PathGroup + * @type Boolean + * @default + */ + fabric.PathGroup.async = true; - if (radius1[0] > 0 || radius1[1] > 0) { - borderArgs.push(["line", outer1[1].start.x, outer1[1].start.y]); - outer1[1].curveTo(borderArgs); - } else { - borderArgs.push([ "line", borderData.c1[0], borderData.c1[1]]); - } +})(typeof exports !== 'undefined' ? exports : this); - if (radius2[0] > 0 || radius2[1] > 0) { - borderArgs.push(["line", outer2[0].start.x, outer2[0].start.y]); - outer2[0].curveTo(borderArgs); - borderArgs.push(["line", inner2[0].end.x, inner2[0].end.y]); - inner2[0].curveToReversed(borderArgs); - } else { - borderArgs.push([ "line", borderData.c2[0], borderData.c2[1]]); - borderArgs.push([ "line", borderData.c3[0], borderData.c3[1]]); - } - if (radius1[0] > 0 || radius1[1] > 0) { - borderArgs.push(["line", inner1[1].end.x, inner1[1].end.y]); - inner1[1].curveToReversed(borderArgs); - } else { - borderArgs.push([ "line", borderData.c4[0], borderData.c4[1]]); - } +(function(global){ - return borderArgs; + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + invoke = fabric.util.array.invoke; + + if (fabric.Group) { + return; } - function calculateCurvePoints(bounds, borderRadius, borders) { + // lock-related properties, for use in fabric.Group#get + // to enable locking behavior on group + // when one of its objects has lock-related properties set + var _lockProperties = { + lockMovementX: true, + lockMovementY: true, + lockRotation: true, + lockScalingX: true, + lockScalingY: true, + lockUniScaling: true + }; - var x = bounds.left, - y = bounds.top, - width = bounds.width, - height = bounds.height, - - tlh = borderRadius[0][0], - tlv = borderRadius[0][1], - trh = borderRadius[1][0], - trv = borderRadius[1][1], - brv = borderRadius[2][0], - brh = borderRadius[2][1], - blh = borderRadius[3][0], - blv = borderRadius[3][1], - - topWidth = width - trh, - rightHeight = height - brv, - bottomWidth = width - brh, - leftHeight = height - blv; + /** + * Group class + * @class fabric.Group + * @extends fabric.Object + * @mixes fabric.Collection + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#groups} + * @see {@link fabric.Group#initialize} for constructor definition + */ + fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, /** @lends fabric.Group.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'group', + + /** + * Constructor + * @param {Object} objects Group objects + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(objects, options) { + options = options || { }; + + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } - return { - topLeftOuter: getCurvePoints( - x, - y, - tlh, - tlv - ).topLeft.subdivide(0.5), - - topLeftInner: getCurvePoints( - x + borders[3].width, - y + borders[0].width, - Math.max(0, tlh - borders[3].width), - Math.max(0, tlv - borders[0].width) - ).topLeft.subdivide(0.5), - - topRightOuter: getCurvePoints( - x + topWidth, - y, - trh, - trv - ).topRight.subdivide(0.5), - - topRightInner: getCurvePoints( - x + Math.min(topWidth, width + borders[3].width), - y + borders[0].width, - (topWidth > width + borders[3].width) ? 0 :trh - borders[3].width, - trv - borders[0].width - ).topRight.subdivide(0.5), - - bottomRightOuter: getCurvePoints( - x + bottomWidth, - y + rightHeight, - brh, - brv - ).bottomRight.subdivide(0.5), - - bottomRightInner: getCurvePoints( - x + Math.min(bottomWidth, width + borders[3].width), - y + Math.min(rightHeight, height + borders[0].width), - Math.max(0, brh - borders[1].width), - Math.max(0, brv - borders[2].width) - ).bottomRight.subdivide(0.5), - - bottomLeftOuter: getCurvePoints( - x, - y + leftHeight, - blh, - blv - ).bottomLeft.subdivide(0.5), - - bottomLeftInner: getCurvePoints( - x + borders[3].width, - y + leftHeight, - Math.max(0, blh - borders[3].width), - Math.max(0, blv - borders[2].width) - ).bottomLeft.subdivide(0.5) - }; - } + this.originalState = { }; + this.callSuper('initialize'); - function getBorderClip(element, borderPoints, borders, radius, bounds) { - var backgroundClip = getCSS(element, 'backgroundClip'), - borderArgs = []; + this._calcBounds(); + this._updateObjectsCoords(); - switch(backgroundClip) { - case "content-box": - case "padding-box": - parseCorner(borderArgs, radius[0], radius[1], borderPoints.topLeftInner, borderPoints.topRightInner, bounds.left + borders[3].width, bounds.top + borders[0].width); - parseCorner(borderArgs, radius[1], radius[2], borderPoints.topRightInner, borderPoints.bottomRightInner, bounds.left + bounds.width - borders[1].width, bounds.top + borders[0].width); - parseCorner(borderArgs, radius[2], radius[3], borderPoints.bottomRightInner, borderPoints.bottomLeftInner, bounds.left + bounds.width - borders[1].width, bounds.top + bounds.height - borders[2].width); - parseCorner(borderArgs, radius[3], radius[0], borderPoints.bottomLeftInner, borderPoints.topLeftInner, bounds.left + borders[3].width, bounds.top + bounds.height - borders[2].width); - break; + if (options) { + extend(this, options); + } + this._setOpacityIfSame(); - default: - parseCorner(borderArgs, radius[0], radius[1], borderPoints.topLeftOuter, borderPoints.topRightOuter, bounds.left, bounds.top); - parseCorner(borderArgs, radius[1], radius[2], borderPoints.topRightOuter, borderPoints.bottomRightOuter, bounds.left + bounds.width, bounds.top); - parseCorner(borderArgs, radius[2], radius[3], borderPoints.bottomRightOuter, borderPoints.bottomLeftOuter, bounds.left + bounds.width, bounds.top + bounds.height); - parseCorner(borderArgs, radius[3], radius[0], borderPoints.bottomLeftOuter, borderPoints.topLeftOuter, bounds.left, bounds.top + bounds.height); - break; - } + this.setCoords(); + this.saveCoords(); + }, - return borderArgs; - } + /** + * @private + */ + _updateObjectsCoords: function() { + this.forEachObject(this._updateObjectCoords, this); + }, - function parseBorders(element, bounds, borders){ - var x = bounds.left, - y = bounds.top, - width = bounds.width, - height = bounds.height, - borderSide, - bx, - by, - bw, - bh, - borderArgs, - // http://www.w3.org/TR/css3-background/#the-border-radius - borderRadius = getBorderRadiusData(element), - borderPoints = calculateCurvePoints(bounds, borderRadius, borders), - borderData = { - clip: getBorderClip(element, borderPoints, borders, borderRadius, bounds), - borders: [] - }; + /** + * @private + */ + _updateObjectCoords: function(object) { + var objectLeft = object.getLeft(), + objectTop = object.getTop(); + + object.set({ + originalLeft: objectLeft, + originalTop: objectTop, + left: objectLeft - this.left, + top: objectTop - this.top + }); - for (borderSide = 0; borderSide < 4; borderSide++) { - - if (borders[borderSide].width > 0) { - bx = x; - by = y; - bw = width; - bh = height - (borders[2].width); - - switch(borderSide) { - case 0: - // top border - bh = borders[0].width; - - borderArgs = drawSide({ - c1: [bx, by], - c2: [bx + bw, by], - c3: [bx + bw - borders[1].width, by + bh], - c4: [bx + borders[3].width, by + bh] - }, borderRadius[0], borderRadius[1], - borderPoints.topLeftOuter, borderPoints.topLeftInner, borderPoints.topRightOuter, borderPoints.topRightInner); - break; - case 1: - // right border - bx = x + width - (borders[1].width); - bw = borders[1].width; - - borderArgs = drawSide({ - c1: [bx + bw, by], - c2: [bx + bw, by + bh + borders[2].width], - c3: [bx, by + bh], - c4: [bx, by + borders[0].width] - }, borderRadius[1], borderRadius[2], - borderPoints.topRightOuter, borderPoints.topRightInner, borderPoints.bottomRightOuter, borderPoints.bottomRightInner); - break; - case 2: - // bottom border - by = (by + height) - (borders[2].width); - bh = borders[2].width; - - borderArgs = drawSide({ - c1: [bx + bw, by + bh], - c2: [bx, by + bh], - c3: [bx + borders[3].width, by], - c4: [bx + bw - borders[2].width, by] - }, borderRadius[2], borderRadius[3], - borderPoints.bottomRightOuter, borderPoints.bottomRightInner, borderPoints.bottomLeftOuter, borderPoints.bottomLeftInner); - break; - case 3: - // left border - bw = borders[3].width; - - borderArgs = drawSide({ - c1: [bx, by + bh + borders[2].width], - c2: [bx, by], - c3: [bx + bw, by + borders[0].width], - c4: [bx + bw, by + bh] - }, borderRadius[3], borderRadius[0], - borderPoints.bottomLeftOuter, borderPoints.bottomLeftInner, borderPoints.topLeftOuter, borderPoints.topLeftInner); - break; - } + object.setCoords(); - borderData.borders.push({ - args: borderArgs, - color: borders[borderSide].color - }); + // do not display corners of objects enclosed in a group + object.__origHasControls = object.hasControls; + object.hasControls = false; + }, + + /** + * Returns string represenation of a group + * @return {String} + */ + toString: function() { + return '#'; + }, + /** + * Adds an object to a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + addWithUpdate: function(object) { + this._restoreObjectsState(); + if (object) { + this._objects.push(object); + object.group = this; } - } + // since _restoreObjectsState set objects inactive + this.forEachObject(this._setObjectActive, this); + this._calcBounds(); + this._updateObjectsCoords(); + return this; + }, - return borderData; - } + /** + * @private + */ + _setObjectActive: function(object) { + object.set('active', true); + object.group = this; + }, - function createShape(ctx, args) { - var shape = ctx.drawShape(); - args.forEach(function(border, index) { - shape[(index === 0) ? "moveTo" : border[0] + "To" ].apply(null, border.slice(1)); - }); - return shape; - } + /** + * Removes an object from a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + removeWithUpdate: function(object) { + this._moveFlippedObject(object); + this._restoreObjectsState(); - function renderBorders(ctx, borderArgs, color) { - if (color !== "transparent") { - ctx.setVariable( "fillStyle", color); - createShape(ctx, borderArgs); - ctx.fill(); - numDraws+=1; - } - } + // since _restoreObjectsState set objects inactive + this.forEachObject(this._setObjectActive, this); + + this.remove(object); + this._calcBounds(); + this._updateObjectsCoords(); - function renderFormValue (el, bounds, stack){ + return this; + }, - var valueWrap = doc.createElement('valuewrap'), - cssPropertyArray = ['lineHeight','textAlign','fontFamily','color','fontSize','paddingLeft','paddingTop','width','height','border','borderLeftWidth','borderTopWidth'], - textValue, - textNode; + /** + * @private + */ + _onObjectAdded: function(object) { + object.group = this; + }, - cssPropertyArray.forEach(function(property) { - try { - valueWrap.style[property] = getCSS(el, property); - } catch(e) { - // Older IE has issues with "border" - h2clog("html2canvas: Parse: Exception caught in renderFormValue: " + e.message); + /** + * @private + */ + _onObjectRemoved: function(object) { + delete object.group; + object.set('active', false); + }, + + /** + * Properties that are delegated to group objects when reading/writing + * @param {Object} delegatedProperties + */ + delegatedProperties: { + fill: true, + opacity: true, + fontFamily: true, + fontWeight: true, + fontSize: true, + fontStyle: true, + lineHeight: true, + textDecoration: true, + textAlign: true, + backgroundColor: true + }, + + /** + * @private + */ + _set: function(key, value) { + if (key in this.delegatedProperties) { + var i = this._objects.length; + this[key] = value; + while (i--) { + this._objects[i].set(key, value); + } } - }); + else { + this[key] = value; + } + }, - valueWrap.style.borderColor = "black"; - valueWrap.style.borderStyle = "solid"; - valueWrap.style.display = "block"; - valueWrap.style.position = "absolute"; + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + objects: invoke(this._objects, 'toObject', propertiesToInclude) + }); + }, - if (/^(submit|reset|button|text|password)$/.test(el.type) || el.nodeName === "SELECT"){ - valueWrap.style.lineHeight = getCSS(el, "height"); - } + /** + * Renders instance on a given context + * @param {CanvasRenderingContext2D} ctx context to render instance on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } - valueWrap.style.top = bounds.top + "px"; - valueWrap.style.left = bounds.left + "px"; + ctx.save(); + this.clipTo && fabric.util.clipContext(this, ctx); - textValue = (el.nodeName === "SELECT") ? (el.options[el.selectedIndex] || 0).text : el.value; - if(!textValue) { - textValue = el.placeholder; - } + // the array is now sorted in order of highest first, so start from end + for (var i = 0, len = this._objects.length; i < len; i++) { + this._renderObject(this._objects[i], ctx); + } - textNode = doc.createTextNode(textValue); + this.clipTo && ctx.restore(); - valueWrap.appendChild(textNode); - body.appendChild(valueWrap); + ctx.restore(); + }, - renderText(el, textNode, stack); - body.removeChild(valueWrap); - } + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _renderControls: function(ctx, noTransform) { + this.callSuper('_renderControls', ctx, noTransform); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i]._renderControls(ctx); + } + }, - function drawImage (ctx) { - ctx.drawImage.apply(ctx, Array.prototype.slice.call(arguments, 1)); - numDraws+=1; - } + /** + * @private + */ + _renderObject: function(object, ctx) { + var originalHasRotatingPoint = object.hasRotatingPoint; - function getPseudoElement(el, which) { - var elStyle = window.getComputedStyle(el, which); - if(!elStyle || !elStyle.content || elStyle.content === "none" || elStyle.content === "-moz-alt-content") { - return; - } - var content = elStyle.content + '', - first = content.substr( 0, 1 ); - //strips quotes - if(first === content.substr( content.length - 1 ) && first.match(/'|"/)) { - content = content.substr( 1, content.length - 2 ); - } + // do not render if object is not visible + if (!object.visible) { + return; + } - var isImage = content.substr( 0, 3 ) === 'url', - elps = document.createElement( isImage ? 'img' : 'span' ); + object.hasRotatingPoint = false; - elps.className = pseudoHide + "-before " + pseudoHide + "-after"; + object.render(ctx); - Object.keys(elStyle).filter(indexedProperty).forEach(function(prop) { - elps.style[prop] = elStyle[prop]; - }); + object.hasRotatingPoint = originalHasRotatingPoint; + }, - if(isImage) { - elps.src = _html2canvas.Util.parseBackgroundImage(content)[0].args[0]; - } else { - elps.innerHTML = content; - } - return elps; - } + /** + * Retores original state of each of group objects (original state is that which was before group was created). + * @private + * @return {fabric.Group} thisArg + * @chainable + */ + _restoreObjectsState: function() { + this._objects.forEach(this._restoreObjectState, this); + return this; + }, - function indexedProperty(property) { - return (isNaN(window.parseInt(property, 10))); - } + /** + * Moves a flipped object to the position where it's displayed + * @private + * @param {fabric.Object} object + * @return {fabric.Group} thisArg + */ + _moveFlippedObject: function(object) { + var oldOriginX = object.get('originX'), + oldOriginY = object.get('originY'), + center = object.getCenterPoint(); + + object.set({ + originX: 'center', + originY: 'center', + left: center.x, + top: center.y + }); - function injectPseudoElements(el, stack) { - var before = getPseudoElement(el, ':before'), - after = getPseudoElement(el, ':after'); - if(!before && !after) { - return; - } + this._toggleFlipping(object); - if(before) { - el.className += " " + pseudoHide + "-before"; - el.parentNode.insertBefore(before, el); - parseElement(before, stack, true); - el.parentNode.removeChild(before); - el.className = el.className.replace(pseudoHide + "-before", "").trim(); - } + var newOrigin = object.getPointByOrigin(oldOriginX, oldOriginY); - if (after) { - el.className += " " + pseudoHide + "-after"; - el.appendChild(after); - parseElement(after, stack, true); - el.removeChild(after); - el.className = el.className.replace(pseudoHide + "-after", "").trim(); - } + object.set({ + originX: oldOriginX, + originY: oldOriginY, + left: newOrigin.x, + top: newOrigin.y + }); - } + return this; + }, - function renderBackgroundRepeat(ctx, image, backgroundPosition, bounds) { - var offsetX = Math.round(bounds.left + backgroundPosition.left), - offsetY = Math.round(bounds.top + backgroundPosition.top); + /** + * @private + */ + _toggleFlipping: function(object) { + if (this.flipX) { + object.toggle('flipX'); + object.set('left', -object.get('left')); + object.setAngle(-object.getAngle()); + } + if (this.flipY) { + object.toggle('flipY'); + object.set('top', -object.get('top')); + object.setAngle(-object.getAngle()); + } + }, - ctx.createPattern(image); - ctx.translate(offsetX, offsetY); - ctx.fill(); - ctx.translate(-offsetX, -offsetY); - } + /** + * Restores original state of a specified object in group + * @private + * @param {fabric.Object} object + * @return {fabric.Group} thisArg + */ + _restoreObjectState: function(object) { + this._setObjectPosition(object); + + object.setCoords(); + object.hasControls = object.__origHasControls; + delete object.__origHasControls; + object.set('active', false); + object.setCoords(); + delete object.group; + + return this; + }, - function backgroundRepeatShape(ctx, image, backgroundPosition, bounds, left, top, width, height) { - var args = []; - args.push(["line", Math.round(left), Math.round(top)]); - args.push(["line", Math.round(left + width), Math.round(top)]); - args.push(["line", Math.round(left + width), Math.round(height + top)]); - args.push(["line", Math.round(left), Math.round(height + top)]); - createShape(ctx, args); - ctx.save(); - ctx.clip(); - renderBackgroundRepeat(ctx, image, backgroundPosition, bounds); - ctx.restore(); - } + /** + * @private + */ + _setObjectPosition: function(object) { + var groupLeft = this.getLeft(), + groupTop = this.getTop(), + rotated = this._getRotatedLeftTop(object); + + object.set({ + angle: object.getAngle() + this.getAngle(), + left: groupLeft + rotated.left, + top: groupTop + rotated.top, + scaleX: object.get('scaleX') * this.get('scaleX'), + scaleY: object.get('scaleY') * this.get('scaleY') + }); + }, - function renderBackgroundColor(ctx, backgroundBounds, bgcolor) { - renderRect( - ctx, - backgroundBounds.left, - backgroundBounds.top, - backgroundBounds.width, - backgroundBounds.height, - bgcolor - ); - } + /** + * @private + */ + _getRotatedLeftTop: function(object) { + var groupAngle = this.getAngle() * (Math.PI / 180); + return { + left: (-Math.sin(groupAngle) * object.getTop() * this.get('scaleY') + + Math.cos(groupAngle) * object.getLeft() * this.get('scaleX')), - function renderBackgroundRepeating(el, bounds, ctx, image, imageIndex) { - var backgroundSize = _html2canvas.Util.BackgroundSize(el, bounds, image, imageIndex), - backgroundPosition = _html2canvas.Util.BackgroundPosition(el, bounds, image, imageIndex, backgroundSize), - backgroundRepeat = getCSS(el, "backgroundRepeat").split(",").map(function(value) { - return value.trim(); - }); + top: (Math.cos(groupAngle) * object.getTop() * this.get('scaleY') + + Math.sin(groupAngle) * object.getLeft() * this.get('scaleX')) + }; + }, - image = resizeImage(image, backgroundSize); + /** + * Destroys a group (restoring state of its objects) + * @return {fabric.Group} thisArg + * @chainable + */ + destroy: function() { + this._objects.forEach(this._moveFlippedObject, this); + return this._restoreObjectsState(); + }, - backgroundRepeat = backgroundRepeat[imageIndex] || backgroundRepeat[0]; + /** + * Saves coordinates of this instance (to be used together with `hasMoved`) + * @saveCoords + * @return {fabric.Group} thisArg + * @chainable + */ + saveCoords: function() { + this._originalLeft = this.get('left'); + this._originalTop = this.get('top'); + return this; + }, - switch (backgroundRepeat) { - case "repeat-x": - backgroundRepeatShape(ctx, image, backgroundPosition, bounds, - bounds.left, bounds.top + backgroundPosition.top, 99999, image.height); - break; + /** + * Checks whether this group was moved (since `saveCoords` was called last) + * @return {Boolean} true if an object was moved (since fabric.Group#saveCoords was called) + */ + hasMoved: function() { + return this._originalLeft !== this.get('left') || + this._originalTop !== this.get('top'); + }, - case "repeat-y": - backgroundRepeatShape(ctx, image, backgroundPosition, bounds, - bounds.left + backgroundPosition.left, bounds.top, image.width, 99999); - break; + /** + * Sets coordinates of all group objects + * @return {fabric.Group} thisArg + * @chainable + */ + setObjectsCoords: function() { + this.forEachObject(function(object) { + object.setCoords(); + }); + return this; + }, - case "no-repeat": - backgroundRepeatShape(ctx, image, backgroundPosition, bounds, - bounds.left + backgroundPosition.left, bounds.top + backgroundPosition.top, image.width, image.height); - break; + /** + * @private + */ + _setOpacityIfSame: function() { + var objects = this.getObjects(), + firstValue = objects[0] ? objects[0].get('opacity') : 1, + isSameOpacity = objects.every(function(o) { + return o.get('opacity') === firstValue; + }); - default: - renderBackgroundRepeat(ctx, image, backgroundPosition, { - top: bounds.top, - left: bounds.left, - width: image.width, - height: image.height - }); - break; - } - } + if (isSameOpacity) { + this.opacity = firstValue; + } + }, - function renderBackgroundImage(element, bounds, ctx) { - var backgroundImage = getCSS(element, "backgroundImage"), - backgroundImages = _html2canvas.Util.parseBackgroundImage(backgroundImage), - image, - imageIndex = backgroundImages.length; + /** + * @private + */ + _calcBounds: function(onlyWidthHeight) { + var aX = [], + aY = [], + o; + + for (var i = 0, len = this._objects.length; i < len; ++i) { + o = this._objects[i]; + o.setCoords(); + for (var prop in o.oCoords) { + aX.push(o.oCoords[prop].x); + aY.push(o.oCoords[prop].y); + } + } - while(imageIndex--) { - backgroundImage = backgroundImages[imageIndex]; + this.set(this._getBounds(aX, aY, onlyWidthHeight)); + }, - if (!backgroundImage.args || backgroundImage.args.length === 0) { - continue; + /** + * @private + */ + _getBounds: function(aX, aY, onlyWidthHeight) { + var ivt = fabric.util.invertTransform(this.getViewportTransform()), + minXY = fabric.util.transformPoint(new fabric.Point(min(aX), min(aY)), ivt), + maxXY = fabric.util.transformPoint(new fabric.Point(max(aX), max(aY)), ivt), + obj = { + width: (maxXY.x - minXY.x) || 0, + height: (maxXY.y - minXY.y) || 0 + }; + + if (!onlyWidthHeight) { + obj.left = (minXY.x + maxXY.x) / 2 || 0; + obj.top = (minXY.y + maxXY.y) / 2 || 0; } + return obj; + }, - var key = backgroundImage.method === 'url' ? - backgroundImage.args[0] : - backgroundImage.value; + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + + for (var i = 0, len = this._objects.length; i < len; i++) { + markup.push(this._objects[i].toSVG(reviver)); + } - image = loadImage(key); + markup.push('\n'); - // TODO add support for background-origin - if (image) { - renderBackgroundRepeating(element, bounds, ctx, image, imageIndex); - } else { - h2clog("html2canvas: Error loading background:", backgroundImage); + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns requested property + * @param {String} prop Property to get + * @return {Any} + */ + get: function(prop) { + if (prop in _lockProperties) { + if (this[prop]) { + return this[prop]; + } + else { + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i][prop]) { + return true; + } + } + return false; + } + } + else { + if (prop in this.delegatedProperties) { + return this._objects[0] && this._objects[0].get(prop); + } + return this[prop]; } } - } - - function resizeImage(image, bounds) { - if(image.width === bounds.width && image.height === bounds.height) { - return image; - } + }); + + /** + * Returns {@link fabric.Group} instance from an object representation + * @static + * @memberOf fabric.Group + * @param {Object} object Object to create a group from + * @param {Function} [callback] Callback to invoke when an group instance is created + * @return {fabric.Group} An instance of fabric.Group + */ + fabric.Group.fromObject = function(object, callback) { + fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) { + delete object.objects; + callback && callback(new fabric.Group(enlivenedObjects, object)); + }); + }; - var ctx, canvas = doc.createElement('canvas'); - canvas.width = bounds.width; - canvas.height = bounds.height; - ctx = canvas.getContext("2d"); - drawImage(ctx, image, 0, 0, image.width, image.height, 0, 0, bounds.width, bounds.height ); - return canvas; - } + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.Group + * @type Boolean + * @default + */ + fabric.Group.async = true; - function setOpacity(ctx, element, parentStack) { - var opacity = getCSS(element, "opacity") * ((parentStack) ? parentStack.opacity : 1); - ctx.setVariable("globalAlpha", opacity); - return opacity; - } +})(typeof exports !== 'undefined' ? exports : this); - function createStack(element, parentStack, bounds) { - var ctx = h2cRenderContext((!parentStack) ? documentWidth() : bounds.width , (!parentStack) ? documentHeight() : bounds.height), - stack = { - ctx: ctx, - zIndex: setZ(getCSS(element, "zIndex"), (parentStack) ? parentStack.zIndex : null), - opacity: setOpacity(ctx, element, parentStack), - cssPosition: getCSS(element, "position"), - borders: getBorderData(element), - clip: (parentStack && parentStack.clip) ? _html2canvas.Util.Extend( {}, parentStack.clip ) : null - }; +(function(global) { - // TODO correct overflow for absolute content residing under a static position - if (options.useOverflow === true && /(hidden|scroll|auto)/.test(getCSS(element, "overflow")) === true && /(BODY)/i.test(element.nodeName) === false){ - stack.clip = (stack.clip) ? clipBounds(stack.clip, bounds) : bounds; - } + 'use strict'; - stack.zIndex.children.push(stack); + var extend = fabric.util.object.extend; - return stack; + if (!global.fabric) { + global.fabric = { }; } - function getBackgroundBounds(borders, bounds, clip) { - var backgroundBounds = { - left: bounds.left + borders[3].width, - top: bounds.top + borders[0].width, - width: bounds.width - (borders[1].width + borders[3].width), - height: bounds.height - (borders[0].width + borders[2].width) - }; - - if (clip) { - backgroundBounds = clipBounds(backgroundBounds, clip); - } - - return backgroundBounds; + if (global.fabric.Image) { + fabric.warn('fabric.Image is already defined.'); + return; } - function renderElement(element, parentStack, pseudoElement){ - var bounds = _html2canvas.Util.Bounds(element), - image, - bgcolor = (ignoreElementsRegExp.test(element.nodeName)) ? "#efefef" : getCSS(element, "backgroundColor"), - stack = createStack(element, parentStack, bounds), - borders = stack.borders, - ctx = stack.ctx, - backgroundBounds = getBackgroundBounds(borders, bounds, stack.clip), - borderData = parseBorders(element, bounds, borders); - - createShape(ctx, borderData.clip); - - ctx.save(); - ctx.clip(); + /** + * Image class + * @class fabric.Image + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#images} + * @see {@link fabric.Image#initialize} for constructor definition + */ + fabric.Image = fabric.util.createClass(fabric.Object, /** @lends fabric.Image.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'image', + + /** + * crossOrigin value (one of "", "anonymous", "allow-credentials") + * @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes + * @type String + * @default + */ + crossOrigin: '', + + /** + * Constructor + * @param {HTMLImageElement | String} element Image element + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + */ + initialize: function(element, options) { + options || (options = { }); + + this.filters = [ ]; + + this.callSuper('initialize', options); + + this._initElement(element, options); + this._initConfig(options); + + if (options.filters) { + this.filters = options.filters; + this.applyFilters(); + } + }, - if (backgroundBounds.height > 0 && backgroundBounds.width > 0){ - renderBackgroundColor(ctx, bounds, bgcolor); - renderBackgroundImage(element, backgroundBounds, ctx); - } + /** + * Returns image element which this instance if based on + * @return {HTMLImageElement} Image element + */ + getElement: function() { + return this._element; + }, - ctx.restore(); + /** + * Sets image element for this instance to a specified one. + * If filters defined they are applied to new image. + * You might need to call `canvas.renderAll` and `object.setCoords` after replacing, to render new image and update controls area. + * @param {HTMLImageElement} element + * @param {Function} [callback] Callback is invoked when all filters have been applied and new image is generated + * @return {fabric.Image} thisArg + * @chainable + */ + setElement: function(element, callback) { + this._element = element; + this._originalElement = element; + this._initConfig(); + + if (this.filters.length !== 0) { + this.applyFilters(callback); + } - borderData.borders.forEach(function(border) { - renderBorders(ctx, border.args, border.color); - }); + return this; + }, - if (!pseudoElement) { - injectPseudoElements(element, stack); - } + /** + * Sets crossOrigin value (on an instance and corresponding image element) + * @return {fabric.Image} thisArg + * @chainable + */ + setCrossOrigin: function(value) { + this.crossOrigin = value; + this._element.crossOrigin = value; - switch(element.nodeName){ - case "IMG": - if ((image = loadImage(element.getAttribute('src')))) { - renderImage(ctx, element, image, bounds, borders); - } else { - h2clog("html2canvas: Error loading :" + element.getAttribute('src')); - } - break; - case "INPUT": - // TODO add all relevant type's, i.e. HTML5 new stuff - // todo add support for placeholder attribute for browsers which support it - if (/^(text|url|email|submit|button|reset)$/.test(element.type) && (element.value || element.placeholder).length > 0){ - renderFormValue(element, bounds, stack); - } - break; - case "TEXTAREA": - if ((element.value || element.placeholder || "").length > 0){ - renderFormValue(element, bounds, stack); - } - break; - case "SELECT": - if ((element.options||element.placeholder || "").length > 0){ - renderFormValue(element, bounds, stack); - } - break; - case "LI": - renderListItem(element, stack, backgroundBounds); - break; - case "VIDEO": - // custom code written by Muaz Khan (www.muazkhan.com) - // to support