From ae3190c5e929ec3b899734e2a6aface7cd4e42d0 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Fri, 7 Feb 2025 10:54:44 +0000
Subject: [PATCH 01/73] React DevTools 6.1.0 -> 6.1.1 (#32326)

Full list of changes:
* DevTools: refactor NativeStyleEditor, don't use custom cache
implementation ([hoxyq](https://github.com/hoxyq) in
[#32298](https://github.com/facebook/react/pull/32298))
* fix[react-devtools-fusebox]: add extension globals to build
([hoxyq](https://github.com/hoxyq) in
[#32297](https://github.com/facebook/react/pull/32297))
* DevTools: fix host component filter option title
([hoxyq](https://github.com/hoxyq) in
[#32296](https://github.com/facebook/react/pull/32296))
* chore[DevTools]: make clipboardWrite optional for chromium
([hoxyq](https://github.com/hoxyq) in
[#32262](https://github.com/facebook/react/pull/32262))
* DevTools: support useEffectEvent and forward-fix experimental prefix
support ([hoxyq](https://github.com/hoxyq) in
[#32106](https://github.com/facebook/react/pull/32106))
---
 packages/react-devtools-core/package.json                | 2 +-
 packages/react-devtools-extensions/chrome/manifest.json  | 4 ++--
 packages/react-devtools-extensions/edge/manifest.json    | 4 ++--
 packages/react-devtools-extensions/firefox/manifest.json | 2 +-
 packages/react-devtools-inline/package.json              | 2 +-
 packages/react-devtools-timeline/package.json            | 2 +-
 packages/react-devtools/CHANGELOG.md                     | 9 +++++++++
 packages/react-devtools/package.json                     | 4 ++--
 8 files changed, 19 insertions(+), 10 deletions(-)

diff --git a/packages/react-devtools-core/package.json b/packages/react-devtools-core/package.json
index 88951de463c96..6794f631772be 100644
--- a/packages/react-devtools-core/package.json
+++ b/packages/react-devtools-core/package.json
@@ -1,6 +1,6 @@
 {
   "name": "react-devtools-core",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "description": "Use react-devtools outside of the browser",
   "license": "MIT",
   "main": "./dist/backend.js",
diff --git a/packages/react-devtools-extensions/chrome/manifest.json b/packages/react-devtools-extensions/chrome/manifest.json
index 4b2d810f60411..5cf6397bc75ef 100644
--- a/packages/react-devtools-extensions/chrome/manifest.json
+++ b/packages/react-devtools-extensions/chrome/manifest.json
@@ -2,8 +2,8 @@
   "manifest_version": 3,
   "name": "React Developer Tools",
   "description": "Adds React debugging tools to the Chrome Developer Tools.",
-  "version": "6.1.0",
-  "version_name": "6.1.0",
+  "version": "6.1.1",
+  "version_name": "6.1.1",
   "minimum_chrome_version": "102",
   "icons": {
     "16": "icons/16-production.png",
diff --git a/packages/react-devtools-extensions/edge/manifest.json b/packages/react-devtools-extensions/edge/manifest.json
index 37a76be2f24bc..512dd888f7d94 100644
--- a/packages/react-devtools-extensions/edge/manifest.json
+++ b/packages/react-devtools-extensions/edge/manifest.json
@@ -2,8 +2,8 @@
   "manifest_version": 3,
   "name": "React Developer Tools",
   "description": "Adds React debugging tools to the Microsoft Edge Developer Tools.",
-  "version": "6.1.0",
-  "version_name": "6.1.0",
+  "version": "6.1.1",
+  "version_name": "6.1.1",
   "minimum_chrome_version": "102",
   "icons": {
     "16": "icons/16-production.png",
diff --git a/packages/react-devtools-extensions/firefox/manifest.json b/packages/react-devtools-extensions/firefox/manifest.json
index d053921ebeecc..22dee6a10a42d 100644
--- a/packages/react-devtools-extensions/firefox/manifest.json
+++ b/packages/react-devtools-extensions/firefox/manifest.json
@@ -2,7 +2,7 @@
   "manifest_version": 3,
   "name": "React Developer Tools",
   "description": "Adds React debugging tools to the Firefox Developer Tools.",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "browser_specific_settings": {
     "gecko": {
       "id": "@react-devtools",
diff --git a/packages/react-devtools-inline/package.json b/packages/react-devtools-inline/package.json
index 86cdc5758b3e9..4a484dedbeb5e 100644
--- a/packages/react-devtools-inline/package.json
+++ b/packages/react-devtools-inline/package.json
@@ -1,6 +1,6 @@
 {
   "name": "react-devtools-inline",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "description": "Embed react-devtools within a website",
   "license": "MIT",
   "main": "./dist/backend.js",
diff --git a/packages/react-devtools-timeline/package.json b/packages/react-devtools-timeline/package.json
index 5519ab339da78..9dbf65b931587 100644
--- a/packages/react-devtools-timeline/package.json
+++ b/packages/react-devtools-timeline/package.json
@@ -1,7 +1,7 @@
 {
   "private": true,
   "name": "react-devtools-timeline",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "license": "MIT",
   "dependencies": {
     "@elg/speedscope": "1.9.0-a6f84db",
diff --git a/packages/react-devtools/CHANGELOG.md b/packages/react-devtools/CHANGELOG.md
index 4e6109a3186fd..b1a4fd9a801e0 100644
--- a/packages/react-devtools/CHANGELOG.md
+++ b/packages/react-devtools/CHANGELOG.md
@@ -4,6 +4,15 @@
 
 ---
 
+### 6.1.1
+February 7, 2025
+
+* DevTools: refactor NativeStyleEditor, don't use custom cache implementation ([hoxyq](https://github.com/hoxyq) in [#32298](https://github.com/facebook/react/pull/32298))
+* DevTools: fix host component filter option title ([hoxyq](https://github.com/hoxyq) in [#32296](https://github.com/facebook/react/pull/32296))
+* chore[DevTools]: make clipboardWrite optional for chromium ([hoxyq](https://github.com/hoxyq) in [#32262](https://github.com/facebook/react/pull/32262))
+
+---
+
 ### 6.1.0
 January 16, 2025
 
diff --git a/packages/react-devtools/package.json b/packages/react-devtools/package.json
index bc6af6588e9ec..a384b168166aa 100644
--- a/packages/react-devtools/package.json
+++ b/packages/react-devtools/package.json
@@ -1,6 +1,6 @@
 {
   "name": "react-devtools",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "description": "Use react-devtools outside of the browser",
   "license": "MIT",
   "repository": {
@@ -26,7 +26,7 @@
     "electron": "^23.1.2",
     "internal-ip": "^6.2.0",
     "minimist": "^1.2.3",
-    "react-devtools-core": "6.1.0",
+    "react-devtools-core": "6.1.1",
     "update-notifier": "^2.1.0"
   }
 }

From 44c3d3d665761bba86eb5c143a6eafc0ebf73263 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Fri, 7 Feb 2025 11:07:46 +0000
Subject: [PATCH 02/73] fix[react-devtools-standalone]: define missing globals
 (#32327)

Same as what we did for `react-devtools-fusebox` in
https://github.com/facebook/react/pull/32297.
---
 packages/react-devtools-core/webpack.standalone.js | 3 +++
 1 file changed, 3 insertions(+)

diff --git a/packages/react-devtools-core/webpack.standalone.js b/packages/react-devtools-core/webpack.standalone.js
index 778c1fa85c627..8caadec10b070 100644
--- a/packages/react-devtools-core/webpack.standalone.js
+++ b/packages/react-devtools-core/webpack.standalone.js
@@ -88,6 +88,9 @@ module.exports = {
       __PROFILE__: false,
       __TEST__: NODE_ENV === 'test',
       __IS_NATIVE__: true,
+      __IS_FIREFOX__: false,
+      __IS_CHROME__: false,
+      __IS_EDGE__: false,
       'process.env.DEVTOOLS_PACKAGE': `"react-devtools-core"`,
       'process.env.DEVTOOLS_VERSION': `"${DEVTOOLS_VERSION}"`,
       'process.env.EDITOR_URL': EDITOR_URL != null ? `"${EDITOR_URL}"` : null,

From 8759c5c8d6aef34df576827215ff7ebaeafc79ea Mon Sep 17 00:00:00 2001
From: Jack Pope <jackpope1@gmail.com>
Date: Fri, 7 Feb 2025 11:12:29 -0500
Subject: [PATCH 03/73] Ship enableFabricCompleteRootInCommitPhase (#32318)

---
 .../src/ReactFiberConfigFabric.js                  | 14 +++-----------
 packages/shared/ReactFeatureFlags.js               |  5 -----
 .../forks/ReactFeatureFlags.native-fb-dynamic.js   |  1 -
 .../shared/forks/ReactFeatureFlags.native-fb.js    |  1 -
 .../shared/forks/ReactFeatureFlags.native-oss.js   |  1 -
 .../forks/ReactFeatureFlags.test-renderer.js       |  1 -
 .../ReactFeatureFlags.test-renderer.native-fb.js   |  1 -
 .../forks/ReactFeatureFlags.test-renderer.www.js   |  1 -
 packages/shared/forks/ReactFeatureFlags.www.js     |  1 -
 9 files changed, 3 insertions(+), 23 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactFiberConfigFabric.js b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
index 59bd296138e0b..d602ab05efa81 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigFabric.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
@@ -57,10 +57,7 @@ import {
   getInspectorDataForInstance,
 } from './ReactNativeFiberInspector';
 
-import {
-  enableFabricCompleteRootInCommitPhase,
-  passChildrenWhenCloningPersistedNodes,
-} from 'shared/ReactFeatureFlags';
+import {passChildrenWhenCloningPersistedNodes} from 'shared/ReactFeatureFlags';
 import {REACT_CONTEXT_TYPE} from 'shared/ReactSymbols';
 import type {ReactContext} from 'shared/ReactTypes';
 
@@ -505,19 +502,14 @@ export function finalizeContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  if (!enableFabricCompleteRootInCommitPhase) {
-    completeRoot(container.containerTag, newChildren);
-  }
+  // Noop - children will be finalized in replaceContainerChildren
 }
 
 export function replaceContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  // Noop - children will be replaced in finalizeContainerChildren
-  if (enableFabricCompleteRootInCommitPhase) {
-    completeRoot(container.containerTag, newChildren);
-  }
+  completeRoot(container.containerTag, newChildren);
 }
 
 export {getClosestInstanceFromNode as getInstanceFromNode};
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index a94f3402de4f8..290d5ba159d68 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -92,11 +92,6 @@ export const enableHalt = __EXPERIMENTAL__;
 
 export const enableViewTransition = __EXPERIMENTAL__;
 
-/**
- * Switches the Fabric API from doing layout in commit work instead of complete work.
- */
-export const enableFabricCompleteRootInCommitPhase = false;
-
 /**
  * Switches Fiber creation to a simple object instead of a constructor.
  */
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index cff57d26ecd95..6aaefdfa336fe 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -23,7 +23,6 @@ export const enableHiddenSubtreeInsertionEffectCleanup = __VARIANT__;
 export const enablePersistedModeClonedFlag = __VARIANT__;
 export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
-export const enableFabricCompleteRootInCommitPhase = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseResourceEffectHook = __VARIANT__;
 export const enableOwnerStacks = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 31b3333966410..878d344a42a41 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -20,7 +20,6 @@ const dynamicFlags: DynamicExportsType = (dynamicFlagsUntyped: any);
 // the exports object every time a flag is read.
 export const {
   alwaysThrottleRetries,
-  enableFabricCompleteRootInCommitPhase,
   enableHiddenSubtreeInsertionEffectCleanup,
   enableObjectFiber,
   enablePersistedModeClonedFlag,
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index 84307ce62746c..a3202c0b80049 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -30,7 +30,6 @@ export const enableAsyncIterableChildren = false;
 export const enableCPUSuspense = false;
 export const enableCreateEventHandleAPI = false;
 export const enableDO_NOT_USE_disableStrictPassiveEffect = false;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableMoveBefore = true;
 export const enableFizzExternalRuntime = true;
 export const enableHalt = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 90725f666e1a1..6bc085f540b23 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -36,7 +36,6 @@ export const enableUseEffectEventHook = false;
 export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = false;
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index b4df6f248f9fd..d62a59122f82c 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -61,7 +61,6 @@ export const renameElementSymbol = false;
 export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableSiblingPrerendering = true;
 export const enableUseResourceEffectHook = true;
 export const enableHydrationLaneScheduling = true;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index a09e479f1732b..301c01a018090 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -39,7 +39,6 @@ export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
 export const enableRenderableContext = false;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = true;
 
 export const enableRetryLaneExpiration = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index c84b89847fa0c..dcb77f9d84b5e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -48,7 +48,6 @@ export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
 export const enableUpdaterTracking = __PROFILE__;
-export const enableFabricCompleteRootInCommitPhase = false;
 
 export const enableSuspenseAvoidThisFallback = true;
 

From 76e44c29110f12caff8302da624076b68547b8ef Mon Sep 17 00:00:00 2001
From: inottn <inottn@outlook.com>
Date: Sat, 8 Feb 2025 04:48:03 +0800
Subject: [PATCH 04/73] [compiler] Improve error messages for unhandled
 terminal and instruction kinds (#32324)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

<!--
Explain the **motivation** for making this change. What existing problem
does the pull request solve?
-->
Improve the error message, as the value is currently an object instead
of a string, which results in it being converted to '[object Object]'.

## How did you test this change?
Already tested locally.
<!--
Demonstrate the code is solid. Example: The exact commands you ran and
their output, screenshots / videos if the pull request changes the user
interface.
How exactly did you verify that your PR solves the issue you wanted to
solve?
  If you leave this empty, your PR will very likely be closed.
-->
---
 .../src/ReactiveScopes/PrintReactiveFunction.ts              | 5 ++++-
 .../src/TypeInference/InferTypes.ts                          | 5 ++++-
 2 files changed, 8 insertions(+), 2 deletions(-)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts
index b5aa44ead095d..259fc06486888 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts
@@ -394,7 +394,10 @@ function writeTerminal(writer: Writer, terminal: ReactiveTerminal): void {
       break;
     }
     default:
-      assertExhaustive(terminal, `Unhandled terminal ${terminal}`);
+      assertExhaustive(
+        terminal,
+        `Unhandled terminal kind \`${(terminal as any).kind}\``,
+      );
   }
 }
 
diff --git a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
index 0270723c3e863..44bf539e847bb 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
@@ -420,7 +420,10 @@ function* generateInstructionTypes(
       break;
     }
     default:
-      assertExhaustive(value, `Unhandled instruction value kind: ${value}`);
+      assertExhaustive(
+        value,
+        `Unhandled instruction value kind: ${(value as any).kind}`,
+      );
   }
 }
 

From 989b0cccc215e5c4692552b0cc01d23938dcf99b Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 16:04:46 -0500
Subject: [PATCH 05/73] [compiler] Add simple walltime measurement (#32331)

Adds a new Timing logger event to the compiler which currently only
records the walltime of running the compiler from the time the babel
plugin's Program visitor enters to the time it exits.

To enable, run the compiler with `ENABLE_REACT_COMPILER_TIMINGS=1 ...`
or `export ENABLE_REACT_COMPILER_TIMINGS=1` to set it by default.
---
 .../src/Babel/BabelPlugin.ts                  | 93 +++++++++++++------
 .../src/Entrypoint/Options.ts                 |  4 +
 2 files changed, 67 insertions(+), 30 deletions(-)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts b/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts
index c648c66043980..aa49bda22b27e 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts
@@ -6,12 +6,15 @@
  */
 
 import type * as BabelCore from '@babel/core';
-import {compileProgram, parsePluginOptions} from '../Entrypoint';
+import {compileProgram, Logger, parsePluginOptions} from '../Entrypoint';
 import {
   injectReanimatedFlag,
   pipelineUsesReanimatedPlugin,
 } from '../Entrypoint/Reanimated';
 
+const ENABLE_REACT_COMPILER_TIMINGS =
+  process.env['ENABLE_REACT_COMPILER_TIMINGS'] === '1';
+
 /*
  * The React Forget Babel Plugin
  * @param {*} _babel
@@ -28,35 +31,65 @@ export default function BabelPluginReactCompiler(
        * prior to B, if A does not have a Program visitor and B does, B will run first. We always
        * want Forget to run true to source as possible.
        */
-      Program(prog, pass): void {
-        let opts = parsePluginOptions(pass.opts);
-        const isDev =
-          (typeof __DEV__ !== 'undefined' && __DEV__ === true) ||
-          process.env['NODE_ENV'] === 'development';
-        if (
-          opts.enableReanimatedCheck === true &&
-          pipelineUsesReanimatedPlugin(pass.file.opts.plugins)
-        ) {
-          opts = injectReanimatedFlag(opts);
-        }
-        if (
-          opts.environment.enableResetCacheOnSourceFileChanges !== false &&
-          isDev
-        ) {
-          opts = {
-            ...opts,
-            environment: {
-              ...opts.environment,
-              enableResetCacheOnSourceFileChanges: true,
-            },
-          };
-        }
-        compileProgram(prog, {
-          opts,
-          filename: pass.filename ?? null,
-          comments: pass.file.ast.comments ?? [],
-          code: pass.file.code,
-        });
+      Program: {
+        enter(prog, pass): void {
+          const filename = pass.filename ?? 'unknown';
+          if (ENABLE_REACT_COMPILER_TIMINGS === true) {
+            performance.mark(`${filename}:start`, {
+              detail: 'BabelPlugin:Program:start',
+            });
+          }
+          let opts = parsePluginOptions(pass.opts);
+          const isDev =
+            (typeof __DEV__ !== 'undefined' && __DEV__ === true) ||
+            process.env['NODE_ENV'] === 'development';
+          if (
+            opts.enableReanimatedCheck === true &&
+            pipelineUsesReanimatedPlugin(pass.file.opts.plugins)
+          ) {
+            opts = injectReanimatedFlag(opts);
+          }
+          if (
+            opts.environment.enableResetCacheOnSourceFileChanges !== false &&
+            isDev
+          ) {
+            opts = {
+              ...opts,
+              environment: {
+                ...opts.environment,
+                enableResetCacheOnSourceFileChanges: true,
+              },
+            };
+          }
+          compileProgram(prog, {
+            opts,
+            filename: pass.filename ?? null,
+            comments: pass.file.ast.comments ?? [],
+            code: pass.file.code,
+          });
+          if (ENABLE_REACT_COMPILER_TIMINGS === true) {
+            performance.mark(`${filename}:end`, {
+              detail: 'BabelPlugin:Program:end',
+            });
+          }
+        },
+        exit(_, pass): void {
+          if (ENABLE_REACT_COMPILER_TIMINGS === true) {
+            const filename = pass.filename ?? 'unknown';
+            const measurement = performance.measure(filename, {
+              start: `${filename}:start`,
+              end: `${filename}:end`,
+              detail: 'BabelPlugin:Program',
+            });
+            if ('logger' in pass.opts && pass.opts.logger != null) {
+              const logger: Logger = pass.opts.logger as Logger;
+              logger.logEvent(filename, {
+                kind: 'Timing',
+                measurement,
+              });
+            }
+          }
+        },
       },
     },
   };
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
index fb951d25c5398..35c2c4134eb44 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
@@ -206,6 +206,10 @@ export type LoggerEvent =
       kind: 'PipelineError';
       fnLoc: t.SourceLocation | null;
       data: string;
+    }
+  | {
+      kind: 'Timing';
+      measurement: PerformanceMeasure;
     };
 
 export type Logger = {

From bc78de3a521f65f756579fee0996ec5c81f3af73 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 16:34:26 -0500
Subject: [PATCH 06/73] [ci] Use 'opened' event for discord notifications
 (#32332)

We don't need to wait for it to be labeled now that we have the shared
maintainer check workflow.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32332).
* #32333
* __->__ #32332
---
 .github/workflows/compiler_discord_notify.yml | 4 ++--
 .github/workflows/runtime_discord_notify.yml  | 4 ++--
 2 files changed, 4 insertions(+), 4 deletions(-)

diff --git a/.github/workflows/compiler_discord_notify.yml b/.github/workflows/compiler_discord_notify.yml
index 1ab9c1b1aff5b..da85190dd2127 100644
--- a/.github/workflows/compiler_discord_notify.yml
+++ b/.github/workflows/compiler_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Compiler) Discord Notify
 
 on:
   pull_request_target:
-    types: [labeled]
+    types: [opened]
     paths:
       - compiler/**
       - .github/workflows/compiler_**.yml
@@ -14,7 +14,7 @@ jobs:
       actor: ${{ github.event.pull_request.user.login }}
 
   notify:
-    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' && github.event.label.name == 'React Core Team' }}
+    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' }}
     needs: check_maintainer
     runs-on: ubuntu-latest
     steps:
diff --git a/.github/workflows/runtime_discord_notify.yml b/.github/workflows/runtime_discord_notify.yml
index 59a1078b499e8..5a138ce71b13b 100644
--- a/.github/workflows/runtime_discord_notify.yml
+++ b/.github/workflows/runtime_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Runtime) Discord Notify
 
 on:
   pull_request_target:
-    types: [labeled]
+    types: [opened]
     paths-ignore:
       - compiler/**
       - .github/workflows/compiler_**.yml
@@ -14,7 +14,7 @@ jobs:
       actor: ${{ github.event.pull_request.user.login }}
 
   notify:
-    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' && github.event.label.name == 'React Core Team' }}
+    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' }}
     needs: check_maintainer
     runs-on: ubuntu-latest
     steps:

From 569c3b28ee968df58ff3c55be9a8efa2ee72fc82 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 16:39:37 -0500
Subject: [PATCH 07/73] [ci] Combine sizebot jobs (#32333)

There's no real reason to have 2 jobs for sizebot. It's more of a
historical artifact from before the GH migration. Merging them should
require one less worker needing to be provisioned and some of the extra
overhead
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32333).
* __->__ #32333
* #32332
---
 .github/workflows/runtime_build_and_test.yml | 47 +++-----------------
 1 file changed, 7 insertions(+), 40 deletions(-)

diff --git a/.github/workflows/runtime_build_and_test.yml b/.github/workflows/runtime_build_and_test.yml
index 9a592780b17c4..12e341a86fd96 100644
--- a/.github/workflows/runtime_build_and_test.yml
+++ b/.github/workflows/runtime_build_and_test.yml
@@ -585,9 +585,10 @@ jobs:
           RELEASE_CHANNEL: experimental
 
   # ----- SIZEBOT -----
-  download_base_build_for_sizebot:
-    if: ${{ github.event_name == 'pull_request' && github.ref_name != 'main' }}
-    name: Download base build for sizebot
+  sizebot:
+    if: ${{ github.event_name == 'pull_request' && github.ref_name != 'main' && github.event.pull_request.base.ref == 'main' }}
+    name: Run sizebot
+    needs: [build_and_lint]
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v4
@@ -603,16 +604,14 @@ jobs:
         id: node_modules
         with:
           path: "**/node_modules"
-          key: ${{ runner.arch }}-${{ runner.os }}-modules-${{ hashFiles('yarn.lock', 'scripts/release/yarn.lock') }}
+          key: runtime-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
       - name: Ensure clean build directory
         run: rm -rf build
-      - run: yarn install --frozen-lockfile
       - run: yarn install --frozen-lockfile
         working-directory: scripts/release
       - name: Download artifacts for base revision
         run: |
-          git fetch origin main
-          GH_TOKEN=${{ github.token }} scripts/release/download-experimental-build.js --commit=$(git rev-parse origin/main)
+          GH_TOKEN=${{ github.token }} scripts/release/download-experimental-build.js --commit=$(git rev-parse ${{ github.event.pull_request.base.sha }})
           mv ./build ./base-build
       # TODO: The `download-experimental-build` script copies the npm
       # packages into the `node_modules` directory. This is a historical
@@ -620,33 +619,8 @@ jobs:
       # don't exist.
       - name: Delete extraneous files
         run: rm -rf ./base-build/node_modules
-      - name: Display structure of base-build
+      - name: Display structure of base-build from origin/main
         run: ls -R base-build
-      - name: Archive base-build
-        uses: actions/upload-artifact@v4
-        with:
-          name: base-build
-          path: base-build
-
-  sizebot:
-    name: Run sizebot
-    needs: [build_and_lint, download_base_build_for_sizebot]
-    runs-on: ubuntu-latest
-    steps:
-      - uses: actions/checkout@v4
-        with:
-          ref: ${{ github.event.pull_request.head.sha || github.sha }}
-      - uses: actions/setup-node@v4
-        with:
-          node-version-file: '.nvmrc'
-          cache: yarn
-          cache-dependency-path: yarn.lock
-      - name: Restore cached node_modules
-        uses: actions/cache@v4
-        id: node_modules
-        with:
-          path: "**/node_modules"
-          key: runtime-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
       - name: Ensure clean build directory
         run: rm -rf build
       - run: yarn install --frozen-lockfile
@@ -662,13 +636,6 @@ jobs:
           node ./scripts/print-warnings/print-warnings.js > build/__test_utils__/ReactAllWarnings.js
       - name: Display structure of build for PR
         run: ls -R build
-      - name: Restore archived base-build from origin/main
-        uses: actions/download-artifact@v4
-        with:
-          name: base-build
-          path: base-build
-      - name: Display structure of base-build from origin/main
-        run: ls -R base-build
       - run: echo ${{ github.sha }} >> build/COMMIT_SHA
       - run: node ./scripts/tasks/danger
       - name: Archive sizebot results

From 7588b6b291b17fb2130244115b07e9945a864626 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 17:49:09 -0500
Subject: [PATCH 08/73] [ci] Disallow PRs against builds branch (#32335)

Our internal build infra relies on a 1:1 mapping between `main` and the
2 build branches. Directly committing changes to those branches breaks
that infra.

Adds a simple workflow to leave a comment and decline the PR.
---
 .../shared_close_direct_sync_branch_prs.yml   | 37 +++++++++++++++++++
 1 file changed, 37 insertions(+)
 create mode 100644 .github/workflows/shared_close_direct_sync_branch_prs.yml

diff --git a/.github/workflows/shared_close_direct_sync_branch_prs.yml b/.github/workflows/shared_close_direct_sync_branch_prs.yml
new file mode 100644
index 0000000000000..1f5dd5b1a465b
--- /dev/null
+++ b/.github/workflows/shared_close_direct_sync_branch_prs.yml
@@ -0,0 +1,37 @@
+name: (Shared) Close Direct Sync Branch PRs
+
+on:
+  pull_request:
+    branches:
+      - builds/facebook-*
+
+env:
+  TZ: /usr/share/zoneinfo/America/Los_Angeles
+  # https://github.com/actions/cache/blob/main/tips-and-workarounds.md#cache-segment-restore-timeout
+  SEGMENT_DOWNLOAD_TIMEOUT_MINS: 1
+
+jobs:
+  close_pr:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Close PR
+        uses: actions/github-script@v7
+        with:
+          script: |
+            const owner = context.repo.owner;
+            const repo = context.repo.repo;
+            const pullNumber = ${{ github.event.number }};
+
+            await github.rest.pulls.createReview({
+              owner,
+              repo,
+              pull_number: pullNumber,
+              body: 'Do not land changes to `${{ github.event.pull_request.base.ref }}`. Please re-open your PR targeting `main` instead.',
+              event: 'REQUEST_CHANGES'
+            });
+            await github.rest.pulls.update({
+              owner,
+              repo,
+              pull_number: pullNumber,
+              state: 'closed'
+            });

From 062fb31155e42b6997a35b97180055814471620c Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 18:01:53 -0500
Subject: [PATCH 09/73] [ci] Fix typo (#32337)

Oops.
---
 .github/workflows/shared_close_direct_sync_branch_prs.yml | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/.github/workflows/shared_close_direct_sync_branch_prs.yml b/.github/workflows/shared_close_direct_sync_branch_prs.yml
index 1f5dd5b1a465b..7575c0e913c7e 100644
--- a/.github/workflows/shared_close_direct_sync_branch_prs.yml
+++ b/.github/workflows/shared_close_direct_sync_branch_prs.yml
@@ -3,7 +3,7 @@ name: (Shared) Close Direct Sync Branch PRs
 on:
   pull_request:
     branches:
-      - builds/facebook-*
+      - 'builds/facebook-**'
 
 env:
   TZ: /usr/share/zoneinfo/America/Los_Angeles

From 594ea533d39f71fa16503c0e5d5e146e9278647e Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Sun, 9 Feb 2025 15:01:28 -0500
Subject: [PATCH 10/73] Remove useActionState Hook export from experimental
 react-server condition (#32342)

This Hook is not available in RSC environments. This is already the case
in stable but not in experimental for some reason. Probably an
oversight.
---
 packages/react/src/ReactServer.experimental.development.js | 2 --
 packages/react/src/ReactServer.experimental.js             | 2 --
 2 files changed, 4 deletions(-)

diff --git a/packages/react/src/ReactServer.experimental.development.js b/packages/react/src/ReactServer.experimental.development.js
index fc22dda4e7896..0176e0e94f7cc 100644
--- a/packages/react/src/ReactServer.experimental.development.js
+++ b/packages/react/src/ReactServer.experimental.development.js
@@ -30,7 +30,6 @@ import {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   getCacheForType,
 } from './ReactHooks';
 import {forwardRef} from './ReactForwardRef';
@@ -78,7 +77,6 @@ export {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   version,
   // Experimental
   REACT_SUSPENSE_LIST_TYPE as unstable_SuspenseList,
diff --git a/packages/react/src/ReactServer.experimental.js b/packages/react/src/ReactServer.experimental.js
index 758c3d8b89ae0..c687bff7213b4 100644
--- a/packages/react/src/ReactServer.experimental.js
+++ b/packages/react/src/ReactServer.experimental.js
@@ -30,7 +30,6 @@ import {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   getCacheForType,
 } from './ReactHooks';
 import {forwardRef} from './ReactForwardRef';
@@ -77,7 +76,6 @@ export {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   version,
   // Experimental
   REACT_SUSPENSE_LIST_TYPE as unstable_SuspenseList,

From 93b58361d9c9632acdda76eb8a1a582d1ff9701a Mon Sep 17 00:00:00 2001
From: Hendrik Liebau <mail@hendrik-liebau.de>
Date: Sun, 9 Feb 2025 23:55:50 +0100
Subject: [PATCH 11/73] Trigger Discord notification when draft PR is set to
 "ready for review" (#32344)

Follow-up for #32332. The Discord webhook seems to ignore draft PRs,
which is a good thing. But when a draft PR is then later set to "ready
for review" we do want to send another notification that should not be
filtered out.
---
 .github/workflows/runtime_discord_notify.yml | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/.github/workflows/runtime_discord_notify.yml b/.github/workflows/runtime_discord_notify.yml
index 5a138ce71b13b..e41b1c56405a7 100644
--- a/.github/workflows/runtime_discord_notify.yml
+++ b/.github/workflows/runtime_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Runtime) Discord Notify
 
 on:
   pull_request_target:
-    types: [opened]
+    types: [opened, ready_for_review]
     paths-ignore:
       - compiler/**
       - .github/workflows/compiler_**.yml

From 3dd2c627707fea4f45fd8e5cc583036a72e3f77b Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Mon, 10 Feb 2025 14:08:44 -0500
Subject: [PATCH 12/73] [react-native] fix divergence in synced code (#32348)

Alternative to #32334
---
 packages/react-native-renderer/src/ReactNativeTypes.js | 3 ++-
 1 file changed, 2 insertions(+), 1 deletion(-)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 55ae2cc1b0a0e..07030a6b7f6c7 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -10,6 +10,7 @@
  */
 
 import type {ElementRef, ElementType, MixedElement} from 'react';
+import {type PublicRootInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
 export type MeasureOnSuccessCallback = (
   x: number,
@@ -231,7 +232,6 @@ export opaque type Node = mixed;
 export opaque type InternalInstanceHandle = mixed;
 type PublicInstance = mixed;
 type PublicTextInstance = mixed;
-export opaque type PublicRootInstance = mixed;
 
 export type ReactFabricType = {
   findHostInstance_DEPRECATED<TElementType: ElementType>(
@@ -261,6 +261,7 @@ export type ReactFabricType = {
   getPublicInstanceFromInternalInstanceHandle(
     internalInstanceHandle: InternalInstanceHandle,
   ): PublicInstance | PublicTextInstance | null,
+  getPublicInstanceFromRootTag(rootTag: number): PublicRootInstance | null,
   ...
 };
 

From cd90a4d8c0d5dbaa8ab61e839b112b1518d5058f Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Mon, 10 Feb 2025 15:46:47 -0500
Subject: [PATCH 13/73] [react-native] Suppress Flow nonstrict-import check in
 ReactNativeTypes (#32349)

Summary: Unblock internal sync.

Test Plan:

Reviewers:

Subscribers:

Tasks:

Tags:
---
 packages/react-native-renderer/src/ReactNativeTypes.js | 1 +
 1 file changed, 1 insertion(+)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 07030a6b7f6c7..8bce919d385e9 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -10,6 +10,7 @@
  */
 
 import type {ElementRef, ElementType, MixedElement} from 'react';
+// $FlowFixMe[nonstrict-import] TODO(@rubennorte)
 import {type PublicRootInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
 export type MeasureOnSuccessCallback = (

From 0a7dc1b1c714e74a1594c712d2317969e6421685 Mon Sep 17 00:00:00 2001
From: Brendan Abbott <brendan@bloodbone.ws>
Date: Wed, 12 Feb 2025 04:14:43 +1000
Subject: [PATCH 14/73] [devtools] Introduce REACT_DEVTOOLS_PORT for the
 standalone react-devtools (#30767)
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit

## Summary

This PR attempts to make running the React DevTools a little friendlier
in projects that are not completely React.

At the moment, running the DevTools with `npx react-devtools` will
default to the port to use the `PORT` env variable otherwise it'll fall
back to `8097`. `PORT` is a common env variable, so we can get into this
strange situation where the a Rails server (eg Puma) is using `PORT`,
and then the React DevTools attempts to boot using the same `PORT`.

This PR introduces a dedicated env variable, `REACT_DEVTOOLS_PORT` to
assist in this scenario.

## How did you test this change?

I'm using fish shell, so I did the following, please let me know if
there's a better way:

```sh
cd packages/react-devtools
set -x PORT 1000
set -x REACT_DEVTOOLS_PORT 2000
node bin.js
```

We can see in the UI that it's listening on `2000`. Without this PR,
it'd listen on `1000`:

![Screenshot 2024-08-21 at 10 45
42 AM](https://github.com/user-attachments/assets/a5c7590c-1b54-4ac8-9a8b-8eb66ff67cfb)
---
 packages/react-devtools/README.md  | 2 +-
 packages/react-devtools/preload.js | 2 +-
 2 files changed, 2 insertions(+), 2 deletions(-)

diff --git a/packages/react-devtools/README.md b/packages/react-devtools/README.md
index 149ec97f8af57..8c436c1fb2b4d 100644
--- a/packages/react-devtools/README.md
+++ b/packages/react-devtools/README.md
@@ -87,7 +87,7 @@ This will ensure the developer tools are connected. **Don’t forget to remove i
 
 ## Advanced
 
-By default DevTools listen to port `8097` on `localhost`. If you need to customize host, port, or other settings, see the `react-devtools-core` package instead.
+By default DevTools listen to port `8097` on `localhost`. The port can be modified by setting the `REACT_DEVTOOLS_PORT` environment variable. If you need to further customize host, port, or other settings, see the `react-devtools-core` package instead.
 
 ## FAQ
 
diff --git a/packages/react-devtools/preload.js b/packages/react-devtools/preload.js
index 634cffc635a40..33a9e3d6dd46e 100644
--- a/packages/react-devtools/preload.js
+++ b/packages/react-devtools/preload.js
@@ -35,7 +35,7 @@ contextBridge.exposeInMainWorld('api', {
     }
     const host = process.env.HOST || 'localhost';
     const protocol = useHttps ? 'https' : 'http';
-    const port = +process.env.PORT || 8097;
+    const port = +process.env.REACT_DEVTOOLS_PORT || +process.env.PORT || 8097;
     return {options, useHttps, host, protocol, port};
   },
 });

From 899e3d1297ec15a5aa8d73e2f1bd478918090a12 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 13:52:25 -0500
Subject: [PATCH 15/73] [crud] Narrow resource type (#32203)

Small refactor to the `resource` type to narrow it to an arbitrary
object or void/null instead of the top type. This makes the overload on
useEffect simpler since the return type of create is no longer widened
to the top type when we merge their definitions.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32203).
* #32206
* #32205
* #32204
* __->__ #32203
---
 .../react-debug-tools/src/ReactDebugHooks.js  |  6 +-
 .../src/ReactFiberCallUserSpace.js            |  2 +-
 .../src/ReactFiberCommitEffects.js            |  8 +-
 .../react-reconciler/src/ReactFiberHooks.js   | 78 +++++++++----------
 .../src/ReactInternalTypes.js                 |  6 +-
 packages/react/src/ReactHooks.js              |  6 +-
 6 files changed, 54 insertions(+), 52 deletions(-)

diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index f30489b7f655f..9c310723b2605 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -739,11 +739,11 @@ function useHostTransitionStatus(): TransitionStatus {
 }
 
 function useResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   nextHook();
   hookLog.push({
diff --git a/packages/react-reconciler/src/ReactFiberCallUserSpace.js b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
index a1b86c7560a2a..dd7beecd93582 100644
--- a/packages/react-reconciler/src/ReactFiberCallUserSpace.js
+++ b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
@@ -183,7 +183,7 @@ export const callComponentWillUnmountInDEV: (
 const callCreate = {
   'react-stack-bottom-frame': function (
     effect: Effect,
-  ): (() => void) | mixed | void {
+  ): (() => void) | {...} | void | null {
     if (!enableUseResourceEffectHook) {
       if (effect.resourceKind != null) {
         if (__DEV__) {
diff --git a/packages/react-reconciler/src/ReactFiberCommitEffects.js b/packages/react-reconciler/src/ReactFiberCommitEffects.js
index 6873bdf9e7a63..a8e08721eed5f 100644
--- a/packages/react-reconciler/src/ReactFiberCommitEffects.js
+++ b/packages/react-reconciler/src/ReactFiberCommitEffects.js
@@ -274,6 +274,7 @@ export function commitHookEffectListMount(
                 addendum =
                   ' You returned null. If your effect does not require clean ' +
                   'up, return undefined (or nothing).';
+                // $FlowFixMe (@poteto) this check is safe on arbitrary non-null/void objects
               } else if (typeof destroy.then === 'function') {
                 addendum =
                   '\n\nIt looks like you wrote ' +
@@ -1036,10 +1037,10 @@ function safelyCallDestroy(
 function safelyCallDestroyWithResource(
   current: Fiber,
   nearestMountedAncestor: Fiber | null,
-  destroy: mixed => void,
-  resource: mixed,
+  destroy: ({...}) => void,
+  resource: {...},
 ) {
-  const destroy_ = resource == null ? destroy : destroy.bind(null, resource);
+  const destroy_ = destroy.bind(null, resource);
   if (__DEV__) {
     runWithFiberInDEV(
       current,
@@ -1050,6 +1051,7 @@ function safelyCallDestroyWithResource(
     );
   } else {
     try {
+      // $FlowFixMe(incompatible-call) Already bound to resource
       destroy_();
     } catch (error) {
       captureCommitPhaseError(current, nearestMountedAncestor, error);
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index f3a581a97476a..9d97710003317 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -205,8 +205,8 @@ export type Hook = {
 // the additional memory and we can follow up with performance
 // optimizations later.
 type EffectInstance = {
-  resource: mixed,
-  destroy: void | (() => void) | ((resource: mixed) => void),
+  resource: {...} | void | null,
+  destroy: void | (() => void) | ((resource: {...} | void | null) => void),
 };
 
 export const ResourceEffectIdentityKind: 0 = 0;
@@ -229,7 +229,7 @@ export type ResourceEffectIdentity = {
   resourceKind: typeof ResourceEffectIdentityKind,
   tag: HookFlags,
   inst: EffectInstance,
-  create: () => mixed,
+  create: () => {...} | void | null,
   deps: Array<mixed> | void | null,
   next: Effect,
 };
@@ -237,7 +237,7 @@ export type ResourceEffectUpdate = {
   resourceKind: typeof ResourceEffectUpdateKind,
   tag: HookFlags,
   inst: EffectInstance,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   deps: Array<mixed> | void | null,
   next: Effect,
   identity: ResourceEffectIdentity,
@@ -2540,9 +2540,9 @@ function pushResourceEffect(
   identityTag: HookFlags,
   updateTag: HookFlags,
   inst: EffectInstance,
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
 ): Effect {
   const effectIdentity: ResourceEffectIdentity = {
@@ -2694,11 +2694,11 @@ function updateEffect(
 }
 
 function mountResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   if (
     __DEV__ &&
@@ -2730,11 +2730,11 @@ function mountResourceEffect(
 function mountResourceEffectImpl(
   fiberFlags: Flags,
   hookFlags: HookFlags,
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   const hook = mountWorkInProgressHook();
   currentlyRenderingFiber.flags |= fiberFlags;
@@ -2752,11 +2752,11 @@ function mountResourceEffectImpl(
 }
 
 function updateResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   updateResourceEffectImpl(
     PassiveEffect,
@@ -2772,11 +2772,11 @@ function updateResourceEffect(
 function updateResourceEffectImpl(
   fiberFlags: Flags,
   hookFlags: HookFlags,
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   const hook = updateWorkInProgressHook();
   const effect: Effect = hook.memoizedState;
@@ -4245,11 +4245,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ): void {
         currentHookNameInDev = 'useResourceEffect';
         mountHookTypesDev();
@@ -4433,11 +4433,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ): void {
         currentHookNameInDev = 'useResourceEffect';
         updateHookTypesDev();
@@ -4620,11 +4620,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         updateHookTypesDev();
@@ -4807,11 +4807,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         updateHookTypesDev();
@@ -5019,11 +5019,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ): void {
         currentHookNameInDev = 'useResourceEffect';
         warnInvalidHookAccess();
@@ -5232,11 +5232,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         warnInvalidHookAccess();
@@ -5445,11 +5445,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         warnInvalidHookAccess();
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 0c5504cab468e..e31b7cefd1ed7 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -398,11 +398,11 @@ export type Dispatcher = {
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
   // TODO: Non-nullable once `enableUseResourceEffectHook` is on everywhere.
   useResourceEffect?: (
-    create: () => mixed,
+    create: () => {...} | void | null,
     createDeps: Array<mixed> | void | null,
-    update: ((resource: mixed) => void) | void,
+    update: ((resource: {...} | void | null) => void) | void,
     updateDeps: Array<mixed> | void | null,
-    destroy: ((resource: mixed) => void) | void,
+    destroy: ((resource: {...} | void | null) => void) | void,
   ) => void,
   useInsertionEffect(
     create: () => (() => void) | void,
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 32f49268880f0..ff45b5415c416 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -202,11 +202,11 @@ export function useEffectEvent<Args, F: (...Array<Args>) => mixed>(
 }
 
 export function useResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ): void {
   if (!enableUseResourceEffectHook) {
     throw new Error('Not implemented.');

From 0461c0d8a49730d1c8ebca2071d9bb7adfc8ac92 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 14:05:50 -0500
Subject: [PATCH 16/73] [crud] Rename useResourceEffect flag (#32204)

Rename the flag in preparation for the overload.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32204).
* #32206
* #32205
* __->__ #32204
---
 .../ReactDOMServerIntegrationHooks-test.js    |  2 +-
 .../src/ReactFiberCallUserSpace.js            |  6 ++--
 .../src/ReactFiberCommitEffects.js            | 16 +++++-----
 .../react-reconciler/src/ReactFiberHooks.js   | 24 +++++++-------
 .../src/ReactInternalTypes.js                 |  2 +-
 .../ReactHooksWithNoopRenderer-test.js        | 32 +++++++++----------
 packages/react-server/src/ReactFizzHooks.js   |  4 +--
 packages/react/src/ReactClient.js             |  4 +--
 packages/react/src/ReactHooks.js              |  4 +--
 packages/shared/ReactFeatureFlags.js          |  2 +-
 .../ReactFeatureFlags.native-fb-dynamic.js    |  2 +-
 .../forks/ReactFeatureFlags.native-fb.js      |  2 +-
 .../forks/ReactFeatureFlags.native-oss.js     |  2 +-
 .../forks/ReactFeatureFlags.test-renderer.js  |  2 +-
 ...actFeatureFlags.test-renderer.native-fb.js |  2 +-
 .../ReactFeatureFlags.test-renderer.www.js    |  2 +-
 .../forks/ReactFeatureFlags.www-dynamic.js    |  2 +-
 .../shared/forks/ReactFeatureFlags.www.js     |  2 +-
 18 files changed, 56 insertions(+), 56 deletions(-)

diff --git a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
index b79e59ad004dd..bce830ddf0647 100644
--- a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
@@ -657,7 +657,7 @@ describe('ReactDOMServerHooks', () => {
 
   describe('useResourceEffect', () => {
     gate(flags => {
-      if (flags.enableUseResourceEffectHook) {
+      if (flags.enableUseEffectCRUDOverload) {
         const yields = [];
         itRenders(
           'should ignore resource effects on the server',
diff --git a/packages/react-reconciler/src/ReactFiberCallUserSpace.js b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
index dd7beecd93582..25ede645b5e7f 100644
--- a/packages/react-reconciler/src/ReactFiberCallUserSpace.js
+++ b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
@@ -18,7 +18,7 @@ import {
   ResourceEffectIdentityKind,
   ResourceEffectUpdateKind,
 } from './ReactFiberHooks';
-import {enableUseResourceEffectHook} from 'shared/ReactFeatureFlags';
+import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 // These indirections exists so we can exclude its stack frame in DEV (and anything below it).
 // TODO: Consider marking the whole bundle instead of these boundaries.
@@ -184,11 +184,11 @@ const callCreate = {
   'react-stack-bottom-frame': function (
     effect: Effect,
   ): (() => void) | {...} | void | null {
-    if (!enableUseResourceEffectHook) {
+    if (!enableUseEffectCRUDOverload) {
       if (effect.resourceKind != null) {
         if (__DEV__) {
           console.error(
-            'Expected only SimpleEffects when enableUseResourceEffectHook is disabled, ' +
+            'Expected only SimpleEffects when enableUseEffectCRUDOverload is disabled, ' +
               'got %s',
             effect.resourceKind,
           );
diff --git a/packages/react-reconciler/src/ReactFiberCommitEffects.js b/packages/react-reconciler/src/ReactFiberCommitEffects.js
index a8e08721eed5f..29e5de2817201 100644
--- a/packages/react-reconciler/src/ReactFiberCommitEffects.js
+++ b/packages/react-reconciler/src/ReactFiberCommitEffects.js
@@ -22,7 +22,7 @@ import {
   enableProfilerCommitHooks,
   enableProfilerNestedUpdatePhase,
   enableSchedulingProfiler,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   enableViewTransition,
 } from 'shared/ReactFeatureFlags';
 import {
@@ -160,7 +160,7 @@ export function commitHookEffectListMount(
 
           // Mount
           let destroy;
-          if (enableUseResourceEffectHook) {
+          if (enableUseEffectCRUDOverload) {
             if (effect.resourceKind === ResourceEffectIdentityKind) {
               if (__DEV__) {
                 effect.inst.resource = runWithFiberInDEV(
@@ -200,7 +200,7 @@ export function commitHookEffectListMount(
             if ((flags & HookInsertion) !== NoHookEffect) {
               setIsRunningInsertionEffect(true);
             }
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (effect.resourceKind == null) {
                 destroy = runWithFiberInDEV(
                   finishedWork,
@@ -219,7 +219,7 @@ export function commitHookEffectListMount(
               setIsRunningInsertionEffect(false);
             }
           } else {
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (effect.resourceKind == null) {
                 const create = effect.create;
                 const inst = effect.inst;
@@ -230,7 +230,7 @@ export function commitHookEffectListMount(
               if (effect.resourceKind != null) {
                 if (__DEV__) {
                   console.error(
-                    'Expected only SimpleEffects when enableUseResourceEffectHook is disabled, ' +
+                    'Expected only SimpleEffects when enableUseEffectCRUDOverload is disabled, ' +
                       'got %s',
                     effect.resourceKind,
                   );
@@ -262,7 +262,7 @@ export function commitHookEffectListMount(
               } else if ((effect.tag & HookInsertion) !== NoFlags) {
                 hookName = 'useInsertionEffect';
               } else if (
-                enableUseResourceEffectHook &&
+                enableUseEffectCRUDOverload &&
                 effect.resourceKind != null
               ) {
                 hookName = 'useResourceEffect';
@@ -338,7 +338,7 @@ export function commitHookEffectListUnmount(
           const inst = effect.inst;
           const destroy = inst.destroy;
           if (destroy !== undefined) {
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (effect.resourceKind == null) {
                 inst.destroy = undefined;
               }
@@ -358,7 +358,7 @@ export function commitHookEffectListUnmount(
                 setIsRunningInsertionEffect(true);
               }
             }
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (
                 effect.resourceKind === ResourceEffectIdentityKind &&
                 effect.inst.resource != null
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 9d97710003317..87f601dae597d 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -38,7 +38,7 @@ import {
   enableSchedulingProfiler,
   enableTransitionTracing,
   enableUseEffectEventHook,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   enableLegacyCache,
   disableLegacyMode,
   enableNoCloningMemoCache,
@@ -3938,7 +3938,7 @@ export const ContextOnlyDispatcher: Dispatcher = {
 if (enableUseEffectEventHook) {
   (ContextOnlyDispatcher: Dispatcher).useEffectEvent = throwInvalidHookError;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (ContextOnlyDispatcher: Dispatcher).useResourceEffect = throwInvalidHookError;
 }
 
@@ -3971,7 +3971,7 @@ const HooksDispatcherOnMount: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnMount: Dispatcher).useEffectEvent = mountEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (HooksDispatcherOnMount: Dispatcher).useResourceEffect = mountResourceEffect;
 }
 
@@ -4004,7 +4004,7 @@ const HooksDispatcherOnUpdate: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnUpdate: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (HooksDispatcherOnUpdate: Dispatcher).useResourceEffect =
     updateResourceEffect;
 }
@@ -4038,7 +4038,7 @@ const HooksDispatcherOnRerender: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnRerender: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (HooksDispatcherOnRerender: Dispatcher).useResourceEffect =
     updateResourceEffect;
 }
@@ -4242,7 +4242,7 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -4430,7 +4430,7 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -4617,7 +4617,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -4804,7 +4804,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -5016,7 +5016,7 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -5229,7 +5229,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -5442,7 +5442,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index e31b7cefd1ed7..9ac0680fb6279 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -396,7 +396,7 @@ export type Dispatcher = {
   ): void,
   // TODO: Non-nullable once `enableUseEffectEventHook` is on everywhere.
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
-  // TODO: Non-nullable once `enableUseResourceEffectHook` is on everywhere.
+  // TODO: Non-nullable once `enableUseEffectCRUDOverload` is on everywhere.
   useResourceEffect?: (
     create: () => {...} | void | null,
     createDeps: Array<mixed> | void | null,
diff --git a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
index e4febdb3e28f1..27bff1e0806c4 100644
--- a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
@@ -3311,7 +3311,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     });
   });
 
-  // @gate enableUseResourceEffectHook
+  // @gate enableUseEffectCRUDOverload
   describe('useResourceEffect', () => {
     class Resource {
       isDeleted: false;
@@ -3333,12 +3333,12 @@ describe('ReactHooksWithNoopRenderer', () => {
       }
     }
 
-    // @gate !enableUseResourceEffectHook
+    // @gate !enableUseEffectCRUDOverload
     it('is null when flag is disabled', async () => {
       expect(useResourceEffect).toBeUndefined();
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('validates create return value', async () => {
       function App({id}) {
         useResourceEffect(() => {
@@ -3359,7 +3359,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       );
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('validates non-empty update deps', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3386,7 +3386,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       ]);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('simple mount and update', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3443,7 +3443,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['destroy(2, Jack)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('simple mount with no update', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3480,7 +3480,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['destroy(1, Jack)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('calls update on every render if no deps are specified', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3523,7 +3523,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['update(2, Lauren)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('does not unmount previous useResourceEffect between updates', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3562,7 +3562,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['update(0)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('unmounts only on deletion', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3596,7 +3596,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('unmounts on deletion', async () => {
       function Wrapper(props) {
         return <App {...props} />;
@@ -3650,7 +3650,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('handles errors in create on mount', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3700,7 +3700,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('handles errors in create on update', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3744,7 +3744,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       }).rejects.toThrow('Oops error!');
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('handles errors in destroy on update', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3800,7 +3800,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook && enableActivity
+    // @gate enableUseEffectCRUDOverload && enableActivity
     it('composes with activity', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3873,7 +3873,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['destroy(0, Lauren)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('composes with suspense', async () => {
       function TextBox({text}) {
         return <AsyncText text={text} ms={0} />;
@@ -3991,7 +3991,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       );
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('composes with other kinds of effects', async () => {
       let rerender;
       function App({id, username}) {
diff --git a/packages/react-server/src/ReactFizzHooks.js b/packages/react-server/src/ReactFizzHooks.js
index 0db0b00b3bdee..63e8576ca788c 100644
--- a/packages/react-server/src/ReactFizzHooks.js
+++ b/packages/react-server/src/ReactFizzHooks.js
@@ -40,7 +40,7 @@ import {createFastHash} from './ReactServerStreamConfig';
 
 import {
   enableUseEffectEventHook,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
 } from 'shared/ReactFeatureFlags';
 import is from 'shared/objectIs';
 import {
@@ -866,7 +866,7 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
 if (enableUseEffectEventHook) {
   HooksDispatcher.useEffectEvent = useEffectEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   HooksDispatcher.useResourceEffect = supportsClientAPIs
     ? noop
     : clientHookNotSupported;
diff --git a/packages/react/src/ReactClient.js b/packages/react/src/ReactClient.js
index f633c7617d275..2bacbc85676fd 100644
--- a/packages/react/src/ReactClient.js
+++ b/packages/react/src/ReactClient.js
@@ -65,7 +65,7 @@ import {addTransitionType} from './ReactTransitionType';
 import {act} from './ReactAct';
 import {captureOwnerStack} from './ReactOwnerStack';
 import * as ReactCompilerRuntime from './ReactCompilerRuntime';
-import {enableUseResourceEffectHook} from 'shared/ReactFeatureFlags';
+import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 const Children = {
   map,
@@ -134,4 +134,4 @@ export {
 };
 
 export const experimental_useResourceEffect: typeof useResourceEffect | void =
-  enableUseResourceEffectHook ? useResourceEffect : undefined;
+  enableUseEffectCRUDOverload ? useResourceEffect : undefined;
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index ff45b5415c416..677e0d705b8aa 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -18,7 +18,7 @@ import {REACT_CONSUMER_TYPE} from 'shared/ReactSymbols';
 
 import ReactSharedInternals from 'shared/ReactSharedInternals';
 
-import {enableUseResourceEffectHook} from 'shared/ReactFeatureFlags';
+import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 type BasicStateAction<S> = (S => S) | S;
 type Dispatch<A> = A => void;
@@ -208,7 +208,7 @@ export function useResourceEffect(
   updateDeps: Array<mixed> | void | null,
   destroy: ((resource: {...} | void | null) => void) | void,
 ): void {
-  if (!enableUseResourceEffectHook) {
+  if (!enableUseEffectCRUDOverload) {
     throw new Error('Not implemented.');
   }
   const dispatcher = resolveDispatcher();
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index 290d5ba159d68..1cb1cb4cf7dc0 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -150,7 +150,7 @@ export const enableInfiniteRenderLoopDetection = false;
 /**
  * Experimental new hook for better managing resources in effects.
  */
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableFastAddPropertiesInDiffing = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index 6aaefdfa336fe..001b3d64c06dc 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -24,7 +24,7 @@ export const enablePersistedModeClonedFlag = __VARIANT__;
 export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
-export const enableUseResourceEffectHook = __VARIANT__;
+export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableOwnerStacks = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 878d344a42a41..6e82185b5d98c 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -24,7 +24,7 @@ export const {
   enableObjectFiber,
   enablePersistedModeClonedFlag,
   enableShallowPropDiffing,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   passChildrenWhenCloningPersistedNodes,
   enableSiblingPrerendering,
   enableOwnerStacks,
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index a3202c0b80049..3f373e998cd8e 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -63,7 +63,7 @@ export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
 export const enableSiblingPrerendering = true;
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 6bc085f540b23..da9b8a2612c9b 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -64,7 +64,7 @@ export const renameElementSymbol = true;
 export const enableShallowPropDiffing = false;
 export const enableSiblingPrerendering = true;
 
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableYieldingBeforePassive = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index d62a59122f82c..8c20cc28deb15 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -62,7 +62,7 @@ export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
 export const enableSiblingPrerendering = true;
-export const enableUseResourceEffectHook = true;
+export const enableUseEffectCRUDOverload = true;
 export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 301c01a018090..bc30992eb6eb5 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -74,7 +74,7 @@ export const enableOwnerStacks = false;
 export const enableShallowPropDiffing = false;
 export const enableSiblingPrerendering = true;
 
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
index e6fd46d0b1fb4..3cab1318c490e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
@@ -36,7 +36,7 @@ export const enableSchedulingProfiler = __VARIANT__;
 export const enableInfiniteRenderLoopDetection = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 
-export const enableUseResourceEffectHook = __VARIANT__;
+export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
 export const enableViewTransition = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index dcb77f9d84b5e..57be83577c956 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -29,7 +29,7 @@ export const {
   enableSiblingPrerendering,
   enableTransitionTracing,
   enableTrustedTypesIntegration,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   favorSafetyOverHydrationPerf,
   renameElementSymbol,
   retryLaneExpirationMs,

From 2c5fd26c07c0fb94ff21a6c10c5a757ef3c5d6a4 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 14:18:50 -0500
Subject: [PATCH 17/73] [crud] Merge useResourceEffect into useEffect (#32205)

Merges the useResourceEffect API into useEffect while keeping the
underlying implementation the same. useResourceEffect will be removed in
the next diff.

To fork between behavior we rely on a `typeof` check for the updater or
destroy function in addition to the CRUD feature flag. This does now
have to be checked every time (instead of inlined statically like before
due to them being different hooks) which will incur some non-zero amount
(possibly negligble) of overhead for every effect.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32205).
* #32206
* __->__ #32205
---
 .../react-debug-tools/src/ReactDebugHooks.js  |   7 +-
 .../ReactDOMServerIntegrationHooks-test.js    |   6 +-
 .../src/ReactFiberCallUserSpace.js            |   2 +-
 .../src/ReactFiberCommitEffects.js            |  41 +--
 .../react-reconciler/src/ReactFiberHooks.js   | 268 ++++++++++++++----
 .../src/ReactInternalTypes.js                 |   7 +-
 .../ReactHooksWithNoopRenderer-test.js        |  70 +++--
 packages/react/src/ReactHooks.js              |  26 +-
 scripts/error-codes/codes.json                |   3 +-
 9 files changed, 296 insertions(+), 134 deletions(-)

diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index 9c310723b2605..f45ccfecdcaec 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -373,8 +373,11 @@ function useInsertionEffect(
 }
 
 function useEffect(
-  create: () => (() => void) | void,
-  inputs: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   nextHook();
   hookLog.push({
diff --git a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
index bce830ddf0647..840d6c5b15d5e 100644
--- a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
@@ -27,7 +27,6 @@ let useRef;
 let useImperativeHandle;
 let useInsertionEffect;
 let useLayoutEffect;
-let useResourceEffect;
 let useDebugValue;
 let forwardRef;
 let yieldedValues;
@@ -52,7 +51,6 @@ function initModules() {
   useImperativeHandle = React.useImperativeHandle;
   useInsertionEffect = React.useInsertionEffect;
   useLayoutEffect = React.useLayoutEffect;
-  useResourceEffect = React.experimental_useResourceEffect;
   forwardRef = React.forwardRef;
 
   yieldedValues = [];
@@ -655,7 +653,7 @@ describe('ReactDOMServerHooks', () => {
     });
   });
 
-  describe('useResourceEffect', () => {
+  describe('useEffect with CRUD overload', () => {
     gate(flags => {
       if (flags.enableUseEffectCRUDOverload) {
         const yields = [];
@@ -663,7 +661,7 @@ describe('ReactDOMServerHooks', () => {
           'should ignore resource effects on the server',
           async render => {
             function Counter(props) {
-              useResourceEffect(
+              useEffect(
                 () => {
                   yieldValue('created on client');
                   return {resource_counter: props.count};
diff --git a/packages/react-reconciler/src/ReactFiberCallUserSpace.js b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
index 25ede645b5e7f..a9b5590f387b7 100644
--- a/packages/react-reconciler/src/ReactFiberCallUserSpace.js
+++ b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
@@ -254,7 +254,7 @@ const callDestroy = {
 export const callDestroyInDEV: (
   current: Fiber,
   nearestMountedAncestor: Fiber | null,
-  destroy: () => void,
+  destroy: (() => void) | (({...}) => void),
 ) => void = __DEV__
   ? // We use this technique to trick minifiers to preserve the function name.
     (callDestroy['react-stack-bottom-frame'].bind(callDestroy): any)
diff --git a/packages/react-reconciler/src/ReactFiberCommitEffects.js b/packages/react-reconciler/src/ReactFiberCommitEffects.js
index 29e5de2817201..05cf17a34273e 100644
--- a/packages/react-reconciler/src/ReactFiberCommitEffects.js
+++ b/packages/react-reconciler/src/ReactFiberCommitEffects.js
@@ -170,8 +170,9 @@ export function commitHookEffectListMount(
                 );
                 if (effect.inst.resource == null) {
                   console.error(
-                    'useResourceEffect must provide a callback which returns a resource. ' +
-                      'If a managed resource is not needed here, use useEffect. Received %s',
+                    'useEffect must provide a callback which returns a resource. ' +
+                      'If a managed resource is not needed here, do not provide an updater or ' +
+                      'destroy callback. Received %s',
                     effect.inst.resource,
                   );
                 }
@@ -261,11 +262,6 @@ export function commitHookEffectListMount(
                 hookName = 'useLayoutEffect';
               } else if ((effect.tag & HookInsertion) !== NoFlags) {
                 hookName = 'useInsertionEffect';
-              } else if (
-                enableUseEffectCRUDOverload &&
-                effect.resourceKind != null
-              ) {
-                hookName = 'useResourceEffect';
               } else {
                 hookName = 'useEffect';
               }
@@ -363,7 +359,7 @@ export function commitHookEffectListUnmount(
                 effect.resourceKind === ResourceEffectIdentityKind &&
                 effect.inst.resource != null
               ) {
-                safelyCallDestroyWithResource(
+                safelyCallDestroy(
                   finishedWork,
                   nearestMountedAncestor,
                   destroy,
@@ -1015,32 +1011,11 @@ export function safelyDetachRef(
 function safelyCallDestroy(
   current: Fiber,
   nearestMountedAncestor: Fiber | null,
-  destroy: () => void,
-) {
-  if (__DEV__) {
-    runWithFiberInDEV(
-      current,
-      callDestroyInDEV,
-      current,
-      nearestMountedAncestor,
-      destroy,
-    );
-  } else {
-    try {
-      destroy();
-    } catch (error) {
-      captureCommitPhaseError(current, nearestMountedAncestor, error);
-    }
-  }
-}
-
-function safelyCallDestroyWithResource(
-  current: Fiber,
-  nearestMountedAncestor: Fiber | null,
-  destroy: ({...}) => void,
-  resource: {...},
+  destroy: (() => void) | (({...}) => void),
+  resource?: {...} | void | null,
 ) {
-  const destroy_ = destroy.bind(null, resource);
+  // $FlowFixMe[extra-arg] @poteto this is safe either way because the extra arg is ignored if it's not a CRUD effect
+  const destroy_ = resource == null ? destroy : destroy.bind(null, resource);
   if (__DEV__) {
     runWithFiberInDEV(
       current,
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 87f601dae597d..976657d4c68f7 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -2523,12 +2523,15 @@ function pushSimpleEffect(
   tag: HookFlags,
   inst: EffectInstance,
   create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): Effect {
   const effect: Effect = {
     tag,
     create,
-    deps,
+    deps: createDeps,
     inst,
     // Circular
     next: (null: any),
@@ -2608,10 +2611,13 @@ function mountEffectImpl(
   fiberFlags: Flags,
   hookFlags: HookFlags,
   create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   const hook = mountWorkInProgressHook();
-  const nextDeps = deps === undefined ? null : deps;
+  const nextDeps = createDeps === undefined ? null : createDeps;
   currentlyRenderingFiber.flags |= fiberFlags;
   hook.memoizedState = pushSimpleEffect(
     HookHasEffect | hookFlags,
@@ -2662,35 +2668,89 @@ function updateEffectImpl(
 }
 
 function mountEffect(
-  create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   if (
     __DEV__ &&
     (currentlyRenderingFiber.mode & StrictEffectsMode) !== NoMode &&
     (currentlyRenderingFiber.mode & NoStrictPassiveEffectsMode) === NoMode
   ) {
-    mountEffectImpl(
-      MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
-      HookPassive,
-      create,
-      deps,
-    );
+    if (
+      enableUseEffectCRUDOverload &&
+      (typeof update === 'function' || typeof destroy === 'function')
+    ) {
+      mountResourceEffectImpl(
+        MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        create,
+        createDeps,
+        update,
+        updateDeps,
+        destroy,
+      );
+    } else {
+      mountEffectImpl(
+        MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        // $FlowFixMe[incompatible-call] @poteto it's not possible to narrow `create` without calling it.
+        create,
+        createDeps,
+      );
+    }
   } else {
-    mountEffectImpl(
-      PassiveEffect | PassiveStaticEffect,
-      HookPassive,
-      create,
-      deps,
-    );
+    if (
+      enableUseEffectCRUDOverload &&
+      (typeof update === 'function' || typeof destroy === 'function')
+    ) {
+      mountResourceEffectImpl(
+        PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        create,
+        createDeps,
+        update,
+        updateDeps,
+        destroy,
+      );
+    } else {
+      mountEffectImpl(
+        PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        // $FlowFixMe[incompatible-call] @poteto it's not possible to narrow `create` without calling it.
+        create,
+        createDeps,
+      );
+    }
   }
 }
 
 function updateEffect(
-  create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
-  updateEffectImpl(PassiveEffect, HookPassive, create, deps);
+  if (
+    enableUseEffectCRUDOverload &&
+    (typeof update === 'function' || typeof destroy === 'function')
+  ) {
+    updateResourceEffectImpl(
+      PassiveEffect,
+      HookPassive,
+      create,
+      createDeps,
+      update,
+      updateDeps,
+      destroy,
+    );
+  } else {
+    // $FlowFixMe[incompatible-call] @poteto it's not possible to narrow `create` without calling it.
+    updateEffectImpl(PassiveEffect, HookPassive, create, createDeps);
+  }
 }
 
 function mountResourceEffect(
@@ -2705,15 +2765,6 @@ function mountResourceEffect(
     (currentlyRenderingFiber.mode & StrictEffectsMode) !== NoMode &&
     (currentlyRenderingFiber.mode & NoStrictPassiveEffectsMode) === NoMode
   ) {
-    mountResourceEffectImpl(
-      MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
-      HookPassive,
-      create,
-      createDeps,
-      update,
-      updateDeps,
-      destroy,
-    );
   } else {
     mountResourceEffectImpl(
       PassiveEffect | PassiveStaticEffect,
@@ -4087,13 +4138,30 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       mountHookTypesDev();
-      checkDepsAreArrayDev(deps);
-      return mountEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        checkDepsAreNonEmptyArrayDev(updateDeps);
+        return mountResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        checkDepsAreArrayDev(createDeps);
+        return mountEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4280,12 +4348,28 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       updateHookTypesDev();
-      return mountEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return mountResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return mountEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4467,12 +4551,28 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4654,12 +4754,28 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4847,13 +4963,29 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       warnInvalidHookAccess();
       mountHookTypesDev();
-      return mountEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return mountResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return mountEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -5060,13 +5192,29 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       warnInvalidHookAccess();
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -5273,13 +5421,29 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       warnInvalidHookAccess();
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 9ac0680fb6279..756d88c4a5d15 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -391,8 +391,11 @@ export type Dispatcher = {
   useContext<T>(context: ReactContext<T>): T,
   useRef<T>(initialValue: T): {current: T},
   useEffect(
-    create: () => (() => void) | void,
-    deps: Array<mixed> | void | null,
+    create: (() => (() => void) | void) | (() => {...} | void | null),
+    createDeps: Array<mixed> | void | null,
+    update?: ((resource: {...} | void | null) => void) | void,
+    updateDeps?: Array<mixed> | void | null,
+    destroy?: ((resource: {...} | void | null) => void) | void,
   ): void,
   // TODO: Non-nullable once `enableUseEffectEventHook` is on everywhere.
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
diff --git a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
index 27bff1e0806c4..47fd534e683a9 100644
--- a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
@@ -41,7 +41,6 @@ let waitFor;
 let waitForThrow;
 let waitForPaint;
 let assertLog;
-let useResourceEffect;
 let assertConsoleErrorDev;
 
 describe('ReactHooksWithNoopRenderer', () => {
@@ -70,7 +69,6 @@ describe('ReactHooksWithNoopRenderer', () => {
     useDeferredValue = React.useDeferredValue;
     Suspense = React.Suspense;
     Activity = React.unstable_Activity;
-    useResourceEffect = React.experimental_useResourceEffect;
     ContinuousEventPriority =
       require('react-reconciler/constants').ContinuousEventPriority;
     if (gate(flags => flags.enableSuspenseList)) {
@@ -3312,7 +3310,7 @@ describe('ReactHooksWithNoopRenderer', () => {
   });
 
   // @gate enableUseEffectCRUDOverload
-  describe('useResourceEffect', () => {
+  describe('useEffect CRUD overload', () => {
     class Resource {
       isDeleted: false;
       id: string;
@@ -3335,34 +3333,34 @@ describe('ReactHooksWithNoopRenderer', () => {
 
     // @gate !enableUseEffectCRUDOverload
     it('is null when flag is disabled', async () => {
-      expect(useResourceEffect).toBeUndefined();
-    });
-
-    // @gate enableUseEffectCRUDOverload
-    it('validates create return value', async () => {
       function App({id}) {
-        useResourceEffect(() => {
-          Scheduler.log(`create(${id})`);
-        }, [id]);
+        useEffect(
+          () => {
+            Scheduler.log(`create(${id})`);
+            return {};
+          },
+          [id],
+          () => {
+            Scheduler.log('update');
+          },
+          [],
+        );
         return null;
       }
 
-      await act(() => {
-        ReactNoop.render(<App id={1} />);
-      });
-      assertConsoleErrorDev(
-        [
-          'useResourceEffect must provide a callback which returns a resource. ' +
-            'If a managed resource is not needed here, use useEffect. Received undefined',
-        ],
-        {withoutStack: true},
+      await expect(async () => {
+        await act(() => {
+          ReactNoop.render(<App id={1} />);
+        });
+      }).rejects.toThrow(
+        'useEffect CRUD overload is not enabled in this build of React.',
       );
     });
 
     // @gate enableUseEffectCRUDOverload
     it('validates non-empty update deps', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log(`create(${id})`);
             return {};
@@ -3380,7 +3378,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         ReactNoop.render(<App id={1} />);
       });
       assertConsoleErrorDev([
-        'useResourceEffect received a dependency array with no dependencies. ' +
+        'useEffect received a dependency array with no dependencies. ' +
           'When specified, the dependency array must have at least one dependency.\n' +
           '    in App (at **)',
       ]);
@@ -3392,7 +3390,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3449,7 +3447,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3486,7 +3484,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3524,9 +3522,9 @@ describe('ReactHooksWithNoopRenderer', () => {
     });
 
     // @gate enableUseEffectCRUDOverload
-    it('does not unmount previous useResourceEffect between updates', async () => {
+    it('does not unmount previous useEffect between updates', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id);
             Scheduler.log(`create(${resource.id})`);
@@ -3565,7 +3563,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     // @gate enableUseEffectCRUDOverload
     it('unmounts only on deletion', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id);
             Scheduler.log(`create(${resource.id})`);
@@ -3605,7 +3603,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3653,7 +3651,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     // @gate enableUseEffectCRUDOverload
     it('handles errors in create on mount', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log(`Mount A [${id}]`);
             return {};
@@ -3665,7 +3663,7 @@ describe('ReactHooksWithNoopRenderer', () => {
             Scheduler.log(`Unmount A [${id}]`);
           },
         );
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log('Oops!');
             throw new Error('Oops!');
@@ -3703,7 +3701,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     // @gate enableUseEffectCRUDOverload
     it('handles errors in create on update', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log(`Mount A [${id}]`);
             return {};
@@ -3750,7 +3748,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`Mount A [${id}, ${resource.opts.username}]`);
@@ -3806,7 +3804,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3885,7 +3883,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -4003,7 +4001,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         useEffect(() => {
           Scheduler.log(`useEffect(${count})`);
         }, [count]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 677e0d705b8aa..2fe6d2b85bcf1 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -87,11 +87,31 @@ export function useRef<T>(initialValue: T): {current: T} {
 }
 
 export function useEffect(
-  create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   const dispatcher = resolveDispatcher();
-  return dispatcher.useEffect(create, deps);
+  if (
+    enableUseEffectCRUDOverload &&
+    (typeof update === 'function' || typeof destroy === 'function')
+  ) {
+    // $FlowFixMe[not-a-function] This is unstable, thus optional
+    return dispatcher.useEffect(
+      create,
+      createDeps,
+      update,
+      updateDeps,
+      destroy,
+    );
+  } else if (typeof update === 'function') {
+    throw new Error(
+      'useEffect CRUD overload is not enabled in this build of React.',
+    );
+  }
+  return dispatcher.useEffect(create, createDeps);
 }
 
 export function useInsertionEffect(
diff --git a/scripts/error-codes/codes.json b/scripts/error-codes/codes.json
index 8fa3d190ecb70..6ab654f1d35e5 100644
--- a/scripts/error-codes/codes.json
+++ b/scripts/error-codes/codes.json
@@ -530,5 +530,6 @@
   "542": "Suspense Exception: This is not a real error! It's an implementation detail of `useActionState` to interrupt the current render. You must either rethrow it immediately, or move the `useActionState` call outside of the `try/catch` block. Capturing without rethrowing will lead to unexpected behavior.\n\nTo handle async errors, wrap your component in an error boundary.",
   "543": "Expected a ResourceEffectUpdate to be pushed together with ResourceEffectIdentity. This is a bug in React.",
   "544": "Found a pair with an auto name. This is a bug in React.",
-  "545": "The %s tag may only be rendered once."
+  "545": "The %s tag may only be rendered once.",
+  "546": "useEffect CRUD overload is not enabled in this build of React."
 }

From a69b80d07e5d1bf363ed15d6209a55b35e0765c2 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 14:19:34 -0500
Subject: [PATCH 18/73] [crud] Remove useResourceEffect (#32206)

Removes useResourceEffect.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32206).
* __->__ #32206
* #32205
---
 .../react-debug-tools/src/ReactDebugHooks.js  |  22 ---
 .../react-reconciler/src/ReactFiberHooks.js   | 158 ------------------
 .../src/ReactInternalTypes.js                 |   9 -
 packages/react-server/src/ReactFizzHooks.js   |  10 +-
 packages/react/index.development.js           |   1 -
 .../react/index.experimental.development.js   |   1 -
 packages/react/index.fb.js                    |   1 -
 packages/react/src/ReactClient.js             |   5 -
 packages/react/src/ReactHooks.js              |  21 ---
 9 files changed, 1 insertion(+), 227 deletions(-)

diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index f45ccfecdcaec..114080d03e921 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -128,9 +128,6 @@ function getPrimitiveStackCache(): Map<string, Array<any>> {
 
       Dispatcher.useId();
 
-      if (typeof Dispatcher.useResourceEffect === 'function') {
-        Dispatcher.useResourceEffect(() => ({}), []);
-      }
       if (typeof Dispatcher.useEffectEvent === 'function') {
         Dispatcher.useEffectEvent((args: empty) => {});
       }
@@ -741,24 +738,6 @@ function useHostTransitionStatus(): TransitionStatus {
   return status;
 }
 
-function useResourceEffect(
-  create: () => {...} | void | null,
-  createDeps: Array<mixed> | void | null,
-  update: ((resource: {...} | void | null) => void) | void,
-  updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: {...} | void | null) => void) | void,
-) {
-  nextHook();
-  hookLog.push({
-    displayName: null,
-    primitive: 'ResourceEffect',
-    stackError: new Error(),
-    value: create,
-    debugInfo: null,
-    dispatcherHookName: 'ResourceEffect',
-  });
-}
-
 function useEffectEvent<Args, F: (...Array<Args>) => mixed>(callback: F): F {
   nextHook();
   hookLog.push({
@@ -798,7 +777,6 @@ const Dispatcher: DispatcherType = {
   useActionState,
   useHostTransitionStatus,
   useEffectEvent,
-  useResourceEffect,
 };
 
 // create a proxy to throw a custom error
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 976657d4c68f7..2ab41770bd0ac 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -3989,9 +3989,6 @@ export const ContextOnlyDispatcher: Dispatcher = {
 if (enableUseEffectEventHook) {
   (ContextOnlyDispatcher: Dispatcher).useEffectEvent = throwInvalidHookError;
 }
-if (enableUseEffectCRUDOverload) {
-  (ContextOnlyDispatcher: Dispatcher).useResourceEffect = throwInvalidHookError;
-}
 
 const HooksDispatcherOnMount: Dispatcher = {
   readContext,
@@ -4022,9 +4019,6 @@ const HooksDispatcherOnMount: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnMount: Dispatcher).useEffectEvent = mountEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  (HooksDispatcherOnMount: Dispatcher).useResourceEffect = mountResourceEffect;
-}
 
 const HooksDispatcherOnUpdate: Dispatcher = {
   readContext,
@@ -4055,10 +4049,6 @@ const HooksDispatcherOnUpdate: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnUpdate: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  (HooksDispatcherOnUpdate: Dispatcher).useResourceEffect =
-    updateResourceEffect;
-}
 
 const HooksDispatcherOnRerender: Dispatcher = {
   readContext,
@@ -4089,10 +4079,6 @@ const HooksDispatcherOnRerender: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnRerender: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  (HooksDispatcherOnRerender: Dispatcher).useResourceEffect =
-    updateResourceEffect;
-}
 
 let HooksDispatcherOnMountInDEV: Dispatcher | null = null;
 let HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher | null = null;
@@ -4310,27 +4296,6 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ): void {
-        currentHookNameInDev = 'useResourceEffect';
-        mountHookTypesDev();
-        checkDepsAreNonEmptyArrayDev(updateDeps);
-        return mountResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   HooksDispatcherOnMountWithHookTypesInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4514,26 +4479,6 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ): void {
-        currentHookNameInDev = 'useResourceEffect';
-        updateHookTypesDev();
-        return mountResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   HooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4717,26 +4662,6 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   HooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4920,26 +4845,6 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   InvalidNestedHooksDispatcherOnMountInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5148,27 +5053,6 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ): void {
-        currentHookNameInDev = 'useResourceEffect';
-        warnInvalidHookAccess();
-        mountHookTypesDev();
-        return mountResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   InvalidNestedHooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5377,27 +5261,6 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        warnInvalidHookAccess();
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   InvalidNestedHooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5606,25 +5469,4 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        warnInvalidHookAccess();
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 }
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 756d88c4a5d15..98e7d4deefea3 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -47,7 +47,6 @@ export type HookType =
   | 'useRef'
   | 'useEffect'
   | 'useEffectEvent'
-  | 'useResourceEffect'
   | 'useInsertionEffect'
   | 'useLayoutEffect'
   | 'useCallback'
@@ -399,14 +398,6 @@ export type Dispatcher = {
   ): void,
   // TODO: Non-nullable once `enableUseEffectEventHook` is on everywhere.
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
-  // TODO: Non-nullable once `enableUseEffectCRUDOverload` is on everywhere.
-  useResourceEffect?: (
-    create: () => {...} | void | null,
-    createDeps: Array<mixed> | void | null,
-    update: ((resource: {...} | void | null) => void) | void,
-    updateDeps: Array<mixed> | void | null,
-    destroy: ((resource: {...} | void | null) => void) | void,
-  ) => void,
   useInsertionEffect(
     create: () => (() => void) | void,
     deps: Array<mixed> | void | null,
diff --git a/packages/react-server/src/ReactFizzHooks.js b/packages/react-server/src/ReactFizzHooks.js
index 63e8576ca788c..a0ec1c7414982 100644
--- a/packages/react-server/src/ReactFizzHooks.js
+++ b/packages/react-server/src/ReactFizzHooks.js
@@ -38,10 +38,7 @@ import {
 } from './ReactFizzConfig';
 import {createFastHash} from './ReactServerStreamConfig';
 
-import {
-  enableUseEffectEventHook,
-  enableUseEffectCRUDOverload,
-} from 'shared/ReactFeatureFlags';
+import {enableUseEffectEventHook} from 'shared/ReactFeatureFlags';
 import is from 'shared/objectIs';
 import {
   REACT_CONTEXT_TYPE,
@@ -866,11 +863,6 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
 if (enableUseEffectEventHook) {
   HooksDispatcher.useEffectEvent = useEffectEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  HooksDispatcher.useResourceEffect = supportsClientAPIs
-    ? noop
-    : clientHookNotSupported;
-}
 
 export let currentResumableState: null | ResumableState = (null: any);
 export function setCurrentResumableState(
diff --git a/packages/react/index.development.js b/packages/react/index.development.js
index 809e940f070ba..fa79633001a06 100644
--- a/packages/react/index.development.js
+++ b/packages/react/index.development.js
@@ -59,7 +59,6 @@ export {
   useDeferredValue,
   useEffect,
   experimental_useEffectEvent,
-  experimental_useResourceEffect,
   useImperativeHandle,
   useInsertionEffect,
   useLayoutEffect,
diff --git a/packages/react/index.experimental.development.js b/packages/react/index.experimental.development.js
index 49c98bb208acb..6074b683b781d 100644
--- a/packages/react/index.experimental.development.js
+++ b/packages/react/index.experimental.development.js
@@ -42,7 +42,6 @@ export {
   useDeferredValue,
   useEffect,
   experimental_useEffectEvent,
-  experimental_useResourceEffect,
   useImperativeHandle,
   useInsertionEffect,
   useLayoutEffect,
diff --git a/packages/react/index.fb.js b/packages/react/index.fb.js
index 8e11bade4df59..29133df24f3a7 100644
--- a/packages/react/index.fb.js
+++ b/packages/react/index.fb.js
@@ -21,7 +21,6 @@ export {
   createElement,
   createRef,
   experimental_useEffectEvent,
-  experimental_useResourceEffect,
   forwardRef,
   Fragment,
   isValidElement,
diff --git a/packages/react/src/ReactClient.js b/packages/react/src/ReactClient.js
index 2bacbc85676fd..715ea8ab47c35 100644
--- a/packages/react/src/ReactClient.js
+++ b/packages/react/src/ReactClient.js
@@ -41,7 +41,6 @@ import {
   useContext,
   useEffect,
   useEffectEvent,
-  useResourceEffect,
   useImperativeHandle,
   useDebugValue,
   useInsertionEffect,
@@ -65,7 +64,6 @@ import {addTransitionType} from './ReactTransitionType';
 import {act} from './ReactAct';
 import {captureOwnerStack} from './ReactOwnerStack';
 import * as ReactCompilerRuntime from './ReactCompilerRuntime';
-import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 const Children = {
   map,
@@ -132,6 +130,3 @@ export {
   act, // DEV-only
   captureOwnerStack, // DEV-only
 };
-
-export const experimental_useResourceEffect: typeof useResourceEffect | void =
-  enableUseEffectCRUDOverload ? useResourceEffect : undefined;
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 2fe6d2b85bcf1..06d61d223874d 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -221,27 +221,6 @@ export function useEffectEvent<Args, F: (...Array<Args>) => mixed>(
   return dispatcher.useEffectEvent(callback);
 }
 
-export function useResourceEffect(
-  create: () => {...} | void | null,
-  createDeps: Array<mixed> | void | null,
-  update: ((resource: {...} | void | null) => void) | void,
-  updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: {...} | void | null) => void) | void,
-): void {
-  if (!enableUseEffectCRUDOverload) {
-    throw new Error('Not implemented.');
-  }
-  const dispatcher = resolveDispatcher();
-  // $FlowFixMe[not-a-function] This is unstable, thus optional
-  return dispatcher.useResourceEffect(
-    create,
-    createDeps,
-    update,
-    updateDeps,
-    destroy,
-  );
-}
-
 export function useOptimistic<S, A>(
   passthrough: S,
   reducer: ?(S, A) => S,

From 192555bb0ed88db30f91c58651c421f178f90384 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Josh=20Goldberg=20=E2=9C=A8?= <git@joshuakgoldberg.com>
Date: Tue, 11 Feb 2025 17:01:04 -0500
Subject: [PATCH 19/73] Added dev-only warning for null/undefined create in
 use*Effect (#32355)
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit

## Summary

Fixes #32354.

Re-creation of #15197: adds a dev-only warning if `create == null` to
the three `use*Effect` functions:

* `useEffect`
* `useInsertionEffect`
* `useLayoutEffect`

Updates the warning to match the same text given in the
`react/exhaustive-deps` lint rule.

## How did you test this change?

I applied the changes manually within `node_modules/` on a local clone
of
https://github.com/JoshuaKGoldberg/repros/tree/react-use-effect-no-arguments.

Please pardon me for opening a PR addressing a not-accepted issue. I was
excited to get back to #15194 -> #15197 now that I have time. 🙂

---------

Co-authored-by: lauren <poteto@users.noreply.github.com>
---
 packages/react/src/ReactHooks.js | 24 ++++++++++++++++++++++++
 1 file changed, 24 insertions(+)

diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 06d61d223874d..ba6b0ffbcb71e 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -93,6 +93,14 @@ export function useEffect(
   updateDeps?: Array<mixed> | void | null,
   destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
+  if (__DEV__) {
+    if (create == null) {
+      console.warn(
+        'React Hook useEffect requires an effect callback. Did you forget to pass a callback to the hook?',
+      );
+    }
+  }
+
   const dispatcher = resolveDispatcher();
   if (
     enableUseEffectCRUDOverload &&
@@ -118,6 +126,14 @@ export function useInsertionEffect(
   create: () => (() => void) | void,
   deps: Array<mixed> | void | null,
 ): void {
+  if (__DEV__) {
+    if (create == null) {
+      console.warn(
+        'React Hook useInsertionEffect requires an effect callback. Did you forget to pass a callback to the hook?',
+      );
+    }
+  }
+
   const dispatcher = resolveDispatcher();
   return dispatcher.useInsertionEffect(create, deps);
 }
@@ -126,6 +142,14 @@ export function useLayoutEffect(
   create: () => (() => void) | void,
   deps: Array<mixed> | void | null,
 ): void {
+  if (__DEV__) {
+    if (create == null) {
+      console.warn(
+        'React Hook useLayoutEffect requires an effect callback. Did you forget to pass a callback to the hook?',
+      );
+    }
+  }
+
   const dispatcher = resolveDispatcher();
   return dispatcher.useLayoutEffect(create, deps);
 }

From f83903bfcc5a61811bd1b69b14f0ebbac4754462 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Rub=C3=A9n=20Norte?= <rubennorte@meta.com>
Date: Wed, 12 Feb 2025 13:52:57 +0000
Subject: [PATCH 20/73] [RN] Set up test to create public instances lazily in
 Fabric (#32363)

## Summary

In React Native, public instances and internal host nodes are not
represented by the same object (ReactNativeElement & shadow nodes vs.
just DOM elements), and the only one that's required for rendering is
the shadow node. Public instances are generally only necessary when
accessed via refs or events, and that usually happens for a small amount
of components in the tree.

This implements an optimization to create the public instance on demand,
instead of eagerly creating it when creating the host node. We expect
this to improve performance by reducing the logic we do per node and the
number of object allocations.

## How did you test this change?

Manually synced the changes to React Native and run Fantom tests and
benchmarks, with the flag enabled and disabled. All tests pass in both
cases, and benchmarks show a slight but consistent performance
improvement.
---
 .../src/ReactFiberConfigFabric.js             | 69 ++++++++++++++-----
 packages/shared/ReactFeatureFlags.js          |  2 +
 .../ReactFeatureFlags.native-fb-dynamic.js    |  1 +
 .../forks/ReactFeatureFlags.native-fb.js      |  1 +
 .../forks/ReactFeatureFlags.native-oss.js     |  1 +
 .../forks/ReactFeatureFlags.test-renderer.js  |  1 +
 ...actFeatureFlags.test-renderer.native-fb.js |  1 +
 .../ReactFeatureFlags.test-renderer.www.js    |  1 +
 .../forks/ReactFeatureFlags.www-dynamic.js    |  1 +
 .../shared/forks/ReactFeatureFlags.www.js     |  2 +
 10 files changed, 61 insertions(+), 19 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactFiberConfigFabric.js b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
index d602ab05efa81..d28b3400c66c3 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigFabric.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
@@ -57,7 +57,10 @@ import {
   getInspectorDataForInstance,
 } from './ReactNativeFiberInspector';
 
-import {passChildrenWhenCloningPersistedNodes} from 'shared/ReactFeatureFlags';
+import {
+  passChildrenWhenCloningPersistedNodes,
+  enableLazyPublicInstanceInFabric,
+} from 'shared/ReactFeatureFlags';
 import {REACT_CONTEXT_TYPE} from 'shared/ReactSymbols';
 import type {ReactContext} from 'shared/ReactTypes';
 
@@ -93,8 +96,11 @@ export type Instance = {
     currentProps: Props,
     // Reference to the React handle (the fiber)
     internalInstanceHandle: InternalInstanceHandle,
-    // Exposed through refs.
-    publicInstance: PublicInstance,
+    // Exposed through refs. Potentially lazily created.
+    publicInstance: PublicInstance | null,
+    // This is only necessary to lazily create `publicInstance`.
+    // Will be set to `null` after that is created.
+    publicRootInstance?: PublicRootInstance | null,
   },
 };
 export type TextInstance = {
@@ -186,23 +192,37 @@ export function createInstance(
     internalInstanceHandle, // internalInstanceHandle
   );
 
-  const component = createPublicInstance(
-    tag,
-    viewConfig,
-    internalInstanceHandle,
-    rootContainerInstance.publicInstance,
-  );
-
-  return {
-    node: node,
-    canonical: {
-      nativeTag: tag,
+  if (enableLazyPublicInstanceInFabric) {
+    return {
+      node: node,
+      canonical: {
+        nativeTag: tag,
+        viewConfig,
+        currentProps: props,
+        internalInstanceHandle,
+        publicInstance: null,
+        publicRootInstance: rootContainerInstance.publicInstance,
+      },
+    };
+  } else {
+    const component = createPublicInstance(
+      tag,
       viewConfig,
-      currentProps: props,
       internalInstanceHandle,
-      publicInstance: component,
-    },
-  };
+      rootContainerInstance.publicInstance,
+    );
+
+    return {
+      node: node,
+      canonical: {
+        nativeTag: tag,
+        viewConfig,
+        currentProps: props,
+        internalInstanceHandle,
+        publicInstance: component,
+      },
+    };
+  }
 }
 
 export function createTextInstance(
@@ -277,7 +297,18 @@ export function getChildHostContext(
 }
 
 export function getPublicInstance(instance: Instance): null | PublicInstance {
-  if (instance.canonical != null && instance.canonical.publicInstance != null) {
+  if (instance.canonical != null) {
+    if (instance.canonical.publicInstance == null) {
+      instance.canonical.publicInstance = createPublicInstance(
+        instance.canonical.nativeTag,
+        instance.canonical.viewConfig,
+        instance.canonical.internalInstanceHandle,
+        instance.canonical.publicRootInstance ?? null,
+      );
+      // This was only necessary to create the public instance.
+      instance.canonical.publicRootInstance = null;
+    }
+
     return instance.canonical.publicInstance;
   }
 
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index 1cb1cb4cf7dc0..fbdfe5a468516 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -154,6 +154,8 @@ export const enableUseEffectCRUDOverload = false;
 
 export const enableFastAddPropertiesInDiffing = true;
 
+export const enableLazyPublicInstanceInFabric = false;
+
 // -----------------------------------------------------------------------------
 // Ready for next major.
 //
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index 001b3d64c06dc..ffcec9334d663 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -28,3 +28,4 @@ export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableOwnerStacks = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
+export const enableLazyPublicInstanceInFabric = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 6e82185b5d98c..2eff113ae42f1 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -30,6 +30,7 @@ export const {
   enableOwnerStacks,
   enableRemoveConsolePatches,
   enableFastAddPropertiesInDiffing,
+  enableLazyPublicInstanceInFabric,
 } = dynamicFlags;
 
 // The rest of the flags are static for better dead code elimination.
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index 3f373e998cd8e..bcd8b375eca67 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -72,6 +72,7 @@ export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableFastAddPropertiesInDiffing = false;
+export const enableLazyPublicInstanceInFabric = false;
 
 // Profiling Only
 export const enableProfilerTimer = __PROFILE__;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index da9b8a2612c9b..6fcd35c40774b 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -71,6 +71,7 @@ export const enableYieldingBeforePassive = true;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableFastAddPropertiesInDiffing = true;
+export const enableLazyPublicInstanceInFabric = false;
 
 // TODO: This must be in sync with the main ReactFeatureFlags file because
 // the Test Renderer's value must be the same as the one used by the
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index 8c20cc28deb15..743ba39a86792 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -69,6 +69,7 @@ export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
+export const enableLazyPublicInstanceInFabric = false;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index bc30992eb6eb5..26747d3fb69a9 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -84,6 +84,7 @@ export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
+export const enableLazyPublicInstanceInFabric = false;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
index 3cab1318c490e..d0b4404a3e946 100644
--- a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
@@ -39,6 +39,7 @@ export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
+export const enableLazyPublicInstanceInFabric = false;
 export const enableViewTransition = __VARIANT__;
 
 // TODO: These flags are hard-coded to the default values used in open source.
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index 57be83577c956..8da74c54bd69e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -110,5 +110,7 @@ export const disableLegacyMode = true;
 
 export const enableShallowPropDiffing = false;
 
+export const enableLazyPublicInstanceInFabric = false;
+
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);

From d814852baf03c61b1e32b59a45c3f72e00577ac8 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Wed, 12 Feb 2025 11:59:56 -0500
Subject: [PATCH 21/73] [compiler] Upgrade esbuild (#32368)

Just a simple upgrade
---
 compiler/package.json |   2 +-
 compiler/yarn.lock    | 314 +++++++++++++++++++++---------------------
 2 files changed, 158 insertions(+), 158 deletions(-)

diff --git a/compiler/package.json b/compiler/package.json
index b16756f0aa2c0..f1696b9b2a5c5 100644
--- a/compiler/package.json
+++ b/compiler/package.json
@@ -28,7 +28,7 @@
   "devDependencies": {
     "@tsconfig/strictest": "^2.0.5",
     "concurrently": "^7.4.0",
-    "esbuild": "^0.24.2",
+    "esbuild": "^0.25.0",
     "folder-hash": "^4.0.4",
     "npm-dts": "^1.3.13",
     "object-assign": "^4.1.1",
diff --git a/compiler/yarn.lock b/compiler/yarn.lock
index 354cc199b0285..b5bd5f8eaf7b4 100644
--- a/compiler/yarn.lock
+++ b/compiler/yarn.lock
@@ -1714,130 +1714,130 @@
     enabled "2.0.x"
     kuler "^2.0.0"
 
-"@esbuild/aix-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.24.2.tgz#38848d3e25afe842a7943643cbcd387cc6e13461"
-  integrity sha512-thpVCb/rhxE/BnMLQ7GReQLLN8q9qbHmI55F4489/ByVg2aQaQ6kbcLb6FHkocZzQhxc4gx0sCk0tJkKBFzDhA==
-
-"@esbuild/android-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.24.2.tgz#f592957ae8b5643129fa889c79e69cd8669bb894"
-  integrity sha512-cNLgeqCqV8WxfcTIOeL4OAtSmL8JjcN6m09XIgro1Wi7cF4t/THaWEa7eL5CMoMBdjoHOTh/vwTO/o2TRXIyzg==
-
-"@esbuild/android-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.24.2.tgz#72d8a2063aa630308af486a7e5cbcd1e134335b3"
-  integrity sha512-tmwl4hJkCfNHwFB3nBa8z1Uy3ypZpxqxfTQOcHX+xRByyYgunVbZ9MzUUfb0RxaHIMnbHagwAxuTL+tnNM+1/Q==
-
-"@esbuild/android-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.24.2.tgz#9a7713504d5f04792f33be9c197a882b2d88febb"
-  integrity sha512-B6Q0YQDqMx9D7rvIcsXfmJfvUYLoP722bgfBlO5cGvNVb5V/+Y7nhBE3mHV9OpxBf4eAS2S68KZztiPaWq4XYw==
-
-"@esbuild/darwin-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.24.2.tgz#02ae04ad8ebffd6e2ea096181b3366816b2b5936"
-  integrity sha512-kj3AnYWc+CekmZnS5IPu9D+HWtUI49hbnyqk0FLEJDbzCIQt7hg7ucF1SQAilhtYpIujfaHr6O0UHlzzSPdOeA==
-
-"@esbuild/darwin-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.24.2.tgz#9ec312bc29c60e1b6cecadc82bd504d8adaa19e9"
-  integrity sha512-WeSrmwwHaPkNR5H3yYfowhZcbriGqooyu3zI/3GGpF8AyUdsrrP0X6KumITGA9WOyiJavnGZUwPGvxvwfWPHIA==
-
-"@esbuild/freebsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.24.2.tgz#5e82f44cb4906d6aebf24497d6a068cfc152fa00"
-  integrity sha512-UN8HXjtJ0k/Mj6a9+5u6+2eZ2ERD7Edt1Q9IZiB5UZAIdPnVKDoG7mdTVGhHJIeEml60JteamR3qhsr1r8gXvg==
-
-"@esbuild/freebsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.24.2.tgz#3fb1ce92f276168b75074b4e51aa0d8141ecce7f"
-  integrity sha512-TvW7wE/89PYW+IevEJXZ5sF6gJRDY/14hyIGFXdIucxCsbRmLUcjseQu1SyTko+2idmCw94TgyaEZi9HUSOe3Q==
-
-"@esbuild/linux-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.24.2.tgz#856b632d79eb80aec0864381efd29de8fd0b1f43"
-  integrity sha512-7HnAD6074BW43YvvUmE/35Id9/NB7BeX5EoNkK9obndmZBUk8xmJJeU7DwmUeN7tkysslb2eSl6CTrYz6oEMQg==
-
-"@esbuild/linux-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.24.2.tgz#c846b4694dc5a75d1444f52257ccc5659021b736"
-  integrity sha512-n0WRM/gWIdU29J57hJyUdIsk0WarGd6To0s+Y+LwvlC55wt+GT/OgkwoXCXvIue1i1sSNWblHEig00GBWiJgfA==
-
-"@esbuild/linux-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.24.2.tgz#f8a16615a78826ccbb6566fab9a9606cfd4a37d5"
-  integrity sha512-sfv0tGPQhcZOgTKO3oBE9xpHuUqguHvSo4jl+wjnKwFpapx+vUDcawbwPNuBIAYdRAvIDBfZVvXprIj3HA+Ugw==
-
-"@esbuild/linux-loong64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.24.2.tgz#1c451538c765bf14913512c76ed8a351e18b09fc"
-  integrity sha512-CN9AZr8kEndGooS35ntToZLTQLHEjtVB5n7dl8ZcTZMonJ7CCfStrYhrzF97eAecqVbVJ7APOEe18RPI4KLhwQ==
-
-"@esbuild/linux-mips64el@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.24.2.tgz#0846edeefbc3d8d50645c51869cc64401d9239cb"
-  integrity sha512-iMkk7qr/wl3exJATwkISxI7kTcmHKE+BlymIAbHO8xanq/TjHaaVThFF6ipWzPHryoFsesNQJPE/3wFJw4+huw==
-
-"@esbuild/linux-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.24.2.tgz#8e3fc54505671d193337a36dfd4c1a23b8a41412"
-  integrity sha512-shsVrgCZ57Vr2L8mm39kO5PPIb+843FStGt7sGGoqiiWYconSxwTiuswC1VJZLCjNiMLAMh34jg4VSEQb+iEbw==
-
-"@esbuild/linux-riscv64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.24.2.tgz#6a1e92096d5e68f7bb10a0d64bb5b6d1daf9a694"
-  integrity sha512-4eSFWnU9Hhd68fW16GD0TINewo1L6dRrB+oLNNbYyMUAeOD2yCK5KXGK1GH4qD/kT+bTEXjsyTCiJGHPZ3eM9Q==
-
-"@esbuild/linux-s390x@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.24.2.tgz#ab18e56e66f7a3c49cb97d337cd0a6fea28a8577"
-  integrity sha512-S0Bh0A53b0YHL2XEXC20bHLuGMOhFDO6GN4b3YjRLK//Ep3ql3erpNcPlEFed93hsQAjAQDNsvcK+hV90FubSw==
-
-"@esbuild/linux-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.24.2.tgz#8140c9b40da634d380b0b29c837a0b4267aff38f"
-  integrity sha512-8Qi4nQcCTbLnK9WoMjdC9NiTG6/E38RNICU6sUNqK0QFxCYgoARqVqxdFmWkdonVsvGqWhmm7MO0jyTqLqwj0Q==
-
-"@esbuild/netbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.24.2.tgz#65f19161432bafb3981f5f20a7ff45abb2e708e6"
-  integrity sha512-wuLK/VztRRpMt9zyHSazyCVdCXlpHkKm34WUyinD2lzK07FAHTq0KQvZZlXikNWkDGoT6x3TD51jKQ7gMVpopw==
-
-"@esbuild/netbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.24.2.tgz#7a3a97d77abfd11765a72f1c6f9b18f5396bcc40"
-  integrity sha512-VefFaQUc4FMmJuAxmIHgUmfNiLXY438XrL4GDNV1Y1H/RW3qow68xTwjZKfj/+Plp9NANmzbH5R40Meudu8mmw==
-
-"@esbuild/openbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.24.2.tgz#58b00238dd8f123bfff68d3acc53a6ee369af89f"
-  integrity sha512-YQbi46SBct6iKnszhSvdluqDmxCJA+Pu280Av9WICNwQmMxV7nLRHZfjQzwbPs3jeWnuAhE9Jy0NrnJ12Oz+0A==
-
-"@esbuild/openbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.24.2.tgz#0ac843fda0feb85a93e288842936c21a00a8a205"
-  integrity sha512-+iDS6zpNM6EnJyWv0bMGLWSWeXGN/HTaF/LXHXHwejGsVi+ooqDfMCCTerNFxEkM3wYVcExkeGXNqshc9iMaOA==
-
-"@esbuild/sunos-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.24.2.tgz#8b7aa895e07828d36c422a4404cc2ecf27fb15c6"
-  integrity sha512-hTdsW27jcktEvpwNHJU4ZwWFGkz2zRJUz8pvddmXPtXDzVKTTINmlmga3ZzwcuMpUvLw7JkLy9QLKyGpD2Yxig==
-
-"@esbuild/win32-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.24.2.tgz#c023afb647cabf0c3ed13f0eddfc4f1d61c66a85"
-  integrity sha512-LihEQ2BBKVFLOC9ZItT9iFprsE9tqjDjnbulhHoFxYQtQfai7qfluVODIYxt1PgdoyQkz23+01rzwNwYfutxUQ==
-
-"@esbuild/win32-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.24.2.tgz#96c356132d2dda990098c8b8b951209c3cd743c2"
-  integrity sha512-q+iGUwfs8tncmFC9pcnD5IvRHAzmbwQ3GPS5/ceCyHdjXubwQWI12MKWSNSMYLJMq23/IUCvJMS76PDqXe1fxA==
-
-"@esbuild/win32-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.24.2.tgz#34aa0b52d0fbb1a654b596acfa595f0c7b77a77b"
-  integrity sha512-7VTgWzgMGvup6aSqDPLiW5zHaxYJGTO4OokMjIlrCtf+VpEL+cXKtCvg723iguPYI5oaUNdS+/V7OU2gvXVWEg==
+"@esbuild/aix-ppc64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.25.0.tgz#499600c5e1757a524990d5d92601f0ac3ce87f64"
+  integrity sha512-O7vun9Sf8DFjH2UtqK8Ku3LkquL9SZL8OLY1T5NZkA34+wG3OQF7cl4Ql8vdNzM6fzBbYfLaiRLIOZ+2FOCgBQ==
+
+"@esbuild/android-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.25.0.tgz#b9b8231561a1dfb94eb31f4ee056b92a985c324f"
+  integrity sha512-grvv8WncGjDSyUBjN9yHXNt+cq0snxXbDxy5pJtzMKGmmpPxeAmAhWxXI+01lU5rwZomDgD3kJwulEnhTRUd6g==
+
+"@esbuild/android-arm@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.25.0.tgz#ca6e7888942505f13e88ac9f5f7d2a72f9facd2b"
+  integrity sha512-PTyWCYYiU0+1eJKmw21lWtC+d08JDZPQ5g+kFyxP0V+es6VPPSUhM6zk8iImp2jbV6GwjX4pap0JFbUQN65X1g==
+
+"@esbuild/android-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.25.0.tgz#e765ea753bac442dfc9cb53652ce8bd39d33e163"
+  integrity sha512-m/ix7SfKG5buCnxasr52+LI78SQ+wgdENi9CqyCXwjVR2X4Jkz+BpC3le3AoBPYTC9NHklwngVXvbJ9/Akhrfg==
+
+"@esbuild/darwin-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.25.0.tgz#fa394164b0d89d4fdc3a8a21989af70ef579fa2c"
+  integrity sha512-mVwdUb5SRkPayVadIOI78K7aAnPamoeFR2bT5nszFUZ9P8UpK4ratOdYbZZXYSqPKMHfS1wdHCJk1P1EZpRdvw==
+
+"@esbuild/darwin-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.25.0.tgz#91979d98d30ba6e7d69b22c617cc82bdad60e47a"
+  integrity sha512-DgDaYsPWFTS4S3nWpFcMn/33ZZwAAeAFKNHNa1QN0rI4pUjgqf0f7ONmXf6d22tqTY+H9FNdgeaAa+YIFUn2Rg==
+
+"@esbuild/freebsd-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.25.0.tgz#b97e97073310736b430a07b099d837084b85e9ce"
+  integrity sha512-VN4ocxy6dxefN1MepBx/iD1dH5K8qNtNe227I0mnTRjry8tj5MRk4zprLEdG8WPyAPb93/e4pSgi1SoHdgOa4w==
+
+"@esbuild/freebsd-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.25.0.tgz#f3b694d0da61d9910ec7deff794d444cfbf3b6e7"
+  integrity sha512-mrSgt7lCh07FY+hDD1TxiTyIHyttn6vnjesnPoVDNmDfOmggTLXRv8Id5fNZey1gl/V2dyVK1VXXqVsQIiAk+A==
+
+"@esbuild/linux-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.25.0.tgz#f921f699f162f332036d5657cad9036f7a993f73"
+  integrity sha512-9QAQjTWNDM/Vk2bgBl17yWuZxZNQIF0OUUuPZRKoDtqF2k4EtYbpyiG5/Dk7nqeK6kIJWPYldkOcBqjXjrUlmg==
+
+"@esbuild/linux-arm@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.25.0.tgz#cc49305b3c6da317c900688995a4050e6cc91ca3"
+  integrity sha512-vkB3IYj2IDo3g9xX7HqhPYxVkNQe8qTK55fraQyTzTX/fxaDtXiEnavv9geOsonh2Fd2RMB+i5cbhu2zMNWJwg==
+
+"@esbuild/linux-ia32@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.25.0.tgz#3e0736fcfab16cff042dec806247e2c76e109e19"
+  integrity sha512-43ET5bHbphBegyeqLb7I1eYn2P/JYGNmzzdidq/w0T8E2SsYL1U6un2NFROFRg1JZLTzdCoRomg8Rvf9M6W6Gg==
+
+"@esbuild/linux-loong64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.25.0.tgz#ea2bf730883cddb9dfb85124232b5a875b8020c7"
+  integrity sha512-fC95c/xyNFueMhClxJmeRIj2yrSMdDfmqJnyOY4ZqsALkDrrKJfIg5NTMSzVBr5YW1jf+l7/cndBfP3MSDpoHw==
+
+"@esbuild/linux-mips64el@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.25.0.tgz#4cababb14eede09248980a2d2d8b966464294ff1"
+  integrity sha512-nkAMFju7KDW73T1DdH7glcyIptm95a7Le8irTQNO/qtkoyypZAnjchQgooFUDQhNAy4iu08N79W4T4pMBwhPwQ==
+
+"@esbuild/linux-ppc64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.25.0.tgz#8860a4609914c065373a77242e985179658e1951"
+  integrity sha512-NhyOejdhRGS8Iwv+KKR2zTq2PpysF9XqY+Zk77vQHqNbo/PwZCzB5/h7VGuREZm1fixhs4Q/qWRSi5zmAiO4Fw==
+
+"@esbuild/linux-riscv64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.25.0.tgz#baf26e20bb2d38cfb86ee282dff840c04f4ed987"
+  integrity sha512-5S/rbP5OY+GHLC5qXp1y/Mx//e92L1YDqkiBbO9TQOvuFXM+iDqUNG5XopAnXoRH3FjIUDkeGcY1cgNvnXp/kA==
+
+"@esbuild/linux-s390x@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.25.0.tgz#8323afc0d6cb1b6dc6e9fd21efd9e1542c3640a4"
+  integrity sha512-XM2BFsEBz0Fw37V0zU4CXfcfuACMrppsMFKdYY2WuTS3yi8O1nFOhil/xhKTmE1nPmVyvQJjJivgDT+xh8pXJA==
+
+"@esbuild/linux-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.25.0.tgz#08fcf60cb400ed2382e9f8e0f5590bac8810469a"
+  integrity sha512-9yl91rHw/cpwMCNytUDxwj2XjFpxML0y9HAOH9pNVQDpQrBxHy01Dx+vaMu0N1CKa/RzBD2hB4u//nfc+Sd3Cw==
+
+"@esbuild/netbsd-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.25.0.tgz#935c6c74e20f7224918fbe2e6c6fe865b6c6ea5b"
+  integrity sha512-RuG4PSMPFfrkH6UwCAqBzauBWTygTvb1nxWasEJooGSJ/NwRw7b2HOwyRTQIU97Hq37l3npXoZGYMy3b3xYvPw==
+
+"@esbuild/netbsd-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.25.0.tgz#414677cef66d16c5a4d210751eb2881bb9c1b62b"
+  integrity sha512-jl+qisSB5jk01N5f7sPCsBENCOlPiS/xptD5yxOx2oqQfyourJwIKLRA2yqWdifj3owQZCL2sn6o08dBzZGQzA==
+
+"@esbuild/openbsd-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.25.0.tgz#8fd55a4d08d25cdc572844f13c88d678c84d13f7"
+  integrity sha512-21sUNbq2r84YE+SJDfaQRvdgznTD8Xc0oc3p3iW/a1EVWeNj/SdUCbm5U0itZPQYRuRTW20fPMWMpcrciH2EJw==
+
+"@esbuild/openbsd-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.25.0.tgz#0c48ddb1494bbc2d6bcbaa1429a7f465fa1dedde"
+  integrity sha512-2gwwriSMPcCFRlPlKx3zLQhfN/2WjJ2NSlg5TKLQOJdV0mSxIcYNTMhk3H3ulL/cak+Xj0lY1Ym9ysDV1igceg==
+
+"@esbuild/sunos-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.25.0.tgz#86ff9075d77962b60dd26203d7352f92684c8c92"
+  integrity sha512-bxI7ThgLzPrPz484/S9jLlvUAHYMzy6I0XiU1ZMeAEOBcS0VePBFxh1JjTQt3Xiat5b6Oh4x7UC7IwKQKIJRIg==
+
+"@esbuild/win32-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.25.0.tgz#849c62327c3229467f5b5cd681bf50588442e96c"
+  integrity sha512-ZUAc2YK6JW89xTbXvftxdnYy3m4iHIkDtK3CLce8wg8M2L+YZhIvO1DKpxrd0Yr59AeNNkTiic9YLf6FTtXWMw==
+
+"@esbuild/win32-ia32@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.25.0.tgz#f62eb480cd7cca088cb65bb46a6db25b725dc079"
+  integrity sha512-eSNxISBu8XweVEWG31/JzjkIGbGIJN/TrRoiSVZwZ6pkC6VX4Im/WV2cz559/TXLcYbcrDN8JtKgd9DJVIo8GA==
+
+"@esbuild/win32-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.25.0.tgz#c8e119a30a7c8d60b9d2e22d2073722dde3b710b"
+  integrity sha512-ZENoHJBxA20C2zFzh6AI4fT6RraMzjYw4xKWemRTRmRVtN9c5DcH9r/f2ihEkMjOW5eGgrwCslG/+Y/3bL+DHQ==
 
 "@eslint-community/eslint-utils@^4.2.0", "@eslint-community/eslint-utils@^4.4.0":
   version "4.4.0"
@@ -2799,10 +2799,10 @@
   dependencies:
     "@babel/types" "^7.3.0"
 
-"@types/eslint@^8.56.6":
-  version "8.56.6"
-  resolved "https://registry.yarnpkg.com/@types/eslint/-/eslint-8.56.6.tgz#d5dc16cac025d313ee101108ba5714ea10eb3ed0"
-  integrity sha512-ymwc+qb1XkjT/gfoQwxIeHZ6ixH23A+tCT2ADSA/DPVKzAjwYkTXBMCQ/f6fe4wEa85Lhp26VPeUxI7wMhAi7A==
+"@types/eslint@^8.56.12":
+  version "8.56.12"
+  resolved "https://registry.yarnpkg.com/@types/eslint/-/eslint-8.56.12.tgz#1657c814ffeba4d2f84c0d4ba0f44ca7ea1ca53a"
+  integrity sha512-03ruubjWyOHlmljCVoxSuNDdmfZDzsrrz0P2LeJsOXr+ZwFQ+0yQIwNCwt/GYhV7Z31fgtXJTAEs+FYlEL851g==
   dependencies:
     "@types/estree" "*"
     "@types/json-schema" "*"
@@ -4105,36 +4105,36 @@ es5-ext@0.8.x:
   resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.8.2.tgz#aba8d9e1943a895ac96837a62a39b3f55ecd94ab"
   integrity sha512-H19ompyhnKiBdjHR1DPHvf5RHgHPmJaY9JNzFGbMbPgdsUkvnUCN1Ke8J4Y0IMyTwFM2M9l4h2GoHwzwpSmXbA==
 
-esbuild@^0.24.2:
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.24.2.tgz#b5b55bee7de017bff5fb8a4e3e44f2ebe2c3567d"
-  integrity sha512-+9egpBW8I3CD5XPe0n6BfT5fxLzxrlDzqydF3aviG+9ni1lDC/OvMHcxqEFV0+LANZG5R1bFMWfUrjVsdwxJvA==
+esbuild@^0.25.0:
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.25.0.tgz#0de1787a77206c5a79eeb634a623d39b5006ce92"
+  integrity sha512-BXq5mqc8ltbaN34cDqWuYKyNhX8D/Z0J1xdtdQ8UcIIIyJyz+ZMKUt58tF3SrZ85jcfN/PZYhjR5uDQAYNVbuw==
   optionalDependencies:
-    "@esbuild/aix-ppc64" "0.24.2"
-    "@esbuild/android-arm" "0.24.2"
-    "@esbuild/android-arm64" "0.24.2"
-    "@esbuild/android-x64" "0.24.2"
-    "@esbuild/darwin-arm64" "0.24.2"
-    "@esbuild/darwin-x64" "0.24.2"
-    "@esbuild/freebsd-arm64" "0.24.2"
-    "@esbuild/freebsd-x64" "0.24.2"
-    "@esbuild/linux-arm" "0.24.2"
-    "@esbuild/linux-arm64" "0.24.2"
-    "@esbuild/linux-ia32" "0.24.2"
-    "@esbuild/linux-loong64" "0.24.2"
-    "@esbuild/linux-mips64el" "0.24.2"
-    "@esbuild/linux-ppc64" "0.24.2"
-    "@esbuild/linux-riscv64" "0.24.2"
-    "@esbuild/linux-s390x" "0.24.2"
-    "@esbuild/linux-x64" "0.24.2"
-    "@esbuild/netbsd-arm64" "0.24.2"
-    "@esbuild/netbsd-x64" "0.24.2"
-    "@esbuild/openbsd-arm64" "0.24.2"
-    "@esbuild/openbsd-x64" "0.24.2"
-    "@esbuild/sunos-x64" "0.24.2"
-    "@esbuild/win32-arm64" "0.24.2"
-    "@esbuild/win32-ia32" "0.24.2"
-    "@esbuild/win32-x64" "0.24.2"
+    "@esbuild/aix-ppc64" "0.25.0"
+    "@esbuild/android-arm" "0.25.0"
+    "@esbuild/android-arm64" "0.25.0"
+    "@esbuild/android-x64" "0.25.0"
+    "@esbuild/darwin-arm64" "0.25.0"
+    "@esbuild/darwin-x64" "0.25.0"
+    "@esbuild/freebsd-arm64" "0.25.0"
+    "@esbuild/freebsd-x64" "0.25.0"
+    "@esbuild/linux-arm" "0.25.0"
+    "@esbuild/linux-arm64" "0.25.0"
+    "@esbuild/linux-ia32" "0.25.0"
+    "@esbuild/linux-loong64" "0.25.0"
+    "@esbuild/linux-mips64el" "0.25.0"
+    "@esbuild/linux-ppc64" "0.25.0"
+    "@esbuild/linux-riscv64" "0.25.0"
+    "@esbuild/linux-s390x" "0.25.0"
+    "@esbuild/linux-x64" "0.25.0"
+    "@esbuild/netbsd-arm64" "0.25.0"
+    "@esbuild/netbsd-x64" "0.25.0"
+    "@esbuild/openbsd-arm64" "0.25.0"
+    "@esbuild/openbsd-x64" "0.25.0"
+    "@esbuild/sunos-x64" "0.25.0"
+    "@esbuild/win32-arm64" "0.25.0"
+    "@esbuild/win32-ia32" "0.25.0"
+    "@esbuild/win32-x64" "0.25.0"
 
 escalade@^3.1.1:
   version "3.1.1"

From 5a78dd7cfec4217c1feb89ee6312c13f40b01aed Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Wed, 12 Feb 2025 15:13:47 -0500
Subject: [PATCH 22/73] [ci] Also notify compiler ready for review PRs (#32371)

Similar to #32344
---
 .github/workflows/compiler_discord_notify.yml | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/.github/workflows/compiler_discord_notify.yml b/.github/workflows/compiler_discord_notify.yml
index da85190dd2127..f81f42b9cb7df 100644
--- a/.github/workflows/compiler_discord_notify.yml
+++ b/.github/workflows/compiler_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Compiler) Discord Notify
 
 on:
   pull_request_target:
-    types: [opened]
+    types: [opened, ready_for_review]
     paths:
       - compiler/**
       - .github/workflows/compiler_**.yml

From e0131f1edae0fc411bf8abb2fed211ca07af60fe Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Fran=C3=A7ois=20Best?= <github@francoisbest.com>
Date: Thu, 13 Feb 2025 13:02:55 +0100
Subject: [PATCH 23/73] fix(devtools): Handle nullish values passed to
 `formatConsoleArguments` (#32372)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

<!--
Explain the **motivation** for making this change. What existing problem
does the pull request solve?
-->

When using React Devtools, calling `console.log('%s', null)` in userland
can cause it to throw an error:

```
TypeError: Cannot read properties of null (reading 'toString')
```

## How did you test this change?

Added a unit test.

<!--
Demonstrate the code is solid. Example: The exact commands you ran and
their output, screenshots / videos if the pull request changes the user
interface.
How exactly did you verify that your PR solves the issue you wanted to
solve?
  If you leave this empty, your PR will very likely be closed.
-->

See https://github.com/47ng/nuqs/issues/808.
---
 .../react-devtools-shared/src/__tests__/utils-test.js    | 9 +++++++++
 .../src/backend/utils/formatConsoleArguments.js          | 2 +-
 2 files changed, 10 insertions(+), 1 deletion(-)

diff --git a/packages/react-devtools-shared/src/__tests__/utils-test.js b/packages/react-devtools-shared/src/__tests__/utils-test.js
index 94726312c3bfa..876aaa99f1ea9 100644
--- a/packages/react-devtools-shared/src/__tests__/utils-test.js
+++ b/packages/react-devtools-shared/src/__tests__/utils-test.js
@@ -470,5 +470,14 @@ function f() { }
         {},
       ]);
     });
+
+    it('formats nullish values', () => {
+      expect(formatConsoleArguments('This is the %s template', null)).toEqual([
+        'This is the null template',
+      ]);
+      expect(
+        formatConsoleArguments('This is the %s template', undefined),
+      ).toEqual(['This is the undefined template']);
+    });
   });
 });
diff --git a/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js b/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js
index a2d303e543ac0..eaf4170970ed4 100644
--- a/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js
+++ b/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js
@@ -58,7 +58,7 @@ export default function formatConsoleArguments(
       }
       case 's': {
         const [arg] = args.splice(argumentsPointer, 1);
-        template += arg.toString();
+        template += String(arg);
 
         break;
       }

From cbbe8666a8d6e6f1b81dffb11bd5d767e4acd6ac Mon Sep 17 00:00:00 2001
From: LoganDark <4723091+LoganDark@users.noreply.github.com>
Date: Thu, 13 Feb 2025 04:04:53 -0800
Subject: [PATCH 24/73] fix value formatting of proxies of class instances
 (#30880)

For Hookstate Proxies of class instances, `data.constructor.name`
returns `Proxy({})`, so use
`Object.getPrototypeOf(data).constructor.name` instead, which works
correctly from my testing.

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

React DevTools immediately bricks itself if you inspect any component
that has a prop that is a Hookstate that wraps a class instance ...
because these are proxies where `data.constructor.name` returns some
un-cloneable object, but `Object.getPrototypeOf(data)` doesn't return
`Object` (it returns the prototype of the class inside).

## How did you test this change?

This part of the code has no associated tests at all.

Technically,
`packages/react-devtools-shared/src/__tests__/legacy/inspectElement-test.js`
exists, but I tried `yarn test` and these tests aren't even executed
anymore. I can't figure it out, so whatever.

If you run this code:

```js
    class Class {}
    const instance = new Class();

    const instanceProxy = new Proxy(instance, {
      get(target, key, receiver) {
        if (key === 'constructor') {
          return { name: new Proxy({}, {}) };
        }

        return Reflect.get(target, key, receiver);
      },
    });
```

then `instanceProxy.constructor.name` returns some proxy that cannot be
cloned, but `Object.getPrototypeOf(instanceProxy).constructor.name`
returns the correct value.

This PR fixes the devtools to use
`Object.getPrototypeOf(instanceProxy).constructor.name`.

I modified my local copy of devtools to use this method and it fixed the
bricking that I experienced.

Related #29954
---
 packages/react-devtools-shared/src/utils.js | 20 +++++++++++++++++++-
 1 file changed, 19 insertions(+), 1 deletion(-)

diff --git a/packages/react-devtools-shared/src/utils.js b/packages/react-devtools-shared/src/utils.js
index f6f7f3f4209aa..12c9fb739ce95 100644
--- a/packages/react-devtools-shared/src/utils.js
+++ b/packages/react-devtools-shared/src/utils.js
@@ -915,7 +915,25 @@ export function formatDataForPreview(
     case 'date':
       return data.toString();
     case 'class_instance':
-      return data.constructor.name;
+      try {
+        let resolvedConstructorName = data.constructor.name;
+        if (typeof resolvedConstructorName === 'string') {
+          return resolvedConstructorName;
+        }
+
+        resolvedConstructorName = Object.getPrototypeOf(data).constructor.name;
+        if (typeof resolvedConstructorName === 'string') {
+          return resolvedConstructorName;
+        }
+
+        try {
+          return truncateForDisplay(String(data));
+        } catch (error) {
+          return 'unserializable';
+        }
+      } catch (error) {
+        return 'unserializable';
+      }
     case 'object':
       if (showFormattedValue) {
         const keys = Array.from(getAllEnumerableKeys(data)).sort(alphaSortKeys);

From c6a7e18636e610efd3aa7a437bbcaf321bf73abd Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Thu, 13 Feb 2025 18:09:49 +0100
Subject: [PATCH 25/73] Ensure `captureOwnerStack` returns `null` when no stack
 is available (#32353)

Co-authored-by: Younes Henni <youneshenniwrites@gmail.com>
---
 packages/react-reconciler/src/ReactCurrentFiber.js  |  2 +-
 .../src/__tests__/ReactOwnerStacks-test.js          | 13 +++++++++++++
 2 files changed, 14 insertions(+), 1 deletion(-)

diff --git a/packages/react-reconciler/src/ReactCurrentFiber.js b/packages/react-reconciler/src/ReactCurrentFiber.js
index 18406d991909a..f65ae5f19232c 100644
--- a/packages/react-reconciler/src/ReactCurrentFiber.js
+++ b/packages/react-reconciler/src/ReactCurrentFiber.js
@@ -72,7 +72,7 @@ export function runWithFiberInDEV<A0, A1, A2, A3, A4, T>(
       }
       return callback(arg0, arg1, arg2, arg3, arg4);
     } finally {
-      current = previousFiber;
+      setCurrentFiber(previousFiber);
     }
   }
   // These errors should never make it into a build so we don't need to encode them in codes.json
diff --git a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
index ca0e9fd12cc11..7ee176a106e15 100644
--- a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
@@ -62,4 +62,17 @@ describe('ReactOwnerStacks', () => {
       '\n    in Bar (at **)' + '\n    in Foo (at **)',
     );
   });
+
+  it('returns null outside of render', async () => {
+    // Awkward to gate since some builds will have `captureOwnerStack` return null in prod
+    if (__DEV__ && gate('enableOwnerStacks')) {
+      expect(React.captureOwnerStack()).toBe(null);
+
+      await act(() => {
+        ReactNoop.render(<div />);
+      });
+
+      expect(React.captureOwnerStack()).toBe(null);
+    }
+  });
 });

From ed8b68dd178af17a2dd36c8678f81f8b454559a9 Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Thu, 13 Feb 2025 18:26:36 +0100
Subject: [PATCH 26/73] Stop exporting dev-only methods in OSS production
 builds (#32200)

---
 .../src/__tests__/ReactTestUtilsAct-test.js   |  8 ---
 .../src/__tests__/ReactIsomorphicAct-test.js  | 12 +++++
 .../src/__tests__/ReactOwnerStacks-test.js    | 10 ++++
 packages/react/index.js                       |  2 -
 packages/react/index.stable.development.js    | 51 +++++++++++++++++++
 packages/react/index.stable.js                |  1 -
 scripts/jest/TestFlags.js                     |  1 +
 scripts/jest/setupHostConfigs.js              | 19 ++++---
 scripts/rollup/build.js                       | 21 ++++----
 9 files changed, 96 insertions(+), 29 deletions(-)
 create mode 100644 packages/react/index.stable.development.js

diff --git a/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js b/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js
index 76cfab25e0016..64ccc387d75a3 100644
--- a/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js
+++ b/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js
@@ -779,13 +779,5 @@ function runActTests(render, unmount, rerender) {
         });
       }
     });
-    describe('throw in prod mode', () => {
-      // @gate !__DEV__
-      it('warns if you try to use act() in prod mode', () => {
-        expect(() => act(() => {})).toThrow(
-          'act(...) is not supported in production builds of React',
-        );
-      });
-    });
   });
 }
diff --git a/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js b/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js
index eeec3b2b7eb3b..874969b131ea5 100644
--- a/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js
@@ -50,6 +50,18 @@ describe('isomorphic act()', () => {
     return text;
   }
 
+  it('behavior in production', () => {
+    if (!__DEV__) {
+      if (gate('fb')) {
+        expect(() => act(() => {})).toThrow(
+          'act(...) is not supported in production builds of React',
+        );
+      } else {
+        expect(React).not.toHaveProperty('act');
+      }
+    }
+  });
+
   // @gate __DEV__
   it('bypasses queueMicrotask', async () => {
     const root = ReactNoop.createRoot();
diff --git a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
index 7ee176a106e15..42294269e7b14 100644
--- a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
@@ -31,6 +31,16 @@ describe('ReactOwnerStacks', () => {
     );
   }
 
+  it('behavior in production', () => {
+    if (!__DEV__) {
+      if (gate('fb')) {
+        expect(React).toHaveProperty('captureOwnerStack', undefined);
+      } else {
+        expect(React).not.toHaveProperty('captureOwnerStack');
+      }
+    }
+  });
+
   // @gate __DEV__ && enableOwnerStacks
   it('can get the component owner stacks during rendering in dev', async () => {
     let stack;
diff --git a/packages/react/index.js b/packages/react/index.js
index 711a044455257..af4cd4b0c1b17 100644
--- a/packages/react/index.js
+++ b/packages/react/index.js
@@ -23,8 +23,6 @@ export type ElementRef<C> = React$ElementRef<C>;
 export type Config<Props, DefaultProps> = React$Config<Props, DefaultProps>;
 export type ChildrenArray<+T> = $ReadOnlyArray<ChildrenArray<T>> | T;
 
-// Export all exports so that they're available in tests.
-// We can't use export * from in Flow for some reason.
 export {
   __CLIENT_INTERNALS_DO_NOT_USE_OR_WARN_USERS_THEY_CANNOT_UPGRADE,
   __COMPILER_RUNTIME,
diff --git a/packages/react/index.stable.development.js b/packages/react/index.stable.development.js
new file mode 100644
index 0000000000000..f9ac98bafbf58
--- /dev/null
+++ b/packages/react/index.stable.development.js
@@ -0,0 +1,51 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+export {
+  __CLIENT_INTERNALS_DO_NOT_USE_OR_WARN_USERS_THEY_CANNOT_UPGRADE,
+  __COMPILER_RUNTIME,
+  Children,
+  Component,
+  Fragment,
+  Profiler,
+  PureComponent,
+  StrictMode,
+  Suspense,
+  cloneElement,
+  createContext,
+  createElement,
+  createRef,
+  use,
+  forwardRef,
+  isValidElement,
+  lazy,
+  memo,
+  cache,
+  unstable_useCacheRefresh,
+  startTransition,
+  useId,
+  useCallback,
+  useContext,
+  useDebugValue,
+  useDeferredValue,
+  useEffect,
+  useImperativeHandle,
+  useInsertionEffect,
+  useLayoutEffect,
+  useMemo,
+  useReducer,
+  useOptimistic,
+  useRef,
+  useState,
+  useSyncExternalStore,
+  useTransition,
+  useActionState,
+  version,
+  act, // DEV-only
+} from './src/ReactClient';
diff --git a/packages/react/index.stable.js b/packages/react/index.stable.js
index 26e22c343223e..6f25c7a37d983 100644
--- a/packages/react/index.stable.js
+++ b/packages/react/index.stable.js
@@ -10,7 +10,6 @@
 export {
   __CLIENT_INTERNALS_DO_NOT_USE_OR_WARN_USERS_THEY_CANNOT_UPGRADE,
   __COMPILER_RUNTIME,
-  act,
   Children,
   Component,
   Fragment,
diff --git a/scripts/jest/TestFlags.js b/scripts/jest/TestFlags.js
index b970955491aae..f736ca2254f64 100644
--- a/scripts/jest/TestFlags.js
+++ b/scripts/jest/TestFlags.js
@@ -78,6 +78,7 @@ function getTestFlags() {
       classic: releaseChannel === 'classic',
       source: !process.env.IS_BUILD,
       www,
+      fb: www || xplat,
 
       // These aren't flags, just a useful aliases for tests.
       enableActivity: releaseChannel === 'experimental' || www || xplat,
diff --git a/scripts/jest/setupHostConfigs.js b/scripts/jest/setupHostConfigs.js
index b52fac3201ebf..aacfaf116fcd2 100644
--- a/scripts/jest/setupHostConfigs.js
+++ b/scripts/jest/setupHostConfigs.js
@@ -43,9 +43,9 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
       }
 
       resolvedEntry = nodePath.join(resolvedEntry, '..', entrypoint);
-      const developmentEntry = resolvedEntry.replace('.js', '.development.js');
-      if (fs.existsSync(developmentEntry)) {
-        return developmentEntry;
+      const devEntry = resolvedEntry.replace('.js', '.development.js');
+      if (__DEV__ && fs.existsSync(devEntry)) {
+        return devEntry;
       }
       if (fs.existsSync(resolvedEntry)) {
         return resolvedEntry;
@@ -60,13 +60,20 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
       __EXPERIMENTAL__ ? '.modern.fb.js' : '.classic.fb.js'
     );
     const devFBEntry = resolvedFBEntry.replace('.js', '.development.js');
-    if (fs.existsSync(devFBEntry)) {
+    if (__DEV__ && fs.existsSync(devFBEntry)) {
       return devFBEntry;
     }
     if (fs.existsSync(resolvedFBEntry)) {
       return resolvedFBEntry;
     }
     const resolvedGenericFBEntry = resolvedEntry.replace('.js', '.fb.js');
+    const devGenericFBEntry = resolvedGenericFBEntry.replace(
+      '.js',
+      '.development.js'
+    );
+    if (__DEV__ && fs.existsSync(devGenericFBEntry)) {
+      return devGenericFBEntry;
+    }
     if (fs.existsSync(resolvedGenericFBEntry)) {
       return resolvedGenericFBEntry;
     }
@@ -77,14 +84,14 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
     __EXPERIMENTAL__ ? '.experimental.js' : '.stable.js'
   );
   const devForkedEntry = resolvedForkedEntry.replace('.js', '.development.js');
-  if (fs.existsSync(devForkedEntry)) {
+  if (__DEV__ && fs.existsSync(devForkedEntry)) {
     return devForkedEntry;
   }
   if (fs.existsSync(resolvedForkedEntry)) {
     return resolvedForkedEntry;
   }
   const plainDevEntry = resolvedEntry.replace('.js', '.development.js');
-  if (fs.existsSync(plainDevEntry)) {
+  if (__DEV__ && fs.existsSync(plainDevEntry)) {
     return plainDevEntry;
   }
   // Just use the plain .js one.
diff --git a/scripts/rollup/build.js b/scripts/rollup/build.js
index 2a67c13e1e620..547362dae7123 100644
--- a/scripts/rollup/build.js
+++ b/scripts/rollup/build.js
@@ -571,7 +571,7 @@ function shouldSkipBundle(bundle, bundleType) {
   return false;
 }
 
-function resolveEntryFork(resolvedEntry, isFBBundle) {
+function resolveEntryFork(resolvedEntry, isFBBundle, isDev) {
   // Pick which entry point fork to use:
   // .modern.fb.js
   // .classic.fb.js
@@ -586,23 +586,20 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
       '.js',
       __EXPERIMENTAL__ ? '.modern.fb.js' : '.classic.fb.js'
     );
-    const developmentFBEntry = resolvedFBEntry.replace(
-      '.js',
-      '.development.js'
-    );
-    if (fs.existsSync(developmentFBEntry)) {
-      return developmentFBEntry;
+    const devFBEntry = resolvedFBEntry.replace('.js', '.development.js');
+    if (isDev && fs.existsSync(devFBEntry)) {
+      return devFBEntry;
     }
     if (fs.existsSync(resolvedFBEntry)) {
       return resolvedFBEntry;
     }
     const resolvedGenericFBEntry = resolvedEntry.replace('.js', '.fb.js');
-    const developmentGenericFBEntry = resolvedGenericFBEntry.replace(
+    const devGenericFBEntry = resolvedGenericFBEntry.replace(
       '.js',
       '.development.js'
     );
-    if (fs.existsSync(developmentGenericFBEntry)) {
-      return developmentGenericFBEntry;
+    if (isDev && fs.existsSync(devGenericFBEntry)) {
+      return devGenericFBEntry;
     }
     if (fs.existsSync(resolvedGenericFBEntry)) {
       return resolvedGenericFBEntry;
@@ -614,7 +611,7 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
     __EXPERIMENTAL__ ? '.experimental.js' : '.stable.js'
   );
   const devForkedEntry = resolvedForkedEntry.replace('.js', '.development.js');
-  if (fs.existsSync(devForkedEntry)) {
+  if (isDev && fs.existsSync(devForkedEntry)) {
     return devForkedEntry;
   }
   if (fs.existsSync(resolvedForkedEntry)) {
@@ -633,7 +630,7 @@ async function createBundle(bundle, bundleType) {
 
   const {isFBWWWBundle, isFBRNBundle} = getBundleTypeFlags(bundleType);
 
-  let resolvedEntry = resolveEntryFork(
+  const resolvedEntry = resolveEntryFork(
     require.resolve(bundle.entry),
     isFBWWWBundle || isFBRNBundle,
     !isProductionBundleType(bundleType)

From 32b0cad8f74da3d6e8b07f4ffbad26dfe8d8a71a Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Thu, 13 Feb 2025 20:38:57 +0100
Subject: [PATCH 27/73] Enable owner stacks in Canary builds (#32053)

Pending internal decision to ship in Canary.
Still off for FB builds.

Docs: https://github.com/reactjs/react.dev/pull/7427
---
 packages/react/index.stable.development.js               | 1 +
 packages/react/src/ReactServer.js                        | 2 ++
 packages/shared/ReactFeatureFlags.js                     | 2 +-
 packages/shared/forks/ReactFeatureFlags.test-renderer.js | 2 +-
 4 files changed, 5 insertions(+), 2 deletions(-)

diff --git a/packages/react/index.stable.development.js b/packages/react/index.stable.development.js
index f9ac98bafbf58..2397010cf5604 100644
--- a/packages/react/index.stable.development.js
+++ b/packages/react/index.stable.development.js
@@ -48,4 +48,5 @@ export {
   useActionState,
   version,
   act, // DEV-only
+  captureOwnerStack, // DEV-only
 } from './src/ReactClient';
diff --git a/packages/react/src/ReactServer.js b/packages/react/src/ReactServer.js
index d6702023e4741..a00e192bd3c1d 100644
--- a/packages/react/src/ReactServer.js
+++ b/packages/react/src/ReactServer.js
@@ -28,6 +28,7 @@ import {lazy} from './ReactLazy';
 import {memo} from './ReactMemo';
 import {cache} from './ReactCacheServer';
 import version from 'shared/ReactVersion';
+import {captureOwnerStack} from './ReactOwnerStack';
 
 const Children = {
   map,
@@ -57,4 +58,5 @@ export {
   useDebugValue,
   useMemo,
   version,
+  captureOwnerStack, // DEV-only
 };
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index fbdfe5a468516..844b2a2f6a914 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -127,7 +127,7 @@ export const passChildrenWhenCloningPersistedNodes = false;
  */
 export const enablePersistedModeClonedFlag = false;
 
-export const enableOwnerStacks = __EXPERIMENTAL__;
+export const enableOwnerStacks = true;
 
 export const enableShallowPropDiffing = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 6fcd35c40774b..ef3c300602bdb 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -88,7 +88,7 @@ export const enableReactTestRendererWarning = true;
 export const disableDefaultPropsExceptForClasses = true;
 
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enableRemoveConsolePatches = true;
 
 // Flow magic to verify the exports of this file match the original version.

From a53da6abe1593483098df2baf927fe07d80153a5 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Thu, 13 Feb 2025 16:06:01 -0500
Subject: [PATCH 28/73] Add useSwipeTransition Hook Behind Experimental Flag
 (#32373)

This Hook will be used to drive a View Transition based on a gesture.

```js
const [value, startGesture] = useSwipeTransition(prev, current, next);
```

The `enableSwipeTransition` flag will depend on `enableViewTransition`
flag but we may decide to ship them independently. This PR doesn't do
anything interesting yet. There will be a lot more PRs to build out the
actual functionality. This is just wiring up the plumbing for the new
Hook.

This first PR is mainly concerned with how the whole starts (and stops).
The core API is the `startGesture` function (although there will be
other conveniences added in the future). You can call this to start a
gesture with a source provider. You can call this multiple times in one
event to batch multiple Hooks listening to the same provider. However,
each render can only handle one source provider at a time and so it does
one render per scheduled gesture provider.

This uses a separate `GestureLane` to drive gesture renders by marking
the Hook as having an update on that lane. Then schedule a render. These
renders should be blocking and in the same microtask as the
`startGesture` to ensure it can block the paint. So it's similar to
sync.

It may not be possible to finish it synchronously e.g. if something
suspends. If so, it just tries again later when it can like any other
render. This can also happen because it also may not be possible to
drive more than one gesture at a time like if we're limited to one View
Transition per document. So right now you can only run one gesture at a
time in practice.

These renders never commit. This means that we can't clear the
`GestureLane` the normal way. Instead, we have to clear only the root's
`pendingLanes` if we don't have any new renders scheduled. Then wait
until something else updates the Fiber after all gestures on it have
stopped before it really clears.
---
 .../view-transition/src/components/Page.css   |  11 +
 .../view-transition/src/components/Page.js    |  39 ++-
 .../react-debug-tools/src/ReactDebugHooks.js  |  37 ++-
 .../src/ReactFiberConcurrentUpdates.js        |  38 ++-
 .../src/ReactFiberGestureScheduler.js         |  90 +++++++
 .../react-reconciler/src/ReactFiberHooks.js   | 242 ++++++++++++++++++
 .../react-reconciler/src/ReactFiberLane.js    |  52 ++--
 .../react-reconciler/src/ReactFiberRoot.js    |   5 +
 .../src/ReactFiberRootScheduler.js            |   8 +-
 .../src/ReactFiberWorkLoop.js                 |  44 ++++
 .../src/ReactInternalTypes.js                 |  14 +-
 packages/react-server/src/ReactFizzHooks.js   |  42 ++-
 packages/react-server/src/ReactFlightHooks.js |  45 ++--
 .../react/index.experimental.development.js   |   1 +
 packages/react/index.experimental.js          |   1 +
 packages/react/src/ReactClient.js             |   8 +-
 packages/react/src/ReactHooks.js              |  19 +-
 packages/shared/ReactFeatureFlags.js          |   2 +
 packages/shared/ReactTypes.js                 |   6 +
 .../forks/ReactFeatureFlags.native-fb.js      |   1 +
 .../forks/ReactFeatureFlags.native-oss.js     |   1 +
 .../forks/ReactFeatureFlags.test-renderer.js  |   1 +
 ...actFeatureFlags.test-renderer.native-fb.js |   1 +
 .../ReactFeatureFlags.test-renderer.www.js    |   1 +
 .../shared/forks/ReactFeatureFlags.www.js     |   2 +
 scripts/error-codes/codes.json                |   4 +-
 26 files changed, 647 insertions(+), 68 deletions(-)
 create mode 100644 packages/react-reconciler/src/ReactFiberGestureScheduler.js

diff --git a/fixtures/view-transition/src/components/Page.css b/fixtures/view-transition/src/components/Page.css
index 5afcc33a8f4bc..a5a9373194ef8 100644
--- a/fixtures/view-transition/src/components/Page.css
+++ b/fixtures/view-transition/src/components/Page.css
@@ -6,3 +6,14 @@
   font-variation-settings:
     "wdth" 100;
 }
+
+.swipe-recognizer {
+  width: 200px;
+  overflow-x: scroll;
+  border: 1px solid #333333;
+  border-radius: 10px;
+}
+
+.swipe-overscroll {
+  width: 200%;
+}
diff --git a/fixtures/view-transition/src/components/Page.js b/fixtures/view-transition/src/components/Page.js
index 40f60327728fd..1c7a9bfeb32db 100644
--- a/fixtures/view-transition/src/components/Page.js
+++ b/fixtures/view-transition/src/components/Page.js
@@ -1,6 +1,9 @@
 import React, {
   unstable_ViewTransition as ViewTransition,
   unstable_Activity as Activity,
+  unstable_useSwipeTransition as useSwipeTransition,
+  useRef,
+  useLayoutEffect,
 } from 'react';
 
 import './Page.css';
@@ -35,7 +38,8 @@ function Component() {
 }
 
 export default function Page({url, navigate}) {
-  const show = url === '/?b';
+  const [renderedUrl, startGesture] = useSwipeTransition('/?a', url, '/?b');
+  const show = renderedUrl === '/?b';
   function onTransition(viewTransition, types) {
     const keyframes = [
       {rotate: '0deg', transformOrigin: '30px 8px'},
@@ -44,6 +48,32 @@ export default function Page({url, navigate}) {
     viewTransition.old.animate(keyframes, 250);
     viewTransition.new.animate(keyframes, 250);
   }
+
+  const swipeRecognizer = useRef(null);
+  const activeGesture = useRef(null);
+  function onScroll() {
+    if (activeGesture.current !== null) {
+      return;
+    }
+    // eslint-disable-next-line no-undef
+    const scrollTimeline = new ScrollTimeline({
+      source: swipeRecognizer.current,
+      axis: 'x',
+    });
+    activeGesture.current = startGesture(scrollTimeline);
+  }
+  function onScrollEnd() {
+    if (activeGesture.current !== null) {
+      const cancelGesture = activeGesture.current;
+      activeGesture.current = null;
+      cancelGesture();
+    }
+  }
+
+  useLayoutEffect(() => {
+    swipeRecognizer.current.scrollLeft = show ? 0 : 10000;
+  }, [show]);
+
   const exclamation = (
     <ViewTransition name="exclamation" onShare={onTransition}>
       <span>!</span>
@@ -90,6 +120,13 @@ export default function Page({url, navigate}) {
           <p></p>
           <p></p>
           <p></p>
+          <div
+            className="swipe-recognizer"
+            onScroll={onScroll}
+            onScrollEnd={onScrollEnd}
+            ref={swipeRecognizer}>
+            <div className="swipe-overscroll">Swipe me</div>
+          </div>
           <p></p>
           <p></p>
           {show ? null : (
diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index 114080d03e921..798cdec4380f8 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -14,6 +14,7 @@ import type {
   Usable,
   Thenable,
   ReactDebugInfo,
+  StartGesture,
 } from 'shared/ReactTypes';
 import type {
   ContextDependency,
@@ -131,6 +132,9 @@ function getPrimitiveStackCache(): Map<string, Array<any>> {
       if (typeof Dispatcher.useEffectEvent === 'function') {
         Dispatcher.useEffectEvent((args: empty) => {});
       }
+      if (typeof Dispatcher.useSwipeTransition === 'function') {
+        Dispatcher.useSwipeTransition(null, null, null);
+      }
     } finally {
       readHookLog = hookLog;
       hookLog = [];
@@ -752,31 +756,50 @@ function useEffectEvent<Args, F: (...Array<Args>) => mixed>(callback: F): F {
   return callback;
 }
 
+function useSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  nextHook();
+  hookLog.push({
+    displayName: null,
+    primitive: 'SwipeTransition',
+    stackError: new Error(),
+    value: current,
+    debugInfo: null,
+    dispatcherHookName: 'SwipeTransition',
+  });
+  return [current, () => () => {}];
+}
+
 const Dispatcher: DispatcherType = {
-  use,
   readContext,
-  useCacheRefresh,
+
+  use,
   useCallback,
   useContext,
   useEffect,
   useImperativeHandle,
-  useDebugValue,
   useLayoutEffect,
   useInsertionEffect,
   useMemo,
-  useMemoCache,
-  useOptimistic,
   useReducer,
   useRef,
   useState,
+  useDebugValue,
+  useDeferredValue,
   useTransition,
   useSyncExternalStore,
-  useDeferredValue,
   useId,
+  useHostTransitionStatus,
   useFormState,
   useActionState,
-  useHostTransitionStatus,
+  useOptimistic,
+  useMemoCache,
+  useCacheRefresh,
   useEffectEvent,
+  useSwipeTransition,
 };
 
 // create a proxy to throw a custom error
diff --git a/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js b/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js
index 5413db10f6f75..859e553ccbcb6 100644
--- a/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js
+++ b/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js
@@ -24,7 +24,14 @@ import {
   throwIfInfiniteUpdateLoopDetected,
   getWorkInProgressRoot,
 } from './ReactFiberWorkLoop';
-import {NoLane, NoLanes, mergeLanes, markHiddenUpdate} from './ReactFiberLane';
+import {
+  NoLane,
+  NoLanes,
+  mergeLanes,
+  markHiddenUpdate,
+  markRootUpdated,
+  GestureLane,
+} from './ReactFiberLane';
 import {NoFlags, Placement, Hydrating} from './ReactFiberFlags';
 import {HostRoot, OffscreenComponent} from './ReactWorkTags';
 import {OffscreenVisible} from './ReactFiberActivityComponent';
@@ -169,6 +176,25 @@ export function enqueueConcurrentRenderForLane(
   return getRootForUpdatedFiber(fiber);
 }
 
+export function enqueueGestureRender(fiber: Fiber): FiberRoot | null {
+  // We can't use the concurrent queuing for these so this is basically just a
+  // short cut for marking the lane on the parent path. It is possible for a
+  // gesture render to suspend and then in the gap get another gesture starting.
+  // However, marking the lane doesn't make much different in this case because
+  // it would have to call startGesture with the same exact provider as was
+  // already rendering. Because otherwise it has no effect on the Hook itself.
+  // TODO: We could potentially solve this case by popping a ScheduledGesture
+  // off the root's queue while we're rendering it so that it can't dedupe
+  // and so new startGesture with the same provider would create a new
+  // ScheduledGesture which goes into a separate render pass anyway.
+  // This is such an edge case it probably doesn't matter much.
+  const root = markUpdateLaneFromFiberToRoot(fiber, null, GestureLane);
+  if (root !== null) {
+    markRootUpdated(root, GestureLane);
+  }
+  return root;
+}
+
 // Calling this function outside this module should only be done for backwards
 // compatibility and should always be accompanied by a warning.
 export function unsafe_markUpdateLaneFromFiberToRoot(
@@ -189,7 +215,7 @@ function markUpdateLaneFromFiberToRoot(
   sourceFiber: Fiber,
   update: ConcurrentUpdate | null,
   lane: Lane,
-): void {
+): null | FiberRoot {
   // Update the source fiber's lanes
   sourceFiber.lanes = mergeLanes(sourceFiber.lanes, lane);
   let alternate = sourceFiber.alternate;
@@ -238,10 +264,14 @@ function markUpdateLaneFromFiberToRoot(
     parent = parent.return;
   }
 
-  if (isHidden && update !== null && node.tag === HostRoot) {
+  if (node.tag === HostRoot) {
     const root: FiberRoot = node.stateNode;
-    markHiddenUpdate(root, update, lane);
+    if (isHidden && update !== null) {
+      markHiddenUpdate(root, update, lane);
+    }
+    return root;
   }
+  return null;
 }
 
 function getRootForUpdatedFiber(sourceFiber: Fiber): FiberRoot | null {
diff --git a/packages/react-reconciler/src/ReactFiberGestureScheduler.js b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
new file mode 100644
index 0000000000000..7664316b67558
--- /dev/null
+++ b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
@@ -0,0 +1,90 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+import type {FiberRoot} from './ReactInternalTypes';
+import type {GestureProvider} from 'shared/ReactTypes';
+
+import {GestureLane} from './ReactFiberLane';
+import {ensureRootIsScheduled} from './ReactFiberRootScheduler';
+
+// This type keeps track of any scheduled or active gestures.
+export type ScheduledGesture = {
+  provider: GestureProvider,
+  count: number, // The number of times this same provider has been started.
+  prev: null | ScheduledGesture, // The previous scheduled gesture in the queue for this root.
+  next: null | ScheduledGesture, // The next scheduled gesture in the queue for this root.
+};
+
+export function scheduleGesture(
+  root: FiberRoot,
+  provider: GestureProvider,
+): ScheduledGesture {
+  let prev = root.gestures;
+  while (prev !== null) {
+    if (prev.provider === provider) {
+      // Existing instance found.
+      prev.count++;
+      return prev;
+    }
+    const next = prev.next;
+    if (next === null) {
+      break;
+    }
+    prev = next;
+  }
+  // Add new instance to the end of the queue.
+  const gesture: ScheduledGesture = {
+    provider: provider,
+    count: 1,
+    prev: prev,
+    next: null,
+  };
+  if (prev === null) {
+    root.gestures = gesture;
+  } else {
+    prev.next = gesture;
+  }
+  ensureRootIsScheduled(root);
+  return gesture;
+}
+
+export function cancelScheduledGesture(
+  root: FiberRoot,
+  gesture: ScheduledGesture,
+): void {
+  gesture.count--;
+  if (gesture.count === 0) {
+    // Delete the scheduled gesture from the queue.
+    deleteScheduledGesture(root, gesture);
+  }
+}
+
+export function deleteScheduledGesture(
+  root: FiberRoot,
+  gesture: ScheduledGesture,
+): void {
+  if (gesture.prev === null) {
+    if (root.gestures === gesture) {
+      root.gestures = gesture.next;
+      if (root.gestures === null) {
+        // Gestures don't clear their lanes while the gesture is still active but it
+        // might not be scheduled to do any more renders and so we shouldn't schedule
+        // any more gesture lane work until a new gesture is scheduled.
+        root.pendingLanes &= ~GestureLane;
+      }
+    }
+  } else {
+    gesture.prev.next = gesture.next;
+    if (gesture.next !== null) {
+      gesture.next.prev = gesture.prev;
+    }
+    gesture.prev = null;
+    gesture.next = null;
+  }
+}
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 2ab41770bd0ac..06e00441c3b8e 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -14,6 +14,8 @@ import type {
   Thenable,
   RejectedThenable,
   Awaited,
+  StartGesture,
+  GestureProvider,
 } from 'shared/ReactTypes';
 import type {
   Fiber,
@@ -26,6 +28,7 @@ import type {Lanes, Lane} from './ReactFiberLane';
 import type {HookFlags} from './ReactHookEffectTags';
 import type {Flags} from './ReactFiberFlags';
 import type {TransitionStatus} from './ReactFiberConfig';
+import type {ScheduledGesture} from './ReactFiberGestureScheduler';
 
 import {
   HostTransitionContext,
@@ -42,6 +45,7 @@ import {
   enableLegacyCache,
   disableLegacyMode,
   enableNoCloningMemoCache,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import {
   REACT_CONTEXT_TYPE,
@@ -70,6 +74,8 @@ import {
   isTransitionLane,
   markRootEntangled,
   includesSomeLane,
+  isGestureRender,
+  GestureLane,
 } from './ReactFiberLane';
 import {
   ContinuousEventPriority,
@@ -130,6 +136,7 @@ import {
   enqueueConcurrentHookUpdate,
   enqueueConcurrentHookUpdateAndEagerlyBailout,
   enqueueConcurrentRenderForLane,
+  enqueueGestureRender,
 } from './ReactFiberConcurrentUpdates';
 import {getTreeId} from './ReactFiberTreeContext';
 import {now} from './Scheduler';
@@ -153,6 +160,11 @@ import {requestCurrentTransition} from './ReactFiberTransition';
 
 import {callComponentInDEV} from './ReactFiberCallUserSpace';
 
+import {
+  scheduleGesture,
+  cancelScheduledGesture,
+} from './ReactFiberGestureScheduler';
+
 export type Update<S, A> = {
   lane: Lane,
   revertLane: Lane,
@@ -3960,6 +3972,133 @@ function markUpdateInDevTools<A>(fiber: Fiber, lane: Lane, action: A): void {
   }
 }
 
+type SwipeTransitionGestureUpdate = {
+  gesture: ScheduledGesture,
+  prev: SwipeTransitionGestureUpdate | null,
+  next: SwipeTransitionGestureUpdate | null,
+};
+
+type SwipeTransitionUpdateQueue = {
+  pending: null | SwipeTransitionGestureUpdate,
+  dispatch: StartGesture,
+};
+
+function startGesture(
+  fiber: Fiber,
+  queue: SwipeTransitionUpdateQueue,
+  gestureProvider: GestureProvider,
+): () => void {
+  const root = enqueueGestureRender(fiber);
+  if (root === null) {
+    // Already unmounted.
+    // TODO: Should we warn here about starting on an unmounted Fiber?
+    return function cancelGesture() {
+      // Noop.
+    };
+  }
+  const scheduledGesture = scheduleGesture(root, gestureProvider);
+  // Add this particular instance to the queue.
+  // We add multiple of the same provider even if they get batched so
+  // that if we cancel one but not the other we can keep track of this.
+  // Order doesn't matter but we insert in the beginning to avoid two fields.
+  const update: SwipeTransitionGestureUpdate = {
+    gesture: scheduledGesture,
+    prev: null,
+    next: queue.pending,
+  };
+  if (queue.pending !== null) {
+    queue.pending.prev = update;
+  }
+  queue.pending = update;
+  return function cancelGesture(): void {
+    if (update.prev === null) {
+      if (queue.pending === update) {
+        queue.pending = update.next;
+      } else {
+        // This was already cancelled. Avoid double decrementing if someone calls this twice by accident.
+        // TODO: Should we warn here about double cancelling?
+        return;
+      }
+    } else {
+      update.prev.next = update.next;
+      if (update.next !== null) {
+        update.next.prev = update.prev;
+      }
+      update.prev = null;
+      update.next = null;
+    }
+    const cancelledGestured = update.gesture;
+    // Decrement ref count of the root schedule.
+    cancelScheduledGesture(root, cancelledGestured);
+  };
+}
+
+function mountSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  const queue: SwipeTransitionUpdateQueue = {
+    pending: null,
+    dispatch: (null: any),
+  };
+  const startGestureOnHook: StartGesture = (queue.dispatch = (startGesture.bind(
+    null,
+    currentlyRenderingFiber,
+    queue,
+  ): any));
+  const hook = mountWorkInProgressHook();
+  hook.queue = queue;
+  return [current, startGestureOnHook];
+}
+
+function updateSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  const hook = updateWorkInProgressHook();
+  const queue: SwipeTransitionUpdateQueue = hook.queue;
+  const startGestureOnHook: StartGesture = queue.dispatch;
+  const rootRenderLanes = getWorkInProgressRootRenderLanes();
+  let value = current;
+  if (isGestureRender(rootRenderLanes)) {
+    // We're inside a gesture render. We'll traverse the queue to see if
+    // this specific Hook is part of this gesture and, if so, which
+    // direction to render.
+    const root: FiberRoot | null = getWorkInProgressRoot();
+    if (root === null) {
+      throw new Error(
+        'Expected a work-in-progress root. This is a bug in React. Please file an issue.',
+      );
+    }
+    // We assume that the currently rendering gesture is the one first in the queue.
+    const rootRenderGesture = root.gestures;
+    let update = queue.pending;
+    while (update !== null) {
+      if (rootRenderGesture === update.gesture) {
+        // We had a match, meaning we're currently rendering a direction of this
+        // hook for this gesture.
+        // TODO: Determine which direction this gesture is currently rendering.
+        value = previous;
+        break;
+      }
+      update = update.next;
+    }
+  }
+  if (queue.pending !== null) {
+    // As long as there are any active gestures we need to leave the lane on
+    // in case we need to render it later. Since a gesture render doesn't commit
+    // the only time it really fully gets cleared is if something else rerenders
+    // this component after all the active gestures has cleared.
+    currentlyRenderingFiber.lanes = mergeLanes(
+      currentlyRenderingFiber.lanes,
+      GestureLane,
+    );
+  }
+  return [value, startGestureOnHook];
+}
+
 export const ContextOnlyDispatcher: Dispatcher = {
   readContext,
 
@@ -3989,6 +4128,10 @@ export const ContextOnlyDispatcher: Dispatcher = {
 if (enableUseEffectEventHook) {
   (ContextOnlyDispatcher: Dispatcher).useEffectEvent = throwInvalidHookError;
 }
+if (enableSwipeTransition) {
+  (ContextOnlyDispatcher: Dispatcher).useSwipeTransition =
+    throwInvalidHookError;
+}
 
 const HooksDispatcherOnMount: Dispatcher = {
   readContext,
@@ -4019,6 +4162,10 @@ const HooksDispatcherOnMount: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnMount: Dispatcher).useEffectEvent = mountEvent;
 }
+if (enableSwipeTransition) {
+  (HooksDispatcherOnMount: Dispatcher).useSwipeTransition =
+    mountSwipeTransition;
+}
 
 const HooksDispatcherOnUpdate: Dispatcher = {
   readContext,
@@ -4049,6 +4196,10 @@ const HooksDispatcherOnUpdate: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnUpdate: Dispatcher).useEffectEvent = updateEvent;
 }
+if (enableSwipeTransition) {
+  (HooksDispatcherOnUpdate: Dispatcher).useSwipeTransition =
+    updateSwipeTransition;
+}
 
 const HooksDispatcherOnRerender: Dispatcher = {
   readContext,
@@ -4079,6 +4230,10 @@ const HooksDispatcherOnRerender: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnRerender: Dispatcher).useEffectEvent = updateEvent;
 }
+if (enableSwipeTransition) {
+  (HooksDispatcherOnRerender: Dispatcher).useSwipeTransition =
+    updateSwipeTransition;
+}
 
 let HooksDispatcherOnMountInDEV: Dispatcher | null = null;
 let HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher | null = null;
@@ -4296,6 +4451,18 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnMountInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        mountHookTypesDev();
+        return mountSwipeTransition(previous, current, next);
+      };
+  }
 
   HooksDispatcherOnMountWithHookTypesInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4479,6 +4646,18 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   HooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4662,6 +4841,18 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnUpdateInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   HooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4845,6 +5036,18 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnRerenderInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   InvalidNestedHooksDispatcherOnMountInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5053,6 +5256,19 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        warnInvalidHookAccess();
+        mountHookTypesDev();
+        return mountSwipeTransition(previous, current, next);
+      };
+  }
 
   InvalidNestedHooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5261,6 +5477,19 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        warnInvalidHookAccess();
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   InvalidNestedHooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5469,4 +5698,17 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        warnInvalidHookAccess();
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 }
diff --git a/packages/react-reconciler/src/ReactFiberLane.js b/packages/react-reconciler/src/ReactFiberLane.js
index 922fe2f977d45..22bf99624dbb4 100644
--- a/packages/react-reconciler/src/ReactFiberLane.js
+++ b/packages/react-reconciler/src/ReactFiberLane.js
@@ -54,23 +54,24 @@ export const DefaultLane: Lane = /*                     */ 0b0000000000000000000
 export const SyncUpdateLanes: Lane =
   SyncLane | InputContinuousLane | DefaultLane;
 
-const TransitionHydrationLane: Lane = /*                */ 0b0000000000000000000000001000000;
-const TransitionLanes: Lanes = /*                       */ 0b0000000001111111111111110000000;
-const TransitionLane1: Lane = /*                        */ 0b0000000000000000000000010000000;
-const TransitionLane2: Lane = /*                        */ 0b0000000000000000000000100000000;
-const TransitionLane3: Lane = /*                        */ 0b0000000000000000000001000000000;
-const TransitionLane4: Lane = /*                        */ 0b0000000000000000000010000000000;
-const TransitionLane5: Lane = /*                        */ 0b0000000000000000000100000000000;
-const TransitionLane6: Lane = /*                        */ 0b0000000000000000001000000000000;
-const TransitionLane7: Lane = /*                        */ 0b0000000000000000010000000000000;
-const TransitionLane8: Lane = /*                        */ 0b0000000000000000100000000000000;
-const TransitionLane9: Lane = /*                        */ 0b0000000000000001000000000000000;
-const TransitionLane10: Lane = /*                       */ 0b0000000000000010000000000000000;
-const TransitionLane11: Lane = /*                       */ 0b0000000000000100000000000000000;
-const TransitionLane12: Lane = /*                       */ 0b0000000000001000000000000000000;
-const TransitionLane13: Lane = /*                       */ 0b0000000000010000000000000000000;
-const TransitionLane14: Lane = /*                       */ 0b0000000000100000000000000000000;
-const TransitionLane15: Lane = /*                       */ 0b0000000001000000000000000000000;
+export const GestureLane: Lane = /*                     */ 0b0000000000000000000000001000000;
+
+const TransitionHydrationLane: Lane = /*                */ 0b0000000000000000000000010000000;
+const TransitionLanes: Lanes = /*                       */ 0b0000000001111111111111100000000;
+const TransitionLane1: Lane = /*                        */ 0b0000000000000000000000100000000;
+const TransitionLane2: Lane = /*                        */ 0b0000000000000000000001000000000;
+const TransitionLane3: Lane = /*                        */ 0b0000000000000000000010000000000;
+const TransitionLane4: Lane = /*                        */ 0b0000000000000000000100000000000;
+const TransitionLane5: Lane = /*                        */ 0b0000000000000000001000000000000;
+const TransitionLane6: Lane = /*                        */ 0b0000000000000000010000000000000;
+const TransitionLane7: Lane = /*                        */ 0b0000000000000000100000000000000;
+const TransitionLane8: Lane = /*                        */ 0b0000000000000001000000000000000;
+const TransitionLane9: Lane = /*                        */ 0b0000000000000010000000000000000;
+const TransitionLane10: Lane = /*                       */ 0b0000000000000100000000000000000;
+const TransitionLane11: Lane = /*                       */ 0b0000000000001000000000000000000;
+const TransitionLane12: Lane = /*                       */ 0b0000000000010000000000000000000;
+const TransitionLane13: Lane = /*                       */ 0b0000000000100000000000000000000;
+const TransitionLane14: Lane = /*                       */ 0b0000000001000000000000000000000;
 
 const RetryLanes: Lanes = /*                            */ 0b0000011110000000000000000000000;
 const RetryLane1: Lane = /*                             */ 0b0000000010000000000000000000000;
@@ -175,6 +176,8 @@ function getHighestPriorityLanes(lanes: Lanes | Lane): Lanes {
       return DefaultHydrationLane;
     case DefaultLane:
       return DefaultLane;
+    case GestureLane:
+      return GestureLane;
     case TransitionHydrationLane:
       return TransitionHydrationLane;
     case TransitionLane1:
@@ -191,7 +194,6 @@ function getHighestPriorityLanes(lanes: Lanes | Lane): Lanes {
     case TransitionLane12:
     case TransitionLane13:
     case TransitionLane14:
-    case TransitionLane15:
       return lanes & TransitionLanes;
     case RetryLane1:
     case RetryLane2:
@@ -459,6 +461,7 @@ function computeExpirationTime(lane: Lane, currentTime: number) {
     case SyncLane:
     case InputContinuousHydrationLane:
     case InputContinuousLane:
+    case GestureLane:
       // User interactions should expire slightly more quickly.
       //
       // NOTE: This is set to the corresponding constant as in Scheduler.js.
@@ -486,7 +489,6 @@ function computeExpirationTime(lane: Lane, currentTime: number) {
     case TransitionLane12:
     case TransitionLane13:
     case TransitionLane14:
-    case TransitionLane15:
       return currentTime + transitionLaneExpirationMs;
     case RetryLane1:
     case RetryLane2:
@@ -640,7 +642,8 @@ export function includesBlockingLane(lanes: Lanes): boolean {
     InputContinuousHydrationLane |
     InputContinuousLane |
     DefaultHydrationLane |
-    DefaultLane;
+    DefaultLane |
+    GestureLane;
   return (lanes & SyncDefaultLanes) !== NoLanes;
 }
 
@@ -663,6 +666,11 @@ export function isTransitionLane(lane: Lane): boolean {
   return (lane & TransitionLanes) !== NoLanes;
 }
 
+export function isGestureRender(lanes: Lanes): boolean {
+  // This should render only the one lane.
+  return lanes === GestureLane;
+}
+
 export function claimNextTransitionLane(): Lane {
   // Cycle through the lanes, assigning each new transition to the next lane.
   // In most cases, this means every transition gets its own lane, until we
@@ -1053,7 +1061,6 @@ export function getBumpedLaneForHydrationByLane(lane: Lane): Lane {
     case TransitionLane12:
     case TransitionLane13:
     case TransitionLane14:
-    case TransitionLane15:
     case RetryLane1:
     case RetryLane2:
     case RetryLane3:
@@ -1197,7 +1204,8 @@ export function getGroupNameOfHighestPriorityLane(lanes: Lanes): string {
       InputContinuousHydrationLane |
       InputContinuousLane |
       DefaultHydrationLane |
-      DefaultLane)
+      DefaultLane |
+      GestureLane)
   ) {
     return 'Blocking';
   }
diff --git a/packages/react-reconciler/src/ReactFiberRoot.js b/packages/react-reconciler/src/ReactFiberRoot.js
index 4971bb4c2be34..03ddde7a5ab5b 100644
--- a/packages/react-reconciler/src/ReactFiberRoot.js
+++ b/packages/react-reconciler/src/ReactFiberRoot.js
@@ -33,6 +33,7 @@ import {
   enableUpdaterTracking,
   enableTransitionTracing,
   disableLegacyMode,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import {initializeUpdateQueue} from './ReactFiberClassUpdateQueue';
 import {LegacyRoot, ConcurrentRoot} from './ReactRootTags';
@@ -97,6 +98,10 @@ function FiberRootNode(
 
   this.formState = formState;
 
+  if (enableSwipeTransition) {
+    this.gestures = null;
+  }
+
   this.incompleteTransitions = new Map();
   if (enableTransitionTracing) {
     this.transitionCallbacks = null;
diff --git a/packages/react-reconciler/src/ReactFiberRootScheduler.js b/packages/react-reconciler/src/ReactFiberRootScheduler.js
index 41daa6b806065..293992e40618d 100644
--- a/packages/react-reconciler/src/ReactFiberRootScheduler.js
+++ b/packages/react-reconciler/src/ReactFiberRootScheduler.js
@@ -20,6 +20,7 @@ import {
   enableComponentPerformanceTrack,
   enableSiblingPrerendering,
   enableYieldingBeforePassive,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import {
   NoLane,
@@ -32,6 +33,7 @@ import {
   claimNextTransitionLane,
   getNextLanesToFlushSync,
   checkIfRootIsPrerendering,
+  isGestureRender,
 } from './ReactFiberLane';
 import {
   CommitContext,
@@ -211,7 +213,8 @@ function flushSyncWorkAcrossRoots_impl(
             rootHasPendingCommit,
           );
           if (
-            includesSyncLane(nextLanes) &&
+            (includesSyncLane(nextLanes) ||
+              (enableSwipeTransition && isGestureRender(nextLanes))) &&
             !checkIfRootIsPrerendering(root, nextLanes)
           ) {
             // This root has pending sync work. Flush it now.
@@ -296,7 +299,8 @@ function processRootScheduleInMicrotask() {
         syncTransitionLanes !== NoLanes ||
         // Common case: we're not treating any extra lanes as synchronous, so we
         // can just check if the next lanes are sync.
-        includesSyncLane(nextLanes)
+        includesSyncLane(nextLanes) ||
+        (enableSwipeTransition && isGestureRender(nextLanes))
       ) {
         mightHavePendingSyncWork = true;
       }
diff --git a/packages/react-reconciler/src/ReactFiberWorkLoop.js b/packages/react-reconciler/src/ReactFiberWorkLoop.js
index 5f17ca31b3693..b3d1e5371c06c 100644
--- a/packages/react-reconciler/src/ReactFiberWorkLoop.js
+++ b/packages/react-reconciler/src/ReactFiberWorkLoop.js
@@ -47,6 +47,7 @@ import {
   enableYieldingBeforePassive,
   enableThrottledScheduling,
   enableViewTransition,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import ReactSharedInternals from 'shared/ReactSharedInternals';
 import is from 'shared/objectIs';
@@ -184,6 +185,8 @@ import {
   claimNextTransitionLane,
   checkIfRootIsPrerendering,
   includesOnlyViewTransitionEligibleLanes,
+  isGestureRender,
+  GestureLane,
 } from './ReactFiberLane';
 import {
   DiscreteEventPriority,
@@ -338,6 +341,7 @@ import {
 import {getMaskedContext, getUnmaskedContext} from './ReactFiberContext';
 import {peekEntangledActionLane} from './ReactFiberAsyncAction';
 import {logUncaughtError} from './ReactFiberErrorLogger';
+import {deleteScheduledGesture} from './ReactFiberGestureScheduler';
 
 const PossiblyWeakMap = typeof WeakMap === 'function' ? WeakMap : Map;
 
@@ -3287,6 +3291,13 @@ function commitRoot(
   const concurrentlyUpdatedLanes = getConcurrentlyUpdatedLanes();
   remainingLanes = mergeLanes(remainingLanes, concurrentlyUpdatedLanes);
 
+  if (enableSwipeTransition && root.gestures === null) {
+    // Gestures don't clear their lanes while the gesture is still active but it
+    // might not be scheduled to do any more renders and so we shouldn't schedule
+    // any more gesture lane work until a new gesture is scheduled.
+    remainingLanes &= ~GestureLane;
+  }
+
   markRootFinished(
     root,
     lanes,
@@ -3310,6 +3321,21 @@ function commitRoot(
     // times out.
   }
 
+  if (enableSwipeTransition && isGestureRender(lanes)) {
+    // This is a special kind of render that doesn't commit regular effects.
+    commitGestureOnRoot(
+      root,
+      finishedWork,
+      recoverableErrors,
+      enableProfilerTimer
+        ? suspendedCommitReason === IMMEDIATE_COMMIT
+          ? completedRenderEndTime
+          : commitStartTime
+        : 0,
+    );
+    return;
+  }
+
   // workInProgressX might be overwritten, so we want
   // to store it in pendingPassiveX until they get processed
   // We need to pass this through as an argument to commitRoot
@@ -3802,6 +3828,24 @@ function flushSpawnedWork(): void {
   }
 }
 
+function commitGestureOnRoot(
+  root: FiberRoot,
+  finishedWork: null | Fiber,
+  recoverableErrors: null | Array<CapturedValue<mixed>>,
+  renderEndTime: number, // Profiling-only
+): void {
+  // We assume that the gesture we just rendered was the first one in the queue.
+  const finishedGesture = root.gestures;
+  if (finishedGesture === null) {
+    throw new Error(
+      'Finished rendering the gesture lane but there were no pending gestures. ' +
+        'React should not have started a render in this case. This is a bug in React.',
+    );
+  }
+  deleteScheduledGesture(root, finishedGesture);
+  // TODO: Run the gesture
+}
+
 function makeErrorInfo(componentStack: ?string) {
   const errorInfo = {
     componentStack,
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 98e7d4deefea3..3479eba1b9dd3 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -17,6 +17,7 @@ import type {
   Awaited,
   ReactComponentInfo,
   ReactDebugInfo,
+  StartGesture,
 } from 'shared/ReactTypes';
 import type {WorkTag} from './ReactWorkTags';
 import type {TypeOfMode} from './ReactTypeOfMode';
@@ -38,6 +39,7 @@ import type {
 import type {ConcurrentUpdate} from './ReactFiberConcurrentUpdates';
 import type {ComponentStackNode} from 'react-server/src/ReactFizzComponentStack';
 import type {ThenableState} from './ReactFiberThenable';
+import type {ScheduledGesture} from './ReactFiberGestureScheduler';
 
 // Unwind Circular: moved from ReactFiberHooks.old
 export type HookType =
@@ -60,7 +62,8 @@ export type HookType =
   | 'useCacheRefresh'
   | 'useOptimistic'
   | 'useFormState'
-  | 'useActionState';
+  | 'useActionState'
+  | 'useSwipeTransition';
 
 export type ContextDependency<T> = {
   context: ReactContext<T>,
@@ -279,6 +282,9 @@ type BaseFiberRootProperties = {
   ) => void,
 
   formState: ReactFormState<any, any> | null,
+
+  // enableSwipeTransition only
+  gestures: null | ScheduledGesture,
 };
 
 // The following attributes are only used by DevTools and are only present in DEV builds.
@@ -442,6 +448,12 @@ export type Dispatcher = {
     initialState: Awaited<S>,
     permalink?: string,
   ) => [Awaited<S>, (P) => void, boolean],
+  // TODO: Non-nullable once `enableSwipeTransition` is on everywhere.
+  useSwipeTransition?: <T>(
+    previous: T,
+    current: T,
+    next: T,
+  ) => [T, StartGesture],
 };
 
 export type AsyncDispatcher = {
diff --git a/packages/react-server/src/ReactFizzHooks.js b/packages/react-server/src/ReactFizzHooks.js
index a0ec1c7414982..8ae00568ae670 100644
--- a/packages/react-server/src/ReactFizzHooks.js
+++ b/packages/react-server/src/ReactFizzHooks.js
@@ -16,6 +16,7 @@ import type {
   Usable,
   ReactCustomFormAction,
   Awaited,
+  StartGesture,
 } from 'shared/ReactTypes';
 
 import type {ResumableState} from './ReactFizzConfig';
@@ -38,7 +39,10 @@ import {
 } from './ReactFizzConfig';
 import {createFastHash} from './ReactServerStreamConfig';
 
-import {enableUseEffectEventHook} from 'shared/ReactFeatureFlags';
+import {
+  enableUseEffectEventHook,
+  enableSwipeTransition,
+} from 'shared/ReactFeatureFlags';
 import is from 'shared/objectIs';
 import {
   REACT_CONTEXT_TYPE,
@@ -795,6 +799,19 @@ function useMemoCache(size: number): Array<mixed> {
   return data;
 }
 
+function unsupportedStartGesture() {
+  throw new Error('startGesture cannot be called during server rendering.');
+}
+
+function useSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  resolveCurrentlyRenderingComponent();
+  return [current, unsupportedStartGesture];
+}
+
 function noop(): void {}
 
 function clientHookNotSupported() {
@@ -837,25 +854,25 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
   : {
       readContext,
       use,
+      useCallback,
       useContext,
+      useEffect: clientHookNotSupported,
+      useImperativeHandle: clientHookNotSupported,
+      useInsertionEffect: clientHookNotSupported,
+      useLayoutEffect: clientHookNotSupported,
       useMemo,
       useReducer: clientHookNotSupported,
       useRef: clientHookNotSupported,
       useState: clientHookNotSupported,
-      useInsertionEffect: clientHookNotSupported,
-      useLayoutEffect: clientHookNotSupported,
-      useCallback,
-      useImperativeHandle: clientHookNotSupported,
-      useEffect: clientHookNotSupported,
       useDebugValue: noop,
       useDeferredValue: clientHookNotSupported,
       useTransition: clientHookNotSupported,
-      useId,
       useSyncExternalStore: clientHookNotSupported,
-      useOptimistic,
-      useActionState,
-      useFormState: useActionState,
+      useId,
       useHostTransitionStatus,
+      useFormState: useActionState,
+      useActionState,
+      useOptimistic,
       useMemoCache,
       useCacheRefresh,
     };
@@ -863,6 +880,11 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
 if (enableUseEffectEventHook) {
   HooksDispatcher.useEffectEvent = useEffectEvent;
 }
+if (enableSwipeTransition) {
+  HooksDispatcher.useSwipeTransition = supportsClientAPIs
+    ? useSwipeTransition
+    : clientHookNotSupported;
+}
 
 export let currentResumableState: null | ResumableState = (null: any);
 export function setCurrentResumableState(
diff --git a/packages/react-server/src/ReactFlightHooks.js b/packages/react-server/src/ReactFlightHooks.js
index d0351e38c86aa..f1d31f3e486eb 100644
--- a/packages/react-server/src/ReactFlightHooks.js
+++ b/packages/react-server/src/ReactFlightHooks.js
@@ -17,6 +17,10 @@ import {
 } from 'shared/ReactSymbols';
 import {createThenableState, trackUsedThenable} from './ReactFlightThenable';
 import {isClientReference} from './ReactFlightServerConfig';
+import {
+  enableUseEffectEventHook,
+  enableSwipeTransition,
+} from 'shared/ReactFeatureFlags';
 
 let currentRequest = null;
 let thenableIndexCounter = 0;
@@ -58,33 +62,32 @@ export function getThenableStateAfterSuspending(): ThenableState {
 }
 
 export const HooksDispatcher: Dispatcher = {
-  useMemo<T>(nextCreate: () => T): T {
-    return nextCreate();
-  },
+  readContext: (unsupportedContext: any),
+
+  use,
   useCallback<T>(callback: T): T {
     return callback;
   },
-  useDebugValue(): void {},
-  useDeferredValue: (unsupportedHook: any),
-  useTransition: (unsupportedHook: any),
-  readContext: (unsupportedContext: any),
   useContext: (unsupportedContext: any),
+  useEffect: (unsupportedHook: any),
+  useImperativeHandle: (unsupportedHook: any),
+  useLayoutEffect: (unsupportedHook: any),
+  useInsertionEffect: (unsupportedHook: any),
+  useMemo<T>(nextCreate: () => T): T {
+    return nextCreate();
+  },
   useReducer: (unsupportedHook: any),
   useRef: (unsupportedHook: any),
   useState: (unsupportedHook: any),
-  useInsertionEffect: (unsupportedHook: any),
-  useLayoutEffect: (unsupportedHook: any),
-  useImperativeHandle: (unsupportedHook: any),
-  useEffect: (unsupportedHook: any),
+  useDebugValue(): void {},
+  useDeferredValue: (unsupportedHook: any),
+  useTransition: (unsupportedHook: any),
+  useSyncExternalStore: (unsupportedHook: any),
   useId,
   useHostTransitionStatus: (unsupportedHook: any),
-  useOptimistic: (unsupportedHook: any),
   useFormState: (unsupportedHook: any),
   useActionState: (unsupportedHook: any),
-  useSyncExternalStore: (unsupportedHook: any),
-  useCacheRefresh(): <T>(?() => T, ?T) => void {
-    return unsupportedRefresh;
-  },
+  useOptimistic: (unsupportedHook: any),
   useMemoCache(size: number): Array<any> {
     const data = new Array<any>(size);
     for (let i = 0; i < size; i++) {
@@ -92,8 +95,16 @@ export const HooksDispatcher: Dispatcher = {
     }
     return data;
   },
-  use,
+  useCacheRefresh(): <T>(?() => T, ?T) => void {
+    return unsupportedRefresh;
+  },
 };
+if (enableUseEffectEventHook) {
+  HooksDispatcher.useEffectEvent = (unsupportedHook: any);
+}
+if (enableSwipeTransition) {
+  HooksDispatcher.useSwipeTransition = (unsupportedHook: any);
+}
 
 function unsupportedHook(): void {
   throw new Error('This Hook is not supported in Server Components.');
diff --git a/packages/react/index.experimental.development.js b/packages/react/index.experimental.development.js
index 6074b683b781d..e8ebc236133b0 100644
--- a/packages/react/index.experimental.development.js
+++ b/packages/react/index.experimental.development.js
@@ -33,6 +33,7 @@ export {
   unstable_getCacheForType,
   unstable_SuspenseList,
   unstable_ViewTransition,
+  unstable_useSwipeTransition,
   unstable_addTransitionType,
   unstable_useCacheRefresh,
   useId,
diff --git a/packages/react/index.experimental.js b/packages/react/index.experimental.js
index 77cf6bd0e0317..a3c6f4a10f090 100644
--- a/packages/react/index.experimental.js
+++ b/packages/react/index.experimental.js
@@ -33,6 +33,7 @@ export {
   unstable_getCacheForType,
   unstable_SuspenseList,
   unstable_ViewTransition,
+  unstable_useSwipeTransition,
   unstable_addTransitionType,
   unstable_useCacheRefresh,
   useId,
diff --git a/packages/react/src/ReactClient.js b/packages/react/src/ReactClient.js
index 715ea8ab47c35..33175a9a77f35 100644
--- a/packages/react/src/ReactClient.js
+++ b/packages/react/src/ReactClient.js
@@ -57,6 +57,7 @@ import {
   use,
   useOptimistic,
   useActionState,
+  useSwipeTransition,
 } from './ReactHooks';
 import ReactSharedInternals from './ReactSharedInternalsClient';
 import {startTransition} from './ReactStartTransition';
@@ -126,7 +127,10 @@ export {
   // enableViewTransition
   REACT_VIEW_TRANSITION_TYPE as unstable_ViewTransition,
   addTransitionType as unstable_addTransitionType,
+  // enableSwipeTransition
+  useSwipeTransition as unstable_useSwipeTransition,
+  // DEV-only
   useId,
-  act, // DEV-only
-  captureOwnerStack, // DEV-only
+  act,
+  captureOwnerStack,
 };
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index ba6b0ffbcb71e..605337480f731 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -13,12 +13,16 @@ import type {
   StartTransitionOptions,
   Usable,
   Awaited,
+  StartGesture,
 } from 'shared/ReactTypes';
 import {REACT_CONSUMER_TYPE} from 'shared/ReactSymbols';
 
 import ReactSharedInternals from 'shared/ReactSharedInternals';
 
-import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
+import {
+  enableUseEffectCRUDOverload,
+  enableSwipeTransition,
+} from 'shared/ReactFeatureFlags';
 
 type BasicStateAction<S> = (S => S) | S;
 type Dispatch<A> = A => void;
@@ -261,3 +265,16 @@ export function useActionState<S, P>(
   const dispatcher = resolveDispatcher();
   return dispatcher.useActionState(action, initialState, permalink);
 }
+
+export function useSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  if (!enableSwipeTransition) {
+    throw new Error('Not implemented.');
+  }
+  const dispatcher = resolveDispatcher();
+  // $FlowFixMe[not-a-function] This is unstable, thus optional
+  return dispatcher.useSwipeTransition(previous, current, next);
+}
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index 844b2a2f6a914..ea09d0a3c76e3 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -92,6 +92,8 @@ export const enableHalt = __EXPERIMENTAL__;
 
 export const enableViewTransition = __EXPERIMENTAL__;
 
+export const enableSwipeTransition = __EXPERIMENTAL__;
+
 /**
  * Switches Fiber creation to a simple object instead of a constructor.
  */
diff --git a/packages/shared/ReactTypes.js b/packages/shared/ReactTypes.js
index 735f96a36f509..0402f9aac1832 100644
--- a/packages/shared/ReactTypes.js
+++ b/packages/shared/ReactTypes.js
@@ -168,6 +168,12 @@ export type ReactFormState<S, ReferenceId> = [
   number /* number of bound arguments */,
 ];
 
+// Intrinsic GestureProvider. This type varies by Environment whether a particular
+// renderer supports it.
+export type GestureProvider = AnimationTimeline; // TODO: More provider types.
+
+export type StartGesture = (gestureProvider: GestureProvider) => () => void;
+
 export type Awaited<T> = T extends null | void
   ? T // special case for `null | undefined` when not in `--strictNullChecks` mode
   : T extends Object // `await` only unwraps object types with a callable then. Non-object types are not unwrapped.
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 2eff113ae42f1..470e148959327 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -82,6 +82,7 @@ export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index bcd8b375eca67..361ebde4136ce 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -71,6 +71,7 @@ export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index ef3c300602bdb..5945416050286 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -70,6 +70,7 @@ export const enableYieldingBeforePassive = true;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableFastAddPropertiesInDiffing = true;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index 743ba39a86792..18172fdfe5724 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -67,6 +67,7 @@ export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 26747d3fb69a9..628a834133f2f 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -82,6 +82,7 @@ export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index 8da74c54bd69e..5932c6eddf6f1 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -112,5 +112,7 @@ export const enableShallowPropDiffing = false;
 
 export const enableLazyPublicInstanceInFabric = false;
 
+export const enableSwipeTransition = false;
+
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/scripts/error-codes/codes.json b/scripts/error-codes/codes.json
index 6ab654f1d35e5..f001b660bd2aa 100644
--- a/scripts/error-codes/codes.json
+++ b/scripts/error-codes/codes.json
@@ -531,5 +531,7 @@
   "543": "Expected a ResourceEffectUpdate to be pushed together with ResourceEffectIdentity. This is a bug in React.",
   "544": "Found a pair with an auto name. This is a bug in React.",
   "545": "The %s tag may only be rendered once.",
-  "546": "useEffect CRUD overload is not enabled in this build of React."
+  "546": "useEffect CRUD overload is not enabled in this build of React.",
+  "547": "startGesture cannot be called during server rendering.",
+  "548": "Finished rendering the gesture lane but there were no pending gestures. React should not have started a render in this case. This is a bug in React."
 }

From e670e72fa076449e40172e20d17cc67c1c15419c Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Dawid=20Ma=C5=82ecki?= <dawid.malecki21@gmail.com>
Date: Fri, 14 Feb 2025 15:10:37 +0100
Subject: [PATCH 29/73] Change TouchedViewDataAtPoint type in ReactNativeTypes
 to use supported by Flow tooling syntax (#32382)

## Summary

The `flow-api-translator` from the `hermes` repo does not support flow
type spreads. It is currently not able to digest the ReactNativeTypes
file as it contains unsupported syntax. The simplest solution is to
change the type of the `TouchedViewDataAtPoint` to equivalent, yet
supported by the Flow tooling. In this case the intersection can be used
as
the `TouchedViewDataAtPoint` and `InspectorData` have no common
property.

## How did you test this change?

Run yarn flow native
---
 .../src/ReactNativeTypes.js                   | 25 ++++++++++---------
 1 file changed, 13 insertions(+), 12 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 8bce919d385e9..261e1f0b63104 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -164,18 +164,19 @@ export type InspectorData = $ReadOnly<{
   componentStack: string,
 }>;
 
-export type TouchedViewDataAtPoint = $ReadOnly<{
-  pointerY: number,
-  touchedViewTag?: number,
-  frame: $ReadOnly<{
-    top: number,
-    left: number,
-    width: number,
-    height: number,
-  }>,
-  closestPublicInstance?: PublicInstance,
-  ...InspectorData,
-}>;
+export type TouchedViewDataAtPoint = $ReadOnly<
+  {
+    pointerY: number,
+    touchedViewTag?: number,
+    frame: $ReadOnly<{
+      top: number,
+      left: number,
+      width: number,
+      height: number,
+    }>,
+    closestPublicInstance?: PublicInstance,
+  } & InspectorData,
+>;
 
 export type RenderRootOptions = {
   onUncaughtError?: (

From 0d9834caeb3b334eaa1be45f136499f51303e7d3 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 09:38:13 -0600
Subject: [PATCH 30/73] build: add support to the rollup build for building
 typescript packages (#32393)

---
 babel.config-ts.js                            |  15 +
 package.json                                  |   5 +-
 .../__tests__/ReactTypeScriptClass-test.ts    |   4 +-
 scripts/jest/config.base.js                   |   6 +-
 scripts/rollup/build.js                       |  45 +-
 scripts/rollup/bundles.js                     |   7 +
 scripts/rollup/packaging.js                   |   4 +
 scripts/rollup/wrappers.js                    |  36 ++
 yarn.lock                                     | 488 +++++++++++++-----
 9 files changed, 459 insertions(+), 151 deletions(-)
 create mode 100644 babel.config-ts.js

diff --git a/babel.config-ts.js b/babel.config-ts.js
new file mode 100644
index 0000000000000..20b35ec013e0f
--- /dev/null
+++ b/babel.config-ts.js
@@ -0,0 +1,15 @@
+/**
+ * This file is purely being used for local jest runs, and doesn't participate in the build process.
+ */
+'use strict';
+
+module.exports = {
+  plugins: [
+    '@babel/plugin-syntax-jsx',
+    '@babel/plugin-transform-flow-strip-types',
+  ],
+  presets: [
+    ['@babel/preset-env', {targets: {node: 'current'}}],
+    '@babel/preset-typescript',
+  ],
+};
diff --git a/package.json b/package.json
index cffd0ba28b493..95fffa700a7e7 100644
--- a/package.json
+++ b/package.json
@@ -35,11 +35,13 @@
     "@babel/plugin-transform-template-literals": "^7.10.5",
     "@babel/preset-flow": "^7.10.4",
     "@babel/preset-react": "^7.23.3",
+    "@babel/preset-typescript": "^7.26.0",
     "@babel/traverse": "^7.11.0",
     "@rollup/plugin-babel": "^6.0.3",
     "@rollup/plugin-commonjs": "^24.0.1",
     "@rollup/plugin-node-resolve": "^15.0.1",
     "@rollup/plugin-replace": "^5.0.2",
+    "@rollup/plugin-typescript": "^12.1.2",
     "abortcontroller-polyfill": "^1.7.5",
     "art": "0.10.1",
     "babel-plugin-syntax-trailing-function-commas": "^6.5.0",
@@ -90,6 +92,7 @@
     "react-lifecycles-compat": "^3.0.4",
     "rimraf": "^3.0.0",
     "rollup": "^3.29.5",
+    "rollup-plugin-dts": "^6.1.1",
     "rollup-plugin-prettier": "^4.1.1",
     "rollup-plugin-strip-banner": "^3.0.0",
     "semver": "^7.1.1",
@@ -98,7 +101,7 @@
     "targz": "^1.0.1",
     "through2": "^3.0.1",
     "tmp": "^0.1.0",
-    "typescript": "^3.7.5",
+    "typescript": "^5.4.3",
     "undici": "^5.28.4",
     "web-streams-polyfill": "^3.1.1",
     "yargs": "^15.3.1"
diff --git a/packages/react/src/__tests__/ReactTypeScriptClass-test.ts b/packages/react/src/__tests__/ReactTypeScriptClass-test.ts
index 5f51cc6f38c77..603edb86ea495 100644
--- a/packages/react/src/__tests__/ReactTypeScriptClass-test.ts
+++ b/packages/react/src/__tests__/ReactTypeScriptClass-test.ts
@@ -529,7 +529,7 @@ describe('ReactTypeScriptClass', function () {
         'StateBasedOnContext uses the legacy contextTypes API which will soon be removed. ' +
           'Use React.createContext() with static contextType instead. (https://react.dev/link/legacy-context)\n' +
           (ReactFeatureFlags.enableOwnerStacks
-            ? '    in ProvideChildContextTypes.Object.<anonymous>.ProvideChildContextTypes (at **)'
+            ? '    in ProvideChildContextTypes.createElement (at **)'
             : '    in StateBasedOnContext (at **)\n') +
           '    in ProvideChildContextTypes (at **)',
       ]);
@@ -725,7 +725,7 @@ describe('ReactTypeScriptClass', function () {
         'ReadContext uses the legacy contextTypes API which will soon be removed. ' +
           'Use React.createContext() with static contextType instead. (https://react.dev/link/legacy-context)\n' +
           (ReactFeatureFlags.enableOwnerStacks
-            ? '    in ProvideContext.Object.<anonymous>.ProvideContext (at **)'
+            ? '    in ProvideContext.createElement (at **)'
             : '    in ReadContext (at **)\n') +
           '    in ProvideContext (at **)',
       ]);
diff --git a/scripts/jest/config.base.js b/scripts/jest/config.base.js
index 6fa4a3619429f..262c6ab18a144 100644
--- a/scripts/jest/config.base.js
+++ b/scripts/jest/config.base.js
@@ -7,7 +7,11 @@ module.exports = {
     '<rootDir>/scripts/bench/',
   ],
   transform: {
-    '.*': require.resolve('./preprocessor.js'),
+    '^.+\\.ts$': [
+      'babel-jest',
+      {configFile: require.resolve('../../babel.config-ts.js')},
+    ],
+    '.(?!ts$)': require.resolve('./preprocessor.js'),
   },
   prettierPath: require.resolve('prettier-2'),
   setupFiles: [require.resolve('./setupEnvironment.js')],
diff --git a/scripts/rollup/build.js b/scripts/rollup/build.js
index 547362dae7123..53b308d16a2d8 100644
--- a/scripts/rollup/build.js
+++ b/scripts/rollup/build.js
@@ -4,8 +4,10 @@ const rollup = require('rollup');
 const babel = require('@rollup/plugin-babel').babel;
 const closure = require('./plugins/closure-plugin');
 const flowRemoveTypes = require('flow-remove-types');
+const {dts} = require('rollup-plugin-dts');
 const prettier = require('rollup-plugin-prettier');
 const replace = require('@rollup/plugin-replace');
+const typescript = require('@rollup/plugin-typescript');
 const stripBanner = require('rollup-plugin-strip-banner');
 const chalk = require('chalk');
 const resolve = require('@rollup/plugin-node-resolve').nodeResolve;
@@ -61,6 +63,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = Bundles.bundleTypes;
 
 const {getFilename} = Bundles;
@@ -250,9 +254,11 @@ function getFormat(bundleType) {
     case RN_FB_DEV:
     case RN_FB_PROD:
     case RN_FB_PROFILING:
+    case CJS_DTS:
       return `cjs`;
     case ESM_DEV:
     case ESM_PROD:
+    case ESM_DTS:
       return `es`;
     case BROWSER_SCRIPT:
       return `iife`;
@@ -281,6 +287,8 @@ function isProductionBundleType(bundleType) {
     case RN_FB_PROD:
     case RN_FB_PROFILING:
     case BROWSER_SCRIPT:
+    case CJS_DTS:
+    case ESM_DTS:
       return true;
     default:
       throw new Error(`Unknown type: ${bundleType}`);
@@ -303,6 +311,8 @@ function isProfilingBundleType(bundleType) {
     case ESM_DEV:
     case ESM_PROD:
     case BROWSER_SCRIPT:
+    case CJS_DTS:
+    case ESM_DTS:
       return false;
     case FB_WWW_PROFILING:
     case NODE_PROFILING:
@@ -368,27 +378,36 @@ function getPlugins(
   pureExternalModules,
   bundle
 ) {
+  // Short-circuit if we're only building a .d.ts bundle
+  if (bundleType === CJS_DTS || bundleType === ESM_DTS) {
+    return [dts({tsconfig: bundle.tsconfig})];
+  }
   try {
     const forks = Modules.getForks(bundleType, entry, moduleType, bundle);
     const isProduction = isProductionBundleType(bundleType);
     const isProfiling = isProfilingBundleType(bundleType);
 
     const needsMinifiedByClosure =
-      bundleType !== ESM_PROD && bundleType !== ESM_DEV;
+      bundleType !== ESM_PROD &&
+      bundleType !== ESM_DEV &&
+      // TODO(@poteto) figure out ICE in closure compiler for eslint-plugin-react-hooks (ts)
+      bundle.tsconfig == null;
 
     return [
       // Keep dynamic imports as externals
       dynamicImports(),
-      {
-        name: 'rollup-plugin-flow-remove-types',
-        transform(code) {
-          const transformed = flowRemoveTypes(code);
-          return {
-            code: transformed.toString(),
-            map: null,
-          };
-        },
-      },
+      bundle.tsconfig != null
+        ? typescript({tsconfig: bundle.tsconfig})
+        : {
+            name: 'rollup-plugin-flow-remove-types',
+            transform(code) {
+              const transformed = flowRemoveTypes(code);
+              return {
+                code: transformed.toString(),
+                map: null,
+              };
+            },
+          },
       // Shim any modules that need forking in this environment.
       useForks(forks),
       // Ensure we don't try to bundle any fbjs modules.
@@ -839,7 +858,9 @@ async function buildEverything() {
       [bundle, RN_FB_DEV],
       [bundle, RN_FB_PROD],
       [bundle, RN_FB_PROFILING],
-      [bundle, BROWSER_SCRIPT]
+      [bundle, BROWSER_SCRIPT],
+      [bundle, CJS_DTS],
+      [bundle, ESM_DTS]
     );
   }
 
diff --git a/scripts/rollup/bundles.js b/scripts/rollup/bundles.js
index 04bfb1a0e5479..c66cff82c5ac2 100644
--- a/scripts/rollup/bundles.js
+++ b/scripts/rollup/bundles.js
@@ -26,6 +26,8 @@ const bundleTypes = {
   RN_FB_PROD: 'RN_FB_PROD',
   RN_FB_PROFILING: 'RN_FB_PROFILING',
   BROWSER_SCRIPT: 'BROWSER_SCRIPT',
+  CJS_DTS: 'CJS_DTS',
+  ESM_DTS: 'ESM_DTS',
 };
 
 const {
@@ -47,6 +49,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = bundleTypes;
 
 const moduleTypes = {
@@ -1270,6 +1274,9 @@ function getFilename(bundle, bundleType) {
       return `${globalName}-profiling.js`;
     case BROWSER_SCRIPT:
       return `${name}.js`;
+    case CJS_DTS:
+    case ESM_DTS:
+      return `${name}.d.ts`;
   }
 }
 
diff --git a/scripts/rollup/packaging.js b/scripts/rollup/packaging.js
index bc83cb8789eb8..564c40f71b922 100644
--- a/scripts/rollup/packaging.js
+++ b/scripts/rollup/packaging.js
@@ -34,6 +34,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = Bundles.bundleTypes;
 
 function getPackageName(name) {
@@ -49,6 +51,7 @@ function getBundleOutputPath(bundle, bundleType, filename, packageName) {
       return `build/node_modules/${packageName}/cjs/${filename}`;
     case ESM_DEV:
     case ESM_PROD:
+    case ESM_DTS:
       return `build/node_modules/${packageName}/esm/${filename}`;
     case BUN_DEV:
     case BUN_PROD:
@@ -56,6 +59,7 @@ function getBundleOutputPath(bundle, bundleType, filename, packageName) {
     case NODE_DEV:
     case NODE_PROD:
     case NODE_PROFILING:
+    case CJS_DTS:
       return `build/node_modules/${packageName}/cjs/${filename}`;
     case FB_WWW_DEV:
     case FB_WWW_PROD:
diff --git a/scripts/rollup/wrappers.js b/scripts/rollup/wrappers.js
index e01ca30a6d054..1773253cc9653 100644
--- a/scripts/rollup/wrappers.js
+++ b/scripts/rollup/wrappers.js
@@ -21,6 +21,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = bundleTypes;
 
 const {RECONCILER} = moduleTypes;
@@ -248,6 +250,16 @@ ${source}
   Object.defineProperty(module.exports, "__esModule", { value: true });
   `;
   },
+
+  /***************** CJS_DTS *****************/
+  [CJS_DTS](source, globalName, filename, moduleType) {
+    return source;
+  },
+
+  /***************** ESM_DTS *****************/
+  [ESM_DTS](source, globalName, filename, moduleType) {
+    return source;
+  },
 };
 
 const licenseHeaderWrappers = {
@@ -464,6 +476,30 @@ ${license}
  * @preventMunge
  */
 
+${source}`;
+  },
+
+  /***************** CJS_DTS *****************/
+  [CJS_DTS](source, globalName, filename, moduleType) {
+    return `/**
+ * @license React
+ * ${filename}
+ *
+${license}
+ */
+
+${source}`;
+  },
+
+  /***************** ESM_DTS *****************/
+  [ESM_DTS](source, globalName, filename, moduleType) {
+    return `/**
+ * @license React
+ * ${filename}
+ *
+${license}
+ */
+
 ${source}`;
   },
 };
diff --git a/yarn.lock b/yarn.lock
index 4922028dafc3b..44d590625111c 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -68,6 +68,15 @@
     "@babel/highlight" "^7.24.7"
     picocolors "^1.0.0"
 
+"@babel/code-frame@^7.26.2":
+  version "7.26.2"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.26.2.tgz#4b5fab97d33338eff916235055f0ebc21e573a85"
+  integrity sha512-RJlIHRueQgwWitWgF8OdFYGZX328Ax5BCemNGlqHfplnRT9ESi8JkFlvaVYbS+UubVY6dpv87Fs2u5M29iNFVQ==
+  dependencies:
+    "@babel/helper-validator-identifier" "^7.25.9"
+    js-tokens "^4.0.0"
+    picocolors "^1.0.0"
+
 "@babel/code-frame@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.8.3.tgz#33e25903d7481181534e12ec0a25f16b6fcf419e"
@@ -225,6 +234,17 @@
     "@jridgewell/trace-mapping" "^0.3.25"
     jsesc "^2.5.1"
 
+"@babel/generator@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.26.9.tgz#75a9482ad3d0cc7188a537aa4910bc59db67cbca"
+  integrity sha512-kEWdzjOAUMW4hAyrzJ0ZaTOu9OmpyDIQicIh0zg0EEcEkYXZb2TjtBhnHi2ViX7PKwZqF4xwqfAm299/QMP3lg==
+  dependencies:
+    "@babel/parser" "^7.26.9"
+    "@babel/types" "^7.26.9"
+    "@jridgewell/gen-mapping" "^0.3.5"
+    "@jridgewell/trace-mapping" "^0.3.25"
+    jsesc "^3.0.2"
+
 "@babel/generator@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.8.3.tgz#0e22c005b0a94c1c74eafe19ef78ce53a4d45c03"
@@ -263,6 +283,13 @@
   dependencies:
     "@babel/types" "^7.22.5"
 
+"@babel/helper-annotate-as-pure@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.25.9.tgz#d8eac4d2dc0d7b6e11fa6e535332e0d3184f06b4"
+  integrity sha512-gv7320KBUFJz1RnylIg5WWYPRXKZ884AGkYpgpWW02TH66Dl+HaC1t1CKd0z3R4b6hdYEcmrNZHUmfCP+1u3/g==
+  dependencies:
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-builder-binary-assignment-operator-visitor@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.10.4.tgz#bb0b75f31bf98cbf9ff143c1ae578b87274ae1a3"
@@ -369,6 +396,19 @@
     "@babel/helper-skip-transparent-expression-wrappers" "^7.20.0"
     "@babel/helper-split-export-declaration" "^7.18.6"
 
+"@babel/helper-create-class-features-plugin@^7.25.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-create-class-features-plugin/-/helper-create-class-features-plugin-7.26.9.tgz#d6f83e3039547fbb39967e78043cd3c8b7820c71"
+  integrity sha512-ubbUqCofvxPRurw5L8WTsCLSkQiVpov4Qx0WMA+jUN+nXBK8ADPlJO1grkFw5CWKC5+sZSOfuGMdX1aI1iT9Sg==
+  dependencies:
+    "@babel/helper-annotate-as-pure" "^7.25.9"
+    "@babel/helper-member-expression-to-functions" "^7.25.9"
+    "@babel/helper-optimise-call-expression" "^7.25.9"
+    "@babel/helper-replace-supers" "^7.26.5"
+    "@babel/helper-skip-transparent-expression-wrappers" "^7.25.9"
+    "@babel/traverse" "^7.26.9"
+    semver "^6.3.1"
+
 "@babel/helper-create-regexp-features-plugin@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-create-regexp-features-plugin/-/helper-create-regexp-features-plugin-7.10.4.tgz#fdd60d88524659a0b6959c0579925e425714f3b8"
@@ -506,6 +546,14 @@
   dependencies:
     "@babel/types" "^7.20.7"
 
+"@babel/helper-member-expression-to-functions@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.25.9.tgz#9dfffe46f727005a5ea29051ac835fb735e4c1a3"
+  integrity sha512-wbfdZ9w5vk0C0oyHqAJbc62+vet5prjj01jjJ8sKn3j9h3MQQlflEdXYvuqRWjHnM12coDEqiC1IRCi0U/EKwQ==
+  dependencies:
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-module-imports@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.10.4.tgz#4c5c54be04bd31670a7382797d75b9fa2e5b5620"
@@ -534,6 +582,14 @@
   dependencies:
     "@babel/types" "^7.22.15"
 
+"@babel/helper-module-imports@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.25.9.tgz#e7f8d20602ebdbf9ebbea0a0751fb0f2a4141715"
+  integrity sha512-tnUA4RsrmflIM6W6RFTLFSXITtl0wKjgpnLgXyowocVPrbYrLUXSBXDgTs8BlbmIzIdlBySRQjINYs2BAkiLtw==
+  dependencies:
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-module-transforms@^7.10.4", "@babel/helper-module-transforms@^7.10.5", "@babel/helper-module-transforms@^7.11.0":
   version "7.11.0"
   resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.11.0.tgz#b16f250229e47211abdd84b34b64737c2ab2d359"
@@ -572,6 +628,15 @@
     "@babel/helper-split-export-declaration" "^7.24.5"
     "@babel/helper-validator-identifier" "^7.24.5"
 
+"@babel/helper-module-transforms@^7.26.0":
+  version "7.26.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.26.0.tgz#8ce54ec9d592695e58d84cd884b7b5c6a2fdeeae"
+  integrity sha512-xO+xu6B5K2czEnQye6BHA7DolFFmS3LB7stHZFaOLb1pAwO1HWLS8fXA+eh0A2yIvltPVmx3eNNDBJA2SLHXFw==
+  dependencies:
+    "@babel/helper-module-imports" "^7.25.9"
+    "@babel/helper-validator-identifier" "^7.25.9"
+    "@babel/traverse" "^7.25.9"
+
 "@babel/helper-optimise-call-expression@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.10.4.tgz#50dc96413d594f995a77905905b05893cd779673"
@@ -593,6 +658,13 @@
   dependencies:
     "@babel/types" "^7.18.6"
 
+"@babel/helper-optimise-call-expression@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.25.9.tgz#3324ae50bae7e2ab3c33f60c9a877b6a0146b54e"
+  integrity sha512-FIpuNaz5ow8VyrYcnXQTDRGvV6tTjkNtCK/RYNDXGSLlUD6cBuQTSw43CShGxjvfBTfcUA/r6UhUCbtYqkhcuQ==
+  dependencies:
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-plugin-utils@^7.0.0", "@babel/helper-plugin-utils@^7.10.4", "@babel/helper-plugin-utils@^7.12.13", "@babel/helper-plugin-utils@^7.14.5", "@babel/helper-plugin-utils@^7.18.6", "@babel/helper-plugin-utils@^7.19.0", "@babel/helper-plugin-utils@^7.24.0", "@babel/helper-plugin-utils@^7.8.0":
   version "7.24.5"
   resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.24.5.tgz#a924607dd254a65695e5bd209b98b902b3b2f11a"
@@ -608,6 +680,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.22.5.tgz#dd7ee3735e8a313b9f7b05a773d892e88e6d7295"
   integrity sha512-uLls06UVKgFG9QD4OeFYLEGteMIAa5kpTPcFL28yuCIIzsf6ZyKZMllKVOCZFhiZ5ptnwX4mtKdWCBE/uT4amg==
 
+"@babel/helper-plugin-utils@^7.25.9", "@babel/helper-plugin-utils@^7.26.5":
+  version "7.26.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.26.5.tgz#18580d00c9934117ad719392c4f6585c9333cc35"
+  integrity sha512-RS+jZcRdZdRFzMyr+wcsaqOmld1/EqTghfaBGQQd/WnRdzdlvSZ//kF7U8VQTxf1ynZ4cjUcYgjVGx13ewNPMg==
+
 "@babel/helper-plugin-utils@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.8.3.tgz#9ea293be19babc0f52ff8ca88b34c3611b208670"
@@ -663,6 +740,15 @@
     "@babel/traverse" "^7.20.7"
     "@babel/types" "^7.20.7"
 
+"@babel/helper-replace-supers@^7.26.5":
+  version "7.26.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-replace-supers/-/helper-replace-supers-7.26.5.tgz#6cb04e82ae291dae8e72335dfe438b0725f14c8d"
+  integrity sha512-bJ6iIVdYX1YooY2X7w1q6VITt+LnUILtNk7zT78ykuwStx8BauCzxvFqFaHjOpW1bVnSUM1PN1f0p5P21wHxvg==
+  dependencies:
+    "@babel/helper-member-expression-to-functions" "^7.25.9"
+    "@babel/helper-optimise-call-expression" "^7.25.9"
+    "@babel/traverse" "^7.26.5"
+
 "@babel/helper-simple-access@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-simple-access/-/helper-simple-access-7.10.4.tgz#0f5ccda2945277a2a7a2d3a821e15395edcf3461"
@@ -706,6 +792,14 @@
   dependencies:
     "@babel/types" "^7.20.0"
 
+"@babel/helper-skip-transparent-expression-wrappers@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.25.9.tgz#0b2e1b62d560d6b1954893fd2b705dc17c91f0c9"
+  integrity sha512-K4Du3BFa3gvyhzgPcntrkDgZzQaq6uozzcpGbOO1OEJaI+EJdqWIMTLgFgQf6lrfiDFo5FU+BxKepI9RmZqahA==
+  dependencies:
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-split-export-declaration@^7.10.4", "@babel/helper-split-export-declaration@^7.11.0":
   version "7.11.0"
   resolved "https://registry.yarnpkg.com/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz#f8a491244acf6a676158ac42072911ba83ad099f"
@@ -744,6 +838,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-string-parser/-/helper-string-parser-7.23.4.tgz#9478c707febcbbe1ddb38a3d91a2e054ae622d83"
   integrity sha512-803gmbQdqwdf4olxrX4AJyFBV/RTr3rSmOj0rKwesmzlfhYNDEs+/iOcznzpNWlJlIlTJC2QfPFcHB6DlzdVLQ==
 
+"@babel/helper-string-parser@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-string-parser/-/helper-string-parser-7.25.9.tgz#1aabb72ee72ed35789b4bbcad3ca2862ce614e8c"
+  integrity sha512-4A/SCr/2KLd5jrtOMFzaKjVtAei3+2r/NChoBNoZ3EyP/+GlhoaEGoWOZUmFmoITP7zOJyHIMm+DYRd8o3PvHA==
+
 "@babel/helper-validator-identifier@^7.10.4":
   version "7.14.0"
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.14.0.tgz#d26cad8a47c65286b15df1547319a5d0bcf27288"
@@ -769,6 +868,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.24.7.tgz#75b889cfaf9e35c2aaf42cf0d72c8e91719251db"
   integrity sha512-rR+PBcQ1SMQDDyF6X0wxtG8QyLCgUB0eRAGguqRLfkCA87l7yAP7ehq8SNj96OOGTO8OBV70KhuFYcIkHXOg0w==
 
+"@babel/helper-validator-identifier@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz#24b64e2c3ec7cd3b3c547729b8d16871f22cbdc7"
+  integrity sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==
+
 "@babel/helper-validator-option@^7.14.5":
   version "7.14.5"
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.14.5.tgz#6e72a1fff18d5dfcb878e1e62f1a021c4b72d5a3"
@@ -779,6 +883,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.23.5.tgz#907a3fbd4523426285365d1206c423c4c5520307"
   integrity sha512-85ttAOMLsr53VgXkTbkx8oA6YTfT4q7/HzXSLEYmjcSTJPMPQtvq1BD79Byep5xMUYbGRzEpDsjUf3dyp54IKw==
 
+"@babel/helper-validator-option@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.25.9.tgz#86e45bd8a49ab7e03f276577f96179653d41da72"
+  integrity sha512-e/zv1co8pp55dNdEcCynfj9X7nyUKUXoUEwfXqaZt0omVOmDe9oOTdKStH4GmAw6zxMFs50ZayuMfHDKlO7Tfw==
+
 "@babel/helper-wrap-function@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-wrap-function/-/helper-wrap-function-7.10.4.tgz#8a6f701eab0ff39f765b5a1cfef409990e624b87"
@@ -905,6 +1014,13 @@
   resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.16.4.tgz#d5f92f57cf2c74ffe9b37981c0e72fee7311372e"
   integrity sha512-6V0qdPUaiVHH3RtZeLIsc+6pDhbYzHR8ogA8w+f+Wc77DuXto19g2QUwveINoS34Uw+W8/hQDGJCx+i4n7xcng==
 
+"@babel/parser@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.26.9.tgz#d9e78bee6dc80f9efd8f2349dcfbbcdace280fd5"
+  integrity sha512-81NWa1njQblgZbQHxWHpxxCzNsa3ZwvFqpUg7P+NNUU6f3UU2jBEg4OlF/J6rl8+PQGh1q6/zWScd001YwcA5A==
+  dependencies:
+    "@babel/types" "^7.26.9"
+
 "@babel/plugin-external-helpers@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/plugin-external-helpers/-/plugin-external-helpers-7.10.4.tgz#40d38e8e48a1fa3766ab43496253266ca26783ce"
@@ -1197,6 +1313,13 @@
   dependencies:
     "@babel/helper-plugin-utils" "^7.22.5"
 
+"@babel/plugin-syntax-jsx@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.25.9.tgz#a34313a178ea56f1951599b929c1ceacee719290"
+  integrity sha512-ld6oezHQMZsZfp6pWtbjaNDF2tiiCYYDqQszHt5VV437lewP9aSi2Of99CK0D0XB21k7FLgnLcmQKyKzynfeAA==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.25.9"
+
 "@babel/plugin-syntax-jsx@^7.7.2":
   version "7.24.1"
   resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.24.1.tgz#3f6ca04b8c841811dbc3c5c5f837934e0d626c10"
@@ -1281,6 +1404,13 @@
   dependencies:
     "@babel/helper-plugin-utils" "^7.14.5"
 
+"@babel/plugin-syntax-typescript@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.25.9.tgz#67dda2b74da43727cf21d46cf9afef23f4365399"
+  integrity sha512-hjMgRy5hb8uJJjUcdWunWVcoi9bGpJp8p5Ol1229PoN6aytsLwNMgmdftO23wnCLMfVmTwZDWMPNq/D1SY60JQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.25.9"
+
 "@babel/plugin-syntax-typescript@^7.7.2":
   version "7.24.1"
   resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.24.1.tgz#b3bcc51f396d15f3591683f90239de143c076844"
@@ -1533,6 +1663,14 @@
     "@babel/helper-simple-access" "^7.16.0"
     babel-plugin-dynamic-import-node "^2.3.3"
 
+"@babel/plugin-transform-modules-commonjs@^7.25.9":
+  version "7.26.3"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.26.3.tgz#8f011d44b20d02c3de44d8850d971d8497f981fb"
+  integrity sha512-MgR55l4q9KddUDITEzEFYn5ZsGDXMSsU9E+kh7fjRXTIC3RHqfCo8RPRbyReYJh44HQ/yomFkqbOFohXvDCiIQ==
+  dependencies:
+    "@babel/helper-module-transforms" "^7.26.0"
+    "@babel/helper-plugin-utils" "^7.25.9"
+
 "@babel/plugin-transform-modules-systemjs@^7.10.4":
   version "7.10.5"
   resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.10.5.tgz#6270099c854066681bae9e05f87e1b9cadbe8c85"
@@ -1794,6 +1932,17 @@
     "@babel/helper-plugin-utils" "^7.14.5"
     "@babel/plugin-syntax-typescript" "^7.16.0"
 
+"@babel/plugin-transform-typescript@^7.25.9":
+  version "7.26.8"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-typescript/-/plugin-transform-typescript-7.26.8.tgz#2e9caa870aa102f50d7125240d9dbf91334b0950"
+  integrity sha512-bME5J9AC8ChwA7aEPJ6zym3w7aObZULHhbNLU0bKUhKsAkylkzUdq+0kdymh9rzi8nlNFl2bmldFBCKNJBUpuw==
+  dependencies:
+    "@babel/helper-annotate-as-pure" "^7.25.9"
+    "@babel/helper-create-class-features-plugin" "^7.25.9"
+    "@babel/helper-plugin-utils" "^7.26.5"
+    "@babel/helper-skip-transparent-expression-wrappers" "^7.25.9"
+    "@babel/plugin-syntax-typescript" "^7.25.9"
+
 "@babel/plugin-transform-unicode-escapes@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/plugin-transform-unicode-escapes/-/plugin-transform-unicode-escapes-7.10.4.tgz#feae523391c7651ddac115dae0a9d06857892007"
@@ -1936,6 +2085,17 @@
     "@babel/helper-validator-option" "^7.14.5"
     "@babel/plugin-transform-typescript" "^7.16.0"
 
+"@babel/preset-typescript@^7.26.0":
+  version "7.26.0"
+  resolved "https://registry.yarnpkg.com/@babel/preset-typescript/-/preset-typescript-7.26.0.tgz#4a570f1b8d104a242d923957ffa1eaff142a106d"
+  integrity sha512-NMk1IGZ5I/oHhoXEElcm+xUnL/szL6xflkFZmoEU9xj1qSJXpiS7rsspYo92B4DRCDvZn2erT5LdsCeXAKNCkg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.25.9"
+    "@babel/helper-validator-option" "^7.25.9"
+    "@babel/plugin-syntax-jsx" "^7.25.9"
+    "@babel/plugin-transform-modules-commonjs" "^7.25.9"
+    "@babel/plugin-transform-typescript" "^7.25.9"
+
 "@babel/register@^7.14.5":
   version "7.14.5"
   resolved "https://registry.yarnpkg.com/@babel/register/-/register-7.14.5.tgz#d0eac615065d9c2f1995842f85d6e56c345f3233"
@@ -1995,6 +2155,15 @@
     "@babel/parser" "^7.24.0"
     "@babel/types" "^7.24.0"
 
+"@babel/template@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.26.9.tgz#4577ad3ddf43d194528cff4e1fa6b232fa609bb2"
+  integrity sha512-qyRplbeIpNZhmzOysF/wFMuP9sctmh2cFzRAZOn1YapxBsE1i9bJIY586R/WBLfLcmcBlM8ROBiQURnnNy+zfA==
+  dependencies:
+    "@babel/code-frame" "^7.26.2"
+    "@babel/parser" "^7.26.9"
+    "@babel/types" "^7.26.9"
+
 "@babel/template@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.8.3.tgz#e02ad04fe262a657809327f578056ca15fd4d1b8"
@@ -2096,6 +2265,19 @@
     debug "^4.1.0"
     globals "^11.1.0"
 
+"@babel/traverse@^7.25.9", "@babel/traverse@^7.26.5", "@babel/traverse@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.26.9.tgz#4398f2394ba66d05d988b2ad13c219a2c857461a"
+  integrity sha512-ZYW7L+pL8ahU5fXmNbPF+iZFHCv5scFak7MZ9bwaRPLUhHh7QQEMjZUg0HevihoqCM5iSYHN61EyCoZvqC+bxg==
+  dependencies:
+    "@babel/code-frame" "^7.26.2"
+    "@babel/generator" "^7.26.9"
+    "@babel/parser" "^7.26.9"
+    "@babel/template" "^7.26.9"
+    "@babel/types" "^7.26.9"
+    debug "^4.3.1"
+    globals "^11.1.0"
+
 "@babel/types@^7.0.0", "@babel/types@^7.18.6", "@babel/types@^7.19.0", "@babel/types@^7.20.7", "@babel/types@^7.23.0", "@babel/types@^7.24.0", "@babel/types@^7.24.5", "@babel/types@^7.3.3":
   version "7.24.5"
   resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.24.5.tgz#7661930afc638a5383eb0c4aee59b74f38db84d7"
@@ -2148,6 +2330,14 @@
     "@babel/helper-validator-identifier" "^7.22.20"
     to-fast-properties "^2.0.0"
 
+"@babel/types@^7.25.9", "@babel/types@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.26.9.tgz#08b43dec79ee8e682c2ac631c010bdcac54a21ce"
+  integrity sha512-Y3IR1cRnOxOCDvMmNiym7XpXQ93iGDDPHx+Zj+NM+rg0fBaShfQLkg+hKPaZCEvg5N/LeCo4+Rj/i3FuJsIQaw==
+  dependencies:
+    "@babel/helper-string-parser" "^7.25.9"
+    "@babel/helper-validator-identifier" "^7.25.9"
+
 "@babel/types@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.8.3.tgz#5a383dffa5416db1b73dedffd311ffd0788fb31c"
@@ -2785,6 +2975,11 @@
   resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz#d7c6e6755c78567a951e04ab52ef0fd26de59f32"
   integrity sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==
 
+"@jridgewell/sourcemap-codec@^1.5.0":
+  version "1.5.0"
+  resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.0.tgz#3188bcb273a414b0d215fd22a58540b989b9409a"
+  integrity sha512-gv3ZRaISU3fjPAgNsriBRqGWQL6quFx04YMPW/zD8XMLsU32mhCCbfbO6KZFLjvYpCZ8zyDEgqsgf+PwPaM7GQ==
+
 "@jridgewell/trace-mapping@^0.3.12", "@jridgewell/trace-mapping@^0.3.18", "@jridgewell/trace-mapping@^0.3.24", "@jridgewell/trace-mapping@^0.3.25", "@jridgewell/trace-mapping@^0.3.9":
   version "0.3.25"
   resolved "https://registry.yarnpkg.com/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz#15f190e98895f3fc23276ee14bc76b675c2e50f0"
@@ -3175,6 +3370,14 @@
     "@rollup/pluginutils" "^5.0.1"
     magic-string "^0.27.0"
 
+"@rollup/plugin-typescript@^12.1.2":
+  version "12.1.2"
+  resolved "https://registry.yarnpkg.com/@rollup/plugin-typescript/-/plugin-typescript-12.1.2.tgz#ebaeec2e7376faa889030ccd7cb485a649e63118"
+  integrity sha512-cdtSp154H5sv637uMr1a8OTWB0L1SWDSm1rDGiyfcGcvQ6cuTs4MDk2BVEBGysUWago4OJN4EQZqOTl/QY3Jgg==
+  dependencies:
+    "@rollup/pluginutils" "^5.1.0"
+    resolve "^1.22.1"
+
 "@rollup/pluginutils@^5.0.1":
   version "5.0.2"
   resolved "https://registry.yarnpkg.com/@rollup/pluginutils/-/pluginutils-5.0.2.tgz#012b8f53c71e4f6f9cb317e311df1404f56e7a33"
@@ -3184,100 +3387,109 @@
     estree-walker "^2.0.2"
     picomatch "^2.3.1"
 
-"@rollup/rollup-android-arm-eabi@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.32.1.tgz#c18bad635ba24220a6c8cc427ab2cab12e1531a3"
-  integrity sha512-/pqA4DmqyCm8u5YIDzIdlLcEmuvxb0v8fZdFhVMszSpDTgbQKdw3/mB3eMUHIbubtJ6F9j+LtmyCnHTEqIHyzA==
-
-"@rollup/rollup-android-arm64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.32.1.tgz#b5c00344b80f20889b72bfe65d3c209cef247362"
-  integrity sha512-If3PDskT77q7zgqVqYuj7WG3WC08G1kwXGVFi9Jr8nY6eHucREHkfpX79c0ACAjLj3QIWKPJR7w4i+f5EdLH5Q==
-
-"@rollup/rollup-darwin-arm64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.32.1.tgz#78e5358d4a2a08c090f75dd87fa2eada42eca1e5"
-  integrity sha512-zCpKHioQ9KgZToFp5Wvz6zaWbMzYQ2LJHQ+QixDKq52KKrF65ueu6Af4hLlLWHjX1Wf/0G5kSJM9PySW9IrvHA==
-
-"@rollup/rollup-darwin-x64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.32.1.tgz#c04c9e173244d44de50278f3f893fb68d987fcc6"
-  integrity sha512-sFvF+t2+TyUo/ZQqUcifrJIgznx58oFZbdHS9TvHq3xhPVL9nOp+yZ6LKrO9GWTP+6DbFtoyLDbjTpR62Mbr3Q==
-
-"@rollup/rollup-freebsd-arm64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.32.1.tgz#3bdf18d4ef32dcfe9b20bba18d7a53a101ed79d9"
-  integrity sha512-NbOa+7InvMWRcY9RG+B6kKIMD/FsnQPH0MWUvDlQB1iXnF/UcKSudCXZtv4lW+C276g3w5AxPbfry5rSYvyeYA==
-
-"@rollup/rollup-freebsd-x64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.32.1.tgz#35867b15c276f4b4ca8eb226f7dd6df8c64640db"
-  integrity sha512-JRBRmwvHPXR881j2xjry8HZ86wIPK2CcDw0EXchE1UgU0ubWp9nvlT7cZYKc6bkypBt745b4bglf3+xJ7hXWWw==
-
-"@rollup/rollup-linux-arm-gnueabihf@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.32.1.tgz#92c212d1b38c105bd1eb101254722d27d869b1ac"
-  integrity sha512-PKvszb+9o/vVdUzCCjL0sKHukEQV39tD3fepXxYrHE3sTKrRdCydI7uldRLbjLmDA3TFDmh418XH19NOsDRH8g==
-
-"@rollup/rollup-linux-arm-musleabihf@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.32.1.tgz#ebb94d8cd438f23e38caa4a87ca80d4cf5b50fa1"
-  integrity sha512-9WHEMV6Y89eL606ReYowXuGF1Yb2vwfKWKdD1A5h+OYnPZSJvxbEjxTRKPgi7tkP2DSnW0YLab1ooy+i/FQp/Q==
-
-"@rollup/rollup-linux-arm64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.32.1.tgz#ce6a5eacbd5fd4bdf7bf27bd818980230bdb9fab"
-  integrity sha512-tZWc9iEt5fGJ1CL2LRPw8OttkCBDs+D8D3oEM8mH8S1ICZCtFJhD7DZ3XMGM8kpqHvhGUTvNUYVDnmkj4BDXnw==
-
-"@rollup/rollup-linux-arm64-musl@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.32.1.tgz#31b4e0a543607e6eb4f982ffb45830919a952a83"
-  integrity sha512-FTYc2YoTWUsBz5GTTgGkRYYJ5NGJIi/rCY4oK/I8aKowx1ToXeoVVbIE4LGAjsauvlhjfl0MYacxClLld1VrOw==
-
-"@rollup/rollup-linux-loongarch64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.32.1.tgz#ad7b35f193f1d2e0dc37eba733069b4af5f6498d"
-  integrity sha512-F51qLdOtpS6P1zJVRzYM0v6MrBNypyPEN1GfMiz0gPu9jN8ScGaEFIZQwteSsGKg799oR5EaP7+B2jHgL+d+Kw==
-
-"@rollup/rollup-linux-powerpc64le-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.32.1.tgz#b713a55d7eac4d2c8a0109c3daca6ea85fc178b3"
-  integrity sha512-wO0WkfSppfX4YFm5KhdCCpnpGbtgQNj/tgvYzrVYFKDpven8w2N6Gg5nB6w+wAMO3AIfSTWeTjfVe+uZ23zAlg==
-
-"@rollup/rollup-linux-riscv64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.32.1.tgz#bea4fd8ad190e9bc1d11efafa2efc9d121f50b96"
-  integrity sha512-iWswS9cIXfJO1MFYtI/4jjlrGb/V58oMu4dYJIKnR5UIwbkzR0PJ09O0PDZT0oJ3LYWXBSWahNf/Mjo6i1E5/g==
-
-"@rollup/rollup-linux-s390x-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.32.1.tgz#cc98c32733ca472635759c78a79b5f8d887b2a6a"
-  integrity sha512-RKt8NI9tebzmEthMnfVgG3i/XeECkMPS+ibVZjZ6mNekpbbUmkNWuIN2yHsb/mBPyZke4nlI4YqIdFPgKuoyQQ==
-
-"@rollup/rollup-linux-x64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.32.1.tgz#5c009c264a7ce0e19b40890ca9945440bb420691"
-  integrity sha512-WQFLZ9c42ECqEjwg/GHHsouij3pzLXkFdz0UxHa/0OM12LzvX7DzedlY0SIEly2v18YZLRhCRoHZDxbBSWoGYg==
-
-"@rollup/rollup-linux-x64-musl@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.32.1.tgz#73d2f44070c23e031262b601927fdb4eec253bc1"
-  integrity sha512-BLoiyHDOWoS3uccNSADMza6V6vCNiphi94tQlVIL5de+r6r/CCQuNnerf+1g2mnk2b6edp5dk0nhdZ7aEjOBsA==
-
-"@rollup/rollup-win32-arm64-msvc@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.32.1.tgz#fa106304818078f9d3fc9005642ad99f596eed2d"
-  integrity sha512-w2l3UnlgYTNNU+Z6wOR8YdaioqfEnwPjIsJ66KxKAf0p+AuL2FHeTX6qvM+p/Ue3XPBVNyVSfCrfZiQh7vZHLQ==
-
-"@rollup/rollup-win32-ia32-msvc@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.32.1.tgz#a1a394c705a0d2a974a124c4b471fc1cf851a56f"
-  integrity sha512-Am9H+TGLomPGkBnaPWie4F3x+yQ2rr4Bk2jpwy+iV+Gel9jLAu/KqT8k3X4jxFPW6Zf8OMnehyutsd+eHoq1WQ==
-
-"@rollup/rollup-win32-x64-msvc@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.32.1.tgz#512db088df67afee8f07183cdf8c9eecd64f6ef8"
-  integrity sha512-ar80GhdZb4DgmW3myIS9nRFYcpJRSME8iqWgzH2i44u+IdrzmiXVxeFnExQ5v4JYUSpg94bWjevMG8JHf1Da5Q==
+"@rollup/pluginutils@^5.1.0":
+  version "5.1.4"
+  resolved "https://registry.yarnpkg.com/@rollup/pluginutils/-/pluginutils-5.1.4.tgz#bb94f1f9eaaac944da237767cdfee6c5b2262d4a"
+  integrity sha512-USm05zrsFxYLPdWWq+K3STlWiT/3ELn3RcV5hJMghpeAIhxfsUIg6mt12CBJBInWMV4VneoV7SfGv8xIwo2qNQ==
+  dependencies:
+    "@types/estree" "^1.0.0"
+    estree-walker "^2.0.2"
+    picomatch "^4.0.2"
+
+"@rollup/rollup-android-arm-eabi@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.34.7.tgz#e554185b1afa5509a7a4040d15ec0c3b4435ded1"
+  integrity sha512-l6CtzHYo8D2TQ3J7qJNpp3Q1Iye56ssIAtqbM2H8axxCEEwvN7o8Ze9PuIapbxFL3OHrJU2JBX6FIIVnP/rYyw==
+
+"@rollup/rollup-android-arm64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.34.7.tgz#b1ee64bb413b2feba39803b0a1bebf2a9f3d70e1"
+  integrity sha512-KvyJpFUueUnSp53zhAa293QBYqwm94TgYTIfXyOTtidhm5V0LbLCJQRGkQClYiX3FXDQGSvPxOTD/6rPStMMDg==
+
+"@rollup/rollup-darwin-arm64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.34.7.tgz#bfdce3e07a345dd1bd628f3b796050f39629d7f0"
+  integrity sha512-jq87CjmgL9YIKvs8ybtIC98s/M3HdbqXhllcy9EdLV0yMg1DpxES2gr65nNy7ObNo/vZ/MrOTxt0bE5LinL6mA==
+
+"@rollup/rollup-darwin-x64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.34.7.tgz#781a94a537c57bdf0a500e47a25ab5985e5e8dff"
+  integrity sha512-rSI/m8OxBjsdnMMg0WEetu/w+LhLAcCDEiL66lmMX4R3oaml3eXz3Dxfvrxs1FbzPbJMaItQiksyMfv1hoIxnA==
+
+"@rollup/rollup-freebsd-arm64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.34.7.tgz#7a028357cbd12c5869c446ad18177c89f3405102"
+  integrity sha512-oIoJRy3ZrdsXpFuWDtzsOOa/E/RbRWXVokpVrNnkS7npz8GEG++E1gYbzhYxhxHbO2om1T26BZjVmdIoyN2WtA==
+
+"@rollup/rollup-freebsd-x64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.34.7.tgz#f24836a6371cccc4408db74f0fd986dacf098950"
+  integrity sha512-X++QSLm4NZfZ3VXGVwyHdRf58IBbCu9ammgJxuWZYLX0du6kZvdNqPwrjvDfwmi6wFdvfZ/s6K7ia0E5kI7m8Q==
+
+"@rollup/rollup-linux-arm-gnueabihf@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.34.7.tgz#95f27e96f0eb9b9ae9887739a8b6dffc90c1237f"
+  integrity sha512-Z0TzhrsNqukTz3ISzrvyshQpFnFRfLunYiXxlCRvcrb3nvC5rVKI+ZXPFG/Aa4jhQa1gHgH3A0exHaRRN4VmdQ==
+
+"@rollup/rollup-linux-arm-musleabihf@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.34.7.tgz#677b34fba9d070877736c3fe8b02aacb5e142d97"
+  integrity sha512-nkznpyXekFAbvFBKBy4nNppSgneB1wwG1yx/hujN3wRnhnkrYVugMTCBXED4+Ni6thoWfQuHNYbFjgGH0MBXtw==
+
+"@rollup/rollup-linux-arm64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.34.7.tgz#32d3d19dedde54e91574a098f22ea43a09cf63dd"
+  integrity sha512-KCjlUkcKs6PjOcxolqrXglBDcfCuUCTVlX5BgzgoJHw+1rWH1MCkETLkLe5iLLS9dP5gKC7mp3y6x8c1oGBUtA==
+
+"@rollup/rollup-linux-arm64-musl@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.34.7.tgz#a58dff44a18696df65ed8c0ad68a2945cf900484"
+  integrity sha512-uFLJFz6+utmpbR313TTx+NpPuAXbPz4BhTQzgaP0tozlLnGnQ6rCo6tLwaSa6b7l6gRErjLicXQ1iPiXzYotjw==
+
+"@rollup/rollup-linux-loongarch64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.34.7.tgz#a7488ab078233111e8aeb370d1ecf107ec7e1716"
+  integrity sha512-ws8pc68UcJJqCpneDFepnwlsMUFoWvPbWXT/XUrJ7rWUL9vLoIN3GAasgG+nCvq8xrE3pIrd+qLX/jotcLy0Qw==
+
+"@rollup/rollup-linux-powerpc64le-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.34.7.tgz#e9b9c0d6bd248a92b2d6ec01ebf99c62ae1f2e9a"
+  integrity sha512-vrDk9JDa/BFkxcS2PbWpr0C/LiiSLxFbNOBgfbW6P8TBe9PPHx9Wqbvx2xgNi1TOAyQHQJ7RZFqBiEohm79r0w==
+
+"@rollup/rollup-linux-riscv64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.34.7.tgz#0df84ce2bea48ee686fb55060d76ab47aff45c4c"
+  integrity sha512-rB+ejFyjtmSo+g/a4eovDD1lHWHVqizN8P0Hm0RElkINpS0XOdpaXloqM4FBkF9ZWEzg6bezymbpLmeMldfLTw==
+
+"@rollup/rollup-linux-s390x-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.34.7.tgz#73df374c57d036856e33dbd2715138922e91e452"
+  integrity sha512-nNXNjo4As6dNqRn7OrsnHzwTgtypfRA3u3AKr0B3sOOo+HkedIbn8ZtFnB+4XyKJojIfqDKmbIzO1QydQ8c+Pw==
+
+"@rollup/rollup-linux-x64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.34.7.tgz#f27af0b55f0cdd84e182e6cd44a6d03da0458149"
+  integrity sha512-9kPVf9ahnpOMSGlCxXGv980wXD0zRR3wyk8+33/MXQIpQEOpaNe7dEHm5LMfyRZRNt9lMEQuH0jUKj15MkM7QA==
+
+"@rollup/rollup-linux-x64-musl@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.34.7.tgz#c7981ad5cfb8c3cd5d643d33ca54e4d2802b9201"
+  integrity sha512-7wJPXRWTTPtTFDFezA8sle/1sdgxDjuMoRXEKtx97ViRxGGkVQYovem+Q8Pr/2HxiHp74SSRG+o6R0Yq0shPwQ==
+
+"@rollup/rollup-win32-arm64-msvc@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.34.7.tgz#06cedc0ef3cbf1cbd8abcf587090712e40ae6941"
+  integrity sha512-MN7aaBC7mAjsiMEZcsJvwNsQVNZShgES/9SzWp1HC9Yjqb5OpexYnRjF7RmE4itbeesHMYYQiAtUAQaSKs2Rfw==
+
+"@rollup/rollup-win32-ia32-msvc@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.34.7.tgz#90b39b977b14961a769be6ea61238e7fc668dd4d"
+  integrity sha512-aeawEKYswsFu1LhDM9RIgToobquzdtSc4jSVqHV8uApz4FVvhFl/mKh92wc8WpFc6aYCothV/03UjY6y7yLgbg==
+
+"@rollup/rollup-win32-x64-msvc@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.34.7.tgz#6531d61e7141091eaab0461ee8e0380c10e4ca57"
+  integrity sha512-4ZedScpxxIrVO7otcZ8kCX1mZArtH2Wfj3uFCxRJ9NO80gg1XV0U/b2f/MKaGwj2X3QopHfoWiDQ917FRpwY3w==
 
 "@sinclair/typebox@^0.25.16":
   version "0.25.24"
@@ -3468,21 +3680,11 @@
   dependencies:
     "@types/estree" "*"
 
-"@types/estree@*":
-  version "0.0.42"
-  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-0.0.42.tgz#8d0c1f480339efedb3e46070e22dd63e0430dd11"
-  integrity sha512-K1DPVvnBCPxzD+G51/cxVIoc2X8uUVl1zpJeE6iKcgHMj4+tbat5Xu4TjV7v2QSDbIeAfLi2hIk+u2+s0MlpUQ==
-
-"@types/estree@1.0.6", "@types/estree@^1.0.6":
+"@types/estree@*", "@types/estree@1.0.6", "@types/estree@^1.0.0", "@types/estree@^1.0.6":
   version "1.0.6"
   resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
   integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
 
-"@types/estree@^1.0.0":
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.0.tgz#5fb2e536c1ae9bf35366eed879e827fa59ca41c2"
-  integrity sha512-WulqXMDUTYAXCjZnk6JtIHPigp55cVtDgDrO2gHRwhyJto21+1zbVCtOYB2L1F9w4qCQ0rOGWBnBe0FNTiEJIQ==
-
 "@types/express-serve-static-core@*", "@types/express-serve-static-core@^4.17.33":
   version "4.17.35"
   resolved "https://registry.yarnpkg.com/@types/express-serve-static-core/-/express-serve-static-core-4.17.35.tgz#c95dd4424f0d32e525d23812aa8ab8e4d3906c4f"
@@ -11370,6 +11572,11 @@ jsesc@^2.5.1:
   resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-2.5.2.tgz#80564d2e483dacf6e8ef209650a67df3f0c283a4"
   integrity sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==
 
+jsesc@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-3.1.0.tgz#74d335a234f67ed19907fdadfac7ccf9d409825d"
+  integrity sha512-/sM3dO2FOzXjKQhJuo0Q173wf2KOo8t4I8vHy6lF9poUp7bKT0/NHE8fPX23PwfhnykfqnC2xRxOnVw5XuGIaA==
+
 jsesc@~0.5.0:
   version "0.5.0"
   resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d"
@@ -11976,6 +12183,13 @@ magic-string@^0.27.0:
   dependencies:
     "@jridgewell/sourcemap-codec" "^1.4.13"
 
+magic-string@^0.30.10:
+  version "0.30.17"
+  resolved "https://registry.yarnpkg.com/magic-string/-/magic-string-0.30.17.tgz#450a449673d2460e5bbcfba9a61916a1714c7453"
+  integrity sha512-sNPKHvyjVf7gyjwS4xGTaW/mCnF8wnjtifKBEhxfZ7E/S8tQ0rssrwGNn6q8JH/ohItJfSQp9mBtQYuTlH5QnA==
+  dependencies:
+    "@jridgewell/sourcemap-codec" "^1.5.0"
+
 make-dir@^1.0.0, make-dir@^1.2.0:
   version "1.3.0"
   resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.3.0.tgz#79c1033b80515bd6d24ec9933e860ca75ee27f0c"
@@ -14343,9 +14557,9 @@ readdirp@^2.2.1:
     readable-stream "^2.0.2"
 
 readdirp@^4.0.1:
-  version "4.1.1"
-  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-4.1.1.tgz#bd115327129672dc47f87408f05df9bd9ca3ef55"
-  integrity sha512-h80JrZu/MHUZCyHu5ciuoI0+WxsCxzxJTILn6Fs8rxSnFPh+UVHYfeIxK1nVGugMqkfC4vJcBOYbkfkwYK0+gw==
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-4.1.2.tgz#eb85801435fbf2a7ee58f19e0921b068fc69948d"
+  integrity sha512-GDhwkLfywWL2s6vEjyhri+eXmfH6j1L7JE27WhqLeYzoh/A3DBaYGEj2H/HFZCn/kMfim73FXxEJTw06WtxQwg==
 
 readdirp@~3.6.0:
   version "3.6.0"
@@ -14744,6 +14958,15 @@ roarr@^2.15.3:
     semver-compare "^1.0.0"
     sprintf-js "^1.1.2"
 
+rollup-plugin-dts@^6.1.1:
+  version "6.1.1"
+  resolved "https://registry.yarnpkg.com/rollup-plugin-dts/-/rollup-plugin-dts-6.1.1.tgz#46b33f4d1d7f4e66f1171ced9b282ac11a15a254"
+  integrity sha512-aSHRcJ6KG2IHIioYlvAOcEq6U99sVtqDDKVhnwt70rW6tsz3tv5OSjEiWcgzfsHdLyGXZ/3b/7b/+Za3Y6r1XA==
+  dependencies:
+    magic-string "^0.30.10"
+  optionalDependencies:
+    "@babel/code-frame" "^7.24.2"
+
 rollup-plugin-prettier@^4.1.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/rollup-plugin-prettier/-/rollup-plugin-prettier-4.1.1.tgz#eb74bd47c3cc3ba68bdf34b5323d0d7a47be8cec"
@@ -14781,31 +15004,31 @@ rollup@^3.29.5:
     fsevents "~2.3.2"
 
 rollup@^4.24.0:
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/rollup/-/rollup-4.32.1.tgz#95309604d92c3d21cbf06c3ee46a098209ce13a4"
-  integrity sha512-z+aeEsOeEa3mEbS1Tjl6sAZ8NE3+AalQz1RJGj81M+fizusbdDMoEJwdJNHfaB40Scr4qNu+welOfes7maKonA==
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/rollup/-/rollup-4.34.7.tgz#e00d8550688a616a3481c6446bb688d4c753ba8f"
+  integrity sha512-8qhyN0oZ4x0H6wmBgfKxJtxM7qS98YJ0k0kNh5ECVtuchIJ7z9IVVvzpmtQyT10PXKMtBxYr1wQ5Apg8RS8kXQ==
   dependencies:
     "@types/estree" "1.0.6"
   optionalDependencies:
-    "@rollup/rollup-android-arm-eabi" "4.32.1"
-    "@rollup/rollup-android-arm64" "4.32.1"
-    "@rollup/rollup-darwin-arm64" "4.32.1"
-    "@rollup/rollup-darwin-x64" "4.32.1"
-    "@rollup/rollup-freebsd-arm64" "4.32.1"
-    "@rollup/rollup-freebsd-x64" "4.32.1"
-    "@rollup/rollup-linux-arm-gnueabihf" "4.32.1"
-    "@rollup/rollup-linux-arm-musleabihf" "4.32.1"
-    "@rollup/rollup-linux-arm64-gnu" "4.32.1"
-    "@rollup/rollup-linux-arm64-musl" "4.32.1"
-    "@rollup/rollup-linux-loongarch64-gnu" "4.32.1"
-    "@rollup/rollup-linux-powerpc64le-gnu" "4.32.1"
-    "@rollup/rollup-linux-riscv64-gnu" "4.32.1"
-    "@rollup/rollup-linux-s390x-gnu" "4.32.1"
-    "@rollup/rollup-linux-x64-gnu" "4.32.1"
-    "@rollup/rollup-linux-x64-musl" "4.32.1"
-    "@rollup/rollup-win32-arm64-msvc" "4.32.1"
-    "@rollup/rollup-win32-ia32-msvc" "4.32.1"
-    "@rollup/rollup-win32-x64-msvc" "4.32.1"
+    "@rollup/rollup-android-arm-eabi" "4.34.7"
+    "@rollup/rollup-android-arm64" "4.34.7"
+    "@rollup/rollup-darwin-arm64" "4.34.7"
+    "@rollup/rollup-darwin-x64" "4.34.7"
+    "@rollup/rollup-freebsd-arm64" "4.34.7"
+    "@rollup/rollup-freebsd-x64" "4.34.7"
+    "@rollup/rollup-linux-arm-gnueabihf" "4.34.7"
+    "@rollup/rollup-linux-arm-musleabihf" "4.34.7"
+    "@rollup/rollup-linux-arm64-gnu" "4.34.7"
+    "@rollup/rollup-linux-arm64-musl" "4.34.7"
+    "@rollup/rollup-linux-loongarch64-gnu" "4.34.7"
+    "@rollup/rollup-linux-powerpc64le-gnu" "4.34.7"
+    "@rollup/rollup-linux-riscv64-gnu" "4.34.7"
+    "@rollup/rollup-linux-s390x-gnu" "4.34.7"
+    "@rollup/rollup-linux-x64-gnu" "4.34.7"
+    "@rollup/rollup-linux-x64-musl" "4.34.7"
+    "@rollup/rollup-win32-arm64-msvc" "4.34.7"
+    "@rollup/rollup-win32-ia32-msvc" "4.34.7"
+    "@rollup/rollup-win32-x64-msvc" "4.34.7"
     fsevents "~2.3.2"
 
 rrweb-cssom@^0.6.0:
@@ -16530,11 +16753,6 @@ typescript@3.9.3:
   resolved "https://registry.yarnpkg.com/typescript/-/typescript-3.9.3.tgz#d3ac8883a97c26139e42df5e93eeece33d610b8a"
   integrity sha512-D/wqnB2xzNFIcoBG9FG8cXRDjiqSTbG2wd8DMZeQyJlP1vfTkIxH4GKveWaEBYySKIg+USu+E+EDIR47SqnaMQ==
 
-typescript@^3.7.5:
-  version "3.7.5"
-  resolved "https://registry.yarnpkg.com/typescript/-/typescript-3.7.5.tgz#0692e21f65fd4108b9330238aac11dd2e177a1ae"
-  integrity sha512-/P5lkRXkWHNAbcJIiHPfRoKqyd7bsyCma1hZNUGfn20qm64T6ZBlrzprymeu918H+mB/0rIg2gGK/BXkhhYgBw==
-
 typescript@^5.4.3:
   version "5.7.3"
   resolved "https://registry.yarnpkg.com/typescript/-/typescript-5.7.3.tgz#919b44a7dbb8583a9b856d162be24a54bf80073e"

From 037b25cfdcd18deea0e1c6c2e8d2548dbf32f7f3 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 12:23:44 -0600
Subject: [PATCH 31/73] test(eslint): create eslint test fixtures (#32396)

---
 fixtures/{eslint => eslint-v6}/.eslintrc.json |   7 +-
 fixtures/eslint-v6/README.md                  |  12 +
 fixtures/eslint-v6/build.mjs                  |   5 +
 fixtures/eslint-v6/index.js                   | 143 +++
 fixtures/eslint-v6/package.json               |  12 +
 fixtures/eslint-v6/yarn.lock                  | 865 ++++++++++++++++++
 fixtures/eslint-v7/.eslintrc.json             |  14 +
 fixtures/eslint-v7/README.md                  |  12 +
 fixtures/eslint-v7/build.mjs                  |   5 +
 fixtures/eslint-v7/index.js                   | 143 +++
 fixtures/eslint-v7/package.json               |  12 +
 fixtures/eslint-v7/yarn.lock                  | 769 ++++++++++++++++
 fixtures/eslint-v8/.eslintrc.json             |  14 +
 fixtures/eslint-v8/README.md                  |  12 +
 fixtures/eslint-v8/build.mjs                  |   5 +
 fixtures/eslint-v8/index.js                   | 143 +++
 fixtures/eslint-v8/package.json               |  12 +
 fixtures/eslint-v8/yarn.lock                  | 676 ++++++++++++++
 fixtures/eslint-v9/README.md                  |  12 +
 fixtures/eslint-v9/build.mjs                  |   5 +
 fixtures/eslint-v9/eslint.config.mjs          |  21 +
 fixtures/eslint-v9/index.js                   | 143 +++
 fixtures/eslint-v9/package.json               |  12 +
 fixtures/eslint-v9/yarn.lock                  | 579 ++++++++++++
 fixtures/eslint/README.md                     |   7 -
 fixtures/eslint/index.js                      |  26 -
 fixtures/eslint/package.json                  |  12 -
 fixtures/eslint/proxy/index.js                |  35 -
 fixtures/eslint/proxy/package.json            |   4 -
 fixtures/eslint/watch.sh                      |   3 -
 fixtures/eslint/yarn.lock                     | 853 -----------------
 31 files changed, 3629 insertions(+), 944 deletions(-)
 rename fixtures/{eslint => eslint-v6}/.eslintrc.json (52%)
 create mode 100644 fixtures/eslint-v6/README.md
 create mode 100644 fixtures/eslint-v6/build.mjs
 create mode 100644 fixtures/eslint-v6/index.js
 create mode 100644 fixtures/eslint-v6/package.json
 create mode 100644 fixtures/eslint-v6/yarn.lock
 create mode 100644 fixtures/eslint-v7/.eslintrc.json
 create mode 100644 fixtures/eslint-v7/README.md
 create mode 100644 fixtures/eslint-v7/build.mjs
 create mode 100644 fixtures/eslint-v7/index.js
 create mode 100644 fixtures/eslint-v7/package.json
 create mode 100644 fixtures/eslint-v7/yarn.lock
 create mode 100644 fixtures/eslint-v8/.eslintrc.json
 create mode 100644 fixtures/eslint-v8/README.md
 create mode 100644 fixtures/eslint-v8/build.mjs
 create mode 100644 fixtures/eslint-v8/index.js
 create mode 100644 fixtures/eslint-v8/package.json
 create mode 100644 fixtures/eslint-v8/yarn.lock
 create mode 100644 fixtures/eslint-v9/README.md
 create mode 100644 fixtures/eslint-v9/build.mjs
 create mode 100644 fixtures/eslint-v9/eslint.config.mjs
 create mode 100644 fixtures/eslint-v9/index.js
 create mode 100644 fixtures/eslint-v9/package.json
 create mode 100644 fixtures/eslint-v9/yarn.lock
 delete mode 100644 fixtures/eslint/README.md
 delete mode 100644 fixtures/eslint/index.js
 delete mode 100644 fixtures/eslint/package.json
 delete mode 100644 fixtures/eslint/proxy/index.js
 delete mode 100644 fixtures/eslint/proxy/package.json
 delete mode 100755 fixtures/eslint/watch.sh
 delete mode 100644 fixtures/eslint/yarn.lock

diff --git a/fixtures/eslint/.eslintrc.json b/fixtures/eslint-v6/.eslintrc.json
similarity index 52%
rename from fixtures/eslint/.eslintrc.json
rename to fixtures/eslint-v6/.eslintrc.json
index e03178a42a72a..33b2cfaacabcd 100644
--- a/fixtures/eslint/.eslintrc.json
+++ b/fixtures/eslint-v6/.eslintrc.json
@@ -1,15 +1,14 @@
 {
   "root": true,
+  "extends": ["plugin:react-hooks/recommended-legacy"],
   "parserOptions": {
-    "ecmaVersion": 8,
+    "ecmaVersion": 2020,
     "sourceType": "module",
     "ecmaFeatures": {
       "jsx": true
     }
   },
-  "plugins": ["react-hooks"],
   "rules": {
-    "react-hooks/rules-of-hooks": 2,
-    "react-hooks/exhaustive-deps": 2
+    "react-hooks/exhaustive-deps": "error"
   }
 }
diff --git a/fixtures/eslint-v6/README.md b/fixtures/eslint-v6/README.md
new file mode 100644
index 0000000000000..7f0ebe8b038ba
--- /dev/null
+++ b/fixtures/eslint-v6/README.md
@@ -0,0 +1,12 @@
+# ESLint v6 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 6.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v6
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v6/build.mjs b/fixtures/eslint-v6/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v6/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v6/index.js b/fixtures/eslint-v6/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v6/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v6/package.json b/fixtures/eslint-v6/package.json
new file mode 100644
index 0000000000000..50c92054b436f
--- /dev/null
+++ b/fixtures/eslint-v6/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v6",
+  "dependencies": {
+    "eslint": "^6",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v6/yarn.lock b/fixtures/eslint-v6/yarn.lock
new file mode 100644
index 0000000000000..3d6dbca037b38
--- /dev/null
+++ b/fixtures/eslint-v6/yarn.lock
@@ -0,0 +1,865 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@babel/code-frame@^7.0.0":
+  version "7.26.2"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.26.2.tgz#4b5fab97d33338eff916235055f0ebc21e573a85"
+  integrity sha512-RJlIHRueQgwWitWgF8OdFYGZX328Ax5BCemNGlqHfplnRT9ESi8JkFlvaVYbS+UubVY6dpv87Fs2u5M29iNFVQ==
+  dependencies:
+    "@babel/helper-validator-identifier" "^7.25.9"
+    js-tokens "^4.0.0"
+    picocolors "^1.0.0"
+
+"@babel/helper-validator-identifier@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz#24b64e2c3ec7cd3b3c547729b8d16871f22cbdc7"
+  integrity sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==
+
+acorn-jsx@^5.2.0:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^7.1.1:
+  version "7.4.1"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-7.4.1.tgz#feaed255973d2e77555b83dbc08851a6c63520fa"
+  integrity sha512-nQyp0o1/mNdbTO1PO6kHkwSrmgZ0MT/jCCpNiwbUjGoRN4dlBhqJtoQuCnEOKzgTVwg0ZWiCoQy6SxMebQVh8A==
+
+ajv@^6.10.0, ajv@^6.10.2:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ansi-escapes@^4.2.1:
+  version "4.3.2"
+  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-4.3.2.tgz#6b2291d1db7d98b6521d5f1efa42d0f3a9feb65e"
+  integrity sha512-gKXj5ALrKWQLsYG9jlTRmR/xKluxHV+Z9QEwNIgCfM1/uwPMCuzVVnh5mwTd+OuBZcwSIMbqssNWRm1lE51QaQ==
+  dependencies:
+    type-fest "^0.21.3"
+
+ansi-regex@^4.1.0:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-4.1.1.tgz#164daac87ab2d6f6db3a29875e2d1766582dabed"
+  integrity sha512-ILlv4k/3f6vfQ4OoP2AGvirOktlQ98ZEL1k9FaQjxa3L1abBgbuTDAdPOpvbGncC0BTVQrl+OM8xZGK6tWXt7g==
+
+ansi-regex@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304"
+  integrity sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==
+
+ansi-styles@^3.2.0, ansi-styles@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
+  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
+  dependencies:
+    color-convert "^1.9.0"
+
+ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^1.0.7:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
+  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
+  dependencies:
+    sprintf-js "~1.0.2"
+
+astral-regex@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/astral-regex/-/astral-regex-1.0.0.tgz#6c8c3fb827dd43ee3918f27b82782ab7658a6fd9"
+  integrity sha512-+Ryf6g3BKoRc7jfp7ad8tM4TtMiaWvbF/1/sQcZPkkS7ag3D5nMBCe2UfOTONtAkaG0tO0ij3C5Lwmf1EiyjHg==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^2.1.0:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
+  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
+  dependencies:
+    ansi-styles "^3.2.1"
+    escape-string-regexp "^1.0.5"
+    supports-color "^5.3.0"
+
+chalk@^4.1.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+chardet@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.7.0.tgz#90094849f0937f2eedc2425d0d28a9e5f0cbad9e"
+  integrity sha512-mT8iDcrh03qDGRRmoA2hmBJnxpllMR+0/0qlzjqZES6NdiWDcZkCNAk4rPFZ9Q85r27unkiNNg8ZOiwZXBHwcA==
+
+cli-cursor@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-3.1.0.tgz#264305a7ae490d1d03bf0c9ba7c925d1753af307"
+  integrity sha512-I/zHAwsKf9FqGoXM4WWRACob9+SNukZTd94DWF57E4toouRulbCxcUh6RKUEOQlYTHJnzkPMySvPNaaSLNfLZw==
+  dependencies:
+    restore-cursor "^3.1.0"
+
+cli-width@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-3.0.0.tgz#a2f48437a2caa9a22436e794bf071ec9e61cedf6"
+  integrity sha512-FxqpkPPwu1HjuN93Omfm4h8uIanXofW0RxVEW3k5RKx+mJJYSthzNhp32Kzxxy3YAEZ/Dc/EWN1vZRY0+kOhbw==
+
+color-convert@^1.9.0:
+  version "1.9.3"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
+  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
+  dependencies:
+    color-name "1.1.3"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
+  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^6.0.5:
+  version "6.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-6.0.6.tgz#30d0efa0712ddb7eb5a76e1e8721bffafa6b5d57"
+  integrity sha512-VqCUuhcd1iB+dsv8gxPttb5iZh/D0iubSP21g36KXdEuf6I5JiioesUVjpCdHV9MZRUfVFlvwtIUyPfxo5trtw==
+  dependencies:
+    nice-try "^1.0.4"
+    path-key "^2.0.1"
+    semver "^5.5.0"
+    shebang-command "^1.2.0"
+    which "^1.2.9"
+
+debug@^4.0.1:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@~0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
+  integrity sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=
+
+doctrine@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961"
+  integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==
+  dependencies:
+    esutils "^2.0.2"
+
+emoji-regex@^7.0.1:
+  version "7.0.3"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-7.0.3.tgz#933a04052860c85e83c122479c4748a8e4c72156"
+  integrity sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==
+
+emoji-regex@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37"
+  integrity sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==
+
+escape-string-regexp@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
+  integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^5.0.0:
+  version "5.1.1"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-5.1.1.tgz#e786e59a66cb92b3f6c1fb0d508aab174848f48c"
+  integrity sha512-2NxwbF/hZ0KpepYN0cNbo+FN6XoK7GaHlQhgx/hIZl6Va0bF45RQOOwhLIy8lQDbuCiadSLCBnH2CFYquit5bw==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^4.1.1"
+
+eslint-utils@^1.4.3:
+  version "1.4.3"
+  resolved "https://registry.yarnpkg.com/eslint-utils/-/eslint-utils-1.4.3.tgz#74fec7c54d0776b6f67e0251040b5806564e981f"
+  integrity sha512-fbBN5W2xdY45KulGXmLHZ3c3FHfVYmKg0IrAKGOkT/464PQsx2UeIzfz1RmEci+KLm1bBaAzZAh8+/E+XAeZ8Q==
+  dependencies:
+    eslint-visitor-keys "^1.1.0"
+
+eslint-visitor-keys@^1.1.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.3.0.tgz#30ebd1ef7c2fdff01c3a4f151044af25fab0523e"
+  integrity sha512-6J72N8UNa462wa/KFODt/PJ3IU60SDpC3QXC1Hjc1BXXpfL2C9R5+AU7jhe0F6GREqVMh4Juu+NY7xn+6dipUQ==
+
+eslint@^6:
+  version "6.8.0"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-6.8.0.tgz#62262d6729739f9275723824302fb227c8c93ffb"
+  integrity sha512-K+Iayyo2LtyYhDSYwz5D5QdWw0hCacNzyq1Y821Xna2xSJj7cijoLLYmLxTQgcgZ9mC61nryMy9S7GRbYpI5Ig==
+  dependencies:
+    "@babel/code-frame" "^7.0.0"
+    ajv "^6.10.0"
+    chalk "^2.1.0"
+    cross-spawn "^6.0.5"
+    debug "^4.0.1"
+    doctrine "^3.0.0"
+    eslint-scope "^5.0.0"
+    eslint-utils "^1.4.3"
+    eslint-visitor-keys "^1.1.0"
+    espree "^6.1.2"
+    esquery "^1.0.1"
+    esutils "^2.0.2"
+    file-entry-cache "^5.0.1"
+    functional-red-black-tree "^1.0.1"
+    glob-parent "^5.0.0"
+    globals "^12.1.0"
+    ignore "^4.0.6"
+    import-fresh "^3.0.0"
+    imurmurhash "^0.1.4"
+    inquirer "^7.0.0"
+    is-glob "^4.0.0"
+    js-yaml "^3.13.1"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    levn "^0.3.0"
+    lodash "^4.17.14"
+    minimatch "^3.0.4"
+    mkdirp "^0.5.1"
+    natural-compare "^1.4.0"
+    optionator "^0.8.3"
+    progress "^2.0.0"
+    regexpp "^2.0.1"
+    semver "^6.1.2"
+    strip-ansi "^5.2.0"
+    strip-json-comments "^3.0.1"
+    table "^5.2.3"
+    text-table "^0.2.0"
+    v8-compile-cache "^2.0.3"
+
+espree@^6.1.2:
+  version "6.2.1"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-6.2.1.tgz#77fc72e1fd744a2052c20f38a5b575832e82734a"
+  integrity sha512-ysCxRQY3WaXJz9tdbWOwuWr5Y/XrPTGX9Kiz3yoUXwW0VZ4w30HTkQLaGx/+ttFjF8i+ACbArnB4ce68a9m5hw==
+  dependencies:
+    acorn "^7.1.1"
+    acorn-jsx "^5.2.0"
+    eslint-visitor-keys "^1.1.0"
+
+esprima@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
+  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
+
+esquery@^1.0.1:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
+  integrity sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+external-editor@^3.0.3:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-3.1.0.tgz#cb03f740befae03ea4d283caed2741a83f335495"
+  integrity sha512-hMQ4CX1p1izmuLYyZqLMO/qGNw10wSv9QDCPfzXfyFrOaCSSoRfqE1Kf1s5an66J5JZC62NewG+mK49jOCtQew==
+  dependencies:
+    chardet "^0.7.0"
+    iconv-lite "^0.4.24"
+    tmp "^0.0.33"
+
+fast-deep-equal@^3.1.1:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@~2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+figures@^3.0.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/figures/-/figures-3.2.0.tgz#625c18bd293c604dc4a8ddb2febf0c88341746af"
+  integrity sha512-yaduQFRKLXYOGgEn6AZau90j3ggSOyiqXU0F9JZfeXYhNa+Jk4X+s45A2zg5jns87GAFa34BBm2kXw4XpNcbdg==
+  dependencies:
+    escape-string-regexp "^1.0.5"
+
+file-entry-cache@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-5.0.1.tgz#ca0f6efa6dd3d561333fb14515065c2fafdf439c"
+  integrity sha512-bCg29ictuBaKUwwArK4ouCaqDgLZcysCFLmM/Yn/FDoqndh/9vNuQfXRDvTuXKLxfD/JtZQGKFT8MGcJBK644g==
+  dependencies:
+    flat-cache "^2.0.1"
+
+flat-cache@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-2.0.1.tgz#5d296d6f04bda44a4630a301413bdbc2ec085ec0"
+  integrity sha512-LoQe6yDuUMDzQAEH8sgmh4Md6oZnc/7PjtwjNFSzveXqSHt6ka9fPBuso7IGf9Rz4uqnSnWiFH2B/zj24a5ReA==
+  dependencies:
+    flatted "^2.0.0"
+    rimraf "2.6.3"
+    write "1.0.3"
+
+flatted@^2.0.0:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-2.0.2.tgz#4575b21e2bcee7434aa9be662f4b7b5f9c2b5138"
+  integrity sha512-r5wGx7YeOwNWNlCA0wQ86zKyDLMQr+/RB8xy74M4hTphfmjlijTSSXGuH8rnvKZnfT9i+75zmd8jcKdMR4O6jA==
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
+
+functional-red-black-tree@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327"
+  integrity sha512-dsKNQNdj6xA3T+QlADDA7mOSlX0qiMINjn0cgr+eGHGsbSHzTabcIogz2+p/iqP1Xs6EP/sS2SbqH+brGTbq0g==
+
+glob-parent@^5.0.0:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4"
+  integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==
+  dependencies:
+    is-glob "^4.0.1"
+
+glob@^7.1.3:
+  version "7.1.3"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
+  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+globals@^12.1.0:
+  version "12.4.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-12.4.0.tgz#a18813576a41b00a24a97e7f815918c2e19925f8"
+  integrity sha512-BWICuzzDvDoH54NHKCseDanAhE3CeDorgDL5MT6LMXXj2WCnd9UC2szdk4AWLfjdgNBCXLUanXYcpBBKOSWGwg==
+  dependencies:
+    type-fest "^0.8.1"
+
+has-flag@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
+  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+iconv-lite@^0.4.24:
+  version "0.4.24"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b"
+  integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==
+  dependencies:
+    safer-buffer ">= 2.1.2 < 3"
+
+ignore@^4.0.6:
+  version "4.0.6"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-4.0.6.tgz#750e3db5862087b4737ebac8207ffd1ef27b25fc"
+  integrity sha512-cyFDKrqc/YdcWFniJhzI42+AzS+gNwmUzOSFcRCQYwySuBBBy/KjuxWLZ/FHEH6Moq1NizMOBWyTcv8O4OZIMg==
+
+import-fresh@^3.0.0:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
+
+inquirer@^7.0.0:
+  version "7.3.3"
+  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-7.3.3.tgz#04d176b2af04afc157a83fd7c100e98ee0aad003"
+  integrity sha512-JG3eIAj5V9CwcGvuOmoo6LB9kbAYT8HXffUl6memuszlwDC/qvFAJw49XJ5NROSFNPxp3iQg1GqkFhaY/CR0IA==
+  dependencies:
+    ansi-escapes "^4.2.1"
+    chalk "^4.1.0"
+    cli-cursor "^3.1.0"
+    cli-width "^3.0.0"
+    external-editor "^3.0.3"
+    figures "^3.0.0"
+    lodash "^4.17.19"
+    mute-stream "0.0.8"
+    run-async "^2.4.0"
+    rxjs "^6.6.0"
+    string-width "^4.1.0"
+    strip-ansi "^6.0.0"
+    through "^2.3.6"
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-fullwidth-code-point@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
+  integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=
+
+is-fullwidth-code-point@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz#f116f8064fe90b3f7844a38997c0b75051269f1d"
+  integrity sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==
+
+is-glob@^4.0.0, is-glob@^4.0.1:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-tokens@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499"
+  integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==
+
+js-yaml@^3.13.1:
+  version "3.14.1"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.14.1.tgz#dae812fdb3825fa306609a8717383c50c36a0537"
+  integrity sha512-okMH7OXXJ7YrN9Ok3/SXrnu4iX9yOk+25nqX4imS2npuvTYDmo/QEZoqwZkYaIDk3jVvBOTOIEgEhaLOynBS9g==
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^4.0.0"
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+levn@^0.3.0, levn@~0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee"
+  integrity sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=
+  dependencies:
+    prelude-ls "~1.1.2"
+    type-check "~0.3.2"
+
+lodash@^4.17.14, lodash@^4.17.19:
+  version "4.17.21"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.21.tgz#679591c564c3bffaae8454cf0b3df370c3d6911c"
+  integrity sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg==
+
+mimic-fn@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-2.1.0.tgz#7ed2c2ccccaf84d3ffcb7a69b57711fc2083401b"
+  integrity sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==
+
+minimatch@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+minimist@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
+  integrity sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=
+
+mkdirp@^0.5.1:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
+  integrity sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=
+  dependencies:
+    minimist "0.0.8"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+mute-stream@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.8.tgz#1630c42b2251ff81e2a283de96a5497ea92e5e0d"
+  integrity sha512-nnbWWOkoWyUsTjKrhgD0dcz22mdkSnpYqbEjIm2nhwhuxlSkpywJmBo8h0ZqJdkp73mb90SssHkN4rsRaBAfAA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+nice-try@^1.0.4:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/nice-try/-/nice-try-1.0.5.tgz#a3378a7696ce7d223e88fc9b764bd7ef1089e366"
+  integrity sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==
+
+once@^1.3.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+  dependencies:
+    wrappy "1"
+
+onetime@^5.1.0:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/onetime/-/onetime-5.1.2.tgz#d0e96ebb56b07476df1dd9c4806e5237985ca45e"
+  integrity sha512-kbpaSSGJTWdAY5KPVeMOKXSrPtr8C8C7wodJbcsd51jRnmD+GZu8Y0VoU6Dm5Z4vWr0Ig/1NKuWRKf7j5aaYSg==
+  dependencies:
+    mimic-fn "^2.1.0"
+
+optionator@^0.8.3:
+  version "0.8.3"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.3.tgz#84fa1d036fe9d3c7e21d99884b601167ec8fb495"
+  integrity sha512-+IW9pACdk3XWmmTXG8m3upGUJst5XRGzxMRjXzAuJ1XnIFNvfhjjIuYkDvysnPQ7qzqVzLt78BCruntqRhWQbA==
+  dependencies:
+    deep-is "~0.1.3"
+    fast-levenshtein "~2.0.6"
+    levn "~0.3.0"
+    prelude-ls "~1.1.2"
+    type-check "~0.3.2"
+    word-wrap "~1.2.3"
+
+os-tmpdir@~1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
+  integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-is-absolute@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
+
+path-key@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40"
+  integrity sha512-fEHGKCSmUSDPv4uoj8AlD+joPlq3peND+HRYyxFz4KPw4z926S/b8rIuFs2FYJg3BwsxJf6A9/3eIdLaYC+9Dw==
+
+picocolors@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
+  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
+
+prelude-ls@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
+  integrity sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=
+
+progress@^2.0.0:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8"
+  integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+regexpp@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/regexpp/-/regexpp-2.0.1.tgz#8d19d31cf632482b589049f8281f93dbcba4d07f"
+  integrity sha512-lv0M6+TkDVniA3aD1Eg0DVpfU/booSu7Eev3TDO/mZKHBfVjgCGTV4t4buppESEYDtkArYFOxTJWv6S5C+iaNw==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+restore-cursor@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-3.1.0.tgz#39f67c54b3a7a58cea5236d95cf0034239631f7e"
+  integrity sha512-l+sSefzHpj5qimhFSE5a8nufZYAM3sBSVMAPtYkmC+4EH2anSGaEMXSD0izRQbu9nfyQ9y5JrVmp7E8oZrUjvA==
+  dependencies:
+    onetime "^5.1.0"
+    signal-exit "^3.0.2"
+
+rimraf@2.6.3:
+  version "2.6.3"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.3.tgz#b2d104fe0d8fb27cf9e0a1cda8262dd3833c6cab"
+  integrity sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==
+  dependencies:
+    glob "^7.1.3"
+
+run-async@^2.4.0:
+  version "2.4.1"
+  resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.4.1.tgz#8440eccf99ea3e70bd409d49aab88e10c189a455"
+  integrity sha512-tvVnVv01b8c1RrA6Ep7JkStj85Guv/YrMcwqYQnwjsAS2cTmmPGBBjAjpCW7RrSodNSoE2/qg9O4bceNvUuDgQ==
+
+rxjs@^6.6.0:
+  version "6.6.7"
+  resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-6.6.7.tgz#90ac018acabf491bf65044235d5863c4dab804c9"
+  integrity sha512-hTdwr+7yYNIT5n4AMYp85KA6yw2Va0FLa3Rguvbpa4W3I5xynaBZo41cM3XM+4Q6fRMj3sBYIR1VAmZMXYJvRQ==
+  dependencies:
+    tslib "^1.9.0"
+
+"safer-buffer@>= 2.1.2 < 3":
+  version "2.1.2"
+  resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a"
+  integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==
+
+semver@^5.5.0:
+  version "5.7.2"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-5.7.2.tgz#48d55db737c3287cd4835e17fa13feace1c41ef8"
+  integrity sha512-cBznnQ9KjJqU67B52RMC65CMarK2600WFnbkcaiwWq3xy/5haFJlshgnpjovMVJ+Hff49d8GEn0b87C5pDQ10g==
+
+semver@^6.1.2:
+  version "6.3.1"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.1.tgz#556d2ef8689146e46dcea4bfdd095f3434dffcb4"
+  integrity sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==
+
+shebang-command@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea"
+  integrity sha512-EV3L1+UQWGor21OmnvojK36mhg+TyIKDh3iFBKBohr5xeXIhNBcx8oWdgkTEEQ+BEFFYdLRuqMfd5L84N1V5Vg==
+  dependencies:
+    shebang-regex "^1.0.0"
+
+shebang-regex@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3"
+  integrity sha512-wpoSFAxys6b2a2wHZ1XpDSgD7N9iVjg29Ph9uV/uaP9Ex/KXlkTZTeddxDPSYQpgvzKLGJke2UU0AzoGCjNIvQ==
+
+signal-exit@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
+  integrity sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=
+
+slice-ansi@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-2.1.0.tgz#cacd7693461a637a5788d92a7dd4fba068e81636"
+  integrity sha512-Qu+VC3EwYLldKa1fCxuuvULvSJOKEgk9pi8dZeCVK7TqBfUNTH4sFkk4joj8afVSfAYgJoSOetjx9QWOJ5mYoQ==
+  dependencies:
+    ansi-styles "^3.2.0"
+    astral-regex "^1.0.0"
+    is-fullwidth-code-point "^2.0.0"
+
+sprintf-js@~1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
+  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
+
+string-width@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-3.1.0.tgz#22767be21b62af1081574306f69ac51b62203961"
+  integrity sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==
+  dependencies:
+    emoji-regex "^7.0.1"
+    is-fullwidth-code-point "^2.0.0"
+    strip-ansi "^5.1.0"
+
+string-width@^4.1.0:
+  version "4.2.3"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-4.2.3.tgz#269c7117d27b05ad2e536830a8ec895ef9c6d010"
+  integrity sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==
+  dependencies:
+    emoji-regex "^8.0.0"
+    is-fullwidth-code-point "^3.0.0"
+    strip-ansi "^6.0.1"
+
+strip-ansi@^5.1.0, strip-ansi@^5.2.0:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-5.2.0.tgz#8c9a536feb6afc962bdfa5b104a5091c1ad9c0ae"
+  integrity sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==
+  dependencies:
+    ansi-regex "^4.1.0"
+
+strip-ansi@^6.0.0, strip-ansi@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9"
+  integrity sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==
+  dependencies:
+    ansi-regex "^5.0.1"
+
+strip-json-comments@^3.0.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^5.3.0:
+  version "5.5.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
+  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
+  dependencies:
+    has-flag "^3.0.0"
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+table@^5.2.3:
+  version "5.4.6"
+  resolved "https://registry.yarnpkg.com/table/-/table-5.4.6.tgz#1292d19500ce3f86053b05f0e8e7e4a3bb21079e"
+  integrity sha512-wmEc8m4fjnob4gt5riFRtTu/6+4rSe12TpAELNSqHMfF3IqnA+CH37USM6/YR3qRZv7e56kAEAtd6nKZaxe0Ug==
+  dependencies:
+    ajv "^6.10.2"
+    lodash "^4.17.14"
+    slice-ansi "^2.1.0"
+    string-width "^3.0.0"
+
+text-table@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==
+
+through@^2.3.6:
+  version "2.3.8"
+  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
+  integrity sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=
+
+tmp@^0.0.33:
+  version "0.0.33"
+  resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9"
+  integrity sha512-jRCJlojKnZ3addtTOjdIqoRuPEKBvNXcGYqzO6zWZX8KfKEpnGY5jfggJQ3EjKuu8D4bJRr0y+cYJFmYbImXGw==
+  dependencies:
+    os-tmpdir "~1.0.2"
+
+tslib@^1.9.0:
+  version "1.14.1"
+  resolved "https://registry.yarnpkg.com/tslib/-/tslib-1.14.1.tgz#cf2d38bdc34a134bcaf1091c41f6619e2f672d00"
+  integrity sha512-Xni35NKzjgMrwevysHTCArtLDpPvye8zV/0E4EyYn43P7/7qvQwPh9BGkHewbMulVntbigmcT7rdX3BNo9wRJg==
+
+type-check@~0.3.2:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
+  integrity sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=
+  dependencies:
+    prelude-ls "~1.1.2"
+
+type-fest@^0.21.3:
+  version "0.21.3"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.21.3.tgz#d260a24b0198436e133fa26a524a6d65fa3b2e37"
+  integrity sha512-t0rzBq87m3fVcduHDUFhKmyyX+9eo6WQjZvf51Ea/M0Q7+T374Jp1aUiyUl0GKxp8M/OETVHSDvmkyPgvX+X2w==
+
+type-fest@^0.8.1:
+  version "0.8.1"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.8.1.tgz#09e249ebde851d3b1e48d27c105444667f17b83d"
+  integrity sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+v8-compile-cache@^2.0.3:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/v8-compile-cache/-/v8-compile-cache-2.4.0.tgz#cdada8bec61e15865f05d097c5f4fd30e94dc128"
+  integrity sha512-ocyWc3bAHBB/guyqJQVI5o4BZkPhznPYUG2ea80Gond/BgNWpap8TOmLSeeQG7bnh2KMISxskdADG59j7zruhw==
+
+which@^1.2.9:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/which/-/which-1.3.1.tgz#a45043d54f5805316da8d62f9f50918d3da70b0a"
+  integrity sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@~1.2.3:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
+
+write@1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/write/-/write-1.0.3.tgz#0800e14523b923a387e415123c865616aae0f5c3"
+  integrity sha512-/lg70HAjtkUgWPVZhZcm+T4hkL8Zbtp1nFNOn3lRrxnlv50SRBv7cR7RqR+GMsd3hUXy9hWBo4CHTbFTcOYwig==
+  dependencies:
+    mkdirp "^0.5.1"
diff --git a/fixtures/eslint-v7/.eslintrc.json b/fixtures/eslint-v7/.eslintrc.json
new file mode 100644
index 0000000000000..33b2cfaacabcd
--- /dev/null
+++ b/fixtures/eslint-v7/.eslintrc.json
@@ -0,0 +1,14 @@
+{
+  "root": true,
+  "extends": ["plugin:react-hooks/recommended-legacy"],
+  "parserOptions": {
+    "ecmaVersion": 2020,
+    "sourceType": "module",
+    "ecmaFeatures": {
+      "jsx": true
+    }
+  },
+  "rules": {
+    "react-hooks/exhaustive-deps": "error"
+  }
+}
diff --git a/fixtures/eslint-v7/README.md b/fixtures/eslint-v7/README.md
new file mode 100644
index 0000000000000..ea4628b0e035a
--- /dev/null
+++ b/fixtures/eslint-v7/README.md
@@ -0,0 +1,12 @@
+# ESLint v7 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 7.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v7
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v7/build.mjs b/fixtures/eslint-v7/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v7/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v7/index.js b/fixtures/eslint-v7/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v7/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v7/package.json b/fixtures/eslint-v7/package.json
new file mode 100644
index 0000000000000..90c369c603e6d
--- /dev/null
+++ b/fixtures/eslint-v7/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v7",
+  "dependencies": {
+    "eslint": "^7",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v7/yarn.lock b/fixtures/eslint-v7/yarn.lock
new file mode 100644
index 0000000000000..62f97bbc20d69
--- /dev/null
+++ b/fixtures/eslint-v7/yarn.lock
@@ -0,0 +1,769 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@babel/code-frame@7.12.11":
+  version "7.12.11"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.12.11.tgz#f4ad435aa263db935b8f10f2c552d23fb716a63f"
+  integrity sha512-Zt1yodBx1UcyiePMSkWnU4hPqhwq7hGi2nFL1LeA3EUl+q2LQx16MISgJ0+z7dnmgvP9QtIleuETGOiOH1RcIw==
+  dependencies:
+    "@babel/highlight" "^7.10.4"
+
+"@babel/helper-validator-identifier@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz#24b64e2c3ec7cd3b3c547729b8d16871f22cbdc7"
+  integrity sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==
+
+"@babel/highlight@^7.10.4":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/highlight/-/highlight-7.25.9.tgz#8141ce68fc73757946f983b343f1231f4691acc6"
+  integrity sha512-llL88JShoCsth8fF8R4SJnIn+WLvR6ccFxu1H3FlMhDontdcmZWf2HgIZ7AIqV3Xcck1idlohrN4EUBQz6klbw==
+  dependencies:
+    "@babel/helper-validator-identifier" "^7.25.9"
+    chalk "^2.4.2"
+    js-tokens "^4.0.0"
+    picocolors "^1.0.0"
+
+"@eslint/eslintrc@^0.4.3":
+  version "0.4.3"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-0.4.3.tgz#9e42981ef035beb3dd49add17acb96e8ff6f394c"
+  integrity sha512-J6KFFz5QCYUJq3pf0mjEcCJVERbzv71PUIDczuh9JkwGEzced6CO5ADLHB1rbf/+oPBtoPfMYNOpGDzCANlbXw==
+  dependencies:
+    ajv "^6.12.4"
+    debug "^4.1.1"
+    espree "^7.3.0"
+    globals "^13.9.0"
+    ignore "^4.0.6"
+    import-fresh "^3.2.1"
+    js-yaml "^3.13.1"
+    minimatch "^3.0.4"
+    strip-json-comments "^3.1.1"
+
+"@humanwhocodes/config-array@^0.5.0":
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/config-array/-/config-array-0.5.0.tgz#1407967d4c6eecd7388f83acf1eaf4d0c6e58ef9"
+  integrity sha512-FagtKFz74XrTl7y6HCzQpwDfXP0yhxe9lHLD1UZxjvZIcbyRz8zTFF/yYNfSfzU414eDwZ1SrO0Qvtyf+wFMQg==
+  dependencies:
+    "@humanwhocodes/object-schema" "^1.2.0"
+    debug "^4.1.1"
+    minimatch "^3.0.4"
+
+"@humanwhocodes/object-schema@^1.2.0":
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/object-schema/-/object-schema-1.2.1.tgz#b520529ec21d8e5945a1851dfd1c32e94e39ff45"
+  integrity sha512-ZnQMnLV4e7hDlUvw8H+U8ASL02SS2Gn6+9Ac3wGGLIe7+je2AeAOxPY+izIPJDfFDb7eDjev0Us8MO1iFRN8hA==
+
+acorn-jsx@^5.3.1:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^7.4.0:
+  version "7.4.1"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-7.4.1.tgz#feaed255973d2e77555b83dbc08851a6c63520fa"
+  integrity sha512-nQyp0o1/mNdbTO1PO6kHkwSrmgZ0MT/jCCpNiwbUjGoRN4dlBhqJtoQuCnEOKzgTVwg0ZWiCoQy6SxMebQVh8A==
+
+ajv@^6.10.0, ajv@^6.12.4:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ajv@^8.0.1:
+  version "8.17.1"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-8.17.1.tgz#37d9a5c776af6bc92d7f4f9510eba4c0a60d11a6"
+  integrity sha512-B/gBuNg5SiMTrPkC+A2+cW0RszwxYmn6VYxB/inlBStS5nx6xHIt/ehKRhIMhqusl7a8LjQoZnjCs5vhwxOQ1g==
+  dependencies:
+    fast-deep-equal "^3.1.3"
+    fast-uri "^3.0.1"
+    json-schema-traverse "^1.0.0"
+    require-from-string "^2.0.2"
+
+ansi-colors@^4.1.1:
+  version "4.1.3"
+  resolved "https://registry.yarnpkg.com/ansi-colors/-/ansi-colors-4.1.3.tgz#37611340eb2243e70cc604cad35d63270d48781b"
+  integrity sha512-/6w/C21Pm1A7aZitlI5Ni/2J6FFQN8i1Cvz3kHABAAbw93v/NlvKdVOqz7CCWz/3iv/JplRSEEZ83XION15ovw==
+
+ansi-regex@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304"
+  integrity sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==
+
+ansi-styles@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
+  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
+  dependencies:
+    color-convert "^1.9.0"
+
+ansi-styles@^4.0.0, ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^1.0.7:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
+  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
+  dependencies:
+    sprintf-js "~1.0.2"
+
+astral-regex@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/astral-regex/-/astral-regex-2.0.0.tgz#483143c567aeed4785759c0865786dc77d7d2e31"
+  integrity sha512-Z7tMw1ytTXt5jqMcOP+OQteU1VuNK9Y02uuJtKQ1Sv69jXQKKg5cibLwGJow8yzZP+eAc18EmLGPal0bp36rvQ==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^2.4.2:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
+  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
+  dependencies:
+    ansi-styles "^3.2.1"
+    escape-string-regexp "^1.0.5"
+    supports-color "^5.3.0"
+
+chalk@^4.0.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+color-convert@^1.9.0:
+  version "1.9.3"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
+  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
+  dependencies:
+    color-name "1.1.3"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
+  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^7.0.2:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.6.tgz#8a58fe78f00dcd70c370451759dfbfaf03e8ee9f"
+  integrity sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==
+  dependencies:
+    path-key "^3.1.0"
+    shebang-command "^2.0.0"
+    which "^2.0.1"
+
+debug@^4.0.1, debug@^4.1.1:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.4.tgz#a6f2dce612fadd2ef1f519b73551f17e85199831"
+  integrity sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==
+
+doctrine@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961"
+  integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==
+  dependencies:
+    esutils "^2.0.2"
+
+emoji-regex@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37"
+  integrity sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==
+
+enquirer@^2.3.5:
+  version "2.4.1"
+  resolved "https://registry.yarnpkg.com/enquirer/-/enquirer-2.4.1.tgz#93334b3fbd74fc7097b224ab4a8fb7e40bf4ae56"
+  integrity sha512-rRqJg/6gd538VHvR3PSrdRBb/1Vy2YfzHqzvbhGIQpDRKIa4FgV/54b5Q1xYSxOOwKvjXweS26E0Q+nAMwp2pQ==
+  dependencies:
+    ansi-colors "^4.1.1"
+    strip-ansi "^6.0.1"
+
+escape-string-regexp@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
+  integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
+
+escape-string-regexp@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
+  integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^5.1.1:
+  version "5.1.1"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-5.1.1.tgz#e786e59a66cb92b3f6c1fb0d508aab174848f48c"
+  integrity sha512-2NxwbF/hZ0KpepYN0cNbo+FN6XoK7GaHlQhgx/hIZl6Va0bF45RQOOwhLIy8lQDbuCiadSLCBnH2CFYquit5bw==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^4.1.1"
+
+eslint-utils@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/eslint-utils/-/eslint-utils-2.1.0.tgz#d2de5e03424e707dc10c74068ddedae708741b27"
+  integrity sha512-w94dQYoauyvlDc43XnGB8lU3Zt713vNChgt4EWwhXAP2XkBvndfxF0AgIqKOOasjPIPzj9JqgwkwbCYD0/V3Zg==
+  dependencies:
+    eslint-visitor-keys "^1.1.0"
+
+eslint-visitor-keys@^1.1.0, eslint-visitor-keys@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.3.0.tgz#30ebd1ef7c2fdff01c3a4f151044af25fab0523e"
+  integrity sha512-6J72N8UNa462wa/KFODt/PJ3IU60SDpC3QXC1Hjc1BXXpfL2C9R5+AU7jhe0F6GREqVMh4Juu+NY7xn+6dipUQ==
+
+eslint-visitor-keys@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-2.1.0.tgz#f65328259305927392c938ed44eb0a5c9b2bd303"
+  integrity sha512-0rSmRBzXgDzIsD6mGdJgevzgezI534Cer5L/vyMX0kHzT/jiB43jRhd9YUlMGYLQy2zprNmoT8qasCGtY+QaKw==
+
+eslint@^7:
+  version "7.32.0"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-7.32.0.tgz#c6d328a14be3fb08c8d1d21e12c02fdb7a2a812d"
+  integrity sha512-VHZ8gX+EDfz+97jGcgyGCyRia/dPOd6Xh9yPv8Bl1+SoaIwD+a/vlrOmGRUyOYu7MwUhc7CxqeaDZU13S4+EpA==
+  dependencies:
+    "@babel/code-frame" "7.12.11"
+    "@eslint/eslintrc" "^0.4.3"
+    "@humanwhocodes/config-array" "^0.5.0"
+    ajv "^6.10.0"
+    chalk "^4.0.0"
+    cross-spawn "^7.0.2"
+    debug "^4.0.1"
+    doctrine "^3.0.0"
+    enquirer "^2.3.5"
+    escape-string-regexp "^4.0.0"
+    eslint-scope "^5.1.1"
+    eslint-utils "^2.1.0"
+    eslint-visitor-keys "^2.0.0"
+    espree "^7.3.1"
+    esquery "^1.4.0"
+    esutils "^2.0.2"
+    fast-deep-equal "^3.1.3"
+    file-entry-cache "^6.0.1"
+    functional-red-black-tree "^1.0.1"
+    glob-parent "^5.1.2"
+    globals "^13.6.0"
+    ignore "^4.0.6"
+    import-fresh "^3.0.0"
+    imurmurhash "^0.1.4"
+    is-glob "^4.0.0"
+    js-yaml "^3.13.1"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    levn "^0.4.1"
+    lodash.merge "^4.6.2"
+    minimatch "^3.0.4"
+    natural-compare "^1.4.0"
+    optionator "^0.9.1"
+    progress "^2.0.0"
+    regexpp "^3.1.0"
+    semver "^7.2.1"
+    strip-ansi "^6.0.0"
+    strip-json-comments "^3.1.0"
+    table "^6.0.9"
+    text-table "^0.2.0"
+    v8-compile-cache "^2.0.3"
+
+espree@^7.3.0, espree@^7.3.1:
+  version "7.3.1"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-7.3.1.tgz#f2df330b752c6f55019f8bd89b7660039c1bbbb6"
+  integrity sha512-v3JCNCE64umkFpmkFGqzVKsOT0tN1Zr+ueqLZfpV1Ob8e+CEgPWa+OxCoGH3tnhimMKIaBm4m/vaRpJ/krRz2g==
+  dependencies:
+    acorn "^7.4.0"
+    acorn-jsx "^5.3.1"
+    eslint-visitor-keys "^1.3.0"
+
+esprima@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
+  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
+
+esquery@^1.4.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
+  integrity sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+fast-deep-equal@^3.1.1, fast-deep-equal@^3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@^2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+fast-uri@^3.0.1:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/fast-uri/-/fast-uri-3.0.6.tgz#88f130b77cfaea2378d56bf970dea21257a68748"
+  integrity sha512-Atfo14OibSv5wAp4VWNsFYE1AchQRTv9cBGWET4pZWHzYshFSS9NQI6I57rdKn9croWVMbYFbLhJ+yJvmZIIHw==
+
+file-entry-cache@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-6.0.1.tgz#211b2dd9659cb0394b073e7323ac3c933d522027"
+  integrity sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==
+  dependencies:
+    flat-cache "^3.0.4"
+
+flat-cache@^3.0.4:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-3.2.0.tgz#2c0c2d5040c99b1632771a9d105725c0115363ee"
+  integrity sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==
+  dependencies:
+    flatted "^3.2.9"
+    keyv "^4.5.3"
+    rimraf "^3.0.2"
+
+flatted@^3.2.9:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.3.2.tgz#adba1448a9841bec72b42c532ea23dbbedef1a27"
+  integrity sha512-AiwGJM8YcNOaobumgtng+6NHuOqC3A7MixFeDafM3X9cIUM+xUXoS5Vfgf+OihAYe20fxqNM9yPBXJzRtZ/4eA==
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
+
+functional-red-black-tree@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327"
+  integrity sha512-dsKNQNdj6xA3T+QlADDA7mOSlX0qiMINjn0cgr+eGHGsbSHzTabcIogz2+p/iqP1Xs6EP/sS2SbqH+brGTbq0g==
+
+glob-parent@^5.1.2:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4"
+  integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==
+  dependencies:
+    is-glob "^4.0.1"
+
+glob@^7.1.3:
+  version "7.1.3"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
+  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+globals@^13.6.0, globals@^13.9.0:
+  version "13.24.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-13.24.0.tgz#8432a19d78ce0c1e833949c36adb345400bb1171"
+  integrity sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==
+  dependencies:
+    type-fest "^0.20.2"
+
+has-flag@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
+  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+ignore@^4.0.6:
+  version "4.0.6"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-4.0.6.tgz#750e3db5862087b4737ebac8207ffd1ef27b25fc"
+  integrity sha512-cyFDKrqc/YdcWFniJhzI42+AzS+gNwmUzOSFcRCQYwySuBBBy/KjuxWLZ/FHEH6Moq1NizMOBWyTcv8O4OZIMg==
+
+import-fresh@^3.0.0, import-fresh@^3.2.1:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-fullwidth-code-point@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz#f116f8064fe90b3f7844a38997c0b75051269f1d"
+  integrity sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==
+
+is-glob@^4.0.0, is-glob@^4.0.1:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-tokens@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499"
+  integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==
+
+js-yaml@^3.13.1:
+  version "3.14.1"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.14.1.tgz#dae812fdb3825fa306609a8717383c50c36a0537"
+  integrity sha512-okMH7OXXJ7YrN9Ok3/SXrnu4iX9yOk+25nqX4imS2npuvTYDmo/QEZoqwZkYaIDk3jVvBOTOIEgEhaLOynBS9g==
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^4.0.0"
+
+json-buffer@3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.1.tgz#9338802a30d3b6605fbe0613e094008ca8c05a13"
+  integrity sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-schema-traverse@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-1.0.0.tgz#ae7bcb3656ab77a73ba5c49bf654f38e6b6860e2"
+  integrity sha512-NM8/P9n3XjXhIZn1lLhkFaACTOURQXjWhV4BA/RnOv8xvgqtqpAX9IO4mRQxSx1Rlo4tqzeqb0sOlruaOy3dug==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+keyv@^4.5.3:
+  version "4.5.4"
+  resolved "https://registry.yarnpkg.com/keyv/-/keyv-4.5.4.tgz#a879a99e29452f942439f2a405e3af8b31d4de93"
+  integrity sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==
+  dependencies:
+    json-buffer "3.0.1"
+
+levn@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.4.1.tgz#ae4562c007473b932a6200d403268dd2fffc6ade"
+  integrity sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==
+  dependencies:
+    prelude-ls "^1.2.1"
+    type-check "~0.4.0"
+
+lodash.merge@^4.6.2:
+  version "4.6.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.2.tgz#558aa53b43b661e1925a0afdfa36a9a1085fe57a"
+  integrity sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==
+
+lodash.truncate@^4.4.2:
+  version "4.4.2"
+  resolved "https://registry.yarnpkg.com/lodash.truncate/-/lodash.truncate-4.4.2.tgz#5a350da0b1113b837ecfffd5812cbe58d6eae193"
+  integrity sha512-jttmRe7bRse52OsWIMDLaXxWqRAmtIUccAQ3garviCqJjafXOfNMO0yMfNpdD6zbGaTU0P5Nz7e7gAT6cKmJRw==
+
+minimatch@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+once@^1.3.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+  dependencies:
+    wrappy "1"
+
+optionator@^0.9.1:
+  version "0.9.4"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.9.4.tgz#7ea1c1a5d91d764fb282139c88fe11e182a3a734"
+  integrity sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==
+  dependencies:
+    deep-is "^0.1.3"
+    fast-levenshtein "^2.0.6"
+    levn "^0.4.1"
+    prelude-ls "^1.2.1"
+    type-check "^0.4.0"
+    word-wrap "^1.2.5"
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-is-absolute@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
+
+path-key@^3.1.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-3.1.1.tgz#581f6ade658cbba65a0d3380de7753295054f375"
+  integrity sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==
+
+picocolors@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
+  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
+
+prelude-ls@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.2.1.tgz#debc6489d7a6e6b0e7611888cec880337d316396"
+  integrity sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==
+
+progress@^2.0.0:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8"
+  integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+regexpp@^3.1.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/regexpp/-/regexpp-3.2.0.tgz#0425a2768d8f23bad70ca4b90461fa2f1213e1b2"
+  integrity sha512-pq2bWo9mVD43nbts2wGv17XLiNLya+GklZ8kaDLV2Z08gDCsGpnKn9BFMepvWuHCbyVvY7J5o5+BVvoQbmlJLg==
+
+require-from-string@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/require-from-string/-/require-from-string-2.0.2.tgz#89a7fdd938261267318eafe14f9c32e598c36909"
+  integrity sha512-Xf0nWe6RseziFMu+Ap9biiUbmplq6S9/p+7w7YXP/JBHhrUDDUhwa+vANyubuqfZWTveU//DYVGsDG7RKL/vEw==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+rimraf@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-3.0.2.tgz#f1a5402ba6220ad52cc1282bac1ae3aa49fd061a"
+  integrity sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==
+  dependencies:
+    glob "^7.1.3"
+
+semver@^7.2.1:
+  version "7.7.1"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-7.7.1.tgz#abd5098d82b18c6c81f6074ff2647fd3e7220c9f"
+  integrity sha512-hlq8tAfn0m/61p4BVRcPzIGr6LKiMwo4VM6dGi6pt4qcRkmNzTcWq6eCEjEh+qXjkMDvPlOFFSGwQjoEa6gyMA==
+
+shebang-command@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-2.0.0.tgz#ccd0af4f8835fbdc265b82461aaf0c36663f34ea"
+  integrity sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==
+  dependencies:
+    shebang-regex "^3.0.0"
+
+shebang-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-3.0.0.tgz#ae16f1644d873ecad843b0307b143362d4c42172"
+  integrity sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==
+
+slice-ansi@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-4.0.0.tgz#500e8dd0fd55b05815086255b3195adf2a45fe6b"
+  integrity sha512-qMCMfhY040cVHT43K9BFygqYbUPFZKHOg7K73mtTWJRb8pyP3fzf4Ixd5SzdEJQ6MRUg/WBnOLxghZtKKurENQ==
+  dependencies:
+    ansi-styles "^4.0.0"
+    astral-regex "^2.0.0"
+    is-fullwidth-code-point "^3.0.0"
+
+sprintf-js@~1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
+  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
+
+string-width@^4.2.3:
+  version "4.2.3"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-4.2.3.tgz#269c7117d27b05ad2e536830a8ec895ef9c6d010"
+  integrity sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==
+  dependencies:
+    emoji-regex "^8.0.0"
+    is-fullwidth-code-point "^3.0.0"
+    strip-ansi "^6.0.1"
+
+strip-ansi@^6.0.0, strip-ansi@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9"
+  integrity sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==
+  dependencies:
+    ansi-regex "^5.0.1"
+
+strip-json-comments@^3.1.0, strip-json-comments@^3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^5.3.0:
+  version "5.5.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
+  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
+  dependencies:
+    has-flag "^3.0.0"
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+table@^6.0.9:
+  version "6.9.0"
+  resolved "https://registry.yarnpkg.com/table/-/table-6.9.0.tgz#50040afa6264141c7566b3b81d4d82c47a8668f5"
+  integrity sha512-9kY+CygyYM6j02t5YFHbNz2FN5QmYGv9zAjVp4lCDjlCw7amdckXlEt/bjMhUIfj4ThGRE4gCUH5+yGnNuPo5A==
+  dependencies:
+    ajv "^8.0.1"
+    lodash.truncate "^4.4.2"
+    slice-ansi "^4.0.0"
+    string-width "^4.2.3"
+    strip-ansi "^6.0.1"
+
+text-table@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==
+
+type-check@^0.4.0, type-check@~0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"
+  integrity sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==
+  dependencies:
+    prelude-ls "^1.2.1"
+
+type-fest@^0.20.2:
+  version "0.20.2"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.20.2.tgz#1bf207f4b28f91583666cb5fbd327887301cd5f4"
+  integrity sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+v8-compile-cache@^2.0.3:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/v8-compile-cache/-/v8-compile-cache-2.4.0.tgz#cdada8bec61e15865f05d097c5f4fd30e94dc128"
+  integrity sha512-ocyWc3bAHBB/guyqJQVI5o4BZkPhznPYUG2ea80Gond/BgNWpap8TOmLSeeQG7bnh2KMISxskdADG59j7zruhw==
+
+which@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/which/-/which-2.0.2.tgz#7c6a8dd0a636a0327e10b59c9286eee93f3f51b1"
+  integrity sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@^1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
diff --git a/fixtures/eslint-v8/.eslintrc.json b/fixtures/eslint-v8/.eslintrc.json
new file mode 100644
index 0000000000000..33b2cfaacabcd
--- /dev/null
+++ b/fixtures/eslint-v8/.eslintrc.json
@@ -0,0 +1,14 @@
+{
+  "root": true,
+  "extends": ["plugin:react-hooks/recommended-legacy"],
+  "parserOptions": {
+    "ecmaVersion": 2020,
+    "sourceType": "module",
+    "ecmaFeatures": {
+      "jsx": true
+    }
+  },
+  "rules": {
+    "react-hooks/exhaustive-deps": "error"
+  }
+}
diff --git a/fixtures/eslint-v8/README.md b/fixtures/eslint-v8/README.md
new file mode 100644
index 0000000000000..da220cef5cbdc
--- /dev/null
+++ b/fixtures/eslint-v8/README.md
@@ -0,0 +1,12 @@
+# ESLint v8 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 8.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v8
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v8/build.mjs b/fixtures/eslint-v8/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v8/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v8/index.js b/fixtures/eslint-v8/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v8/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v8/package.json b/fixtures/eslint-v8/package.json
new file mode 100644
index 0000000000000..620520ecdbfd4
--- /dev/null
+++ b/fixtures/eslint-v8/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v8",
+  "dependencies": {
+    "eslint": "^8",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v8/yarn.lock b/fixtures/eslint-v8/yarn.lock
new file mode 100644
index 0000000000000..88d04029954a4
--- /dev/null
+++ b/fixtures/eslint-v8/yarn.lock
@@ -0,0 +1,676 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@eslint-community/eslint-utils@^4.2.0":
+  version "4.4.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/eslint-utils/-/eslint-utils-4.4.1.tgz#d1145bf2c20132d6400495d6df4bf59362fd9d56"
+  integrity sha512-s3O3waFUrMV8P/XaF/+ZTp1X9XBZW1a4B97ZnjQF2KYWaFD2A8KyFBsrsfSjEmjn3RGWAIuvlneuZm3CUK3jbA==
+  dependencies:
+    eslint-visitor-keys "^3.4.3"
+
+"@eslint-community/regexpp@^4.6.1":
+  version "4.12.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
+  integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
+
+"@eslint/eslintrc@^2.1.4":
+  version "2.1.4"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-2.1.4.tgz#388a269f0f25c1b6adc317b5a2c55714894c70ad"
+  integrity sha512-269Z39MS6wVJtsoUl10L60WdkhJVdPG24Q4eZTH3nnF6lpvSShEK3wQjDX9JRWAUPvPh7COouPpU9IrqaZFvtQ==
+  dependencies:
+    ajv "^6.12.4"
+    debug "^4.3.2"
+    espree "^9.6.0"
+    globals "^13.19.0"
+    ignore "^5.2.0"
+    import-fresh "^3.2.1"
+    js-yaml "^4.1.0"
+    minimatch "^3.1.2"
+    strip-json-comments "^3.1.1"
+
+"@eslint/js@8.57.1":
+  version "8.57.1"
+  resolved "https://registry.yarnpkg.com/@eslint/js/-/js-8.57.1.tgz#de633db3ec2ef6a3c89e2f19038063e8a122e2c2"
+  integrity sha512-d9zaMRSTIKDLhctzH12MtXvJKSSUhaHcjV+2Z+GK+EEY7XKpP5yR4x+N3TAcHTcu963nIr+TMcCb4DBCYX1z6Q==
+
+"@humanwhocodes/config-array@^0.13.0":
+  version "0.13.0"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/config-array/-/config-array-0.13.0.tgz#fb907624df3256d04b9aa2df50d7aa97ec648748"
+  integrity sha512-DZLEEqFWQFiyK6h5YIeynKx7JlvCYWL0cImfSRXZ9l4Sg2efkFGTuFf6vzXjK1cq6IYkU+Eg/JizXw+TD2vRNw==
+  dependencies:
+    "@humanwhocodes/object-schema" "^2.0.3"
+    debug "^4.3.1"
+    minimatch "^3.0.5"
+
+"@humanwhocodes/module-importer@^1.0.1":
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz#af5b2691a22b44be847b0ca81641c5fb6ad0172c"
+  integrity sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==
+
+"@humanwhocodes/object-schema@^2.0.3":
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/object-schema/-/object-schema-2.0.3.tgz#4a2868d75d6d6963e423bcf90b7fd1be343409d3"
+  integrity sha512-93zYdMES/c1D69yZiKDBj0V24vqNzB/koF26KPaagAfd3P/4gUlh3Dys5ogAK+Exi9QyzlD8x/08Zt7wIKcDcA==
+
+"@nodelib/fs.scandir@2.1.5":
+  version "2.1.5"
+  resolved "https://registry.yarnpkg.com/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz#7619c2eb21b25483f6d167548b4cfd5a7488c3d5"
+  integrity sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==
+  dependencies:
+    "@nodelib/fs.stat" "2.0.5"
+    run-parallel "^1.1.9"
+
+"@nodelib/fs.stat@2.0.5":
+  version "2.0.5"
+  resolved "https://registry.yarnpkg.com/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz#5bd262af94e9d25bd1e71b05deed44876a222e8b"
+  integrity sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==
+
+"@nodelib/fs.walk@^1.2.8":
+  version "1.2.8"
+  resolved "https://registry.yarnpkg.com/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz#e95737e8bb6746ddedf69c556953494f196fe69a"
+  integrity sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==
+  dependencies:
+    "@nodelib/fs.scandir" "2.1.5"
+    fastq "^1.6.0"
+
+"@ungap/structured-clone@^1.2.0":
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/@ungap/structured-clone/-/structured-clone-1.3.0.tgz#d06bbb384ebcf6c505fde1c3d0ed4ddffe0aaff8"
+  integrity sha512-WmoN8qaIAo7WTYWbAZuG8PYEhn5fkz7dZrqTBZ7dtt//lL2Gwms1IcnQ5yHqjDfX8Ft5j4YzDM23f87zBfDe9g==
+
+acorn-jsx@^5.3.2:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^8.9.0:
+  version "8.14.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.14.0.tgz#063e2c70cac5fb4f6467f0b11152e04c682795b0"
+  integrity sha512-cl669nCJTZBsL97OF4kUQm5g5hC2uihk0NxY3WENAC0TYdILVkAyHymAntgxGkl7K+t0cXIrH5siy5S4XkFycA==
+
+ajv@^6.12.4:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ansi-regex@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304"
+  integrity sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==
+
+ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-2.0.1.tgz#246f50f3ca78a3240f6c997e8a9bd1eac49e4b38"
+  integrity sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^4.0.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^7.0.2:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.6.tgz#8a58fe78f00dcd70c370451759dfbfaf03e8ee9f"
+  integrity sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==
+  dependencies:
+    path-key "^3.1.0"
+    shebang-command "^2.0.0"
+    which "^2.0.1"
+
+debug@^4.3.1, debug@^4.3.2:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.4.tgz#a6f2dce612fadd2ef1f519b73551f17e85199831"
+  integrity sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==
+
+doctrine@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961"
+  integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==
+  dependencies:
+    esutils "^2.0.2"
+
+escape-string-regexp@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
+  integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^7.2.2:
+  version "7.2.2"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-7.2.2.tgz#deb4f92563390f32006894af62a22dba1c46423f"
+  integrity sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^5.2.0"
+
+eslint-visitor-keys@^3.4.1, eslint-visitor-keys@^3.4.3:
+  version "3.4.3"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz#0cd72fe8550e3c2eae156a96a4dddcd1c8ac5800"
+  integrity sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==
+
+eslint@^8:
+  version "8.57.1"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-8.57.1.tgz#7df109654aba7e3bbe5c8eae533c5e461d3c6ca9"
+  integrity sha512-ypowyDxpVSYpkXr9WPv2PAZCtNip1Mv5KTW0SCurXv/9iOpcrH9PaqUElksqEB6pChqHGDRCFTyrZlGhnLNGiA==
+  dependencies:
+    "@eslint-community/eslint-utils" "^4.2.0"
+    "@eslint-community/regexpp" "^4.6.1"
+    "@eslint/eslintrc" "^2.1.4"
+    "@eslint/js" "8.57.1"
+    "@humanwhocodes/config-array" "^0.13.0"
+    "@humanwhocodes/module-importer" "^1.0.1"
+    "@nodelib/fs.walk" "^1.2.8"
+    "@ungap/structured-clone" "^1.2.0"
+    ajv "^6.12.4"
+    chalk "^4.0.0"
+    cross-spawn "^7.0.2"
+    debug "^4.3.2"
+    doctrine "^3.0.0"
+    escape-string-regexp "^4.0.0"
+    eslint-scope "^7.2.2"
+    eslint-visitor-keys "^3.4.3"
+    espree "^9.6.1"
+    esquery "^1.4.2"
+    esutils "^2.0.2"
+    fast-deep-equal "^3.1.3"
+    file-entry-cache "^6.0.1"
+    find-up "^5.0.0"
+    glob-parent "^6.0.2"
+    globals "^13.19.0"
+    graphemer "^1.4.0"
+    ignore "^5.2.0"
+    imurmurhash "^0.1.4"
+    is-glob "^4.0.0"
+    is-path-inside "^3.0.3"
+    js-yaml "^4.1.0"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    levn "^0.4.1"
+    lodash.merge "^4.6.2"
+    minimatch "^3.1.2"
+    natural-compare "^1.4.0"
+    optionator "^0.9.3"
+    strip-ansi "^6.0.1"
+    text-table "^0.2.0"
+
+espree@^9.6.0, espree@^9.6.1:
+  version "9.6.1"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-9.6.1.tgz#a2a17b8e434690a5432f2f8018ce71d331a48c6f"
+  integrity sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==
+  dependencies:
+    acorn "^8.9.0"
+    acorn-jsx "^5.3.2"
+    eslint-visitor-keys "^3.4.1"
+
+esquery@^1.4.2:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+fast-deep-equal@^3.1.1, fast-deep-equal@^3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@^2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+fastq@^1.6.0:
+  version "1.19.0"
+  resolved "https://registry.yarnpkg.com/fastq/-/fastq-1.19.0.tgz#a82c6b7c2bb4e44766d865f07997785fecfdcb89"
+  integrity sha512-7SFSRCNjBQIZH/xZR3iy5iQYR8aGBE0h3VG6/cwlbrpdciNYBMotQav8c1XI3HjHH+NikUpP53nPdlZSdWmFzA==
+  dependencies:
+    reusify "^1.0.4"
+
+file-entry-cache@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-6.0.1.tgz#211b2dd9659cb0394b073e7323ac3c933d522027"
+  integrity sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==
+  dependencies:
+    flat-cache "^3.0.4"
+
+find-up@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-5.0.0.tgz#4c92819ecb7083561e4f4a240a86be5198f536fc"
+  integrity sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==
+  dependencies:
+    locate-path "^6.0.0"
+    path-exists "^4.0.0"
+
+flat-cache@^3.0.4:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-3.2.0.tgz#2c0c2d5040c99b1632771a9d105725c0115363ee"
+  integrity sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==
+  dependencies:
+    flatted "^3.2.9"
+    keyv "^4.5.3"
+    rimraf "^3.0.2"
+
+flatted@^3.2.9:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.3.2.tgz#adba1448a9841bec72b42c532ea23dbbedef1a27"
+  integrity sha512-AiwGJM8YcNOaobumgtng+6NHuOqC3A7MixFeDafM3X9cIUM+xUXoS5Vfgf+OihAYe20fxqNM9yPBXJzRtZ/4eA==
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
+
+glob-parent@^6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-6.0.2.tgz#6d237d99083950c79290f24c7642a3de9a28f9e3"
+  integrity sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==
+  dependencies:
+    is-glob "^4.0.3"
+
+glob@^7.1.3:
+  version "7.1.3"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
+  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+globals@^13.19.0:
+  version "13.24.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-13.24.0.tgz#8432a19d78ce0c1e833949c36adb345400bb1171"
+  integrity sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==
+  dependencies:
+    type-fest "^0.20.2"
+
+graphemer@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/graphemer/-/graphemer-1.4.0.tgz#fb2f1d55e0e3a1849aeffc90c4fa0dd53a0e66c6"
+  integrity sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+ignore@^5.2.0:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.2.tgz#3cd40e729f3643fd87cb04e50bf0eb722bc596f5"
+  integrity sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==
+
+import-fresh@^3.2.1:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-glob@^4.0.0, is-glob@^4.0.3:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+is-path-inside@^3.0.3:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-3.0.3.tgz#d231362e53a07ff2b0e0ea7fed049161ffd16283"
+  integrity sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-yaml@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-4.1.0.tgz#c1fb65f8f5017901cdd2c951864ba18458a10602"
+  integrity sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==
+  dependencies:
+    argparse "^2.0.1"
+
+json-buffer@3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.1.tgz#9338802a30d3b6605fbe0613e094008ca8c05a13"
+  integrity sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+keyv@^4.5.3:
+  version "4.5.4"
+  resolved "https://registry.yarnpkg.com/keyv/-/keyv-4.5.4.tgz#a879a99e29452f942439f2a405e3af8b31d4de93"
+  integrity sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==
+  dependencies:
+    json-buffer "3.0.1"
+
+levn@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.4.1.tgz#ae4562c007473b932a6200d403268dd2fffc6ade"
+  integrity sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==
+  dependencies:
+    prelude-ls "^1.2.1"
+    type-check "~0.4.0"
+
+locate-path@^6.0.0:
+  version "6.0.0"
+  resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-6.0.0.tgz#55321eb309febbc59c4801d931a72452a681d286"
+  integrity sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==
+  dependencies:
+    p-locate "^5.0.0"
+
+lodash.merge@^4.6.2:
+  version "4.6.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.2.tgz#558aa53b43b661e1925a0afdfa36a9a1085fe57a"
+  integrity sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==
+
+minimatch@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+minimatch@^3.0.5, minimatch@^3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.1.2.tgz#19cd194bfd3e428f049a70817c038d89ab4be35b"
+  integrity sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+once@^1.3.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+  dependencies:
+    wrappy "1"
+
+optionator@^0.9.3:
+  version "0.9.4"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.9.4.tgz#7ea1c1a5d91d764fb282139c88fe11e182a3a734"
+  integrity sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==
+  dependencies:
+    deep-is "^0.1.3"
+    fast-levenshtein "^2.0.6"
+    levn "^0.4.1"
+    prelude-ls "^1.2.1"
+    type-check "^0.4.0"
+    word-wrap "^1.2.5"
+
+p-limit@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-3.1.0.tgz#e1daccbe78d0d1388ca18c64fea38e3e57e3706b"
+  integrity sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==
+  dependencies:
+    yocto-queue "^0.1.0"
+
+p-locate@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-5.0.0.tgz#83c8315c6785005e3bd021839411c9e110e6d834"
+  integrity sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==
+  dependencies:
+    p-limit "^3.0.2"
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-exists@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-4.0.0.tgz#513bdbe2d3b95d7762e8c1137efa195c6c61b5b3"
+  integrity sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==
+
+path-is-absolute@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
+
+path-key@^3.1.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-3.1.1.tgz#581f6ade658cbba65a0d3380de7753295054f375"
+  integrity sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==
+
+prelude-ls@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.2.1.tgz#debc6489d7a6e6b0e7611888cec880337d316396"
+  integrity sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+queue-microtask@^1.2.2:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/queue-microtask/-/queue-microtask-1.2.3.tgz#4929228bbc724dfac43e0efb058caf7b6cfb6243"
+  integrity sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+reusify@^1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/reusify/-/reusify-1.0.4.tgz#90da382b1e126efc02146e90845a88db12925d76"
+  integrity sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==
+
+rimraf@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-3.0.2.tgz#f1a5402ba6220ad52cc1282bac1ae3aa49fd061a"
+  integrity sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==
+  dependencies:
+    glob "^7.1.3"
+
+run-parallel@^1.1.9:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/run-parallel/-/run-parallel-1.2.0.tgz#66d1368da7bdf921eb9d95bd1a9229e7f21a43ee"
+  integrity sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==
+  dependencies:
+    queue-microtask "^1.2.2"
+
+shebang-command@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-2.0.0.tgz#ccd0af4f8835fbdc265b82461aaf0c36663f34ea"
+  integrity sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==
+  dependencies:
+    shebang-regex "^3.0.0"
+
+shebang-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-3.0.0.tgz#ae16f1644d873ecad843b0307b143362d4c42172"
+  integrity sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==
+
+strip-ansi@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9"
+  integrity sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==
+  dependencies:
+    ansi-regex "^5.0.1"
+
+strip-json-comments@^3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+text-table@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==
+
+type-check@^0.4.0, type-check@~0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"
+  integrity sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==
+  dependencies:
+    prelude-ls "^1.2.1"
+
+type-fest@^0.20.2:
+  version "0.20.2"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.20.2.tgz#1bf207f4b28f91583666cb5fbd327887301cd5f4"
+  integrity sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+which@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/which/-/which-2.0.2.tgz#7c6a8dd0a636a0327e10b59c9286eee93f3f51b1"
+  integrity sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@^1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
+
+yocto-queue@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/yocto-queue/-/yocto-queue-0.1.0.tgz#0294eb3dee05028d31ee1a5fa2c556a6aaf10a1b"
+  integrity sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==
diff --git a/fixtures/eslint-v9/README.md b/fixtures/eslint-v9/README.md
new file mode 100644
index 0000000000000..3ea521cfa8909
--- /dev/null
+++ b/fixtures/eslint-v9/README.md
@@ -0,0 +1,12 @@
+# ESLint v9 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 9.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v9
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v9/build.mjs b/fixtures/eslint-v9/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v9/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v9/eslint.config.mjs b/fixtures/eslint-v9/eslint.config.mjs
new file mode 100644
index 0000000000000..ffc8375265c2b
--- /dev/null
+++ b/fixtures/eslint-v9/eslint.config.mjs
@@ -0,0 +1,21 @@
+import * as reactHooks from 'eslint-plugin-react-hooks';
+
+export default [
+  {
+    languageOptions: {
+      ecmaVersion: 'latest',
+      sourceType: 'module',
+      parserOptions: {
+        ecmaFeatures: {
+          jsx: true,
+        },
+      },
+    },
+  },
+  reactHooks.configs['recommended-latest'],
+  {
+    rules: {
+      'react-hooks/exhaustive-deps': 'error',
+    },
+  },
+];
diff --git a/fixtures/eslint-v9/index.js b/fixtures/eslint-v9/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v9/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v9/package.json b/fixtures/eslint-v9/package.json
new file mode 100644
index 0000000000000..e8ae91a0613e1
--- /dev/null
+++ b/fixtures/eslint-v9/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v9",
+  "dependencies": {
+    "eslint": "^9",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v9/yarn.lock b/fixtures/eslint-v9/yarn.lock
new file mode 100644
index 0000000000000..5a1a246827f6f
--- /dev/null
+++ b/fixtures/eslint-v9/yarn.lock
@@ -0,0 +1,579 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@eslint-community/eslint-utils@^4.2.0":
+  version "4.4.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/eslint-utils/-/eslint-utils-4.4.1.tgz#d1145bf2c20132d6400495d6df4bf59362fd9d56"
+  integrity sha512-s3O3waFUrMV8P/XaF/+ZTp1X9XBZW1a4B97ZnjQF2KYWaFD2A8KyFBsrsfSjEmjn3RGWAIuvlneuZm3CUK3jbA==
+  dependencies:
+    eslint-visitor-keys "^3.4.3"
+
+"@eslint-community/regexpp@^4.12.1":
+  version "4.12.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
+  integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
+
+"@eslint/config-array@^0.19.0":
+  version "0.19.2"
+  resolved "https://registry.yarnpkg.com/@eslint/config-array/-/config-array-0.19.2.tgz#3060b809e111abfc97adb0bb1172778b90cb46aa"
+  integrity sha512-GNKqxfHG2ySmJOBSHg7LxeUx4xpuCoFjacmlCoYWEbaPXLwvfIjixRI12xCQZeULksQb23uiA8F40w5TojpV7w==
+  dependencies:
+    "@eslint/object-schema" "^2.1.6"
+    debug "^4.3.1"
+    minimatch "^3.1.2"
+
+"@eslint/core@^0.10.0":
+  version "0.10.0"
+  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.10.0.tgz#23727063c21b335f752dbb3a16450f6f9cbc9091"
+  integrity sha512-gFHJ+xBOo4G3WRlR1e/3G8A6/KZAH6zcE/hkLRCZTi/B9avAG365QhFA8uOGzTMqgTghpn7/fSnscW++dpMSAw==
+  dependencies:
+    "@types/json-schema" "^7.0.15"
+
+"@eslint/core@^0.11.0":
+  version "0.11.0"
+  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.11.0.tgz#7a9226e850922e42cbd2ba71361eacbe74352a12"
+  integrity sha512-DWUB2pksgNEb6Bz2fggIy1wh6fGgZP4Xyy/Mt0QZPiloKKXerbqq9D3SBQTlCRYOrcRPu4vuz+CGjwdfqxnoWA==
+  dependencies:
+    "@types/json-schema" "^7.0.15"
+
+"@eslint/eslintrc@^3.2.0":
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-3.2.0.tgz#57470ac4e2e283a6bf76044d63281196e370542c"
+  integrity sha512-grOjVNN8P3hjJn/eIETF1wwd12DdnwFDoyceUJLYYdkpbwq3nLi+4fqrTAONx7XDALqlL220wC/RHSC/QTI/0w==
+  dependencies:
+    ajv "^6.12.4"
+    debug "^4.3.2"
+    espree "^10.0.1"
+    globals "^14.0.0"
+    ignore "^5.2.0"
+    import-fresh "^3.2.1"
+    js-yaml "^4.1.0"
+    minimatch "^3.1.2"
+    strip-json-comments "^3.1.1"
+
+"@eslint/js@9.20.0":
+  version "9.20.0"
+  resolved "https://registry.yarnpkg.com/@eslint/js/-/js-9.20.0.tgz#7421bcbe74889fcd65d1be59f00130c289856eb4"
+  integrity sha512-iZA07H9io9Wn836aVTytRaNqh00Sad+EamwOVJT12GTLw1VGMFV/4JaME+JjLtr9fiGaoWgYnS54wrfWsSs4oQ==
+
+"@eslint/object-schema@^2.1.6":
+  version "2.1.6"
+  resolved "https://registry.yarnpkg.com/@eslint/object-schema/-/object-schema-2.1.6.tgz#58369ab5b5b3ca117880c0f6c0b0f32f6950f24f"
+  integrity sha512-RBMg5FRL0I0gs51M/guSAj5/e14VQ4tpZnQNWwuDT66P14I43ItmPfIZRhO9fUVIPOAQXU47atlywZ/czoqFPA==
+
+"@eslint/plugin-kit@^0.2.5":
+  version "0.2.5"
+  resolved "https://registry.yarnpkg.com/@eslint/plugin-kit/-/plugin-kit-0.2.5.tgz#ee07372035539e7847ef834e3f5e7b79f09e3a81"
+  integrity sha512-lB05FkqEdUg2AA0xEbUz0SnkXT1LcCTa438W4IWTUh4hdOnVbQyOJ81OrDXsJk/LSiJHubgGEFoR5EHq1NsH1A==
+  dependencies:
+    "@eslint/core" "^0.10.0"
+    levn "^0.4.1"
+
+"@humanfs/core@^0.19.1":
+  version "0.19.1"
+  resolved "https://registry.yarnpkg.com/@humanfs/core/-/core-0.19.1.tgz#17c55ca7d426733fe3c561906b8173c336b40a77"
+  integrity sha512-5DyQ4+1JEUzejeK1JGICcideyfUbGixgS9jNgex5nqkW+cY7WZhxBigmieN5Qnw9ZosSNVC9KQKyb+GUaGyKUA==
+
+"@humanfs/node@^0.16.6":
+  version "0.16.6"
+  resolved "https://registry.yarnpkg.com/@humanfs/node/-/node-0.16.6.tgz#ee2a10eaabd1131987bf0488fd9b820174cd765e"
+  integrity sha512-YuI2ZHQL78Q5HbhDiBA1X4LmYdXCKCMQIfw0pw7piHJwyREFebJUvrQN4cMssyES6x+vfUbx1CIpaQUKYdQZOw==
+  dependencies:
+    "@humanfs/core" "^0.19.1"
+    "@humanwhocodes/retry" "^0.3.0"
+
+"@humanwhocodes/module-importer@^1.0.1":
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz#af5b2691a22b44be847b0ca81641c5fb6ad0172c"
+  integrity sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==
+
+"@humanwhocodes/retry@^0.3.0":
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.3.1.tgz#c72a5c76a9fbaf3488e231b13dc52c0da7bab42a"
+  integrity sha512-JBxkERygn7Bv/GbN5Rv8Ul6LVknS+5Bp6RgDC/O8gEBU/yeH5Ui5C/OlWrTb6qct7LjjfT6Re2NxB0ln0yYybA==
+
+"@humanwhocodes/retry@^0.4.1":
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.4.1.tgz#9a96ce501bc62df46c4031fbd970e3cc6b10f07b"
+  integrity sha512-c7hNEllBlenFTHBky65mhq8WD2kbN9Q6gk0bTk8lSBvc554jpXSkST1iePudpt7+A/AQvuHs9EMqjHDXMY1lrA==
+
+"@types/estree@^1.0.6":
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
+  integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
+
+"@types/json-schema@^7.0.15":
+  version "7.0.15"
+  resolved "https://registry.yarnpkg.com/@types/json-schema/-/json-schema-7.0.15.tgz#596a1747233694d50f6ad8a7869fcb6f56cf5841"
+  integrity sha512-5+fP8P8MFNC+AyZCDxrB2pkZFPGzqQWUzpSeuuVLvm8VMcorNYavBqoFcxK8bQz4Qsbn4oUEEem4wDLfcysGHA==
+
+acorn-jsx@^5.3.2:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^8.14.0:
+  version "8.14.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.14.0.tgz#063e2c70cac5fb4f6467f0b11152e04c682795b0"
+  integrity sha512-cl669nCJTZBsL97OF4kUQm5g5hC2uihk0NxY3WENAC0TYdILVkAyHymAntgxGkl7K+t0cXIrH5siy5S4XkFycA==
+
+ajv@^6.12.4:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-2.0.1.tgz#246f50f3ca78a3240f6c997e8a9bd1eac49e4b38"
+  integrity sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^4.0.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^7.0.6:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.6.tgz#8a58fe78f00dcd70c370451759dfbfaf03e8ee9f"
+  integrity sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==
+  dependencies:
+    path-key "^3.1.0"
+    shebang-command "^2.0.0"
+    which "^2.0.1"
+
+debug@^4.3.1, debug@^4.3.2:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.4.tgz#a6f2dce612fadd2ef1f519b73551f17e85199831"
+  integrity sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==
+
+escape-string-regexp@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
+  integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^8.2.0:
+  version "8.2.0"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-8.2.0.tgz#377aa6f1cb5dc7592cfd0b7f892fd0cf352ce442"
+  integrity sha512-PHlWUfG6lvPc3yvP5A4PNyBL1W8fkDUccmI21JUu/+GKZBoH/W5u6usENXUrWFRsyoW5ACUjFGgAFQp5gUlb/A==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^5.2.0"
+
+eslint-visitor-keys@^3.4.3:
+  version "3.4.3"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz#0cd72fe8550e3c2eae156a96a4dddcd1c8ac5800"
+  integrity sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==
+
+eslint-visitor-keys@^4.2.0:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-4.2.0.tgz#687bacb2af884fcdda8a6e7d65c606f46a14cd45"
+  integrity sha512-UyLnSehNt62FFhSwjZlHmeokpRK59rcz29j+F1/aDgbkbRTk7wIc9XzdoasMUbRNKDM0qQt/+BJ4BrpFeABemw==
+
+eslint@^9:
+  version "9.20.1"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-9.20.1.tgz#923924c078f5226832449bac86662dd7e53c91d6"
+  integrity sha512-m1mM33o6dBUjxl2qb6wv6nGNwCAsns1eKtaQ4l/NPHeTvhiUPbtdfMyktxN4B3fgHIgsYh1VT3V9txblpQHq+g==
+  dependencies:
+    "@eslint-community/eslint-utils" "^4.2.0"
+    "@eslint-community/regexpp" "^4.12.1"
+    "@eslint/config-array" "^0.19.0"
+    "@eslint/core" "^0.11.0"
+    "@eslint/eslintrc" "^3.2.0"
+    "@eslint/js" "9.20.0"
+    "@eslint/plugin-kit" "^0.2.5"
+    "@humanfs/node" "^0.16.6"
+    "@humanwhocodes/module-importer" "^1.0.1"
+    "@humanwhocodes/retry" "^0.4.1"
+    "@types/estree" "^1.0.6"
+    "@types/json-schema" "^7.0.15"
+    ajv "^6.12.4"
+    chalk "^4.0.0"
+    cross-spawn "^7.0.6"
+    debug "^4.3.2"
+    escape-string-regexp "^4.0.0"
+    eslint-scope "^8.2.0"
+    eslint-visitor-keys "^4.2.0"
+    espree "^10.3.0"
+    esquery "^1.5.0"
+    esutils "^2.0.2"
+    fast-deep-equal "^3.1.3"
+    file-entry-cache "^8.0.0"
+    find-up "^5.0.0"
+    glob-parent "^6.0.2"
+    ignore "^5.2.0"
+    imurmurhash "^0.1.4"
+    is-glob "^4.0.0"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    lodash.merge "^4.6.2"
+    minimatch "^3.1.2"
+    natural-compare "^1.4.0"
+    optionator "^0.9.3"
+
+espree@^10.0.1, espree@^10.3.0:
+  version "10.3.0"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-10.3.0.tgz#29267cf5b0cb98735b65e64ba07e0ed49d1eed8a"
+  integrity sha512-0QYC8b24HWY8zjRnDTL6RiHfDbAWn63qb4LMj1Z4b076A4une81+z03Kg7l7mn/48PUTqoLptSXez8oknU8Clg==
+  dependencies:
+    acorn "^8.14.0"
+    acorn-jsx "^5.3.2"
+    eslint-visitor-keys "^4.2.0"
+
+esquery@^1.5.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+fast-deep-equal@^3.1.1, fast-deep-equal@^3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@^2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+file-entry-cache@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-8.0.0.tgz#7787bddcf1131bffb92636c69457bbc0edd6d81f"
+  integrity sha512-XXTUwCvisa5oacNGRP9SfNtYBNAMi+RPwBFmblZEF7N7swHYQS6/Zfk7SRwx4D5j3CH211YNRco1DEMNVfZCnQ==
+  dependencies:
+    flat-cache "^4.0.0"
+
+find-up@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-5.0.0.tgz#4c92819ecb7083561e4f4a240a86be5198f536fc"
+  integrity sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==
+  dependencies:
+    locate-path "^6.0.0"
+    path-exists "^4.0.0"
+
+flat-cache@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-4.0.1.tgz#0ece39fcb14ee012f4b0410bd33dd9c1f011127c"
+  integrity sha512-f7ccFPK3SXFHpx15UIGyRJ/FJQctuKZ0zVuN3frBo4HnK3cay9VEW0R6yPYFHC0AgqhukPzKjq22t5DmAyqGyw==
+  dependencies:
+    flatted "^3.2.9"
+    keyv "^4.5.4"
+
+flatted@^3.2.9:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.3.2.tgz#adba1448a9841bec72b42c532ea23dbbedef1a27"
+  integrity sha512-AiwGJM8YcNOaobumgtng+6NHuOqC3A7MixFeDafM3X9cIUM+xUXoS5Vfgf+OihAYe20fxqNM9yPBXJzRtZ/4eA==
+
+glob-parent@^6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-6.0.2.tgz#6d237d99083950c79290f24c7642a3de9a28f9e3"
+  integrity sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==
+  dependencies:
+    is-glob "^4.0.3"
+
+globals@^14.0.0:
+  version "14.0.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-14.0.0.tgz#898d7413c29babcf6bafe56fcadded858ada724e"
+  integrity sha512-oahGvuMGQlPw/ivIYBjVSrWAfWLBeku5tpPE2fOPLi+WHffIWbuh2tCjhyQhTBPMf5E9jDEH4FOmTYgYwbKwtQ==
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+ignore@^5.2.0:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.2.tgz#3cd40e729f3643fd87cb04e50bf0eb722bc596f5"
+  integrity sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==
+
+import-fresh@^3.2.1:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-glob@^4.0.0, is-glob@^4.0.3:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-yaml@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-4.1.0.tgz#c1fb65f8f5017901cdd2c951864ba18458a10602"
+  integrity sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==
+  dependencies:
+    argparse "^2.0.1"
+
+json-buffer@3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.1.tgz#9338802a30d3b6605fbe0613e094008ca8c05a13"
+  integrity sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+keyv@^4.5.4:
+  version "4.5.4"
+  resolved "https://registry.yarnpkg.com/keyv/-/keyv-4.5.4.tgz#a879a99e29452f942439f2a405e3af8b31d4de93"
+  integrity sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==
+  dependencies:
+    json-buffer "3.0.1"
+
+levn@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.4.1.tgz#ae4562c007473b932a6200d403268dd2fffc6ade"
+  integrity sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==
+  dependencies:
+    prelude-ls "^1.2.1"
+    type-check "~0.4.0"
+
+locate-path@^6.0.0:
+  version "6.0.0"
+  resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-6.0.0.tgz#55321eb309febbc59c4801d931a72452a681d286"
+  integrity sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==
+  dependencies:
+    p-locate "^5.0.0"
+
+lodash.merge@^4.6.2:
+  version "4.6.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.2.tgz#558aa53b43b661e1925a0afdfa36a9a1085fe57a"
+  integrity sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==
+
+minimatch@^3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.1.2.tgz#19cd194bfd3e428f049a70817c038d89ab4be35b"
+  integrity sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+optionator@^0.9.3:
+  version "0.9.4"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.9.4.tgz#7ea1c1a5d91d764fb282139c88fe11e182a3a734"
+  integrity sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==
+  dependencies:
+    deep-is "^0.1.3"
+    fast-levenshtein "^2.0.6"
+    levn "^0.4.1"
+    prelude-ls "^1.2.1"
+    type-check "^0.4.0"
+    word-wrap "^1.2.5"
+
+p-limit@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-3.1.0.tgz#e1daccbe78d0d1388ca18c64fea38e3e57e3706b"
+  integrity sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==
+  dependencies:
+    yocto-queue "^0.1.0"
+
+p-locate@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-5.0.0.tgz#83c8315c6785005e3bd021839411c9e110e6d834"
+  integrity sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==
+  dependencies:
+    p-limit "^3.0.2"
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-exists@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-4.0.0.tgz#513bdbe2d3b95d7762e8c1137efa195c6c61b5b3"
+  integrity sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==
+
+path-key@^3.1.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-3.1.1.tgz#581f6ade658cbba65a0d3380de7753295054f375"
+  integrity sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==
+
+prelude-ls@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.2.1.tgz#debc6489d7a6e6b0e7611888cec880337d316396"
+  integrity sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+shebang-command@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-2.0.0.tgz#ccd0af4f8835fbdc265b82461aaf0c36663f34ea"
+  integrity sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==
+  dependencies:
+    shebang-regex "^3.0.0"
+
+shebang-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-3.0.0.tgz#ae16f1644d873ecad843b0307b143362d4c42172"
+  integrity sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==
+
+strip-json-comments@^3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+type-check@^0.4.0, type-check@~0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"
+  integrity sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==
+  dependencies:
+    prelude-ls "^1.2.1"
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+which@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/which/-/which-2.0.2.tgz#7c6a8dd0a636a0327e10b59c9286eee93f3f51b1"
+  integrity sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@^1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+yocto-queue@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/yocto-queue/-/yocto-queue-0.1.0.tgz#0294eb3dee05028d31ee1a5fa2c556a6aaf10a1b"
+  integrity sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==
diff --git a/fixtures/eslint/README.md b/fixtures/eslint/README.md
deleted file mode 100644
index 28ab22551372d..0000000000000
--- a/fixtures/eslint/README.md
+++ /dev/null
@@ -1,7 +0,0 @@
-# ESLint Playground Fixture
-
-This is an internal playground for quick iteration on our lint rules inside an IDE like VSCode.
-
-See instructions in `./index.js` in this directory.
-
-![Demo](https://duaw26jehqd4r.cloudfront.net/items/2Z390a31003O0l0o0e3O/Screen%20Recording%202019-01-16%20at%2010.29%20PM.gif?v=d6856125)
\ No newline at end of file
diff --git a/fixtures/eslint/index.js b/fixtures/eslint/index.js
deleted file mode 100644
index d53415310560d..0000000000000
--- a/fixtures/eslint/index.js
+++ /dev/null
@@ -1,26 +0,0 @@
-// This is a testing playground for our lint rules.
-
-// 1. Run yarn && yarn start
-// 2. "File > Add Folder to Workspace" this specific folder in VSCode with ESLint extension
-// 3. Changes to the rule source should get picked up without restarting ESLint server
-
-function Comment({comment, commentSource}) {
-  const currentUserID = comment.viewer.id;
-  const environment = RelayEnvironment.forUser(currentUserID);
-  const commentID = nullthrows(comment.id);
-  useEffect(() => {
-    const subscription = SubscriptionCounter.subscribeOnce(
-      `StoreSubscription_${commentID}`,
-      () =>
-        StoreSubscription.subscribe(
-          environment,
-          {
-            comment_id: commentID,
-          },
-          currentUserID,
-          commentSource
-        )
-    );
-    return () => subscription.dispose();
-  }, [commentID, commentSource, currentUserID, environment]);
-}
diff --git a/fixtures/eslint/package.json b/fixtures/eslint/package.json
deleted file mode 100644
index 04f8d6b98be99..0000000000000
--- a/fixtures/eslint/package.json
+++ /dev/null
@@ -1,12 +0,0 @@
-{
-  "private": true,
-  "name": "eslint-playground",
-  "dependencies": {
-    "eslint": "4.1.0",
-    "eslint-plugin-react-hooks": "link:./proxy"
-  },
-  "scripts": {
-    "start": "./watch.sh",
-    "lint": "eslint index.js"
-  }
-}
diff --git a/fixtures/eslint/proxy/index.js b/fixtures/eslint/proxy/index.js
deleted file mode 100644
index f54e672d21126..0000000000000
--- a/fixtures/eslint/proxy/index.js
+++ /dev/null
@@ -1,35 +0,0 @@
-'use strict';
-
-// This file is a proxy for our rule definition that will
-// load the latest built version on every check. This makes
-// it convenient to test inside IDEs (which would otherwise
-// load a version of our rule once and never restart the server).
-// See instructions in ../index.js playground.
-
-let build;
-reload();
-
-function reload() {
-  for (let id in require.cache) {
-    if (/eslint-plugin-react-hooks/.test(id)) {
-      delete require.cache[id];
-    }
-  }
-  // Point to the built version.
-  build = require('../../../build/oss-experimental/eslint-plugin-react-hooks');
-}
-
-let rules = {};
-for (let key in build.rules) {
-  if (build.rules.hasOwnProperty(key)) {
-    rules[key] = Object.assign({}, build.rules, {
-      create() {
-        // Reload changes to the built rule
-        reload();
-        return build.rules[key].create.apply(this, arguments);
-      },
-    });
-  }
-}
-
-module.exports = {rules};
diff --git a/fixtures/eslint/proxy/package.json b/fixtures/eslint/proxy/package.json
deleted file mode 100644
index 1461c2d43f5f1..0000000000000
--- a/fixtures/eslint/proxy/package.json
+++ /dev/null
@@ -1,4 +0,0 @@
-{
-  "private": true,
-  "version": "0.0.0"
-}
\ No newline at end of file
diff --git a/fixtures/eslint/watch.sh b/fixtures/eslint/watch.sh
deleted file mode 100755
index 0ca6359c03516..0000000000000
--- a/fixtures/eslint/watch.sh
+++ /dev/null
@@ -1,3 +0,0 @@
-#!/bin/bash
-(cd ../.. && yarn build eslint --type=NODE_DEV)
-(cd ../.. && watchman-make --make 'yarn build eslint --type=NODE_DEV' -p 'packages/eslint-plugin-*/**/*' -t ignored)
diff --git a/fixtures/eslint/yarn.lock b/fixtures/eslint/yarn.lock
deleted file mode 100644
index 7a557036da3aa..0000000000000
--- a/fixtures/eslint/yarn.lock
+++ /dev/null
@@ -1,853 +0,0 @@
-# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
-# yarn lockfile v1
-
-
-acorn-jsx@^3.0.0:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-3.0.1.tgz#afdf9488fb1ecefc8348f6fb22f464e32a58b36b"
-  integrity sha1-r9+UiPsezvyDSPb7IvRk4ypYs2s=
-  dependencies:
-    acorn "^3.0.4"
-
-acorn@^3.0.4:
-  version "3.3.0"
-  resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a"
-  integrity sha1-ReN/s56No/JbruP/U2niu18iAXo=
-
-acorn@^5.5.0:
-  version "5.7.3"
-  resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.7.3.tgz#67aa231bf8812974b85235a96771eb6bd07ea279"
-  integrity sha512-T/zvzYRfbVojPWahDsE5evJdHb3oJoQfFbsrKM7w5Zcs++Tr257tia3BmMP8XYVjp1S9RZXQMh7gao96BlqZOw==
-
-ajv-keywords@^3.0.0:
-  version "3.2.0"
-  resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-3.2.0.tgz#e86b819c602cf8821ad637413698f1dec021847a"
-  integrity sha1-6GuBnGAs+IIa1jdBNpjx3sAhhHo=
-
-ajv@^6.0.1:
-  version "6.7.0"
-  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.7.0.tgz#e3ce7bb372d6577bb1839f1dfdfcbf5ad2948d96"
-  integrity sha512-RZXPviBTtfmtka9n9sy1N5M5b82CbxWIR6HIis4s3WQTXDJamc/0gpCWNGz6EWdWp4DOfjzJfhz/AS9zVPjjWg==
-  dependencies:
-    fast-deep-equal "^2.0.1"
-    fast-json-stable-stringify "^2.0.0"
-    json-schema-traverse "^0.4.1"
-    uri-js "^4.2.2"
-
-ansi-escapes@^3.0.0:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-3.1.0.tgz#f73207bb81207d75fd6c83f125af26eea378ca30"
-  integrity sha512-UgAb8H9D41AQnu/PbWlCofQVcnV4Gs2bBJi9eZPxfU/hgglFh3SMDMENRIqdr7H6XFnXdoknctFByVsCOotTVw==
-
-ansi-regex@^2.0.0:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df"
-  integrity sha1-w7M6te42DYbg5ijwRorn7yfWVN8=
-
-ansi-regex@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998"
-  integrity sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=
-
-ansi-styles@^2.2.1:
-  version "2.2.1"
-  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe"
-  integrity sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=
-
-ansi-styles@^3.2.1:
-  version "3.2.1"
-  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
-  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
-  dependencies:
-    color-convert "^1.9.0"
-
-argparse@^1.0.7:
-  version "1.0.10"
-  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
-  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
-  dependencies:
-    sprintf-js "~1.0.2"
-
-babel-code-frame@^6.22.0:
-  version "6.26.0"
-  resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b"
-  integrity sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=
-  dependencies:
-    chalk "^1.1.3"
-    esutils "^2.0.2"
-    js-tokens "^3.0.2"
-
-balanced-match@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
-  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
-
-brace-expansion@^1.1.7:
-  version "1.1.11"
-  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
-  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
-  dependencies:
-    balanced-match "^1.0.0"
-    concat-map "0.0.1"
-
-buffer-from@^1.0.0:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/buffer-from/-/buffer-from-1.1.1.tgz#32713bc028f75c02fdb710d7c7bcec1f2c6070ef"
-  integrity sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==
-
-caller-path@^0.1.0:
-  version "0.1.0"
-  resolved "https://registry.yarnpkg.com/caller-path/-/caller-path-0.1.0.tgz#94085ef63581ecd3daa92444a8fe94e82577751f"
-  integrity sha1-lAhe9jWB7NPaqSREqP6U6CV3dR8=
-  dependencies:
-    callsites "^0.2.0"
-
-callsites@^0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/callsites/-/callsites-0.2.0.tgz#afab96262910a7f33c19a5775825c69f34e350ca"
-  integrity sha1-r6uWJikQp/M8GaV3WCXGnzTjUMo=
-
-chalk@^1.1.3:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98"
-  integrity sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=
-  dependencies:
-    ansi-styles "^2.2.1"
-    escape-string-regexp "^1.0.2"
-    has-ansi "^2.0.0"
-    strip-ansi "^3.0.0"
-    supports-color "^2.0.0"
-
-chalk@^2.0.0, chalk@^2.1.0:
-  version "2.4.2"
-  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
-  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
-  dependencies:
-    ansi-styles "^3.2.1"
-    escape-string-regexp "^1.0.5"
-    supports-color "^5.3.0"
-
-chardet@^0.4.0:
-  version "0.4.2"
-  resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.4.2.tgz#b5473b33dc97c424e5d98dc87d55d4d8a29c8bf2"
-  integrity sha1-tUc7M9yXxCTl2Y3IfVXU2KKci/I=
-
-circular-json@^0.3.1:
-  version "0.3.3"
-  resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66"
-  integrity sha512-UZK3NBx2Mca+b5LsG7bY183pHWt5Y1xts4P3Pz7ENTwGVnJOUWbRb3ocjvX7hx9tq/yTAdclXm9sZ38gNuem4A==
-
-cli-cursor@^2.1.0:
-  version "2.1.0"
-  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-2.1.0.tgz#b35dac376479facc3e94747d41d0d0f5238ffcb5"
-  integrity sha1-s12sN2R5+sw+lHR9QdDQ9SOP/LU=
-  dependencies:
-    restore-cursor "^2.0.0"
-
-cli-width@^2.0.0:
-  version "2.2.0"
-  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.0.tgz#ff19ede8a9a5e579324147b0c11f0fbcbabed639"
-  integrity sha1-/xnt6Kml5XkyQUewwR8PvLq+1jk=
-
-color-convert@^1.9.0:
-  version "1.9.3"
-  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
-  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
-  dependencies:
-    color-name "1.1.3"
-
-color-name@1.1.3:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
-  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
-
-concat-map@0.0.1:
-  version "0.0.1"
-  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
-  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
-
-concat-stream@^1.6.0:
-  version "1.6.2"
-  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.2.tgz#904bdf194cd3122fc675c77fc4ac3d4ff0fd1a34"
-  integrity sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==
-  dependencies:
-    buffer-from "^1.0.0"
-    inherits "^2.0.3"
-    readable-stream "^2.2.2"
-    typedarray "^0.0.6"
-
-core-util-is@~1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7"
-  integrity sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=
-
-debug@^2.6.8:
-  version "2.6.9"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f"
-  integrity sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==
-  dependencies:
-    ms "2.0.0"
-
-deep-is@~0.1.3:
-  version "0.1.3"
-  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
-  integrity sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=
-
-doctrine@^2.0.0:
-  version "2.1.0"
-  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d"
-  integrity sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==
-  dependencies:
-    esutils "^2.0.2"
-
-escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.5:
-  version "1.0.5"
-  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
-  integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
-
-"eslint-plugin-react-hooks@link:./proxy":
-  version "0.0.0"
-  uid ""
-
-eslint-scope@^3.7.1:
-  version "3.7.3"
-  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-3.7.3.tgz#bb507200d3d17f60247636160b4826284b108535"
-  integrity sha512-W+B0SvF4gamyCTmUc+uITPY0989iXVfKvhwtmJocTaYoc/3khEHmEmvfY/Gn9HA9VV75jrQECsHizkNw1b68FA==
-  dependencies:
-    esrecurse "^4.1.0"
-    estraverse "^4.1.1"
-
-eslint@4.1.0:
-  version "4.1.0"
-  resolved "https://registry.yarnpkg.com/eslint/-/eslint-4.1.0.tgz#bbb55a28220ee08b69da9554d45a6b2ebfd7d913"
-  integrity sha1-u7VaKCIO4Itp2pVU1FprLr/X2RM=
-  dependencies:
-    babel-code-frame "^6.22.0"
-    chalk "^1.1.3"
-    concat-stream "^1.6.0"
-    debug "^2.6.8"
-    doctrine "^2.0.0"
-    eslint-scope "^3.7.1"
-    espree "^3.4.3"
-    esquery "^1.0.0"
-    estraverse "^4.2.0"
-    esutils "^2.0.2"
-    file-entry-cache "^2.0.0"
-    glob "^7.1.2"
-    globals "^9.17.0"
-    ignore "^3.3.3"
-    imurmurhash "^0.1.4"
-    inquirer "^3.0.6"
-    is-my-json-valid "^2.16.0"
-    is-resolvable "^1.0.0"
-    js-yaml "^3.8.4"
-    json-stable-stringify "^1.0.1"
-    levn "^0.3.0"
-    lodash "^4.17.4"
-    minimatch "^3.0.2"
-    mkdirp "^0.5.1"
-    natural-compare "^1.4.0"
-    optionator "^0.8.2"
-    path-is-inside "^1.0.2"
-    pluralize "^4.0.0"
-    progress "^2.0.0"
-    require-uncached "^1.0.3"
-    strip-json-comments "~2.0.1"
-    table "^4.0.1"
-    text-table "~0.2.0"
-
-espree@^3.4.3:
-  version "3.5.4"
-  resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7"
-  integrity sha512-yAcIQxtmMiB/jL32dzEp2enBeidsB7xWPLNiw3IIkpVds1P+h7qF9YwJq1yUNzp2OKXgAprs4F61ih66UsoD1A==
-  dependencies:
-    acorn "^5.5.0"
-    acorn-jsx "^3.0.0"
-
-esprima@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
-  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
-
-esquery@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.0.1.tgz#406c51658b1f5991a5f9b62b1dc25b00e3e5c708"
-  integrity sha512-SmiyZ5zIWH9VM+SRUReLS5Q8a7GxtRdxEBVZpm98rJM7Sb+A9DVCndXfkeFUd3byderg+EbDkfnevfCwynWaNA==
-  dependencies:
-    estraverse "^4.0.0"
-
-esrecurse@^4.1.0:
-  version "4.2.1"
-  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.1.tgz#007a3b9fdbc2b3bb87e4879ea19c92fdbd3942cf"
-  integrity sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==
-  dependencies:
-    estraverse "^4.1.0"
-
-estraverse@^4.0.0, estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0:
-  version "4.2.0"
-  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
-  integrity sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=
-
-esutils@^2.0.2:
-  version "2.0.2"
-  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
-  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
-
-external-editor@^2.0.4:
-  version "2.2.0"
-  resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-2.2.0.tgz#045511cfd8d133f3846673d1047c154e214ad3d5"
-  integrity sha512-bSn6gvGxKt+b7+6TKEv1ZycHleA7aHhRHyAqJyp5pbUFuYYNIzpZnQDk7AsYckyWdEnTeAnay0aCy2aV6iTk9A==
-  dependencies:
-    chardet "^0.4.0"
-    iconv-lite "^0.4.17"
-    tmp "^0.0.33"
-
-fast-deep-equal@^2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-2.0.1.tgz#7b05218ddf9667bf7f370bf7fdb2cb15fdd0aa49"
-  integrity sha1-ewUhjd+WZ79/Nwv3/bLLFf3Qqkk=
-
-fast-json-stable-stringify@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
-  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
-
-fast-levenshtein@~2.0.4:
-  version "2.0.6"
-  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
-  integrity sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=
-
-figures@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/figures/-/figures-2.0.0.tgz#3ab1a2d2a62c8bfb431a0c94cb797a2fce27c962"
-  integrity sha1-OrGi0qYsi/tDGgyUy3l6L84nyWI=
-  dependencies:
-    escape-string-regexp "^1.0.5"
-
-file-entry-cache@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-2.0.0.tgz#c392990c3e684783d838b8c84a45d8a048458361"
-  integrity sha1-w5KZDD5oR4PYOLjISkXYoEhFg2E=
-  dependencies:
-    flat-cache "^1.2.1"
-    object-assign "^4.0.1"
-
-flat-cache@^1.2.1:
-  version "1.3.4"
-  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.4.tgz#2c2ef77525cc2929007dfffa1dd314aa9c9dee6f"
-  integrity sha512-VwyB3Lkgacfik2vhqR4uv2rvebqmDvFu4jlN/C1RzWoJEo8I7z4Q404oiqYCkq41mni8EzQnm95emU9seckwtg==
-  dependencies:
-    circular-json "^0.3.1"
-    graceful-fs "^4.1.2"
-    rimraf "~2.6.2"
-    write "^0.2.1"
-
-fs.realpath@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
-  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
-
-generate-function@^2.0.0:
-  version "2.3.1"
-  resolved "https://registry.yarnpkg.com/generate-function/-/generate-function-2.3.1.tgz#f069617690c10c868e73b8465746764f97c3479f"
-  integrity sha512-eeB5GfMNeevm/GRYq20ShmsaGcmI81kIX2K9XQx5miC8KdHaC6Jm0qQ8ZNeGOi7wYB8OsdxKs+Y2oVuTFuVwKQ==
-  dependencies:
-    is-property "^1.0.2"
-
-generate-object-property@^1.1.0:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/generate-object-property/-/generate-object-property-1.2.0.tgz#9c0e1c40308ce804f4783618b937fa88f99d50d0"
-  integrity sha1-nA4cQDCM6AT0eDYYuTf6iPmdUNA=
-  dependencies:
-    is-property "^1.0.0"
-
-glob@^7.1.2, glob@^7.1.3:
-  version "7.1.3"
-  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
-  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
-  dependencies:
-    fs.realpath "^1.0.0"
-    inflight "^1.0.4"
-    inherits "2"
-    minimatch "^3.0.4"
-    once "^1.3.0"
-    path-is-absolute "^1.0.0"
-
-globals@^9.17.0:
-  version "9.18.0"
-  resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a"
-  integrity sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==
-
-graceful-fs@^4.1.2:
-  version "4.1.15"
-  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.15.tgz#ffb703e1066e8a0eeaa4c8b80ba9253eeefbfb00"
-  integrity sha512-6uHUhOPEBgQ24HM+r6b/QwWfZq+yiFcipKFrOFiBEnWdy5sdzYoi+pJeQaPI5qOLRFqWmAXUPQNsielzdLoecA==
-
-has-ansi@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91"
-  integrity sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=
-  dependencies:
-    ansi-regex "^2.0.0"
-
-has-flag@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
-  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
-
-iconv-lite@^0.4.17:
-  version "0.4.24"
-  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b"
-  integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==
-  dependencies:
-    safer-buffer ">= 2.1.2 < 3"
-
-ignore@^3.3.3:
-  version "3.3.10"
-  resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.10.tgz#0a97fb876986e8081c631160f8f9f389157f0043"
-  integrity sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==
-
-imurmurhash@^0.1.4:
-  version "0.1.4"
-  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
-  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
-
-inflight@^1.0.4:
-  version "1.0.6"
-  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
-  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
-  dependencies:
-    once "^1.3.0"
-    wrappy "1"
-
-inherits@2, inherits@^2.0.3, inherits@~2.0.3:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
-  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
-
-inquirer@^3.0.6:
-  version "3.3.0"
-  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-3.3.0.tgz#9dd2f2ad765dcab1ff0443b491442a20ba227dc9"
-  integrity sha512-h+xtnyk4EwKvFWHrUYsWErEVR+igKtLdchu+o0Z1RL7VU/jVMFbYir2bp6bAj8efFNxWqHX0dIss6fJQ+/+qeQ==
-  dependencies:
-    ansi-escapes "^3.0.0"
-    chalk "^2.0.0"
-    cli-cursor "^2.1.0"
-    cli-width "^2.0.0"
-    external-editor "^2.0.4"
-    figures "^2.0.0"
-    lodash "^4.3.0"
-    mute-stream "0.0.7"
-    run-async "^2.2.0"
-    rx-lite "^4.0.8"
-    rx-lite-aggregates "^4.0.8"
-    string-width "^2.1.0"
-    strip-ansi "^4.0.0"
-    through "^2.3.6"
-
-is-fullwidth-code-point@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
-  integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=
-
-is-my-ip-valid@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/is-my-ip-valid/-/is-my-ip-valid-1.0.0.tgz#7b351b8e8edd4d3995d4d066680e664d94696824"
-  integrity sha512-gmh/eWXROncUzRnIa1Ubrt5b8ep/MGSnfAUI3aRp+sqTCs1tv1Isl8d8F6JmkN3dXKc3ehZMrtiPN9eL03NuaQ==
-
-is-my-json-valid@^2.16.0:
-  version "2.19.0"
-  resolved "https://registry.yarnpkg.com/is-my-json-valid/-/is-my-json-valid-2.19.0.tgz#8fd6e40363cd06b963fa877d444bfb5eddc62175"
-  integrity sha512-mG0f/unGX1HZ5ep4uhRaPOS8EkAY8/j6mDRMJrutq4CqhoJWYp7qAlonIPy3TV7p3ju4TK9fo/PbnoksWmsp5Q==
-  dependencies:
-    generate-function "^2.0.0"
-    generate-object-property "^1.1.0"
-    is-my-ip-valid "^1.0.0"
-    jsonpointer "^4.0.0"
-    xtend "^4.0.0"
-
-is-promise@^2.1.0:
-  version "2.1.0"
-  resolved "https://registry.yarnpkg.com/is-promise/-/is-promise-2.1.0.tgz#79a2a9ece7f096e80f36d2b2f3bc16c1ff4bf3fa"
-  integrity sha1-eaKp7OfwlugPNtKy87wWwf9L8/o=
-
-is-property@^1.0.0, is-property@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/is-property/-/is-property-1.0.2.tgz#57fe1c4e48474edd65b09911f26b1cd4095dda84"
-  integrity sha1-V/4cTkhHTt1lsJkR8msc1Ald2oQ=
-
-is-resolvable@^1.0.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88"
-  integrity sha512-qgDYXFSR5WvEfuS5dMj6oTMEbrrSaM0CrFk2Yiq/gXnBvD9pMa2jGXxyhGLfvhZpuMZe18CJpFxAt3CRs42NMg==
-
-isarray@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
-  integrity sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=
-
-js-tokens@^3.0.2:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b"
-  integrity sha1-mGbfOVECEw449/mWvOtlRDIJwls=
-
-js-yaml@^3.8.4:
-  version "3.12.1"
-  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.12.1.tgz#295c8632a18a23e054cf5c9d3cecafe678167600"
-  integrity sha512-um46hB9wNOKlwkHgiuyEVAybXBjwFUV0Z/RaHJblRd9DXltue9FTYvzCr9ErQrK9Adz5MU4gHWVaNUfdmrC8qA==
-  dependencies:
-    argparse "^1.0.7"
-    esprima "^4.0.0"
-
-json-schema-traverse@^0.4.1:
-  version "0.4.1"
-  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
-  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
-
-json-stable-stringify@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af"
-  integrity sha1-mnWdOcXy/1A/1TAGRu1EX4jE+a8=
-  dependencies:
-    jsonify "~0.0.0"
-
-jsonify@~0.0.0:
-  version "0.0.0"
-  resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73"
-  integrity sha1-LHS27kHZPKUbe1qu6PUDYx0lKnM=
-
-jsonpointer@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/jsonpointer/-/jsonpointer-4.0.1.tgz#4fd92cb34e0e9db3c89c8622ecf51f9b978c6cb9"
-  integrity sha1-T9kss04OnbPInIYi7PUfm5eMbLk=
-
-levn@^0.3.0, levn@~0.3.0:
-  version "0.3.0"
-  resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee"
-  integrity sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=
-  dependencies:
-    prelude-ls "~1.1.2"
-    type-check "~0.3.2"
-
-lodash@^4.17.4, lodash@^4.3.0:
-  version "4.17.11"
-  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.11.tgz#b39ea6229ef607ecd89e2c8df12536891cac9b8d"
-  integrity sha512-cQKh8igo5QUhZ7lg38DYWAxMvjSAKG0A8wGSVimP07SIUEK2UO+arSRKbRZWtelMtN5V0Hkwh5ryOto/SshYIg==
-
-mimic-fn@^1.0.0:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022"
-  integrity sha512-jf84uxzwiuiIVKiOLpfYk7N46TSy8ubTonmneY9vrpHNAnp0QBt2BxWV9dO3/j+BoVAb+a5G6YDPW3M5HOdMWQ==
-
-minimatch@^3.0.2, minimatch@^3.0.4:
-  version "3.0.4"
-  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
-  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
-  dependencies:
-    brace-expansion "^1.1.7"
-
-minimist@0.0.8:
-  version "0.0.8"
-  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
-  integrity sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=
-
-mkdirp@^0.5.1:
-  version "0.5.1"
-  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
-  integrity sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=
-  dependencies:
-    minimist "0.0.8"
-
-ms@2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
-  integrity sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=
-
-mute-stream@0.0.7:
-  version "0.0.7"
-  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.7.tgz#3075ce93bc21b8fab43e1bc4da7e8115ed1e7bab"
-  integrity sha1-MHXOk7whuPq0PhvE2n6BFe0ee6s=
-
-natural-compare@^1.4.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
-  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
-
-object-assign@^4.0.1:
-  version "4.1.1"
-  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863"
-  integrity sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=
-
-once@^1.3.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
-  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
-  dependencies:
-    wrappy "1"
-
-onetime@^2.0.0:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/onetime/-/onetime-2.0.1.tgz#067428230fd67443b2794b22bba528b6867962d4"
-  integrity sha1-BnQoIw/WdEOyeUsiu6UotoZ5YtQ=
-  dependencies:
-    mimic-fn "^1.0.0"
-
-optionator@^0.8.2:
-  version "0.8.2"
-  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.2.tgz#364c5e409d3f4d6301d6c0b4c05bba50180aeb64"
-  integrity sha1-NkxeQJ0/TWMB1sC0wFu6UBgK62Q=
-  dependencies:
-    deep-is "~0.1.3"
-    fast-levenshtein "~2.0.4"
-    levn "~0.3.0"
-    prelude-ls "~1.1.2"
-    type-check "~0.3.2"
-    wordwrap "~1.0.0"
-
-os-tmpdir@~1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
-  integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=
-
-path-is-absolute@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
-  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
-
-path-is-inside@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53"
-  integrity sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=
-
-pluralize@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-4.0.0.tgz#59b708c1c0190a2f692f1c7618c446b052fd1762"
-  integrity sha1-WbcIwcAZCi9pLxx2GMRGsFL9F2I=
-
-prelude-ls@~1.1.2:
-  version "1.1.2"
-  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
-  integrity sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=
-
-process-nextick-args@~2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa"
-  integrity sha512-MtEC1TqN0EU5nephaJ4rAtThHtC86dNN9qCuEhtshvpVBkAW5ZO7BASN9REnF9eoXGcRub+pFuKEpOHE+HbEMw==
-
-progress@^2.0.0:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8"
-  integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==
-
-punycode@^2.1.0:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
-  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
-
-readable-stream@^2.2.2:
-  version "2.3.6"
-  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.6.tgz#b11c27d88b8ff1fbe070643cf94b0c79ae1b0aaf"
-  integrity sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==
-  dependencies:
-    core-util-is "~1.0.0"
-    inherits "~2.0.3"
-    isarray "~1.0.0"
-    process-nextick-args "~2.0.0"
-    safe-buffer "~5.1.1"
-    string_decoder "~1.1.1"
-    util-deprecate "~1.0.1"
-
-require-uncached@^1.0.3:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/require-uncached/-/require-uncached-1.0.3.tgz#4e0d56d6c9662fd31e43011c4b95aa49955421d3"
-  integrity sha1-Tg1W1slmL9MeQwEcS5WqSZVUIdM=
-  dependencies:
-    caller-path "^0.1.0"
-    resolve-from "^1.0.0"
-
-resolve-from@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-1.0.1.tgz#26cbfe935d1aeeeabb29bc3fe5aeb01e93d44226"
-  integrity sha1-Jsv+k10a7uq7Kbw/5a6wHpPUQiY=
-
-restore-cursor@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-2.0.0.tgz#9f7ee287f82fd326d4fd162923d62129eee0dfaf"
-  integrity sha1-n37ih/gv0ybU/RYpI9YhKe7g368=
-  dependencies:
-    onetime "^2.0.0"
-    signal-exit "^3.0.2"
-
-rimraf@~2.6.2:
-  version "2.6.3"
-  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.3.tgz#b2d104fe0d8fb27cf9e0a1cda8262dd3833c6cab"
-  integrity sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==
-  dependencies:
-    glob "^7.1.3"
-
-run-async@^2.2.0:
-  version "2.3.0"
-  resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.3.0.tgz#0371ab4ae0bdd720d4166d7dfda64ff7a445a6c0"
-  integrity sha1-A3GrSuC91yDUFm19/aZP96RFpsA=
-  dependencies:
-    is-promise "^2.1.0"
-
-rx-lite-aggregates@^4.0.8:
-  version "4.0.8"
-  resolved "https://registry.yarnpkg.com/rx-lite-aggregates/-/rx-lite-aggregates-4.0.8.tgz#753b87a89a11c95467c4ac1626c4efc4e05c67be"
-  integrity sha1-dTuHqJoRyVRnxKwWJsTvxOBcZ74=
-  dependencies:
-    rx-lite "*"
-
-rx-lite@*, rx-lite@^4.0.8:
-  version "4.0.8"
-  resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-4.0.8.tgz#0b1e11af8bc44836f04a6407e92da42467b79444"
-  integrity sha1-Cx4Rr4vESDbwSmQH6S2kJGe3lEQ=
-
-safe-buffer@~5.1.0, safe-buffer@~5.1.1:
-  version "5.1.2"
-  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d"
-  integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==
-
-"safer-buffer@>= 2.1.2 < 3":
-  version "2.1.2"
-  resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a"
-  integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==
-
-signal-exit@^3.0.2:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
-  integrity sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=
-
-slice-ansi@1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-1.0.0.tgz#044f1a49d8842ff307aad6b505ed178bd950134d"
-  integrity sha512-POqxBK6Lb3q6s047D/XsDVNPnF9Dl8JSaqe9h9lURl0OdNqy/ujDrOiIHtsqXMGbWWTIomRzAMaTyawAU//Reg==
-  dependencies:
-    is-fullwidth-code-point "^2.0.0"
-
-sprintf-js@~1.0.2:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
-  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
-
-string-width@^2.1.0, string-width@^2.1.1:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e"
-  integrity sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==
-  dependencies:
-    is-fullwidth-code-point "^2.0.0"
-    strip-ansi "^4.0.0"
-
-string_decoder@~1.1.1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8"
-  integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==
-  dependencies:
-    safe-buffer "~5.1.0"
-
-strip-ansi@^3.0.0:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf"
-  integrity sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=
-  dependencies:
-    ansi-regex "^2.0.0"
-
-strip-ansi@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f"
-  integrity sha1-qEeQIusaw2iocTibY1JixQXuNo8=
-  dependencies:
-    ansi-regex "^3.0.0"
-
-strip-json-comments@~2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a"
-  integrity sha1-PFMZQukIwml8DsNEhYwobHygpgo=
-
-supports-color@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7"
-  integrity sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=
-
-supports-color@^5.3.0:
-  version "5.5.0"
-  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
-  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
-  dependencies:
-    has-flag "^3.0.0"
-
-table@^4.0.1:
-  version "4.0.3"
-  resolved "https://registry.yarnpkg.com/table/-/table-4.0.3.tgz#00b5e2b602f1794b9acaf9ca908a76386a7813bc"
-  integrity sha512-S7rnFITmBH1EnyKcvxBh1LjYeQMmnZtCXSEbHcH6S0NoKit24ZuFO/T1vDcLdYsLQkM188PVVhQmzKIuThNkKg==
-  dependencies:
-    ajv "^6.0.1"
-    ajv-keywords "^3.0.0"
-    chalk "^2.1.0"
-    lodash "^4.17.4"
-    slice-ansi "1.0.0"
-    string-width "^2.1.1"
-
-text-table@~0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
-  integrity sha1-f17oI66AUgfACvLfSoTsP8+lcLQ=
-
-through@^2.3.6:
-  version "2.3.8"
-  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
-  integrity sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=
-
-tmp@^0.0.33:
-  version "0.0.33"
-  resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9"
-  integrity sha512-jRCJlojKnZ3addtTOjdIqoRuPEKBvNXcGYqzO6zWZX8KfKEpnGY5jfggJQ3EjKuu8D4bJRr0y+cYJFmYbImXGw==
-  dependencies:
-    os-tmpdir "~1.0.2"
-
-type-check@~0.3.2:
-  version "0.3.2"
-  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
-  integrity sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=
-  dependencies:
-    prelude-ls "~1.1.2"
-
-typedarray@^0.0.6:
-  version "0.0.6"
-  resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777"
-  integrity sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=
-
-uri-js@^4.2.2:
-  version "4.2.2"
-  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
-  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
-  dependencies:
-    punycode "^2.1.0"
-
-util-deprecate@~1.0.1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
-  integrity sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=
-
-wordwrap@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb"
-  integrity sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=
-
-wrappy@1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
-  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
-
-write@^0.2.1:
-  version "0.2.1"
-  resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757"
-  integrity sha1-X8A4KOJkzqP+kUVUdvejxWbLB1c=
-  dependencies:
-    mkdirp "^0.5.1"
-
-xtend@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af"
-  integrity sha1-pcbVMr5lbiPbgg77lDofBJmNY68=

From 5adf40208f4a2f56bda5c059d18ce578c5091dab Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 13:10:54 -0600
Subject: [PATCH 32/73] feat(eslint-plugin-react-hooks): convert to typescript
 and package type declarations (#32240)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

This change converts the eslint hooks plugin to typescript, which also
allows us to include type declarations in the package, for those using
[typescript eslint
configs](https://eslint.org/blog/2025/01/eslint-v9.18.0-released/#stable-typescript-configuration-file-support).

### Constituent changes that should land before this one

- [x] ~https://github.com/facebook/react/pull/32276~
- [x] https://github.com/facebook/react/pull/32279
- [x] https://github.com/facebook/react/pull/32283
- [x] https://github.com/facebook/react/pull/32393
- [x] https://github.com/facebook/react/pull/32396

Closes #30119

---------

Co-authored-by: Lauren Tan <poteto@users.noreply.github.com>
---
 .../eslint-plugin-react-hooks/babel.config.js |   8 +
 packages/eslint-plugin-react-hooks/index.js   |   9 +-
 .../eslint-plugin-react-hooks/jest.config.js  |   8 +
 .../eslint-plugin-react-hooks/npm/index.d.ts  |   1 +
 .../eslint-plugin-react-hooks/package.json    |  11 +-
 .../{ExhaustiveDeps.js => ExhaustiveDeps.ts}  | 631 +++++++++++-------
 .../src/{RulesOfHooks.js => RulesOfHooks.ts}  | 145 ++--
 .../eslint-plugin-react-hooks/src/index.js    |  61 --
 .../eslint-plugin-react-hooks/src/index.ts    |  64 ++
 .../src/types/estree.d.ts                     |   2 +
 .../eslint-plugin-react-hooks/tsconfig.json   |   1 -
 .../eslint-plugin-react-hooks/tsup.config.ts  |   9 -
 scripts/rollup/bundles.js                     |  14 +-
 yarn.lock                                     | 467 +------------
 14 files changed, 574 insertions(+), 857 deletions(-)
 create mode 100644 packages/eslint-plugin-react-hooks/babel.config.js
 create mode 100644 packages/eslint-plugin-react-hooks/jest.config.js
 create mode 100644 packages/eslint-plugin-react-hooks/npm/index.d.ts
 rename packages/eslint-plugin-react-hooks/src/{ExhaustiveDeps.js => ExhaustiveDeps.ts} (78%)
 rename packages/eslint-plugin-react-hooks/src/{RulesOfHooks.js => RulesOfHooks.ts} (85%)
 delete mode 100644 packages/eslint-plugin-react-hooks/src/index.js
 create mode 100644 packages/eslint-plugin-react-hooks/src/index.ts
 delete mode 100644 packages/eslint-plugin-react-hooks/tsup.config.ts

diff --git a/packages/eslint-plugin-react-hooks/babel.config.js b/packages/eslint-plugin-react-hooks/babel.config.js
new file mode 100644
index 0000000000000..3b947a7163bcb
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/babel.config.js
@@ -0,0 +1,8 @@
+/**
+ * This file is purely being used for local jest runs, and doesn't participate in the build process.
+ */
+'use strict';
+
+module.exports = {
+  extends: '../../babel.config-ts.js',
+};
diff --git a/packages/eslint-plugin-react-hooks/index.js b/packages/eslint-plugin-react-hooks/index.js
index 754dc9f9c7f23..ce26a10c31518 100644
--- a/packages/eslint-plugin-react-hooks/index.js
+++ b/packages/eslint-plugin-react-hooks/index.js
@@ -1,8 +1 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-export * from './src/index';
+module.exports = require('./src/index.ts');
diff --git a/packages/eslint-plugin-react-hooks/jest.config.js b/packages/eslint-plugin-react-hooks/jest.config.js
new file mode 100644
index 0000000000000..a7b91c3ef1cbe
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/jest.config.js
@@ -0,0 +1,8 @@
+'use strict';
+
+process.env.NODE_ENV = 'development';
+
+module.exports = {
+  setupFiles: [require.resolve('../../scripts/jest/setupEnvironment.js')],
+  moduleFileExtensions: ['ts', 'js', 'json'],
+};
diff --git a/packages/eslint-plugin-react-hooks/npm/index.d.ts b/packages/eslint-plugin-react-hooks/npm/index.d.ts
new file mode 100644
index 0000000000000..62ca164ec2173
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/npm/index.d.ts
@@ -0,0 +1 @@
+export * from './cjs/eslint-plugin-react-hooks';
diff --git a/packages/eslint-plugin-react-hooks/package.json b/packages/eslint-plugin-react-hooks/package.json
index b45609362faac..d3717b9dee61c 100644
--- a/packages/eslint-plugin-react-hooks/package.json
+++ b/packages/eslint-plugin-react-hooks/package.json
@@ -10,8 +10,9 @@
   "files": [
     "LICENSE",
     "README.md",
+    "cjs",
     "index.js",
-    "cjs"
+    "index.d.ts"
   ],
   "keywords": [
     "eslint",
@@ -19,10 +20,16 @@
     "eslintplugin",
     "react"
   ],
+  "scripts": {
+    "test": "jest",
+    "typecheck": "tsc --noEmit"
+  },
   "license": "MIT",
   "bugs": {
     "url": "https://github.com/facebook/react/issues"
   },
+  "main": "./index.js",
+  "types": "./index.d.ts",
   "engines": {
     "node": ">=10"
   },
@@ -32,6 +39,7 @@
   },
   "devDependencies": {
     "@babel/eslint-parser": "^7.11.4",
+    "@babel/preset-typescript": "^7.26.0",
     "@tsconfig/strictest": "^2.0.5",
     "@typescript-eslint/parser-v2": "npm:@typescript-eslint/parser@^2.26.0",
     "@typescript-eslint/parser-v3": "npm:@typescript-eslint/parser@^3.10.0",
@@ -45,7 +53,6 @@
     "eslint-v7": "npm:eslint@^7.7.0",
     "eslint-v9": "npm:eslint@^9.0.0",
     "jest": "^29.5.0",
-    "tsup": "^8.3.5",
     "typescript": "^5.4.3"
   }
 }
diff --git a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
similarity index 78%
rename from packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js
rename to packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
index b2818327ff9e4..9f3d4d4db9004 100644
--- a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js
+++ b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
@@ -4,12 +4,41 @@
  * This source code is licensed under the MIT license found in the
  * LICENSE file in the root directory of this source tree.
  */
-
 /* eslint-disable no-for-of-loops/no-for-of-loops */
+import type {Rule, Scope} from 'eslint';
+import type {
+  ArrayExpression,
+  ArrowFunctionExpression,
+  CallExpression,
+  Expression,
+  FunctionDeclaration,
+  FunctionExpression,
+  Identifier,
+  Node,
+  Pattern,
+  PrivateIdentifier,
+  Super,
+  VariableDeclarator,
+} from 'estree';
+
+type DeclaredDependency = {
+  key: string;
+  node: Node;
+};
 
-'use strict';
+type Dependency = {
+  isStable: boolean;
+  references: Scope.Reference[];
+};
+
+type DependencyTreeNode = {
+  isUsed: boolean; // True if used in code
+  isSatisfiedRecursively: boolean; // True if specified in deps
+  isSubtreeUsed: boolean; // True if something deeper is used by code
+  children: Map<string, DependencyTreeNode>; // Nodes for properties
+};
 
-export default {
+const rule = {
   meta: {
     type: 'suggestion',
     docs: {
@@ -36,7 +65,7 @@ export default {
       },
     ],
   },
-  create(context) {
+  create(context: Rule.RuleContext) {
     // Parse the `additionalHooks` regex.
     const additionalHooks =
       context.options &&
@@ -45,7 +74,7 @@ export default {
         ? new RegExp(context.options[0].additionalHooks)
         : undefined;
 
-    const enableDangerousAutofixThisMayCauseInfiniteLoops =
+    const enableDangerousAutofixThisMayCauseInfiniteLoops: boolean =
       (context.options &&
         context.options[0] &&
         context.options[0].enableDangerousAutofixThisMayCauseInfiniteLoops) ||
@@ -56,11 +85,15 @@ export default {
       enableDangerousAutofixThisMayCauseInfiniteLoops,
     };
 
-    function reportProblem(problem) {
+    function reportProblem(problem: Rule.ReportDescriptor) {
       if (enableDangerousAutofixThisMayCauseInfiniteLoops) {
         // Used to enable legacy behavior. Dangerous.
         // Keep this as an option until major IDEs upgrade (including VSCode FB ESLint extension).
-        if (Array.isArray(problem.suggest) && problem.suggest.length > 0) {
+        if (
+          Array.isArray(problem.suggest) &&
+          problem.suggest.length > 0 &&
+          problem.suggest[0]
+        ) {
           problem.fix = problem.suggest[0].fix;
         }
       }
@@ -68,15 +101,15 @@ export default {
     }
 
     /**
-     * SourceCode#getText that also works down to ESLint 3.0.0
+     * SourceCode that also works down to ESLint 3.0.0
      */
-    const getSource =
-      typeof context.getSource === 'function'
-        ? node => {
-            return context.getSource(node);
+    const getSourceCode =
+      typeof context.getSourceCode === 'function'
+        ? () => {
+            return context.getSourceCode();
           }
-        : node => {
-            return context.sourceCode.getText(node);
+        : () => {
+            return context.sourceCode;
           };
     /**
      * SourceCode#getScope that also works down to ESLint 3.0.0
@@ -86,24 +119,34 @@ export default {
         ? () => {
             return context.getScope();
           }
-        : node => {
+        : (node: Node) => {
             return context.sourceCode.getScope(node);
           };
 
-    const scopeManager = context.getSourceCode().scopeManager;
+    const scopeManager = getSourceCode().scopeManager;
 
     // Should be shared between visitors.
-    const setStateCallSites = new WeakMap();
-    const stateVariables = new WeakSet();
-    const stableKnownValueCache = new WeakMap();
-    const functionWithoutCapturedValueCache = new WeakMap();
-    const useEffectEventVariables = new WeakSet();
-    function memoizeWithWeakMap(fn, map) {
-      return function (arg) {
+    const setStateCallSites = new WeakMap<
+      Expression | Super,
+      Pattern | null | undefined
+    >();
+    const stateVariables = new WeakSet<Identifier>();
+    const stableKnownValueCache = new WeakMap<Scope.Variable, boolean>();
+    const functionWithoutCapturedValueCache = new WeakMap<
+      Scope.Variable,
+      boolean
+    >();
+    const useEffectEventVariables = new WeakSet<Expression>();
+
+    function memoizeWithWeakMap(
+      fn: (resolved: Scope.Variable) => boolean,
+      map: WeakMap<Scope.Variable, boolean>,
+    ) {
+      return function (arg: Scope.Variable): boolean {
         if (map.has(arg)) {
           // to verify cache hits:
           // console.log(arg.name)
-          return map.get(arg);
+          return map.get(arg)!;
         }
         const result = fn(arg);
         map.set(arg, result);
@@ -114,12 +157,12 @@ export default {
      * Visitor for both function expressions and arrow function expressions.
      */
     function visitFunctionWithDependencies(
-      node,
-      declaredDependenciesNode,
-      reactiveHook,
-      reactiveHookName,
-      isEffect,
-    ) {
+      node: ArrowFunctionExpression | FunctionDeclaration | FunctionExpression,
+      declaredDependenciesNode: Node | undefined,
+      reactiveHook: Node,
+      reactiveHookName: string,
+      isEffect: boolean,
+    ): void {
       if (isEffect && node.async) {
         reportProblem({
           node: node,
@@ -140,6 +183,9 @@ export default {
 
       // Get the current scope.
       const scope = scopeManager.acquire(node);
+      if (!scope) {
+        return;
+      }
 
       // Find all our "pure scopes". On every re-render of a component these
       // pure scopes may have changes to the variables declared within. So all
@@ -150,7 +196,7 @@ export default {
       // scope. We can't enforce this in a lint so we trust that all variables
       // declared outside of pure scope are indeed frozen.
       const pureScopes = new Set();
-      let componentScope = null;
+      let componentScope: Scope.Scope | null = null;
       {
         let currentScope = scope.upper;
         while (currentScope) {
@@ -186,7 +232,7 @@ export default {
       // const onStuff = useEffectEvent(() => {})
       //       ^^^ true for this reference
       // False for everything else.
-      function isStableKnownHookValue(resolved) {
+      function isStableKnownHookValue(resolved: Scope.Variable): boolean {
         if (!isArray(resolved.defs)) {
           return false;
         }
@@ -195,10 +241,11 @@ export default {
           return false;
         }
         // Look for `let stuff = ...`
-        if (def.node.type !== 'VariableDeclarator') {
+        const defNode: VariableDeclarator = def.node;
+        if (defNode.type !== 'VariableDeclarator') {
           return false;
         }
-        let init = def.node.init;
+        let init = defNode.init;
         if (init == null) {
           return false;
         }
@@ -207,8 +254,8 @@ export default {
         }
         // Detect primitive constants
         // const foo = 42
-        let declaration = def.node.parent;
-        if (declaration == null) {
+        let declaration = defNode.parent;
+        if (declaration == null && componentScope) {
           // This might happen if variable is declared after the callback.
           // In that case ESLint won't set up .parent refs.
           // So we'll set them up manually.
@@ -219,6 +266,8 @@ export default {
           }
         }
         if (
+          declaration &&
+          'kind' in declaration &&
           declaration.kind === 'const' &&
           init.type === 'Literal' &&
           (typeof init.value === 'string' ||
@@ -233,10 +282,11 @@ export default {
         if (init.type !== 'CallExpression') {
           return false;
         }
-        let callee = init.callee;
+        let callee: Expression | PrivateIdentifier | Super = init.callee;
         // Step into `= React.something` initializer.
         if (
           callee.type === 'MemberExpression' &&
+          'name' in callee.object &&
           callee.object.name === 'React' &&
           callee.property != null &&
           !callee.computed
@@ -246,7 +296,8 @@ export default {
         if (callee.type !== 'Identifier') {
           return false;
         }
-        const id = def.node.id;
+        const definitionNode: VariableDeclarator = def.node;
+        const id = definitionNode.id;
         const {name} = callee;
         if (name === 'useRef' && id.type === 'Identifier') {
           // useRef() return value is stable.
@@ -256,6 +307,7 @@ export default {
           id.type === 'Identifier'
         ) {
           for (const ref of resolved.references) {
+            // @ts-expect-error These types are not compatible (Reference and Identifier)
             if (ref !== id) {
               useEffectEventVariables.add(ref.identifier);
             }
@@ -278,17 +330,14 @@ export default {
               if (name === 'useState') {
                 const references = resolved.references;
                 let writeCount = 0;
-                for (let i = 0; i < references.length; i++) {
-                  if (references[i].isWrite()) {
+                for (const reference of references) {
+                  if (reference.isWrite()) {
                     writeCount++;
                   }
                   if (writeCount > 1) {
                     return false;
                   }
-                  setStateCallSites.set(
-                    references[i].identifier,
-                    id.elements[0],
-                  );
+                  setStateCallSites.set(reference.identifier, id.elements[0]);
                 }
               }
               // Setter is stable.
@@ -296,8 +345,8 @@ export default {
             } else if (id.elements[0] === resolved.identifiers[0]) {
               if (name === 'useState') {
                 const references = resolved.references;
-                for (let i = 0; i < references.length; i++) {
-                  stateVariables.add(references[i].identifier);
+                for (const reference of references) {
+                  stateVariables.add(reference.identifier);
                 }
               }
               // State variable itself is dynamic.
@@ -323,7 +372,9 @@ export default {
       }
 
       // Some are just functions that don't reference anything dynamic.
-      function isFunctionWithoutCapturedValues(resolved) {
+      function isFunctionWithoutCapturedValues(
+        resolved: Scope.Variable,
+      ): boolean {
         if (!isArray(resolved.defs)) {
           return false;
         }
@@ -336,12 +387,10 @@ export default {
         }
         // Search the direct component subscopes for
         // top-level function definitions matching this reference.
-        const fnNode = def.node;
-        const childScopes = componentScope.childScopes;
+        const fnNode: Node = def.node;
+        const childScopes = componentScope?.childScopes || [];
         let fnScope = null;
-        let i;
-        for (i = 0; i < childScopes.length; i++) {
-          const childScope = childScopes[i];
+        for (const childScope of childScopes) {
           const childScopeBlock = childScope.block;
           if (
             // function handleChange() {}
@@ -362,8 +411,7 @@ export default {
         }
         // Does this function capture any values
         // that are in pure scopes (aka render)?
-        for (i = 0; i < fnScope.through.length; i++) {
-          const ref = fnScope.through[i];
+        for (const ref of fnScope.through) {
           if (ref.resolved == null) {
             continue;
           }
@@ -392,15 +440,21 @@ export default {
       );
 
       // These are usually mistaken. Collect them.
-      const currentRefsInEffectCleanup = new Map();
+      const currentRefsInEffectCleanup = new Map<
+        string,
+        {
+          reference: Scope.Reference;
+          dependencyNode: Identifier;
+        }
+      >();
 
       // Is this reference inside a cleanup function for this effect node?
       // We can check by traversing scopes upwards from the reference, and checking
       // if the last "return () => " we encounter is located directly inside the effect.
-      function isInsideEffectCleanup(reference) {
-        let curScope = reference.from;
+      function isInsideEffectCleanup(reference: Scope.Reference): boolean {
+        let curScope: Scope.Scope | null = reference.from;
         let isInReturnedFunction = false;
-        while (curScope.block !== node) {
+        while (curScope && curScope.block !== node) {
           if (curScope.type === 'function') {
             isInReturnedFunction =
               curScope.block.parent != null &&
@@ -413,11 +467,11 @@ export default {
 
       // Get dependencies from all our resolved references in pure scopes.
       // Key is dependency string, value is whether it's stable.
-      const dependencies = new Map();
-      const optionalChains = new Map();
+      const dependencies = new Map<string, Dependency>();
+      const optionalChains = new Map<string, boolean>();
       gatherDependenciesRecursively(scope);
 
-      function gatherDependenciesRecursively(currentScope) {
+      function gatherDependenciesRecursively(currentScope: Scope.Scope): void {
         for (const reference of currentScope.references) {
           // If this reference is not resolved or it is not declared in a pure
           // scope then we don't care about this reference.
@@ -434,6 +488,9 @@ export default {
             node,
             reference.identifier,
           );
+          if (referenceNode == null) {
+            continue;
+          }
           const dependencyNode = getDependency(referenceNode);
           const dependency = analyzePropertyChain(
             dependencyNode,
@@ -446,8 +503,8 @@ export default {
             isEffect &&
             // ... and this look like accessing .current...
             dependencyNode.type === 'Identifier' &&
-            (dependencyNode.parent.type === 'MemberExpression' ||
-              dependencyNode.parent.type === 'OptionalMemberExpression') &&
+            (dependencyNode.parent?.type === 'MemberExpression' ||
+              dependencyNode.parent?.type === 'OptionalMemberExpression') &&
             !dependencyNode.parent.computed &&
             dependencyNode.parent.property.type === 'Identifier' &&
             dependencyNode.parent.property.name === 'current' &&
@@ -461,8 +518,8 @@ export default {
           }
 
           if (
-            dependencyNode.parent.type === 'TSTypeQuery' ||
-            dependencyNode.parent.type === 'TSTypeReference'
+            dependencyNode.parent?.type === 'TSTypeQuery' ||
+            dependencyNode.parent?.type === 'TSTypeReference'
           ) {
             continue;
           }
@@ -472,10 +529,11 @@ export default {
             continue;
           }
           // Ignore references to the function itself as it's not defined yet.
-          if (def.node != null && def.node.init === node.parent) {
+          if (def.node && def.node.init === node.parent) {
             continue;
           }
           // Ignore Flow type parameters
+          // @ts-expect-error We don't have flow types
           if (def.type === 'TypeParameter') {
             continue;
           }
@@ -492,7 +550,7 @@ export default {
               references: [reference],
             });
           } else {
-            dependencies.get(dependency).references.push(reference);
+            dependencies.get(dependency)?.references.push(reference);
           }
         }
 
@@ -504,12 +562,12 @@ export default {
       // Warn about accessing .current in cleanup effects.
       currentRefsInEffectCleanup.forEach(
         ({reference, dependencyNode}, dependency) => {
-          const references = reference.resolved.references;
+          const references = reference.resolved?.references || [];
           // Is React managing this ref or us?
           // Let's see if we can find a .current assignment.
           let foundCurrentAssignment = false;
-          for (let i = 0; i < references.length; i++) {
-            const {identifier} = references[i];
+          for (const reference of references) {
+            const {identifier} = reference;
             const {parent} = identifier;
             if (
               parent != null &&
@@ -520,7 +578,7 @@ export default {
               parent.property.type === 'Identifier' &&
               parent.property.name === 'current' &&
               // ref.current = <something>
-              parent.parent.type === 'AssignmentExpression' &&
+              parent.parent?.type === 'AssignmentExpression' &&
               parent.parent.left === parent
             ) {
               foundCurrentAssignment = true;
@@ -532,6 +590,7 @@ export default {
             return;
           }
           reportProblem({
+            // @ts-expect-error We can do better here (dependencyNode.parent has not been type narrowed)
             node: dependencyNode.parent.property,
             message:
               `The ref value '${dependency}.current' will likely have ` +
@@ -545,8 +604,8 @@ export default {
 
       // Warn about assigning to variables in the outer scope.
       // Those are usually bugs.
-      const staleAssignments = new Set();
-      function reportStaleAssignment(writeExpr, key) {
+      const staleAssignments = new Set<string>();
+      function reportStaleAssignment(writeExpr: Node, key: string): void {
         if (staleAssignments.has(key)) {
           return;
         }
@@ -555,16 +614,16 @@ export default {
           node: writeExpr,
           message:
             `Assignments to the '${key}' variable from inside React Hook ` +
-            `${getSource(reactiveHook)} will be lost after each ` +
+            `${getSourceCode().getText(reactiveHook)} will be lost after each ` +
             `render. To preserve the value over time, store it in a useRef ` +
             `Hook and keep the mutable value in the '.current' property. ` +
             `Otherwise, you can move this variable directly inside ` +
-            `${getSource(reactiveHook)}.`,
+            `${getSourceCode().getText(reactiveHook)}.`,
         });
       }
 
       // Remember which deps are stable and report bad usage first.
-      const stableDependencies = new Set();
+      const stableDependencies = new Set<string>();
       dependencies.forEach(({isStable, references}, key) => {
         if (isStable) {
           stableDependencies.add(key);
@@ -584,8 +643,8 @@ export default {
       if (!declaredDependenciesNode) {
         // Check if there are any top-level setState() calls.
         // Those tend to lead to infinite loops.
-        let setStateInsideEffectWithoutDeps = null;
-        dependencies.forEach(({isStable, references}, key) => {
+        let setStateInsideEffectWithoutDeps: string | null = null;
+        dependencies.forEach(({references}, key) => {
           if (setStateInsideEffectWithoutDeps) {
             return;
           }
@@ -600,11 +659,11 @@ export default {
               return;
             }
 
-            let fnScope = reference.from;
-            while (fnScope.type !== 'function') {
+            let fnScope: Scope.Scope | null = reference.from;
+            while (fnScope && fnScope.type !== 'function') {
               fnScope = fnScope.upper;
             }
-            const isDirectlyInsideEffect = fnScope.block === node;
+            const isDirectlyInsideEffect = fnScope?.block === node;
             if (isDirectlyInsideEffect) {
               // TODO: we could potentially ignore early returns.
               setStateInsideEffectWithoutDeps = key;
@@ -616,7 +675,7 @@ export default {
             dependencies,
             declaredDependencies: [],
             stableDependencies,
-            externalDependencies: new Set(),
+            externalDependencies: new Set<string>(),
             isEffect: true,
           });
           reportProblem({
@@ -645,8 +704,8 @@ export default {
         return;
       }
 
-      const declaredDependencies = [];
-      const externalDependencies = new Set();
+      const declaredDependencies: DeclaredDependency[] = [];
+      const externalDependencies = new Set<string>();
       const isArrayExpression =
         declaredDependenciesNode.type === 'ArrayExpression';
       const isTSAsArrayExpression =
@@ -660,7 +719,7 @@ export default {
         reportProblem({
           node: declaredDependenciesNode,
           message:
-            `React Hook ${getSource(reactiveHook)} was passed a ` +
+            `React Hook ${getSourceCode().getText(reactiveHook)} was passed a ` +
             'dependency list that is not an array literal. This means we ' +
             "can't statically verify whether you've passed the correct " +
             'dependencies.',
@@ -670,108 +729,117 @@ export default {
           ? declaredDependenciesNode.expression
           : declaredDependenciesNode;
 
-        arrayExpression.elements.forEach(declaredDependencyNode => {
-          // Skip elided elements.
-          if (declaredDependencyNode === null) {
-            return;
-          }
-          // If we see a spread element then add a special warning.
-          if (declaredDependencyNode.type === 'SpreadElement') {
-            reportProblem({
-              node: declaredDependencyNode,
-              message:
-                `React Hook ${getSource(reactiveHook)} has a spread ` +
-                "element in its dependency array. This means we can't " +
-                "statically verify whether you've passed the " +
-                'correct dependencies.',
-            });
-            return;
-          }
-          if (useEffectEventVariables.has(declaredDependencyNode)) {
-            reportProblem({
-              node: declaredDependencyNode,
-              message:
-                'Functions returned from `useEffectEvent` must not be included in the dependency array. ' +
-                `Remove \`${getSource(
-                  declaredDependencyNode,
-                )}\` from the list.`,
-              suggest: [
-                {
-                  desc: `Remove the dependency \`${getSource(
+        (arrayExpression as ArrayExpression).elements.forEach(
+          declaredDependencyNode => {
+            // Skip elided elements.
+            if (declaredDependencyNode === null) {
+              return;
+            }
+            // If we see a spread element then add a special warning.
+            if (declaredDependencyNode.type === 'SpreadElement') {
+              reportProblem({
+                node: declaredDependencyNode,
+                message:
+                  `React Hook ${getSourceCode().getText(reactiveHook)} has a spread ` +
+                  "element in its dependency array. This means we can't " +
+                  "statically verify whether you've passed the " +
+                  'correct dependencies.',
+              });
+              return;
+            }
+            if (useEffectEventVariables.has(declaredDependencyNode)) {
+              reportProblem({
+                node: declaredDependencyNode,
+                message:
+                  'Functions returned from `useEffectEvent` must not be included in the dependency array. ' +
+                  `Remove \`${getSourceCode().getText(
                     declaredDependencyNode,
-                  )}\``,
-                  fix(fixer) {
-                    return fixer.removeRange(declaredDependencyNode.range);
+                  )}\` from the list.`,
+                suggest: [
+                  {
+                    desc: `Remove the dependency \`${getSourceCode().getText(
+                      declaredDependencyNode,
+                    )}\``,
+                    fix(fixer) {
+                      return fixer.removeRange(declaredDependencyNode.range!);
+                    },
                   },
-                },
-              ],
-            });
-          }
-          // Try to normalize the declared dependency. If we can't then an error
-          // will be thrown. We will catch that error and report an error.
-          let declaredDependency;
-          try {
-            declaredDependency = analyzePropertyChain(
-              declaredDependencyNode,
-              null,
-            );
-          } catch (error) {
-            if (/Unsupported node type/.test(error.message)) {
-              if (declaredDependencyNode.type === 'Literal') {
-                if (dependencies.has(declaredDependencyNode.value)) {
-                  reportProblem({
-                    node: declaredDependencyNode,
-                    message:
-                      `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
-                      `because it never changes. ` +
-                      `Did you mean to include ${declaredDependencyNode.value} in the array instead?`,
-                  });
+                ],
+              });
+            }
+            // Try to normalize the declared dependency. If we can't then an error
+            // will be thrown. We will catch that error and report an error.
+            let declaredDependency;
+            try {
+              declaredDependency = analyzePropertyChain(
+                declaredDependencyNode,
+                null,
+              );
+            } catch (error: unknown) {
+              if (
+                error instanceof Error &&
+                /Unsupported node type/.test(error.message)
+              ) {
+                if (declaredDependencyNode.type === 'Literal') {
+                  if (
+                    declaredDependencyNode.value &&
+                    dependencies.has(declaredDependencyNode.value as string)
+                  ) {
+                    reportProblem({
+                      node: declaredDependencyNode,
+                      message:
+                        `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
+                        `because it never changes. ` +
+                        `Did you mean to include ${declaredDependencyNode.value} in the array instead?`,
+                    });
+                  } else {
+                    reportProblem({
+                      node: declaredDependencyNode,
+                      message:
+                        `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
+                        'because it never changes. You can safely remove it.',
+                    });
+                  }
                 } else {
                   reportProblem({
                     node: declaredDependencyNode,
                     message:
-                      `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
-                      'because it never changes. You can safely remove it.',
+                      `React Hook ${getSourceCode().getText(reactiveHook)} has a ` +
+                      `complex expression in the dependency array. ` +
+                      'Extract it to a separate variable so it can be statically checked.',
                   });
                 }
+
+                return;
               } else {
-                reportProblem({
-                  node: declaredDependencyNode,
-                  message:
-                    `React Hook ${getSource(reactiveHook)} has a ` +
-                    `complex expression in the dependency array. ` +
-                    'Extract it to a separate variable so it can be statically checked.',
-                });
+                throw error;
               }
-
-              return;
-            } else {
-              throw error;
             }
-          }
 
-          let maybeID = declaredDependencyNode;
-          while (
-            maybeID.type === 'MemberExpression' ||
-            maybeID.type === 'OptionalMemberExpression' ||
-            maybeID.type === 'ChainExpression'
-          ) {
-            maybeID = maybeID.object || maybeID.expression.object;
-          }
-          const isDeclaredInComponent = !componentScope.through.some(
-            ref => ref.identifier === maybeID,
-          );
+            let maybeID = declaredDependencyNode;
+            while (
+              maybeID.type === 'MemberExpression' ||
+              maybeID.type === 'OptionalMemberExpression' ||
+              maybeID.type === 'ChainExpression'
+            ) {
+              // @ts-expect-error This can be done better
+              maybeID = maybeID.object || maybeID.expression.object;
+            }
+            const isDeclaredInComponent = !componentScope.through.some(
+              ref => ref.identifier === maybeID,
+            );
 
-          // Add the dependency to our declared dependency map.
-          declaredDependencies.push({
-            key: declaredDependency,
-            node: declaredDependencyNode,
-          });
+            // Add the dependency to our declared dependency map.
+            declaredDependencies.push({
+              key: declaredDependency,
+              node: declaredDependencyNode,
+            });
 
-          if (!isDeclaredInComponent) {
-            externalDependencies.add(declaredDependency);
-          }
-        });
+            if (!isDeclaredInComponent) {
+              externalDependencies.add(declaredDependency);
+            }
+          },
+        );
       }
 
       const {
@@ -824,10 +892,10 @@ export default {
 
             const message =
               `The '${construction.name.name}' ${depType} ${causation} the dependencies of ` +
-              `${reactiveHookName} Hook (at line ${declaredDependenciesNode.loc.start.line}) ` +
+              `${reactiveHookName} Hook (at line ${declaredDependenciesNode.loc?.start.line}) ` +
               `change on every render. ${advice}`;
 
-            let suggest;
+            let suggest: Rule.ReportDescriptor['suggest'];
             // Only handle the simple case of variable assignments.
             // Wrapping function declarations can mess up hoisting.
             if (
@@ -848,12 +916,12 @@ export default {
                         : ['useCallback(', ')'];
                     return [
                       // TODO: also add an import?
-                      fixer.insertTextBefore(construction.node.init, before),
+                      fixer.insertTextBefore(construction.node.init!, before),
                       // TODO: ideally we'd gather deps here but it would require
                       // restructuring the rule code. This will cause a new lint
                       // error to appear immediately for useCallback. Note we're
                       // not adding [] because would that changes semantics.
-                      fixer.insertTextAfter(construction.node.init, after),
+                      fixer.insertTextAfter(construction.node.init!, after),
                     ];
                   },
                 },
@@ -889,7 +957,7 @@ export default {
       }
 
       // Alphabetize the suggestions, but only if deps were already alphabetized.
-      function areDeclaredDepsAlphabetized() {
+      function areDeclaredDepsAlphabetized(): boolean {
         if (declaredDependencies.length === 0) {
           return true;
         }
@@ -905,7 +973,7 @@ export default {
       // This function is the last step before printing a dependency, so now is a good time to
       // check whether any members in our path are always used as optional-only. In that case,
       // we will use ?. instead of . to concatenate those parts of the path.
-      function formatDependency(path) {
+      function formatDependency(path: string): string {
         const members = path.split('.');
         let finalPath = '';
         for (let i = 0; i < members.length; i++) {
@@ -919,7 +987,12 @@ export default {
         return finalPath;
       }
 
-      function getWarningMessage(deps, singlePrefix, label, fixVerb) {
+      function getWarningMessage(
+        deps: Set<string>,
+        singlePrefix: string,
+        label: string,
+        fixVerb: string,
+      ): string | null {
         if (deps.size === 0) {
           return null;
         }
@@ -942,7 +1015,7 @@ export default {
 
       let extraWarning = '';
       if (unnecessaryDependencies.size > 0) {
-        let badRef = null;
+        let badRef: string | null = null;
         Array.from(unnecessaryDependencies.keys()).forEach(key => {
           if (badRef !== null) {
             return;
@@ -956,7 +1029,7 @@ export default {
             ` Mutable values like '${badRef}' aren't valid dependencies ` +
             "because mutating them doesn't re-render the component.";
         } else if (externalDependencies.size > 0) {
-          const dep = Array.from(externalDependencies)[0];
+          const dep = Array.from(externalDependencies)[0]!;
           // Don't show this warning for things that likely just got moved *inside* the callback
           // because in that case they're clearly not referring to globals.
           if (!scope.set.has(dep)) {
@@ -980,8 +1053,7 @@ export default {
           return;
         }
         let isPropsOnlyUsedInMembers = true;
-        for (let i = 0; i < refs.length; i++) {
-          const ref = refs[i];
+        for (const ref of refs) {
           const id = fastFindReferenceWithParent(
             componentScope.block,
             ref.identifier,
@@ -1008,14 +1080,14 @@ export default {
             ` However, 'props' will change when *any* prop changes, so the ` +
             `preferred fix is to destructure the 'props' object outside of ` +
             `the ${reactiveHookName} call and refer to those specific props ` +
-            `inside ${getSource(reactiveHook)}.`;
+            `inside ${getSourceCode().getText(reactiveHook)}.`;
         }
       }
 
       if (!extraWarning && missingDependencies.size > 0) {
         // See if the user is trying to avoid specifying a callable prop.
         // This usually means they're unaware of useCallback.
-        let missingCallbackDep = null;
+        let missingCallbackDep: string | null = null;
         missingDependencies.forEach(missingDep => {
           if (missingCallbackDep) {
             return;
@@ -1023,19 +1095,22 @@ export default {
           // Is this a variable from top scope?
           const topScopeRef = componentScope.set.get(missingDep);
           const usedDep = dependencies.get(missingDep);
-          if (usedDep.references[0].resolved !== topScopeRef) {
+          if (
+            !usedDep?.references ||
+            usedDep?.references[0]?.resolved !== topScopeRef
+          ) {
             return;
           }
           // Is this a destructured prop?
-          const def = topScopeRef.defs[0];
+          const def = topScopeRef?.defs[0];
           if (def == null || def.name == null || def.type !== 'Parameter') {
             return;
           }
           // Was it called in at least one case? Then it's a function.
           let isFunctionCall = false;
-          let id;
-          for (let i = 0; i < usedDep.references.length; i++) {
-            id = usedDep.references[i].identifier;
+          let id: Identifier | undefined;
+          for (const reference of usedDep.references) {
+            id = reference.identifier;
             if (
               id != null &&
               id.parent != null &&
@@ -1064,17 +1139,21 @@ export default {
       }
 
       if (!extraWarning && missingDependencies.size > 0) {
-        let setStateRecommendation = null;
-        missingDependencies.forEach(missingDep => {
+        let setStateRecommendation: {
+          missingDep: string;
+          setter: string;
+          form: 'reducer' | 'updater' | 'inlineReducer';
+        } | null = null;
+        for (const missingDep of missingDependencies) {
           if (setStateRecommendation !== null) {
-            return;
+            break;
           }
-          const usedDep = dependencies.get(missingDep);
+          const usedDep = dependencies.get(missingDep)!;
           const references = usedDep.references;
           let id;
           let maybeCall;
-          for (let i = 0; i < references.length; i++) {
-            id = references[i].identifier;
+          for (const reference of references) {
+            id = reference.identifier;
             maybeCall = id.parent;
             // Try to see if we have setState(someExpr(missingDep)).
             while (maybeCall != null && maybeCall !== componentScope.block) {
@@ -1083,22 +1162,27 @@ export default {
                   maybeCall.callee,
                 );
                 if (correspondingStateVariable != null) {
-                  if (correspondingStateVariable.name === missingDep) {
+                  if (
+                    'name' in correspondingStateVariable &&
+                    correspondingStateVariable.name === missingDep
+                  ) {
                     // setCount(count + 1)
                     setStateRecommendation = {
                       missingDep,
-                      setter: maybeCall.callee.name,
+                      setter:
+                        'name' in maybeCall.callee ? maybeCall.callee.name : '',
                       form: 'updater',
                     };
                   } else if (stateVariables.has(id)) {
                     // setCount(count + increment)
                     setStateRecommendation = {
                       missingDep,
-                      setter: maybeCall.callee.name,
+                      setter:
+                        'name' in maybeCall.callee ? maybeCall.callee.name : '',
                       form: 'reducer',
                     };
                   } else {
-                    const resolved = references[i].resolved;
+                    const resolved = reference.resolved;
                     if (resolved != null) {
                       // If it's a parameter *and* a missing dep,
                       // it must be a prop or something inside a prop.
@@ -1107,7 +1191,10 @@ export default {
                       if (def != null && def.type === 'Parameter') {
                         setStateRecommendation = {
                           missingDep,
-                          setter: maybeCall.callee.name,
+                          setter:
+                            'name' in maybeCall.callee
+                              ? maybeCall.callee.name
+                              : '',
                           form: 'inlineReducer',
                         };
                       }
@@ -1122,7 +1209,7 @@ export default {
               break;
             }
           }
-        });
+        }
         if (setStateRecommendation !== null) {
           switch (setStateRecommendation.form) {
             case 'reducer':
@@ -1158,7 +1245,7 @@ export default {
       reportProblem({
         node: declaredDependenciesNode,
         message:
-          `React Hook ${getSource(reactiveHook)} has ` +
+          `React Hook ${getSourceCode().getText(reactiveHook)} has ` +
           // To avoid a long message, show the next actionable item.
           (getWarningMessage(missingDependencies, 'a', 'missing', 'include') ||
             getWarningMessage(
@@ -1191,7 +1278,7 @@ export default {
       });
     }
 
-    function visitCallExpression(node) {
+    function visitCallExpression(node: CallExpression): void {
       const callbackIndex = getReactiveHookCallbackIndex(node.callee, options);
       if (callbackIndex === -1) {
         // Not a React Hook call that needs deps.
@@ -1199,7 +1286,9 @@ export default {
       }
       let callback = node.arguments[callbackIndex];
       const reactiveHook = node.callee;
-      const reactiveHookName = getNodeWithoutReactNamespace(reactiveHook).name;
+      const nodeWithoutNamespace = getNodeWithoutReactNamespace(reactiveHook);
+      const reactiveHookName =
+        'name' in nodeWithoutNamespace ? nodeWithoutNamespace.name : '';
       const maybeNode = node.arguments[callbackIndex + 1];
       const declaredDependenciesNode =
         maybeNode &&
@@ -1268,6 +1357,7 @@ export default {
           // The function passed as a callback is not written inline.
           // But perhaps it's in the dependencies array?
           if (
+            'elements' in declaredDependenciesNode &&
             declaredDependenciesNode.elements &&
             declaredDependenciesNode.elements.some(
               el => el && el.type === 'Identifier' && el.name === callback.name,
@@ -1368,7 +1458,7 @@ export default {
       CallExpression: visitCallExpression,
     };
   },
-};
+} satisfies Rule.RuleModule;
 
 // The meat of the logic.
 function collectRecommendations({
@@ -1377,6 +1467,12 @@ function collectRecommendations({
   stableDependencies,
   externalDependencies,
   isEffect,
+}: {
+  dependencies: Map<string, Dependency>;
+  declaredDependencies: DeclaredDependency[];
+  stableDependencies: Set<string>;
+  externalDependencies: Set<string>;
+  isEffect: boolean;
 }) {
   // Our primary data structure.
   // It is a logical representation of property chains:
@@ -1388,7 +1484,7 @@ function collectRecommendations({
   // and the nodes that were *declared* as deps. Then we will
   // traverse it to learn which deps are missing or unnecessary.
   const depTree = createDepTree();
-  function createDepTree() {
+  function createDepTree(): DependencyTreeNode {
     return {
       isUsed: false, // True if used in code
       isSatisfiedRecursively: false, // True if specified in deps
@@ -1419,7 +1515,10 @@ function collectRecommendations({
   });
 
   // Tree manipulation helpers.
-  function getOrCreateNodeByPath(rootNode, path) {
+  function getOrCreateNodeByPath(
+    rootNode: DependencyTreeNode,
+    path: string,
+  ): DependencyTreeNode {
     const keys = path.split('.');
     let node = rootNode;
     for (const key of keys) {
@@ -1432,7 +1531,11 @@ function collectRecommendations({
     }
     return node;
   }
-  function markAllParentsByPath(rootNode, path, fn) {
+  function markAllParentsByPath(
+    rootNode: DependencyTreeNode,
+    path: string,
+    fn: (node: DependencyTreeNode) => void,
+  ): void {
     const keys = path.split('.');
     let node = rootNode;
     for (const key of keys) {
@@ -1446,15 +1549,20 @@ function collectRecommendations({
   }
 
   // Now we can learn which dependencies are missing or necessary.
-  const missingDependencies = new Set();
-  const satisfyingDependencies = new Set();
+  const missingDependencies = new Set<string>();
+  const satisfyingDependencies = new Set<string>();
   scanTreeRecursively(
     depTree,
     missingDependencies,
     satisfyingDependencies,
     key => key,
   );
-  function scanTreeRecursively(node, missingPaths, satisfyingPaths, keyToPath) {
+  function scanTreeRecursively(
+    node: DependencyTreeNode,
+    missingPaths: Set<string>,
+    satisfyingPaths: Set<string>,
+    keyToPath: (key: string) => string,
+  ): void {
     node.children.forEach((child, key) => {
       const path = keyToPath(key);
       if (child.isSatisfiedRecursively) {
@@ -1484,9 +1592,9 @@ function collectRecommendations({
   }
 
   // Collect suggestions in the order they were originally specified.
-  const suggestedDependencies = [];
-  const unnecessaryDependencies = new Set();
-  const duplicateDependencies = new Set();
+  const suggestedDependencies: string[] = [];
+  const unnecessaryDependencies = new Set<string>();
+  const duplicateDependencies = new Set<string>();
   declaredDependencies.forEach(({key}) => {
     // Does this declared dep satisfy a real need?
     if (satisfyingDependencies.has(key)) {
@@ -1532,7 +1640,7 @@ function collectRecommendations({
 
 // If the node will result in constructing a referentially unique value, return
 // its human readable type name, else return null.
-function getConstructionExpressionType(node) {
+function getConstructionExpressionType(node: Node): string | null {
   switch (node.type) {
     case 'ObjectExpression':
       return 'object';
@@ -1590,6 +1698,11 @@ function scanForConstructions({
   declaredDependenciesNode,
   componentScope,
   scope,
+}: {
+  declaredDependencies: DeclaredDependency[];
+  declaredDependenciesNode: Node;
+  componentScope: Scope.Scope;
+  scope: Scope.Scope;
 }) {
   const constructions = declaredDependencies
     .map(({key}) => {
@@ -1616,7 +1729,7 @@ function scanForConstructions({
         const constantExpressionType = getConstructionExpressionType(
           node.node.init,
         );
-        if (constantExpressionType != null) {
+        if (constantExpressionType) {
           return [ref, constantExpressionType];
         }
       }
@@ -1634,12 +1747,11 @@ function scanForConstructions({
       }
       return null;
     })
-    .filter(Boolean);
+    .filter(Boolean) as [Scope.Variable, string][];
 
-  function isUsedOutsideOfHook(ref) {
+  function isUsedOutsideOfHook(ref: Scope.Variable): boolean {
     let foundWriteExpr = false;
-    for (let i = 0; i < ref.references.length; i++) {
-      const reference = ref.references[i];
+    for (const reference of ref.references) {
       if (reference.writeExpr) {
         if (foundWriteExpr) {
           // Two writes to the same function.
@@ -1650,7 +1762,7 @@ function scanForConstructions({
           continue;
         }
       }
-      let currentScope = reference.from;
+      let currentScope: Scope.Scope | null = reference.from;
       while (currentScope !== scope && currentScope != null) {
         currentScope = currentScope.upper;
       }
@@ -1666,7 +1778,7 @@ function scanForConstructions({
   }
 
   return constructions.map(([ref, depType]) => ({
-    construction: ref.defs[0],
+    construction: ref.defs[0] as Scope.Definition,
     depType,
     isUsedOutsideOfHook: isUsedOutsideOfHook(ref),
   }));
@@ -1679,11 +1791,13 @@ function scanForConstructions({
  * props.foo.(bar) => (props).foo.bar
  * props.foo.bar.(baz) => (props).foo.bar.baz
  */
-function getDependency(node) {
+function getDependency(node: Node): Node {
   if (
+    node.parent &&
     (node.parent.type === 'MemberExpression' ||
       node.parent.type === 'OptionalMemberExpression') &&
     node.parent.object === node &&
+    'name' in node.parent.property &&
     node.parent.property.name !== 'current' &&
     !node.parent.computed &&
     !(
@@ -1713,9 +1827,13 @@ function getDependency(node) {
  * It just means there is an optional member somewhere inside.
  * This particular node might still represent a required member, so check .optional field.
  */
-function markNode(node, optionalChains, result) {
+function markNode(
+  node: Node,
+  optionalChains: Map<string, boolean> | null,
+  result: string,
+): void {
   if (optionalChains) {
-    if (node.optional) {
+    if ('optional' in node && node.optional) {
       // We only want to consider it optional if *all* usages were optional.
       if (!optionalChains.has(result)) {
         // Mark as (maybe) optional. If there's a required usage, this will be overridden.
@@ -1735,7 +1853,10 @@ function markNode(node, optionalChains, result) {
  * foo.bar(.)baz -> 'foo.bar.baz'
  * Otherwise throw.
  */
-function analyzePropertyChain(node, optionalChains) {
+function analyzePropertyChain(
+  node: Node,
+  optionalChains: Map<string, boolean> | null,
+): string {
   if (node.type === 'Identifier' || node.type === 'JSXIdentifier') {
     const result = node.name;
     if (optionalChains) {
@@ -1755,7 +1876,10 @@ function analyzePropertyChain(node, optionalChains) {
     const result = `${object}.${property}`;
     markNode(node, optionalChains, result);
     return result;
-  } else if (node.type === 'ChainExpression' && !node.computed) {
+  } else if (
+    node.type === 'ChainExpression' &&
+    (!('computed' in node) || !node.computed)
+  ) {
     const expression = node.expression;
 
     if (expression.type === 'CallExpression') {
@@ -1772,7 +1896,9 @@ function analyzePropertyChain(node, optionalChains) {
   }
 }
 
-function getNodeWithoutReactNamespace(node, options) {
+function getNodeWithoutReactNamespace(
+  node: Expression | Super,
+): Expression | Identifier | Super {
   if (
     node.type === 'MemberExpression' &&
     node.object.type === 'Identifier' &&
@@ -1790,7 +1916,13 @@ function getNodeWithoutReactNamespace(node, options) {
 // 0 for useEffect/useMemo/useCallback(fn).
 // 1 for useImperativeHandle(ref, fn).
 // For additionally configured Hooks, assume that they're like useEffect (0).
-function getReactiveHookCallbackIndex(calleeNode, options) {
+function getReactiveHookCallbackIndex(
+  calleeNode: Expression | Super,
+  options?: {
+    additionalHooks: RegExp | undefined;
+    enableDangerousAutofixThisMayCauseInfiniteLoops?: boolean;
+  },
+): 0 | -1 | 1 {
   const node = getNodeWithoutReactNamespace(calleeNode);
   if (node.type !== 'Identifier') {
     return -1;
@@ -1812,8 +1944,11 @@ function getReactiveHookCallbackIndex(calleeNode, options) {
         let name;
         try {
           name = analyzePropertyChain(node, null);
-        } catch (error) {
-          if (/Unsupported node type/.test(error.message)) {
+        } catch (error: unknown) {
+          if (
+            error instanceof Error &&
+            /Unsupported node type/.test(error.message)
+          ) {
             return 0;
           } else {
             throw error;
@@ -1836,12 +1971,12 @@ function getReactiveHookCallbackIndex(calleeNode, options) {
  * - optimized by only searching nodes with a range surrounding our target node
  * - agnostic to AST node types, it looks for `{ type: string, ... }`
  */
-function fastFindReferenceWithParent(start, target) {
+function fastFindReferenceWithParent(start: Node, target: Node): Node | null {
   const queue = [start];
-  let item = null;
+  let item: Node;
 
   while (queue.length) {
-    item = queue.shift();
+    item = queue.shift() as Node;
 
     if (isSameIdentifier(item, target)) {
       return item;
@@ -1872,7 +2007,7 @@ function fastFindReferenceWithParent(start, target) {
   return null;
 }
 
-function joinEnglish(arr) {
+function joinEnglish(arr: string[]): string {
   let s = '';
   for (let i = 0; i < arr.length; i++) {
     s += arr[i];
@@ -1887,39 +2022,49 @@ function joinEnglish(arr) {
   return s;
 }
 
-function isNodeLike(val) {
+function isNodeLike(val: unknown): boolean {
   return (
     typeof val === 'object' &&
     val !== null &&
     !Array.isArray(val) &&
+    'type' in val &&
     typeof val.type === 'string'
   );
 }
 
-function isSameIdentifier(a, b) {
+function isSameIdentifier(a: Node, b: Node): boolean {
   return (
     (a.type === 'Identifier' || a.type === 'JSXIdentifier') &&
     a.type === b.type &&
     a.name === b.name &&
+    !!a.range &&
+    !!b.range &&
     a.range[0] === b.range[0] &&
     a.range[1] === b.range[1]
   );
 }
 
-function isAncestorNodeOf(a, b) {
-  return a.range[0] <= b.range[0] && a.range[1] >= b.range[1];
+function isAncestorNodeOf(a: Node, b: Node): boolean {
+  return (
+    !!a.range &&
+    !!b.range &&
+    a.range[0] <= b.range[0] &&
+    a.range[1] >= b.range[1]
+  );
 }
 
-function isUseEffectEventIdentifier(node) {
+function isUseEffectEventIdentifier(node: Node): boolean {
   if (__EXPERIMENTAL__) {
     return node.type === 'Identifier' && node.name === 'useEffectEvent';
   }
   return false;
 }
 
-function getUnknownDependenciesMessage(reactiveHookName) {
+function getUnknownDependenciesMessage(reactiveHookName: string): string {
   return (
     `React Hook ${reactiveHookName} received a function whose dependencies ` +
     `are unknown. Pass an inline function instead.`
   );
 }
+
+export default rule;
diff --git a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.js b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
similarity index 85%
rename from packages/eslint-plugin-react-hooks/src/RulesOfHooks.js
rename to packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
index fc340519e233e..24870d71614ea 100644
--- a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.js
+++ b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
@@ -4,18 +4,16 @@
  * This source code is licensed under the MIT license found in the
  * LICENSE file in the root directory of this source tree.
  */
-
-/* global BigInt */
 /* eslint-disable no-for-of-loops/no-for-of-loops */
 
-'use strict';
+import type {Rule, Scope} from 'eslint';
+import type {CallExpression, DoWhileStatement, Node} from 'estree';
 
 /**
  * Catch all identifiers that begin with "use" followed by an uppercase Latin
  * character to exclude identifiers like "user".
  */
-
-function isHookName(s) {
+function isHookName(s: string): boolean {
   return s === 'use' || /^use[A-Z0-9]/.test(s);
 }
 
@@ -23,8 +21,7 @@ function isHookName(s) {
  * We consider hooks to be a hook name identifier or a member expression
  * containing a hook name.
  */
-
-function isHook(node) {
+function isHook(node: Node): boolean {
   if (node.type === 'Identifier') {
     return isHookName(node.name);
   } else if (
@@ -44,16 +41,17 @@ function isHook(node) {
  * Checks if the node is a React component name. React component names must
  * always start with an uppercase letter.
  */
-
-function isComponentName(node) {
+function isComponentName(node: Node): boolean {
   return node.type === 'Identifier' && /^[A-Z]/.test(node.name);
 }
 
-function isReactFunction(node, functionName) {
+function isReactFunction(node: Node, functionName: string): boolean {
   return (
-    node.name === functionName ||
+    ('name' in node && node.name === functionName) ||
     (node.type === 'MemberExpression' &&
+      'name' in node.object &&
       node.object.name === 'React' &&
+      'name' in node.property &&
       node.property.name === functionName)
   );
 }
@@ -62,10 +60,10 @@ function isReactFunction(node, functionName) {
  * Checks if the node is a callback argument of forwardRef. This render function
  * should follow the rules of hooks.
  */
-
-function isForwardRefCallback(node) {
+function isForwardRefCallback(node: Node): boolean {
   return !!(
     node.parent &&
+    'callee' in node.parent &&
     node.parent.callee &&
     isReactFunction(node.parent.callee, 'forwardRef')
   );
@@ -75,16 +73,16 @@ function isForwardRefCallback(node) {
  * Checks if the node is a callback argument of React.memo. This anonymous
  * functional component should follow the rules of hooks.
  */
-
-function isMemoCallback(node) {
+function isMemoCallback(node: Node): boolean {
   return !!(
     node.parent &&
+    'callee' in node.parent &&
     node.parent.callee &&
     isReactFunction(node.parent.callee, 'memo')
   );
 }
 
-function isInsideComponentOrHook(node) {
+function isInsideComponentOrHook(node: Node | undefined): boolean {
   while (node) {
     const functionName = getFunctionName(node);
     if (functionName) {
@@ -100,7 +98,7 @@ function isInsideComponentOrHook(node) {
   return false;
 }
 
-function isInsideDoWhileLoop(node) {
+function isInsideDoWhileLoop(node: Node | undefined): node is DoWhileStatement {
   while (node) {
     if (node.type === 'DoWhileStatement') {
       return true;
@@ -110,18 +108,18 @@ function isInsideDoWhileLoop(node) {
   return false;
 }
 
-function isUseEffectEventIdentifier(node) {
+function isUseEffectEventIdentifier(node: Node): boolean {
   if (__EXPERIMENTAL__) {
     return node.type === 'Identifier' && node.name === 'useEffectEvent';
   }
   return false;
 }
 
-function isUseIdentifier(node) {
+function isUseIdentifier(node: Node): boolean {
   return isReactFunction(node, 'use');
 }
 
-export default {
+const rule = {
   meta: {
     type: 'problem',
     docs: {
@@ -130,25 +128,28 @@ export default {
       url: 'https://reactjs.org/docs/hooks-rules.html',
     },
   },
-  create(context) {
-    let lastEffect = null;
-    const codePathReactHooksMapStack = [];
-    const codePathSegmentStack = [];
+  create(context: Rule.RuleContext) {
+    let lastEffect: CallExpression | null = null;
+    const codePathReactHooksMapStack: Map<Rule.CodePathSegment, Node[]>[] = [];
+    const codePathSegmentStack: Rule.CodePathSegment[] = [];
     const useEffectEventFunctions = new WeakSet();
 
     // For a given scope, iterate through the references and add all useEffectEvent definitions. We can
     // do this in non-Program nodes because we can rely on the assumption that useEffectEvent functions
     // can only be declared within a component or hook at its top level.
-    function recordAllUseEffectEventFunctions(scope) {
+    function recordAllUseEffectEventFunctions(scope: Scope.Scope): void {
       for (const reference of scope.references) {
         const parent = reference.identifier.parent;
         if (
-          parent.type === 'VariableDeclarator' &&
+          parent?.type === 'VariableDeclarator' &&
           parent.init &&
           parent.init.type === 'CallExpression' &&
           parent.init.callee &&
           isUseEffectEventIdentifier(parent.init.callee)
         ) {
+          if (reference.resolved === null) {
+            throw new Error('Unexpected null reference.resolved');
+          }
           for (const ref of reference.resolved.references) {
             if (ref !== reference) {
               useEffectEventFunctions.add(ref.identifier);
@@ -159,26 +160,26 @@ export default {
     }
 
     /**
-     * SourceCode#getText that also works down to ESLint 3.0.0
+     * SourceCode that also works down to ESLint 3.0.0
      */
-    const getSource =
-      typeof context.getSource === 'function'
-        ? node => {
-            return context.getSource(node);
+    const getSourceCode =
+      typeof context.getSourceCode === 'function'
+        ? () => {
+            return context.getSourceCode();
           }
-        : node => {
-            return context.sourceCode.getText(node);
+        : () => {
+            return context.sourceCode;
           };
     /**
      * SourceCode#getScope that also works down to ESLint 3.0.0
      */
     const getScope =
       typeof context.getScope === 'function'
-        ? () => {
+        ? (): Scope.Scope => {
             return context.getScope();
           }
-        : node => {
-            return context.sourceCode.getScope(node);
+        : (node: Node): Scope.Scope => {
+            return getSourceCode().getScope(node);
           };
 
     return {
@@ -187,7 +188,10 @@ export default {
       onCodePathSegmentEnd: () => codePathSegmentStack.pop(),
 
       // Maintain code path stack as we traverse.
-      onCodePathStart: () => codePathReactHooksMapStack.push(new Map()),
+      onCodePathStart: () =>
+        codePathReactHooksMapStack.push(
+          new Map<Rule.CodePathSegment, Node[]>(),
+        ),
 
       // Process our code path.
       //
@@ -195,8 +199,10 @@ export default {
       // segment and reachable from every final segment.
       onCodePathEnd(codePath, codePathNode) {
         const reactHooksMap = codePathReactHooksMapStack.pop();
-        if (reactHooksMap.size === 0) {
+        if (reactHooksMap?.size === 0) {
           return;
+        } else if (typeof reactHooksMap === 'undefined') {
+          throw new Error('Unexpected undefined reactHooksMap');
         }
 
         // All of the segments which are cyclic are recorded in this set.
@@ -223,11 +229,13 @@ export default {
          *
          * Populates `cyclic` with cyclic segments.
          */
-
-        function countPathsFromStart(segment, pathHistory) {
+        function countPathsFromStart(
+          segment: Rule.CodePathSegment,
+          pathHistory?: Set<string>,
+        ): bigint {
           const {cache} = countPathsFromStart;
           let paths = cache.get(segment.id);
-          const pathList = new Set(pathHistory);
+          const pathList = new Set<string>(pathHistory);
 
           // If `pathList` includes the current segment then we've found a cycle!
           // We need to fill `cyclic` with all segments inside cycle
@@ -295,7 +303,10 @@ export default {
          * Populates `cyclic` with cyclic segments.
          */
 
-        function countPathsToEnd(segment, pathHistory) {
+        function countPathsToEnd(
+          segment: Rule.CodePathSegment,
+          pathHistory?: Set<string>,
+        ): bigint {
           const {cache} = countPathsToEnd;
           let paths = cache.get(segment.id);
           const pathList = new Set(pathHistory);
@@ -359,7 +370,9 @@ export default {
          * so we would return that.
          */
 
-        function shortestPathLengthToStart(segment) {
+        function shortestPathLengthToStart(
+          segment: Rule.CodePathSegment,
+        ): number {
           const {cache} = shortestPathLengthToStart;
           let length = cache.get(segment.id);
 
@@ -392,9 +405,9 @@ export default {
           return length;
         }
 
-        countPathsFromStart.cache = new Map();
-        countPathsToEnd.cache = new Map();
-        shortestPathLengthToStart.cache = new Map();
+        countPathsFromStart.cache = new Map<string, bigint>();
+        countPathsToEnd.cache = new Map<string, bigint>();
+        shortestPathLengthToStart.cache = new Map<string, number | null>();
 
         // Count all code paths to the end of our component/hook. Also primes
         // the `countPathsToEnd` cache.
@@ -502,7 +515,7 @@ export default {
               context.report({
                 node: hook,
                 message:
-                  `React Hook "${getSource(hook)}" may be executed ` +
+                  `React Hook "${getSourceCode().getText(hook)}" may be executed ` +
                   'more than once. Possibly because it is called in a loop. ' +
                   'React Hooks must be called in the exact same order in ' +
                   'every component render.',
@@ -516,12 +529,13 @@ export default {
             // called in.
             if (isDirectlyInsideComponentOrHook) {
               // Report an error if the hook is called inside an async function.
+              // @ts-expect-error the above check hasn't properly type-narrowed `codePathNode` (async doesn't exist on Node)
               const isAsyncFunction = codePathNode.async;
               if (isAsyncFunction) {
                 context.report({
                   node: hook,
                   message:
-                    `React Hook "${getSource(hook)}" cannot be ` +
+                    `React Hook "${getSourceCode().getText(hook)}" cannot be ` +
                     'called in an async function.',
                 });
               }
@@ -537,7 +551,7 @@ export default {
                 !isInsideDoWhileLoop(hook) // wrapping do/while loops are checked separately.
               ) {
                 const message =
-                  `React Hook "${getSource(hook)}" is called ` +
+                  `React Hook "${getSourceCode().getText(hook)}" is called ` +
                   'conditionally. React Hooks must be called in the exact ' +
                   'same order in every component render.' +
                   (possiblyHasEarlyReturn
@@ -549,21 +563,22 @@ export default {
             } else if (
               codePathNode.parent &&
               (codePathNode.parent.type === 'MethodDefinition' ||
+                // @ts-expect-error `ClassProperty` was removed from typescript-estree in https://github.com/typescript-eslint/typescript-eslint/pull/3806
                 codePathNode.parent.type === 'ClassProperty' ||
                 codePathNode.parent.type === 'PropertyDefinition') &&
               codePathNode.parent.value === codePathNode
             ) {
               // Custom message for hooks inside a class
               const message =
-                `React Hook "${getSource(hook)}" cannot be called ` +
+                `React Hook "${getSourceCode().getText(hook)}" cannot be called ` +
                 'in a class component. React Hooks must be called in a ' +
                 'React function component or a custom React Hook function.';
               context.report({node: hook, message});
             } else if (codePathFunctionName) {
               // Custom message if we found an invalid function name.
               const message =
-                `React Hook "${getSource(hook)}" is called in ` +
-                `function "${getSource(codePathFunctionName)}" ` +
+                `React Hook "${getSourceCode().getText(hook)}" is called in ` +
+                `function "${getSourceCode().getText(codePathFunctionName)}" ` +
                 'that is neither a React function component nor a custom ' +
                 'React Hook function.' +
                 ' React component names must start with an uppercase letter.' +
@@ -572,7 +587,7 @@ export default {
             } else if (codePathNode.type === 'Program') {
               // These are dangerous if you have inline requires enabled.
               const message =
-                `React Hook "${getSource(hook)}" cannot be called ` +
+                `React Hook "${getSourceCode().getText(hook)}" cannot be called ` +
                 'at the top level. React Hooks must be called in a ' +
                 'React function component or a custom React Hook function.';
               context.report({node: hook, message});
@@ -585,7 +600,7 @@ export default {
               // `use(...)` can be called in callbacks.
               if (isSomewhereInsideComponentOrHook && !isUseIdentifier(hook)) {
                 const message =
-                  `React Hook "${getSource(hook)}" cannot be called ` +
+                  `React Hook "${getSourceCode().getText(hook)}" cannot be called ` +
                   'inside a callback. React Hooks must be called in a ' +
                   'React function component or a custom React Hook function.';
                 context.report({node: hook, message});
@@ -638,7 +653,7 @@ export default {
           context.report({
             node,
             message:
-              `\`${getSource(
+              `\`${getSourceCode().getText(
                 node,
               )}\` is a function created with React Hook "useEffectEvent", and can only be called from ` +
               'the same component. They cannot be assigned to variables or passed down.',
@@ -667,7 +682,7 @@ export default {
       },
     };
   },
-};
+} satisfies Rule.RuleModule;
 
 /**
  * Gets the static name of a function AST node. For function declarations it is
@@ -677,7 +692,7 @@ export default {
  * same AST nodes with some exceptions to better fit our use case.
  */
 
-function getFunctionName(node) {
+function getFunctionName(node: Node) {
   if (
     node.type === 'FunctionDeclaration' ||
     (node.type === 'FunctionExpression' && node.id)
@@ -693,20 +708,20 @@ function getFunctionName(node) {
     node.type === 'ArrowFunctionExpression'
   ) {
     if (
-      node.parent.type === 'VariableDeclarator' &&
+      node.parent?.type === 'VariableDeclarator' &&
       node.parent.init === node
     ) {
       // const useHook = () => {};
       return node.parent.id;
     } else if (
-      node.parent.type === 'AssignmentExpression' &&
+      node.parent?.type === 'AssignmentExpression' &&
       node.parent.right === node &&
       node.parent.operator === '='
     ) {
       // useHook = () => {};
       return node.parent.left;
     } else if (
-      node.parent.type === 'Property' &&
+      node.parent?.type === 'Property' &&
       node.parent.value === node &&
       !node.parent.computed
     ) {
@@ -721,8 +736,9 @@ function getFunctionName(node) {
       // class {useHook = () => {}}
       // class {useHook() {}}
     } else if (
-      node.parent.type === 'AssignmentPattern' &&
+      node.parent?.type === 'AssignmentPattern' &&
       node.parent.right === node &&
+      // @ts-expect-error Property computed does not exist on type `AssignmentPattern`.
       !node.parent.computed
     ) {
       // const {useHook = () => {}} = {};
@@ -742,7 +758,8 @@ function getFunctionName(node) {
 /**
  * Convenience function for peeking the last item in a stack.
  */
-
-function last(array) {
-  return array[array.length - 1];
+function last<T>(array: T[]): T {
+  return array[array.length - 1] as T;
 }
+
+export default rule;
diff --git a/packages/eslint-plugin-react-hooks/src/index.js b/packages/eslint-plugin-react-hooks/src/index.js
deleted file mode 100644
index 0ebfbc91a5a8d..0000000000000
--- a/packages/eslint-plugin-react-hooks/src/index.js
+++ /dev/null
@@ -1,61 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-'use strict';
-
-import RulesOfHooks from './RulesOfHooks';
-import ExhaustiveDeps from './ExhaustiveDeps';
-
-// All rules
-export const rules = {
-  'rules-of-hooks': RulesOfHooks,
-  'exhaustive-deps': ExhaustiveDeps,
-};
-
-// Config rules
-const configRules = {
-  'react-hooks/rules-of-hooks': 'error',
-  'react-hooks/exhaustive-deps': 'warn',
-};
-
-// Legacy config
-const legacyRecommendedConfig = {
-  plugins: ['react-hooks'],
-  rules: configRules,
-};
-
-// Base plugin object
-const reactHooksPlugin = {
-  meta: {name: 'eslint-plugin-react-hooks'},
-  rules,
-};
-
-// Flat config
-const flatRecommendedConfig = {
-  name: 'react-hooks/recommended',
-  plugins: {'react-hooks': reactHooksPlugin},
-  rules: configRules,
-};
-
-export const configs = {
-  /** Legacy recommended config, to be used with rc-based configurations */
-  'recommended-legacy': legacyRecommendedConfig,
-
-  /** Latest recommended config, to be used with flat configurations */
-  'recommended-latest': flatRecommendedConfig,
-
-  /**
-   * 'recommended' is currently aliased to the legacy / rc recommended config) to maintain backwards compatibility.
-   * This is deprecated and in v6, it will switch to alias the flat recommended config.
-   */
-  recommended: legacyRecommendedConfig,
-};
-
-export default {
-  ...reactHooksPlugin,
-  configs,
-};
diff --git a/packages/eslint-plugin-react-hooks/src/index.ts b/packages/eslint-plugin-react-hooks/src/index.ts
new file mode 100644
index 0000000000000..42b55320fcd89
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/src/index.ts
@@ -0,0 +1,64 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+import RulesOfHooks from './RulesOfHooks';
+import ExhaustiveDeps from './ExhaustiveDeps';
+import type {ESLint, Linter, Rule} from 'eslint';
+
+// All rules
+const rules = {
+  'rules-of-hooks': RulesOfHooks,
+  'exhaustive-deps': ExhaustiveDeps,
+} satisfies Record<string, Rule.RuleModule>;
+
+// Config rules
+const configRules = {
+  'react-hooks/rules-of-hooks': 'error',
+  'react-hooks/exhaustive-deps': 'warn',
+} satisfies Linter.RulesRecord;
+
+// Legacy config
+const legacyRecommendedConfig = {
+  plugins: ['react-hooks'],
+  rules: configRules,
+} satisfies Linter.LegacyConfig;
+
+// Plugin object
+const plugin = {
+  // TODO: Make this more dynamic to populate version from package.json.
+  // This can be done by injecting at build time, since importing the package.json isn't an option in Meta
+  meta: {name: 'eslint-plugin-react-hooks'},
+  rules,
+  configs: {
+    /** Legacy recommended config, to be used with rc-based configurations */
+    'recommended-legacy': legacyRecommendedConfig,
+
+    /**
+     * 'recommended' is currently aliased to the legacy / rc recommended config) to maintain backwards compatibility.
+     * This is deprecated and in v6, it will switch to alias the flat recommended config.
+     */
+    recommended: legacyRecommendedConfig,
+
+    /** Latest recommended config, to be used with flat configurations */
+    'recommended-latest': {
+      name: 'react-hooks/recommended',
+      plugins: {
+        get 'react-hooks'(): ESLint.Plugin {
+          return plugin;
+        },
+      },
+      rules: configRules,
+    },
+  },
+} satisfies ESLint.Plugin;
+
+const configs = plugin.configs;
+const meta = plugin.meta;
+export {configs, meta, rules};
+
+// TODO: If the plugin is ever updated to be pure ESM and drops support for rc-based configs, then it should be exporting the plugin as default
+// instead of individual named exports.
+// export default plugin;
diff --git a/packages/eslint-plugin-react-hooks/src/types/estree.d.ts b/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
index 10337ef7d6bf0..f266369704885 100644
--- a/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
+++ b/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
@@ -1,3 +1,5 @@
+import {Expression, Identifier, Node} from 'estree-jsx';
+
 /**
  * This file augments the `estree` types to include types that are not built-in to `estree` or `estree-jsx`.
  * This is necessary because the `estree` types are used by ESLint, and ESLint does not natively support
diff --git a/packages/eslint-plugin-react-hooks/tsconfig.json b/packages/eslint-plugin-react-hooks/tsconfig.json
index db8a4893649ea..e67b840d3fd7a 100644
--- a/packages/eslint-plugin-react-hooks/tsconfig.json
+++ b/packages/eslint-plugin-react-hooks/tsconfig.json
@@ -6,7 +6,6 @@
     "moduleResolution": "Bundler",
     "lib": ["ES2020"],
     "rootDir": ".",
-    "noEmit": true,
     "sourceMap": false,
     "types": ["estree-jsx", "node"]
   },
diff --git a/packages/eslint-plugin-react-hooks/tsup.config.ts b/packages/eslint-plugin-react-hooks/tsup.config.ts
deleted file mode 100644
index e275d0495e26c..0000000000000
--- a/packages/eslint-plugin-react-hooks/tsup.config.ts
+++ /dev/null
@@ -1,9 +0,0 @@
-import {defineConfig} from 'tsup';
-
-export default defineConfig({
-  clean: true,
-  dts: true,
-  entry: ['src/index.ts'],
-  format: ['cjs'],
-  outDir: 'build',
-});
diff --git a/scripts/rollup/bundles.js b/scripts/rollup/bundles.js
index c66cff82c5ac2..0a378c4f31bf7 100644
--- a/scripts/rollup/bundles.js
+++ b/scripts/rollup/bundles.js
@@ -1184,17 +1184,19 @@ const bundles = [
 
   /******* ESLint Plugin for Hooks *******/
   {
-    // TODO: it's awkward to create a bundle for this but if we don't, the package
-    // won't get copied. We also can't create just DEV bundle because it contains a
-    // NODE_ENV check inside. We should probably tweak our build process to allow
-    // "raw" packages that don't get bundled.
-    bundleTypes: [NODE_DEV, NODE_PROD],
+    // TODO: we're building this from typescript source now, but there's really
+    // no reason to have both dev and prod for this package.  It's
+    // currently required in order for the package to be copied over correctly.
+    // So, it would be worth improving that flow.
+    name: 'eslint-plugin-react-hooks',
+    bundleTypes: [NODE_DEV, NODE_PROD, CJS_DTS],
     moduleType: ISOMORPHIC,
-    entry: 'eslint-plugin-react-hooks',
+    entry: 'eslint-plugin-react-hooks/src/index.ts',
     global: 'ESLintPluginReactHooks',
     minifyWithProdErrorCodes: false,
     wrapWithModuleBoundaries: false,
     externals: [],
+    tsconfig: './packages/eslint-plugin-react-hooks/tsconfig.json',
   },
 
   /******* React Fresh *******/
diff --git a/yarn.lock b/yarn.lock
index 44d590625111c..ba71ba7abe323 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -2403,131 +2403,6 @@
     opn "5.3.0"
     react "^16.13.1"
 
-"@esbuild/aix-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.24.2.tgz#38848d3e25afe842a7943643cbcd387cc6e13461"
-  integrity sha512-thpVCb/rhxE/BnMLQ7GReQLLN8q9qbHmI55F4489/ByVg2aQaQ6kbcLb6FHkocZzQhxc4gx0sCk0tJkKBFzDhA==
-
-"@esbuild/android-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.24.2.tgz#f592957ae8b5643129fa889c79e69cd8669bb894"
-  integrity sha512-cNLgeqCqV8WxfcTIOeL4OAtSmL8JjcN6m09XIgro1Wi7cF4t/THaWEa7eL5CMoMBdjoHOTh/vwTO/o2TRXIyzg==
-
-"@esbuild/android-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.24.2.tgz#72d8a2063aa630308af486a7e5cbcd1e134335b3"
-  integrity sha512-tmwl4hJkCfNHwFB3nBa8z1Uy3ypZpxqxfTQOcHX+xRByyYgunVbZ9MzUUfb0RxaHIMnbHagwAxuTL+tnNM+1/Q==
-
-"@esbuild/android-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.24.2.tgz#9a7713504d5f04792f33be9c197a882b2d88febb"
-  integrity sha512-B6Q0YQDqMx9D7rvIcsXfmJfvUYLoP722bgfBlO5cGvNVb5V/+Y7nhBE3mHV9OpxBf4eAS2S68KZztiPaWq4XYw==
-
-"@esbuild/darwin-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.24.2.tgz#02ae04ad8ebffd6e2ea096181b3366816b2b5936"
-  integrity sha512-kj3AnYWc+CekmZnS5IPu9D+HWtUI49hbnyqk0FLEJDbzCIQt7hg7ucF1SQAilhtYpIujfaHr6O0UHlzzSPdOeA==
-
-"@esbuild/darwin-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.24.2.tgz#9ec312bc29c60e1b6cecadc82bd504d8adaa19e9"
-  integrity sha512-WeSrmwwHaPkNR5H3yYfowhZcbriGqooyu3zI/3GGpF8AyUdsrrP0X6KumITGA9WOyiJavnGZUwPGvxvwfWPHIA==
-
-"@esbuild/freebsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.24.2.tgz#5e82f44cb4906d6aebf24497d6a068cfc152fa00"
-  integrity sha512-UN8HXjtJ0k/Mj6a9+5u6+2eZ2ERD7Edt1Q9IZiB5UZAIdPnVKDoG7mdTVGhHJIeEml60JteamR3qhsr1r8gXvg==
-
-"@esbuild/freebsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.24.2.tgz#3fb1ce92f276168b75074b4e51aa0d8141ecce7f"
-  integrity sha512-TvW7wE/89PYW+IevEJXZ5sF6gJRDY/14hyIGFXdIucxCsbRmLUcjseQu1SyTko+2idmCw94TgyaEZi9HUSOe3Q==
-
-"@esbuild/linux-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.24.2.tgz#856b632d79eb80aec0864381efd29de8fd0b1f43"
-  integrity sha512-7HnAD6074BW43YvvUmE/35Id9/NB7BeX5EoNkK9obndmZBUk8xmJJeU7DwmUeN7tkysslb2eSl6CTrYz6oEMQg==
-
-"@esbuild/linux-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.24.2.tgz#c846b4694dc5a75d1444f52257ccc5659021b736"
-  integrity sha512-n0WRM/gWIdU29J57hJyUdIsk0WarGd6To0s+Y+LwvlC55wt+GT/OgkwoXCXvIue1i1sSNWblHEig00GBWiJgfA==
-
-"@esbuild/linux-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.24.2.tgz#f8a16615a78826ccbb6566fab9a9606cfd4a37d5"
-  integrity sha512-sfv0tGPQhcZOgTKO3oBE9xpHuUqguHvSo4jl+wjnKwFpapx+vUDcawbwPNuBIAYdRAvIDBfZVvXprIj3HA+Ugw==
-
-"@esbuild/linux-loong64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.24.2.tgz#1c451538c765bf14913512c76ed8a351e18b09fc"
-  integrity sha512-CN9AZr8kEndGooS35ntToZLTQLHEjtVB5n7dl8ZcTZMonJ7CCfStrYhrzF97eAecqVbVJ7APOEe18RPI4KLhwQ==
-
-"@esbuild/linux-mips64el@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.24.2.tgz#0846edeefbc3d8d50645c51869cc64401d9239cb"
-  integrity sha512-iMkk7qr/wl3exJATwkISxI7kTcmHKE+BlymIAbHO8xanq/TjHaaVThFF6ipWzPHryoFsesNQJPE/3wFJw4+huw==
-
-"@esbuild/linux-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.24.2.tgz#8e3fc54505671d193337a36dfd4c1a23b8a41412"
-  integrity sha512-shsVrgCZ57Vr2L8mm39kO5PPIb+843FStGt7sGGoqiiWYconSxwTiuswC1VJZLCjNiMLAMh34jg4VSEQb+iEbw==
-
-"@esbuild/linux-riscv64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.24.2.tgz#6a1e92096d5e68f7bb10a0d64bb5b6d1daf9a694"
-  integrity sha512-4eSFWnU9Hhd68fW16GD0TINewo1L6dRrB+oLNNbYyMUAeOD2yCK5KXGK1GH4qD/kT+bTEXjsyTCiJGHPZ3eM9Q==
-
-"@esbuild/linux-s390x@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.24.2.tgz#ab18e56e66f7a3c49cb97d337cd0a6fea28a8577"
-  integrity sha512-S0Bh0A53b0YHL2XEXC20bHLuGMOhFDO6GN4b3YjRLK//Ep3ql3erpNcPlEFed93hsQAjAQDNsvcK+hV90FubSw==
-
-"@esbuild/linux-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.24.2.tgz#8140c9b40da634d380b0b29c837a0b4267aff38f"
-  integrity sha512-8Qi4nQcCTbLnK9WoMjdC9NiTG6/E38RNICU6sUNqK0QFxCYgoARqVqxdFmWkdonVsvGqWhmm7MO0jyTqLqwj0Q==
-
-"@esbuild/netbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.24.2.tgz#65f19161432bafb3981f5f20a7ff45abb2e708e6"
-  integrity sha512-wuLK/VztRRpMt9zyHSazyCVdCXlpHkKm34WUyinD2lzK07FAHTq0KQvZZlXikNWkDGoT6x3TD51jKQ7gMVpopw==
-
-"@esbuild/netbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.24.2.tgz#7a3a97d77abfd11765a72f1c6f9b18f5396bcc40"
-  integrity sha512-VefFaQUc4FMmJuAxmIHgUmfNiLXY438XrL4GDNV1Y1H/RW3qow68xTwjZKfj/+Plp9NANmzbH5R40Meudu8mmw==
-
-"@esbuild/openbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.24.2.tgz#58b00238dd8f123bfff68d3acc53a6ee369af89f"
-  integrity sha512-YQbi46SBct6iKnszhSvdluqDmxCJA+Pu280Av9WICNwQmMxV7nLRHZfjQzwbPs3jeWnuAhE9Jy0NrnJ12Oz+0A==
-
-"@esbuild/openbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.24.2.tgz#0ac843fda0feb85a93e288842936c21a00a8a205"
-  integrity sha512-+iDS6zpNM6EnJyWv0bMGLWSWeXGN/HTaF/LXHXHwejGsVi+ooqDfMCCTerNFxEkM3wYVcExkeGXNqshc9iMaOA==
-
-"@esbuild/sunos-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.24.2.tgz#8b7aa895e07828d36c422a4404cc2ecf27fb15c6"
-  integrity sha512-hTdsW27jcktEvpwNHJU4ZwWFGkz2zRJUz8pvddmXPtXDzVKTTINmlmga3ZzwcuMpUvLw7JkLy9QLKyGpD2Yxig==
-
-"@esbuild/win32-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.24.2.tgz#c023afb647cabf0c3ed13f0eddfc4f1d61c66a85"
-  integrity sha512-LihEQ2BBKVFLOC9ZItT9iFprsE9tqjDjnbulhHoFxYQtQfai7qfluVODIYxt1PgdoyQkz23+01rzwNwYfutxUQ==
-
-"@esbuild/win32-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.24.2.tgz#96c356132d2dda990098c8b8b951209c3cd743c2"
-  integrity sha512-q+iGUwfs8tncmFC9pcnD5IvRHAzmbwQ3GPS5/ceCyHdjXubwQWI12MKWSNSMYLJMq23/IUCvJMS76PDqXe1fxA==
-
-"@esbuild/win32-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.24.2.tgz#34aa0b52d0fbb1a654b596acfa595f0c7b77a77b"
-  integrity sha512-7VTgWzgMGvup6aSqDPLiW5zHaxYJGTO4OokMjIlrCtf+VpEL+cXKtCvg723iguPYI5oaUNdS+/V7OU2gvXVWEg==
-
 "@eslint-community/eslint-utils@^4.2.0", "@eslint-community/eslint-utils@^4.4.0":
   version "4.4.0"
   resolved "https://registry.yarnpkg.com/@eslint-community/eslint-utils/-/eslint-utils-4.4.0.tgz#a23514e8fb9af1269d5f7788aa556798d61c6b59"
@@ -2924,15 +2799,6 @@
     "@jridgewell/sourcemap-codec" "^1.4.10"
     "@jridgewell/trace-mapping" "^0.3.9"
 
-"@jridgewell/gen-mapping@^0.3.2":
-  version "0.3.8"
-  resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.8.tgz#4f0e06362e01362f823d348f1872b08f666d8142"
-  integrity sha512-imAbBGkb+ebQyxKgzv5Hu2nmROxoDOXHh80evxdoXNOrvAnVx7zimzc1Oo5h9RlfV4vPXaE2iM5pOFbvOCClWA==
-  dependencies:
-    "@jridgewell/set-array" "^1.2.1"
-    "@jridgewell/sourcemap-codec" "^1.4.10"
-    "@jridgewell/trace-mapping" "^0.3.24"
-
 "@jridgewell/gen-mapping@^0.3.5":
   version "0.3.5"
   resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.5.tgz#dcce6aff74bdf6dad1a95802b69b04a2fcb1fb36"
@@ -3396,101 +3262,6 @@
     estree-walker "^2.0.2"
     picomatch "^4.0.2"
 
-"@rollup/rollup-android-arm-eabi@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.34.7.tgz#e554185b1afa5509a7a4040d15ec0c3b4435ded1"
-  integrity sha512-l6CtzHYo8D2TQ3J7qJNpp3Q1Iye56ssIAtqbM2H8axxCEEwvN7o8Ze9PuIapbxFL3OHrJU2JBX6FIIVnP/rYyw==
-
-"@rollup/rollup-android-arm64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.34.7.tgz#b1ee64bb413b2feba39803b0a1bebf2a9f3d70e1"
-  integrity sha512-KvyJpFUueUnSp53zhAa293QBYqwm94TgYTIfXyOTtidhm5V0LbLCJQRGkQClYiX3FXDQGSvPxOTD/6rPStMMDg==
-
-"@rollup/rollup-darwin-arm64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.34.7.tgz#bfdce3e07a345dd1bd628f3b796050f39629d7f0"
-  integrity sha512-jq87CjmgL9YIKvs8ybtIC98s/M3HdbqXhllcy9EdLV0yMg1DpxES2gr65nNy7ObNo/vZ/MrOTxt0bE5LinL6mA==
-
-"@rollup/rollup-darwin-x64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.34.7.tgz#781a94a537c57bdf0a500e47a25ab5985e5e8dff"
-  integrity sha512-rSI/m8OxBjsdnMMg0WEetu/w+LhLAcCDEiL66lmMX4R3oaml3eXz3Dxfvrxs1FbzPbJMaItQiksyMfv1hoIxnA==
-
-"@rollup/rollup-freebsd-arm64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.34.7.tgz#7a028357cbd12c5869c446ad18177c89f3405102"
-  integrity sha512-oIoJRy3ZrdsXpFuWDtzsOOa/E/RbRWXVokpVrNnkS7npz8GEG++E1gYbzhYxhxHbO2om1T26BZjVmdIoyN2WtA==
-
-"@rollup/rollup-freebsd-x64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.34.7.tgz#f24836a6371cccc4408db74f0fd986dacf098950"
-  integrity sha512-X++QSLm4NZfZ3VXGVwyHdRf58IBbCu9ammgJxuWZYLX0du6kZvdNqPwrjvDfwmi6wFdvfZ/s6K7ia0E5kI7m8Q==
-
-"@rollup/rollup-linux-arm-gnueabihf@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.34.7.tgz#95f27e96f0eb9b9ae9887739a8b6dffc90c1237f"
-  integrity sha512-Z0TzhrsNqukTz3ISzrvyshQpFnFRfLunYiXxlCRvcrb3nvC5rVKI+ZXPFG/Aa4jhQa1gHgH3A0exHaRRN4VmdQ==
-
-"@rollup/rollup-linux-arm-musleabihf@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.34.7.tgz#677b34fba9d070877736c3fe8b02aacb5e142d97"
-  integrity sha512-nkznpyXekFAbvFBKBy4nNppSgneB1wwG1yx/hujN3wRnhnkrYVugMTCBXED4+Ni6thoWfQuHNYbFjgGH0MBXtw==
-
-"@rollup/rollup-linux-arm64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.34.7.tgz#32d3d19dedde54e91574a098f22ea43a09cf63dd"
-  integrity sha512-KCjlUkcKs6PjOcxolqrXglBDcfCuUCTVlX5BgzgoJHw+1rWH1MCkETLkLe5iLLS9dP5gKC7mp3y6x8c1oGBUtA==
-
-"@rollup/rollup-linux-arm64-musl@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.34.7.tgz#a58dff44a18696df65ed8c0ad68a2945cf900484"
-  integrity sha512-uFLJFz6+utmpbR313TTx+NpPuAXbPz4BhTQzgaP0tozlLnGnQ6rCo6tLwaSa6b7l6gRErjLicXQ1iPiXzYotjw==
-
-"@rollup/rollup-linux-loongarch64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.34.7.tgz#a7488ab078233111e8aeb370d1ecf107ec7e1716"
-  integrity sha512-ws8pc68UcJJqCpneDFepnwlsMUFoWvPbWXT/XUrJ7rWUL9vLoIN3GAasgG+nCvq8xrE3pIrd+qLX/jotcLy0Qw==
-
-"@rollup/rollup-linux-powerpc64le-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.34.7.tgz#e9b9c0d6bd248a92b2d6ec01ebf99c62ae1f2e9a"
-  integrity sha512-vrDk9JDa/BFkxcS2PbWpr0C/LiiSLxFbNOBgfbW6P8TBe9PPHx9Wqbvx2xgNi1TOAyQHQJ7RZFqBiEohm79r0w==
-
-"@rollup/rollup-linux-riscv64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.34.7.tgz#0df84ce2bea48ee686fb55060d76ab47aff45c4c"
-  integrity sha512-rB+ejFyjtmSo+g/a4eovDD1lHWHVqizN8P0Hm0RElkINpS0XOdpaXloqM4FBkF9ZWEzg6bezymbpLmeMldfLTw==
-
-"@rollup/rollup-linux-s390x-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.34.7.tgz#73df374c57d036856e33dbd2715138922e91e452"
-  integrity sha512-nNXNjo4As6dNqRn7OrsnHzwTgtypfRA3u3AKr0B3sOOo+HkedIbn8ZtFnB+4XyKJojIfqDKmbIzO1QydQ8c+Pw==
-
-"@rollup/rollup-linux-x64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.34.7.tgz#f27af0b55f0cdd84e182e6cd44a6d03da0458149"
-  integrity sha512-9kPVf9ahnpOMSGlCxXGv980wXD0zRR3wyk8+33/MXQIpQEOpaNe7dEHm5LMfyRZRNt9lMEQuH0jUKj15MkM7QA==
-
-"@rollup/rollup-linux-x64-musl@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.34.7.tgz#c7981ad5cfb8c3cd5d643d33ca54e4d2802b9201"
-  integrity sha512-7wJPXRWTTPtTFDFezA8sle/1sdgxDjuMoRXEKtx97ViRxGGkVQYovem+Q8Pr/2HxiHp74SSRG+o6R0Yq0shPwQ==
-
-"@rollup/rollup-win32-arm64-msvc@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.34.7.tgz#06cedc0ef3cbf1cbd8abcf587090712e40ae6941"
-  integrity sha512-MN7aaBC7mAjsiMEZcsJvwNsQVNZShgES/9SzWp1HC9Yjqb5OpexYnRjF7RmE4itbeesHMYYQiAtUAQaSKs2Rfw==
-
-"@rollup/rollup-win32-ia32-msvc@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.34.7.tgz#90b39b977b14961a769be6ea61238e7fc668dd4d"
-  integrity sha512-aeawEKYswsFu1LhDM9RIgToobquzdtSc4jSVqHV8uApz4FVvhFl/mKh92wc8WpFc6aYCothV/03UjY6y7yLgbg==
-
-"@rollup/rollup-win32-x64-msvc@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.34.7.tgz#6531d61e7141091eaab0461ee8e0380c10e4ca57"
-  integrity sha512-4ZedScpxxIrVO7otcZ8kCX1mZArtH2Wfj3uFCxRJ9NO80gg1XV0U/b2f/MKaGwj2X3QopHfoWiDQ917FRpwY3w==
-
 "@sinclair/typebox@^0.25.16":
   version "0.25.24"
   resolved "https://registry.yarnpkg.com/@sinclair/typebox/-/typebox-0.25.24.tgz#8c7688559979f7079aacaf31aa881c3aa410b718"
@@ -3680,7 +3451,7 @@
   dependencies:
     "@types/estree" "*"
 
-"@types/estree@*", "@types/estree@1.0.6", "@types/estree@^1.0.0", "@types/estree@^1.0.6":
+"@types/estree@*", "@types/estree@^1.0.0", "@types/estree@^1.0.6":
   version "1.0.6"
   resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
   integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
@@ -5760,13 +5531,6 @@ bundle-name@^3.0.0:
   dependencies:
     run-applescript "^5.0.0"
 
-bundle-require@^5.0.0:
-  version "5.1.0"
-  resolved "https://registry.yarnpkg.com/bundle-require/-/bundle-require-5.1.0.tgz#8db66f41950da3d77af1ef3322f4c3e04009faee"
-  integrity sha512-3WrrOuZiyaaZPWiEt4G3+IffISVC9HYlWueJEBWED4ZH4aIAC2PnkdnuRrR94M+w6yGWn4AglWtJtBI8YqvgoA==
-  dependencies:
-    load-tsconfig "^0.2.3"
-
 bunyan@1.8.15:
   version "1.8.15"
   resolved "https://registry.yarnpkg.com/bunyan/-/bunyan-1.8.15.tgz#8ce34ca908a17d0776576ca1b2f6cbd916e93b46"
@@ -5787,11 +5551,6 @@ bytes@3.1.2:
   resolved "https://registry.yarnpkg.com/bytes/-/bytes-3.1.2.tgz#8b0beeb98605adf1b128fa4386403c009e0221a5"
   integrity sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==
 
-cac@^6.7.14:
-  version "6.7.14"
-  resolved "https://registry.yarnpkg.com/cac/-/cac-6.7.14.tgz#804e1e6f506ee363cb0e3ccbb09cad5dd9870959"
-  integrity sha512-b6Ilus+c3RrdDk+JhLKUAQfzzgLEPy6wcXqS7f/xe1EETvsDP6GORG7SFuOs6cID5YkqchW/LXZbX5bc8j7ZcQ==
-
 cache-base@^1.0.1:
   version "1.0.1"
   resolved "https://registry.yarnpkg.com/cache-base/-/cache-base-1.0.1.tgz#0a7f46416831c8b662ee36fe4e7c59d76f666ab2"
@@ -6093,13 +5852,6 @@ chokidar@^3.5.3:
   optionalDependencies:
     fsevents "~2.3.2"
 
-chokidar@^4.0.1:
-  version "4.0.3"
-  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-4.0.3.tgz#7be37a4c03c9aee1ecfe862a4a23b2c70c205d30"
-  integrity sha512-Qgzu8kfBvo+cA4962jnP1KkS6Dop5NS6g7R5LFYJr4b8Ub94PPQXUksCw9PvXoeXPRRddRNC5C1JQUR2SMGtnA==
-  dependencies:
-    readdirp "^4.0.1"
-
 chownr@^1.0.1:
   version "1.1.4"
   resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.1.4.tgz#6fc9d7b42d32a583596337666e7d08084da2cc6b"
@@ -6368,7 +6120,7 @@ commander@^2.18.0, commander@^2.20.0, commander@^2.6.0, commander@^2.8.1:
   resolved "https://registry.yarnpkg.com/commander/-/commander-2.20.3.tgz#fd485e84c03eb4881c20722ba48035e8531aeb33"
   integrity sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==
 
-commander@^4.0.0, commander@^4.0.1:
+commander@^4.0.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/commander/-/commander-4.1.1.tgz#9fd602bd936294e9e9ef46a3f4d6964044b18068"
   integrity sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==
@@ -6511,11 +6263,6 @@ connect-history-api-fallback@^2.0.0:
   resolved "https://registry.yarnpkg.com/connect-history-api-fallback/-/connect-history-api-fallback-2.0.0.tgz#647264845251a0daf25b97ce87834cace0f5f1c8"
   integrity sha512-U73+6lQFmfiNPrYbXqr6kZ1i1wiRqXnp2nhMsINseWXO8lDau0LGEffJ8kQi4EjLZympVgRdvqjAgiZ1tgzDDA==
 
-consola@^3.2.3:
-  version "3.4.0"
-  resolved "https://registry.yarnpkg.com/consola/-/consola-3.4.0.tgz#4cfc9348fd85ed16a17940b3032765e31061ab88"
-  integrity sha512-EiPU8G6dQG0GFHNR8ljnZFki/8a+cQwEQ+7wpxdChl02Q8HXlwEZWD5lqAF8vC2sEC3Tehr8hy7vErz88LHyUA==
-
 console-browserify@^1.1.0:
   version "1.2.0"
   resolved "https://registry.yarnpkg.com/console-browserify/-/console-browserify-1.2.0.tgz#67063cef57ceb6cf4993a2ab3a55840ae8c49336"
@@ -7039,13 +6786,6 @@ debug@^4.3.4, debug@~4.3.1:
   dependencies:
     ms "2.1.2"
 
-debug@^4.3.7:
-  version "4.4.0"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
-  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
-  dependencies:
-    ms "^2.1.3"
-
 decamelize@6.0.0:
   version "6.0.0"
   resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-6.0.0.tgz#8cad4d916fde5c41a264a43d0ecc56fe3d31749e"
@@ -7744,37 +7484,6 @@ es6-error@4.1.1, es6-error@^4.1.1:
   resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.1.1.tgz#9e3af407459deed47e9a91f9b885a84eb05c561d"
   integrity sha512-Um/+FxMr9CISWh0bi5Zv0iOD+4cFh5qLeks1qhAopKVAJw3drgKbKySikp7wGhDL0HPeaja0P5ULZrxLkniUVg==
 
-esbuild@^0.24.0:
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.24.2.tgz#b5b55bee7de017bff5fb8a4e3e44f2ebe2c3567d"
-  integrity sha512-+9egpBW8I3CD5XPe0n6BfT5fxLzxrlDzqydF3aviG+9ni1lDC/OvMHcxqEFV0+LANZG5R1bFMWfUrjVsdwxJvA==
-  optionalDependencies:
-    "@esbuild/aix-ppc64" "0.24.2"
-    "@esbuild/android-arm" "0.24.2"
-    "@esbuild/android-arm64" "0.24.2"
-    "@esbuild/android-x64" "0.24.2"
-    "@esbuild/darwin-arm64" "0.24.2"
-    "@esbuild/darwin-x64" "0.24.2"
-    "@esbuild/freebsd-arm64" "0.24.2"
-    "@esbuild/freebsd-x64" "0.24.2"
-    "@esbuild/linux-arm" "0.24.2"
-    "@esbuild/linux-arm64" "0.24.2"
-    "@esbuild/linux-ia32" "0.24.2"
-    "@esbuild/linux-loong64" "0.24.2"
-    "@esbuild/linux-mips64el" "0.24.2"
-    "@esbuild/linux-ppc64" "0.24.2"
-    "@esbuild/linux-riscv64" "0.24.2"
-    "@esbuild/linux-s390x" "0.24.2"
-    "@esbuild/linux-x64" "0.24.2"
-    "@esbuild/netbsd-arm64" "0.24.2"
-    "@esbuild/netbsd-x64" "0.24.2"
-    "@esbuild/openbsd-arm64" "0.24.2"
-    "@esbuild/openbsd-x64" "0.24.2"
-    "@esbuild/sunos-x64" "0.24.2"
-    "@esbuild/win32-arm64" "0.24.2"
-    "@esbuild/win32-ia32" "0.24.2"
-    "@esbuild/win32-x64" "0.24.2"
-
 escalade@^3.0.2:
   version "3.0.2"
   resolved "https://registry.yarnpkg.com/escalade/-/escalade-3.0.2.tgz#6a580d70edb87880f22b4c91d0d56078df6962c4"
@@ -8649,11 +8358,6 @@ fd-slicer@~1.1.0:
   dependencies:
     pend "~1.2.0"
 
-fdir@^6.4.2:
-  version "6.4.3"
-  resolved "https://registry.yarnpkg.com/fdir/-/fdir-6.4.3.tgz#011cdacf837eca9b811c89dbb902df714273db72"
-  integrity sha512-PMXmW2y1hDDfTSRc9gaXIuCCRpuoz3Kaz8cUelp3smouvfT632ozg2vrT6lJsHKKOF59YLbOGfAWGUcKEfRMQw==
-
 fetch-blob@^3.1.2, fetch-blob@^3.1.4:
   version "3.2.0"
   resolved "https://registry.yarnpkg.com/fetch-blob/-/fetch-blob-3.2.0.tgz#f09b8d4bbd45adc6f0c20b7e787e793e309dcce9"
@@ -9292,18 +8996,6 @@ glob@^10.2.5:
     minipass "^5.0.0 || ^6.0.2"
     path-scurry "^1.7.0"
 
-glob@^10.3.10:
-  version "10.4.5"
-  resolved "https://registry.yarnpkg.com/glob/-/glob-10.4.5.tgz#f4d9f0b90ffdbab09c9d77f5f29b4262517b0956"
-  integrity sha512-7Bv8RF0k6xjo7d4A/PxYLbUCfb6c+Vpd2/mB2yRDlew7Jb5hEXiCD9ibfO7wpk8i4sevK6DFny9h7EYbM3/sHg==
-  dependencies:
-    foreground-child "^3.1.0"
-    jackspeak "^3.1.2"
-    minimatch "^9.0.4"
-    minipass "^7.1.2"
-    package-json-from-dist "^1.0.0"
-    path-scurry "^1.11.1"
-
 glob@^6.0.1:
   version "6.0.4"
   resolved "https://registry.yarnpkg.com/glob/-/glob-6.0.4.tgz#0f08860f6a155127b2fadd4f9ce24b1aab6e4d22"
@@ -11489,11 +11181,6 @@ jose@5.4.1:
   resolved "https://registry.yarnpkg.com/jose/-/jose-5.4.1.tgz#b471ee3963920ba5452fd1b1398c8ba72a7b2fcf"
   integrity sha512-U6QajmpV/nhL9SyfAewo000fkiRQ+Yd2H0lBxJJ9apjpOgkOcBQJWOrMo917lxLptdS/n/o/xPzMkXhF46K8hQ==
 
-joycon@^3.1.1:
-  version "3.1.1"
-  resolved "https://registry.yarnpkg.com/joycon/-/joycon-3.1.1.tgz#bce8596d6ae808f8b68168f5fc69280996894f03"
-  integrity sha512-34wB/Y7MW7bzjKRjUKTa46I2Z7eV62Rkhva+KkopW7Qvv/OSWBqvkSY7vusOPrNuZcUG3tApvdVgNB8POj3SPw==
-
 jpeg-js@^0.4.2:
   version "0.4.4"
   resolved "https://registry.yarnpkg.com/jpeg-js/-/jpeg-js-0.4.4.tgz#a9f1c6f1f9f0fa80cdb3484ed9635054d28936aa"
@@ -11880,11 +11567,6 @@ lighthouse-logger@^1.0.0:
     debug "^2.6.8"
     marky "^1.2.0"
 
-lilconfig@^3.1.1:
-  version "3.1.3"
-  resolved "https://registry.yarnpkg.com/lilconfig/-/lilconfig-3.1.3.tgz#a1bcfd6257f9585bf5ae14ceeebb7b559025e4c4"
-  integrity sha512-/vlFKAoH5Cgt3Ie+JLhRbwOsCQePABiU3tJ1egGvyQ+33R/vcwM2Zl2QR/LzjsBeItPt3oSVXapn+m4nQDvpzw==
-
 lines-and-columns@^1.1.6:
   version "1.2.4"
   resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632"
@@ -11906,11 +11588,6 @@ load-json-file@^1.0.0:
     pinkie-promise "^2.0.0"
     strip-bom "^2.0.0"
 
-load-tsconfig@^0.2.3:
-  version "0.2.5"
-  resolved "https://registry.yarnpkg.com/load-tsconfig/-/load-tsconfig-0.2.5.tgz#453b8cd8961bfb912dea77eb6c168fe8cca3d3a1"
-  integrity sha512-IXO6OCs9yg8tMKzfPZ1YmheJbZCiEsnBdcB03l0OcfK9prKnJb96siuHCr5Fl37/yo9DnKU+TLpxzTUspw9shg==
-
 loader-runner@^4.2.0:
   version "4.3.0"
   resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-4.3.0.tgz#c1b4a163b99f614830353b16755e7149ac2314e1"
@@ -12047,11 +11724,6 @@ lodash.omitby@4.6.0:
   resolved "https://registry.yarnpkg.com/lodash.omitby/-/lodash.omitby-4.6.0.tgz#5c15ff4754ad555016b53c041311e8f079204791"
   integrity sha1-XBX/R1StVVAWtTwEExHo8HkgR5E=
 
-lodash.sortby@^4.7.0:
-  version "4.7.0"
-  resolved "https://registry.yarnpkg.com/lodash.sortby/-/lodash.sortby-4.7.0.tgz#edd14c824e2cc9c1e0b0a1b42bb5210516a42438"
-  integrity sha512-HDWXG8isMntAyRF5vZ7xKuEvOhT4AhlRt/3czTSjvGUxjYCBVRQY48ViDHyfYz9VIoBkW4TMGQNapx+l3RUwdA==
-
 lodash.truncate@^4.4.2:
   version "4.4.2"
   resolved "https://registry.yarnpkg.com/lodash.truncate/-/lodash.truncate-4.4.2.tgz#5a350da0b1113b837ecfffd5812cbe58d6eae193"
@@ -12572,7 +12244,7 @@ ms@2.1.2:
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009"
   integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==
 
-ms@2.1.3, ms@^2.1.1, ms@^2.1.2, ms@^2.1.3:
+ms@2.1.3, ms@^2.1.1, ms@^2.1.2:
   version "2.1.3"
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
   integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
@@ -12604,7 +12276,7 @@ mv@~2:
     ncp "~2.0.0"
     rimraf "~2.4.0"
 
-mz@2.7.0, mz@^2.7.0:
+mz@2.7.0:
   version "2.7.0"
   resolved "https://registry.yarnpkg.com/mz/-/mz-2.7.0.tgz#95008057a56cafadc2bc63dde7f9ff6955948e32"
   integrity sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==
@@ -13646,11 +13318,6 @@ picocolors@^1.0.0:
   resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.0.0.tgz#cb5bdc74ff3f51892236eaf79d68bc44564ab81c"
   integrity sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==
 
-picocolors@^1.1.1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
-  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
-
 picomatch@^2.0.4, picomatch@^2.2.3, picomatch@^2.3.1:
   version "2.3.1"
   resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.3.1.tgz#3ba3833733646d9d3e4995946c1365a67fb07a42"
@@ -13821,13 +13488,6 @@ posix-character-classes@^0.1.0:
   resolved "https://registry.yarnpkg.com/posix-character-classes/-/posix-character-classes-0.1.1.tgz#01eac0fe3b5af71a2a6c02feabb8c1fef7e00eab"
   integrity sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=
 
-postcss-load-config@^6.0.1:
-  version "6.0.1"
-  resolved "https://registry.yarnpkg.com/postcss-load-config/-/postcss-load-config-6.0.1.tgz#6fd7dcd8ae89badcf1b2d644489cbabf83aa8096"
-  integrity sha512-oPtTM4oerL+UXmx+93ytZVN82RrlY/wPUV8IeDxFrzIjXOLF1pN+EmKPLbubvKHT2HC20xXsCAH2Z+CKV6Oz/g==
-  dependencies:
-    lilconfig "^3.1.1"
-
 postcss-modules-extract-imports@^1.2.0:
   version "1.2.1"
   resolved "https://registry.yarnpkg.com/postcss-modules-extract-imports/-/postcss-modules-extract-imports-1.2.1.tgz#dc87e34148ec7eab5f791f7cd5849833375b741a"
@@ -14556,11 +14216,6 @@ readdirp@^2.2.1:
     micromatch "^3.1.10"
     readable-stream "^2.0.2"
 
-readdirp@^4.0.1:
-  version "4.1.2"
-  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-4.1.2.tgz#eb85801435fbf2a7ee58f19e0921b068fc69948d"
-  integrity sha512-GDhwkLfywWL2s6vEjyhri+eXmfH6j1L7JE27WhqLeYzoh/A3DBaYGEj2H/HFZCn/kMfim73FXxEJTw06WtxQwg==
-
 readdirp@~3.6.0:
   version "3.6.0"
   resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-3.6.0.tgz#74a370bd857116e245b29cc97340cd431a02a6c7"
@@ -15003,34 +14658,6 @@ rollup@^3.29.5:
   optionalDependencies:
     fsevents "~2.3.2"
 
-rollup@^4.24.0:
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/rollup/-/rollup-4.34.7.tgz#e00d8550688a616a3481c6446bb688d4c753ba8f"
-  integrity sha512-8qhyN0oZ4x0H6wmBgfKxJtxM7qS98YJ0k0kNh5ECVtuchIJ7z9IVVvzpmtQyT10PXKMtBxYr1wQ5Apg8RS8kXQ==
-  dependencies:
-    "@types/estree" "1.0.6"
-  optionalDependencies:
-    "@rollup/rollup-android-arm-eabi" "4.34.7"
-    "@rollup/rollup-android-arm64" "4.34.7"
-    "@rollup/rollup-darwin-arm64" "4.34.7"
-    "@rollup/rollup-darwin-x64" "4.34.7"
-    "@rollup/rollup-freebsd-arm64" "4.34.7"
-    "@rollup/rollup-freebsd-x64" "4.34.7"
-    "@rollup/rollup-linux-arm-gnueabihf" "4.34.7"
-    "@rollup/rollup-linux-arm-musleabihf" "4.34.7"
-    "@rollup/rollup-linux-arm64-gnu" "4.34.7"
-    "@rollup/rollup-linux-arm64-musl" "4.34.7"
-    "@rollup/rollup-linux-loongarch64-gnu" "4.34.7"
-    "@rollup/rollup-linux-powerpc64le-gnu" "4.34.7"
-    "@rollup/rollup-linux-riscv64-gnu" "4.34.7"
-    "@rollup/rollup-linux-s390x-gnu" "4.34.7"
-    "@rollup/rollup-linux-x64-gnu" "4.34.7"
-    "@rollup/rollup-linux-x64-musl" "4.34.7"
-    "@rollup/rollup-win32-arm64-msvc" "4.34.7"
-    "@rollup/rollup-win32-ia32-msvc" "4.34.7"
-    "@rollup/rollup-win32-x64-msvc" "4.34.7"
-    fsevents "~2.3.2"
-
 rrweb-cssom@^0.6.0:
   version "0.6.0"
   resolved "https://registry.yarnpkg.com/rrweb-cssom/-/rrweb-cssom-0.6.0.tgz#ed298055b97cbddcdeb278f904857629dec5e0e1"
@@ -15671,13 +15298,6 @@ source-map-url@^0.4.0:
   resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.4.0.tgz#3e935d7ddd73631b97659956d55128e87b5084a3"
   integrity sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=
 
-source-map@0.8.0-beta.0:
-  version "0.8.0-beta.0"
-  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.8.0-beta.0.tgz#d4c1bb42c3f7ee925f005927ba10709e0d1d1f11"
-  integrity sha512-2ymg6oRBpebeZi9UUNsgQ89bhx01TcTkmNTGnNO88imTmbSgy4nfujrgVEFKWpMTEGA11EDkTt7mqObTPdigIA==
-  dependencies:
-    whatwg-url "^7.0.0"
-
 source-map@^0.5.0, source-map@^0.5.1, source-map@^0.5.6:
   version "0.5.7"
   resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc"
@@ -16136,19 +15756,6 @@ style-loader@^1.2.1:
     loader-utils "^2.0.0"
     schema-utils "^2.6.6"
 
-sucrase@^3.35.0:
-  version "3.35.0"
-  resolved "https://registry.yarnpkg.com/sucrase/-/sucrase-3.35.0.tgz#57f17a3d7e19b36d8995f06679d121be914ae263"
-  integrity sha512-8EbVDiu9iN/nESwxeSxDKe0dunta1GOlHufmSSXxMD2z2/tMZpDMpvXQGsc+ajGo8y2uYUmixaSRUc/QPoQ0GA==
-  dependencies:
-    "@jridgewell/gen-mapping" "^0.3.2"
-    commander "^4.0.0"
-    glob "^10.3.10"
-    lines-and-columns "^1.1.6"
-    mz "^2.7.0"
-    pirates "^4.0.1"
-    ts-interface-checker "^0.1.9"
-
 sumchecker@^3.0.1:
   version "3.0.1"
   resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-3.0.1.tgz#6377e996795abb0b6d348e9b3e1dfb24345a8e42"
@@ -16437,19 +16044,6 @@ tiny-warning@^1.0.3:
   resolved "https://registry.yarnpkg.com/tiny-warning/-/tiny-warning-1.0.3.tgz#94a30db453df4c643d0fd566060d60a875d84754"
   integrity sha512-lBN9zLN/oAf68o3zNXYrdCt1kP8WsiGW8Oo2ka41b2IM5JL/S1CTyX1rW0mb/zSuJun0ZUrDxx4sqvYS2FWzPA==
 
-tinyexec@^0.3.1:
-  version "0.3.2"
-  resolved "https://registry.yarnpkg.com/tinyexec/-/tinyexec-0.3.2.tgz#941794e657a85e496577995c6eef66f53f42b3d2"
-  integrity sha512-KQQR9yN7R5+OSwaK0XQoj22pwHoTlgYqmUscPYoknOoWCWfj/5/ABTMRi69FrKU5ffPVh5QcFikpWJI/P1ocHA==
-
-tinyglobby@^0.2.9:
-  version "0.2.10"
-  resolved "https://registry.yarnpkg.com/tinyglobby/-/tinyglobby-0.2.10.tgz#e712cf2dc9b95a1f5c5bbd159720e15833977a0f"
-  integrity sha512-Zc+8eJlFMvgatPZTl6A9L/yht8QqdmUNtURHaKZLmKBE12hNPSrqNkUp2cs3M/UKmNVVAMFQYSjYIVHDjW5zew==
-  dependencies:
-    fdir "^6.4.2"
-    picomatch "^4.0.2"
-
 titleize@^3.0.0:
   version "3.0.0"
   resolved "https://registry.yarnpkg.com/titleize/-/titleize-3.0.0.tgz#71c12eb7fdd2558aa8a44b0be83b8a76694acd53"
@@ -16556,13 +16150,6 @@ tough-cookie@^4.1.2:
     universalify "^0.2.0"
     url-parse "^1.5.3"
 
-tr46@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/tr46/-/tr46-1.0.1.tgz#a8b13fd6bfd2489519674ccde55ba3693b706d09"
-  integrity sha512-dTpowEjclQ7Kgx5SdBkqRzVhERQXov8/l9Ft9dVM9fmg0W0KQSVaXX9T4i6twCPNtYiZM53lpSSUAwJbFPOHxA==
-  dependencies:
-    punycode "^2.1.0"
-
 tr46@^4.1.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/tr46/-/tr46-4.1.1.tgz#281a758dcc82aeb4fe38c7dfe4d11a395aac8469"
@@ -16580,11 +16167,6 @@ traverse-chain@~0.1.0:
   resolved "https://registry.yarnpkg.com/traverse-chain/-/traverse-chain-0.1.0.tgz#61dbc2d53b69ff6091a12a168fd7d433107e40f1"
   integrity sha1-YdvC1Ttp/2CRoSoWj9fUMxB+QPE=
 
-tree-kill@^1.2.2:
-  version "1.2.2"
-  resolved "https://registry.yarnpkg.com/tree-kill/-/tree-kill-1.2.2.tgz#4ca09a9092c88b73a7cdc5e8a01b507b0790a0cc"
-  integrity sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==
-
 trim-newlines@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613"
@@ -16602,11 +16184,6 @@ ts-api-utils@^1.0.1:
   resolved "https://registry.yarnpkg.com/ts-api-utils/-/ts-api-utils-1.3.0.tgz#4b490e27129f1e8e686b45cc4ab63714dc60eea1"
   integrity sha512-UQMIo7pb8WRomKR1/+MFVLTroIvDVtMX3K6OUir8ynLyzB8Jeriont2bTAtmNPa1ekAgN7YPDyf6V+ygrdU+eQ==
 
-ts-interface-checker@^0.1.9:
-  version "0.1.13"
-  resolved "https://registry.yarnpkg.com/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz#784fd3d679722bc103b1b4b8030bcddb5db2a699"
-  integrity sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==
-
 ts-node@8.9.1:
   version "8.9.1"
   resolved "https://registry.yarnpkg.com/ts-node/-/ts-node-8.9.1.tgz#2f857f46c47e91dcd28a14e052482eb14cfd65a5"
@@ -16633,28 +16210,6 @@ tslib@^2.3.0:
   resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.3.0.tgz#803b8cdab3e12ba581a4ca41c8839bbb0dacb09e"
   integrity sha512-N82ooyxVNm6h1riLCoyS9e3fuJ3AMG2zIZs2Gd1ATcSFjSA23Q0fzjjZeh0jbJvWVDZ0cJT8yaNNaaXHzueNjg==
 
-tsup@^8.3.5:
-  version "8.3.6"
-  resolved "https://registry.yarnpkg.com/tsup/-/tsup-8.3.6.tgz#a10eb2dc27f84b510a0f00341ab75cad03d13a88"
-  integrity sha512-XkVtlDV/58S9Ye0JxUUTcrQk4S+EqlOHKzg6Roa62rdjL1nGWNUstG0xgI4vanHdfIpjP448J8vlN0oK6XOJ5g==
-  dependencies:
-    bundle-require "^5.0.0"
-    cac "^6.7.14"
-    chokidar "^4.0.1"
-    consola "^3.2.3"
-    debug "^4.3.7"
-    esbuild "^0.24.0"
-    joycon "^3.1.1"
-    picocolors "^1.1.1"
-    postcss-load-config "^6.0.1"
-    resolve-from "^5.0.0"
-    rollup "^4.24.0"
-    source-map "0.8.0-beta.0"
-    sucrase "^3.35.0"
-    tinyexec "^0.3.1"
-    tinyglobby "^0.2.9"
-    tree-kill "^1.2.2"
-
 tsutils@^3.17.1:
   version "3.17.1"
   resolved "https://registry.yarnpkg.com/tsutils/-/tsutils-3.17.1.tgz#ed719917f11ca0dee586272b2ac49e015a2dd759"
@@ -17287,11 +16842,6 @@ webidl-conversions@^3.0.0:
   resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-3.0.1.tgz#24534275e2a7bc6be7bc86611cc16ae0a5654871"
   integrity sha512-2JAn3z8AR6rjK8Sm8orRC0h/bcl/DqL7tRPdGZ4I1CjdF+EaMLmYxBHyXuKL849eucPFhvBoxMsflfOb8kxaeQ==
 
-webidl-conversions@^4.0.2:
-  version "4.0.2"
-  resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-4.0.2.tgz#a855980b1f0b6b359ba1d5d9fb39ae941faa63ad"
-  integrity sha512-YQ+BmxuTgd6UXZW3+ICGfyqRyHXVlD5GtQr5+qjiNW7bF0cqrzX500HVXPBOvgXb5YnzDd+h0zqyv61KUD7+Sg==
-
 webidl-conversions@^7.0.0:
   version "7.0.0"
   resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-7.0.0.tgz#256b4e1882be7debbf01d05f0aa2039778ea080a"
@@ -17462,15 +17012,6 @@ whatwg-url@^5.0.0:
     tr46 "~0.0.3"
     webidl-conversions "^3.0.0"
 
-whatwg-url@^7.0.0:
-  version "7.1.0"
-  resolved "https://registry.yarnpkg.com/whatwg-url/-/whatwg-url-7.1.0.tgz#c2c492f1eca612988efd3d2266be1b9fc6170d06"
-  integrity sha512-WUu7Rg1DroM7oQvGWfOiAK21n74Gg+T4elXEQYkOhtyLeWiJFoOGLXPKI/9gzIie9CtwVLm8wtw6YJdKyxSjeg==
-  dependencies:
-    lodash.sortby "^4.7.0"
-    tr46 "^1.0.1"
-    webidl-conversions "^4.0.2"
-
 when@3.7.7:
   version "3.7.7"
   resolved "https://registry.yarnpkg.com/when/-/when-3.7.7.tgz#aba03fc3bb736d6c88b091d013d8a8e590d84718"

From be91130f184f04c6e7bb9ff18222aba2ef2f96f6 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 15:14:43 -0600
Subject: [PATCH 33/73] chore: remove `devEngines` declaration in root package
 (#32398)

This change removes the `devEngines` declaration in the root package. It
didn't match the package.json spec and in npm 10.9.0 (released in
October), a breaking change was introduced that checks the `devEngines`
property. This causes `npm pack` calls to fail, due to the malformed
`devEngines`. Since there's already an `.nvmrc` defined in the repo, and
no strong need to enforce a specific node version for local development,
this removes the declaration altogether.
---
 package.json | 5 +----
 1 file changed, 1 insertion(+), 4 deletions(-)

diff --git a/package.json b/package.json
index 95fffa700a7e7..8e5dae3f944a0 100644
--- a/package.json
+++ b/package.json
@@ -106,9 +106,6 @@
     "web-streams-polyfill": "^3.1.1",
     "yargs": "^15.3.1"
   },
-  "devEngines": {
-    "node": "16.x || 18.x || 20.x || 22.x"
-  },
   "jest": {
     "testRegex": "/scripts/jest/dont-run-jest-directly\\.js$"
   },
@@ -122,7 +119,7 @@
     "lint": "node ./scripts/tasks/eslint.js",
     "lint-build": "node ./scripts/rollup/validate/index.js",
     "extract-errors": "node scripts/error-codes/extract-errors.js",
-    "postinstall": "node node_modules/fbjs-scripts/node/check-dev-engines.js package.json && node ./scripts/flow/createFlowConfigs.js",
+    "postinstall": "node ./scripts/flow/createFlowConfigs.js",
     "test": "node ./scripts/jest/jest-cli.js",
     "test-stable": "node ./scripts/jest/jest-cli.js --release-channel=stable",
     "test-www": "node ./scripts/jest/jest-cli.js --release-channel=www-modern",

From eb1f77dedfc8f7491ecd39b160e4743fa39dfc99 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 16:00:43 -0600
Subject: [PATCH 34/73] ci: add workflow for running the eslint plugin e2e
 tests (#32397)

This change adds a workflow for PR builds, that runs the e2e tests for
`eslint-plugin-react-hooks` created in #32396

![screenshot of ci tests
running](https://github.com/user-attachments/assets/307a878c-92b5-44cf-84f2-3b21979b262a)
---
 .../workflows/runtime_eslint_plugin_e2e.yml   | 56 +++++++++++++++++++
 fixtures/eslint-v6/build.mjs                  |  9 ++-
 fixtures/eslint-v6/package.json               |  2 +-
 fixtures/eslint-v6/yarn.lock                  |  2 +-
 fixtures/eslint-v7/build.mjs                  |  9 ++-
 fixtures/eslint-v7/package.json               |  2 +-
 fixtures/eslint-v7/yarn.lock                  |  2 +-
 fixtures/eslint-v8/build.mjs                  |  9 ++-
 fixtures/eslint-v8/package.json               |  2 +-
 fixtures/eslint-v8/yarn.lock                  |  2 +-
 fixtures/eslint-v9/build.mjs                  |  9 ++-
 fixtures/eslint-v9/package.json               |  2 +-
 fixtures/eslint-v9/yarn.lock                  |  2 +-
 13 files changed, 96 insertions(+), 12 deletions(-)
 create mode 100644 .github/workflows/runtime_eslint_plugin_e2e.yml

diff --git a/.github/workflows/runtime_eslint_plugin_e2e.yml b/.github/workflows/runtime_eslint_plugin_e2e.yml
new file mode 100644
index 0000000000000..a6f0bf28f005e
--- /dev/null
+++ b/.github/workflows/runtime_eslint_plugin_e2e.yml
@@ -0,0 +1,56 @@
+name: (Runtime) ESLint Plugin E2E
+
+on:
+  push:
+    branches: [main]
+  pull_request:
+    paths-ignore:
+      - compiler/**
+
+concurrency:
+  group: ${{ github.workflow }}-${{ github.ref_name }}-${{ github.event.pull_request.number || github.run_id }}
+  cancel-in-progress: true
+
+env:
+  TZ: /usr/share/zoneinfo/America/Los_Angeles
+
+jobs:
+  # ----- TESTS -----
+  test:
+    name: ESLint v${{ matrix.eslint_major }}
+    runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        eslint_major:
+          - "6"
+          - "7"
+          - "8"
+          - "9"
+    continue-on-error: true
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          ref: ${{ github.event.pull_request.head.sha || github.sha }}
+      - uses: actions/setup-node@v4
+        with:
+          node-version-file: '.nvmrc'
+          cache: yarn
+          cache-dependency-path: yarn.lock
+      - name: Restore cached node_modules
+        uses: actions/cache@v4
+        id: node_modules
+        with:
+          path: "**/node_modules"
+          key: runtime-eslint_e2e-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
+      - name: Ensure clean build directory
+        run: rm -rf build
+      - run: yarn install --frozen-lockfile
+      - name: Build plugin
+        working-directory: fixtures/eslint-v${{ matrix.eslint_major }}
+        run: node build.mjs
+      - name: Install fixture dependencies
+        working-directory: ./fixtures/eslint-v${{ matrix.eslint_major }}
+        run: yarn --frozen-lockfile
+      - name: Run lint test
+        working-directory: ./fixtures/eslint-v${{ matrix.eslint_major }}
+        run: yarn lint
diff --git a/fixtures/eslint-v6/build.mjs b/fixtures/eslint-v6/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v6/build.mjs
+++ b/fixtures/eslint-v6/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v6/package.json b/fixtures/eslint-v6/package.json
index 50c92054b436f..c410edd78fc87 100644
--- a/fixtures/eslint-v6/package.json
+++ b/fixtures/eslint-v6/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v6",
   "dependencies": {
     "eslint": "^6",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v6/yarn.lock b/fixtures/eslint-v6/yarn.lock
index 3d6dbca037b38..5af9623e877f3 100644
--- a/fixtures/eslint-v6/yarn.lock
+++ b/fixtures/eslint-v6/yarn.lock
@@ -205,7 +205,7 @@ escape-string-regexp@^1.0.5:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
   integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 
diff --git a/fixtures/eslint-v7/build.mjs b/fixtures/eslint-v7/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v7/build.mjs
+++ b/fixtures/eslint-v7/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v7/package.json b/fixtures/eslint-v7/package.json
index 90c369c603e6d..5e64917514599 100644
--- a/fixtures/eslint-v7/package.json
+++ b/fixtures/eslint-v7/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v7",
   "dependencies": {
     "eslint": "^7",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v7/yarn.lock b/fixtures/eslint-v7/yarn.lock
index 62f97bbc20d69..4a191de947f37 100644
--- a/fixtures/eslint-v7/yarn.lock
+++ b/fixtures/eslint-v7/yarn.lock
@@ -234,7 +234,7 @@ escape-string-regexp@^4.0.0:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
   integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 
diff --git a/fixtures/eslint-v8/build.mjs b/fixtures/eslint-v8/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v8/build.mjs
+++ b/fixtures/eslint-v8/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v8/package.json b/fixtures/eslint-v8/package.json
index 620520ecdbfd4..ed3de107c524f 100644
--- a/fixtures/eslint-v8/package.json
+++ b/fixtures/eslint-v8/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v8",
   "dependencies": {
     "eslint": "^8",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v8/yarn.lock b/fixtures/eslint-v8/yarn.lock
index 88d04029954a4..d5a947b6347d7 100644
--- a/fixtures/eslint-v8/yarn.lock
+++ b/fixtures/eslint-v8/yarn.lock
@@ -192,7 +192,7 @@ escape-string-regexp@^4.0.0:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
   integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 
diff --git a/fixtures/eslint-v9/build.mjs b/fixtures/eslint-v9/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v9/build.mjs
+++ b/fixtures/eslint-v9/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v9/package.json b/fixtures/eslint-v9/package.json
index e8ae91a0613e1..58d0a94c0c58c 100644
--- a/fixtures/eslint-v9/package.json
+++ b/fixtures/eslint-v9/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v9",
   "dependencies": {
     "eslint": "^9",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v9/yarn.lock b/fixtures/eslint-v9/yarn.lock
index 5a1a246827f6f..1583b73f14e21 100644
--- a/fixtures/eslint-v9/yarn.lock
+++ b/fixtures/eslint-v9/yarn.lock
@@ -209,7 +209,7 @@ escape-string-regexp@^4.0.0:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
   integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 

From 4632e36a4ef16a1af24987c56e42b664f6403e64 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 19:28:12 -0600
Subject: [PATCH 35/73] refactor(eslint-plugin-react-hooks): change array type
 and improve conditionals (#32400)

- [build(eslint-plugin-react-hooks): add
ts-linting](https://github.com/facebook/react/commit/4c0fbe73d9abc2681445f62b9450737f3df12ee2)
This change adds configuration to the eslint config governing
`eslint-plugin-react-hooks` to use the typescript-eslint plugin and
parser. It adds the typescript-recommended config, and configures the
team's preferred `array-type` convention.

- [refactor(eslint-plugin-react-hooks): improve
conditionals](https://github.com/facebook/react/commit/540d0d95bc5172ef95ccc2ad70b4b202b6eeedd2)
This change addresses several feedback items from
https://github.com/facebook/react/pull/32240

- [ci (eslint-e2e): exclude nested node_modules from
cache](https://github.com/facebook/react/pull/32400/commits/a3279f46a85cfb4ddea5a863a6f7c71344280d36)
This change removes the nested fixture `node_modules` from being cached,
so that the symbolic link can be made after the build happens.
---
 .eslintrc.js                                  | 25 ++++++++--
 .../workflows/runtime_eslint_plugin_e2e.yml   |  2 +-
 package.json                                  |  2 +
 .../src/ExhaustiveDeps.ts                     | 32 ++++++------
 .../src/RulesOfHooks.ts                       | 12 +++--
 yarn.lock                                     | 50 ++++++++++++++++++-
 6 files changed, 97 insertions(+), 26 deletions(-)

diff --git a/.eslintrc.js b/.eslintrc.js
index 7fe08f4cdf36e..360bd5ba76a9c 100644
--- a/.eslintrc.js
+++ b/.eslintrc.js
@@ -446,10 +446,7 @@ module.exports = {
       },
     },
     {
-      files: [
-        'scripts/eslint-rules/*.js',
-        'packages/eslint-plugin-react-hooks/src/*.js',
-      ],
+      files: ['scripts/eslint-rules/*.js'],
       plugins: ['eslint-plugin'],
       rules: {
         'eslint-plugin/prefer-object-rule': ERROR,
@@ -517,6 +514,26 @@ module.exports = {
         __IS_INTERNAL_VERSION__: 'readonly',
       },
     },
+    {
+      files: ['packages/eslint-plugin-react-hooks/src/**/*'],
+      extends: ['plugin:@typescript-eslint/recommended'],
+      parser: '@typescript-eslint/parser',
+      plugins: ['@typescript-eslint', 'eslint-plugin'],
+      rules: {
+        '@typescript-eslint/no-explicit-any': OFF,
+        '@typescript-eslint/no-non-null-assertion': OFF,
+        '@typescript-eslint/array-type': [ERROR, {default: 'generic'}],
+
+        'es/no-optional-chaining': OFF,
+
+        'eslint-plugin/prefer-object-rule': ERROR,
+        'eslint-plugin/require-meta-fixable': [
+          ERROR,
+          {catchNoFixerButFixableProperty: true},
+        ],
+        'eslint-plugin/require-meta-has-suggestions': ERROR,
+      },
+    },
   ],
 
   env: {
diff --git a/.github/workflows/runtime_eslint_plugin_e2e.yml b/.github/workflows/runtime_eslint_plugin_e2e.yml
index a6f0bf28f005e..edc188f38622e 100644
--- a/.github/workflows/runtime_eslint_plugin_e2e.yml
+++ b/.github/workflows/runtime_eslint_plugin_e2e.yml
@@ -40,7 +40,7 @@ jobs:
         uses: actions/cache@v4
         id: node_modules
         with:
-          path: "**/node_modules"
+          path: "node_modules"
           key: runtime-eslint_e2e-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
       - name: Ensure clean build directory
         run: rm -rf build
diff --git a/package.json b/package.json
index 8e5dae3f944a0..0a2b6c3024c93 100644
--- a/package.json
+++ b/package.json
@@ -42,6 +42,8 @@
     "@rollup/plugin-node-resolve": "^15.0.1",
     "@rollup/plugin-replace": "^5.0.2",
     "@rollup/plugin-typescript": "^12.1.2",
+    "@typescript-eslint/eslint-plugin": "^6.21.0",
+    "@typescript-eslint/parser": "^6.21.0",
     "abortcontroller-polyfill": "^1.7.5",
     "art": "0.10.1",
     "babel-plugin-syntax-trailing-function-commas": "^6.5.0",
diff --git a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
index 9f3d4d4db9004..1b0059757278f 100644
--- a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
+++ b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
@@ -28,7 +28,7 @@ type DeclaredDependency = {
 
 type Dependency = {
   isStable: boolean;
-  references: Scope.Reference[];
+  references: Array<Scope.Reference>;
 };
 
 type DependencyTreeNode = {
@@ -184,7 +184,9 @@ const rule = {
       // Get the current scope.
       const scope = scopeManager.acquire(node);
       if (!scope) {
-        return;
+        throw new Error(
+          'Unable to acquire scope for the current node. This is a bug in eslint-plugin-react-hooks, please file an issue.',
+        );
       }
 
       // Find all our "pure scopes". On every re-render of a component these
@@ -255,7 +257,7 @@ const rule = {
         // Detect primitive constants
         // const foo = 42
         let declaration = defNode.parent;
-        if (declaration == null && componentScope) {
+        if (declaration == null && componentScope != null) {
           // This might happen if variable is declared after the callback.
           // In that case ESLint won't set up .parent refs.
           // So we'll set them up manually.
@@ -266,7 +268,7 @@ const rule = {
           }
         }
         if (
-          declaration &&
+          declaration != null &&
           'kind' in declaration &&
           declaration.kind === 'const' &&
           init.type === 'Literal' &&
@@ -454,7 +456,7 @@ const rule = {
       function isInsideEffectCleanup(reference: Scope.Reference): boolean {
         let curScope: Scope.Scope | null = reference.from;
         let isInReturnedFunction = false;
-        while (curScope && curScope.block !== node) {
+        while (curScope != null && curScope.block !== node) {
           if (curScope.type === 'function') {
             isInReturnedFunction =
               curScope.block.parent != null &&
@@ -529,7 +531,7 @@ const rule = {
             continue;
           }
           // Ignore references to the function itself as it's not defined yet.
-          if (def.node && def.node.init === node.parent) {
+          if (def.node != null && def.node.init === node.parent) {
             continue;
           }
           // Ignore Flow type parameters
@@ -566,8 +568,8 @@ const rule = {
           // Is React managing this ref or us?
           // Let's see if we can find a .current assignment.
           let foundCurrentAssignment = false;
-          for (const reference of references) {
-            const {identifier} = reference;
+          for (const ref of references) {
+            const {identifier} = ref;
             const {parent} = identifier;
             if (
               parent != null &&
@@ -660,7 +662,7 @@ const rule = {
             }
 
             let fnScope: Scope.Scope | null = reference.from;
-            while (fnScope && fnScope.type !== 'function') {
+            while (fnScope != null && fnScope.type !== 'function') {
               fnScope = fnScope.upper;
             }
             const isDirectlyInsideEffect = fnScope?.block === node;
@@ -704,7 +706,7 @@ const rule = {
         return;
       }
 
-      const declaredDependencies: DeclaredDependency[] = [];
+      const declaredDependencies: Array<DeclaredDependency> = [];
       const externalDependencies = new Set<string>();
       const isArrayExpression =
         declaredDependenciesNode.type === 'ArrayExpression';
@@ -1469,7 +1471,7 @@ function collectRecommendations({
   isEffect,
 }: {
   dependencies: Map<string, Dependency>;
-  declaredDependencies: DeclaredDependency[];
+  declaredDependencies: Array<DeclaredDependency>;
   stableDependencies: Set<string>;
   externalDependencies: Set<string>;
   isEffect: boolean;
@@ -1592,7 +1594,7 @@ function collectRecommendations({
   }
 
   // Collect suggestions in the order they were originally specified.
-  const suggestedDependencies: string[] = [];
+  const suggestedDependencies: Array<string> = [];
   const unnecessaryDependencies = new Set<string>();
   const duplicateDependencies = new Set<string>();
   declaredDependencies.forEach(({key}) => {
@@ -1699,7 +1701,7 @@ function scanForConstructions({
   componentScope,
   scope,
 }: {
-  declaredDependencies: DeclaredDependency[];
+  declaredDependencies: Array<DeclaredDependency>;
   declaredDependenciesNode: Node;
   componentScope: Scope.Scope;
   scope: Scope.Scope;
@@ -1747,7 +1749,7 @@ function scanForConstructions({
       }
       return null;
     })
-    .filter(Boolean) as [Scope.Variable, string][];
+    .filter(Boolean) as Array<[Scope.Variable, string]>;
 
   function isUsedOutsideOfHook(ref: Scope.Variable): boolean {
     let foundWriteExpr = false;
@@ -2007,7 +2009,7 @@ function fastFindReferenceWithParent(start: Node, target: Node): Node | null {
   return null;
 }
 
-function joinEnglish(arr: string[]): string {
+function joinEnglish(arr: Array<string>): string {
   let s = '';
   for (let i = 0; i < arr.length; i++) {
     s += arr[i];
diff --git a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
index 24870d71614ea..0ab0c5ff21e4b 100644
--- a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
+++ b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
@@ -130,8 +130,10 @@ const rule = {
   },
   create(context: Rule.RuleContext) {
     let lastEffect: CallExpression | null = null;
-    const codePathReactHooksMapStack: Map<Rule.CodePathSegment, Node[]>[] = [];
-    const codePathSegmentStack: Rule.CodePathSegment[] = [];
+    const codePathReactHooksMapStack: Array<
+      Map<Rule.CodePathSegment, Array<Node>>
+    > = [];
+    const codePathSegmentStack: Array<Rule.CodePathSegment> = [];
     const useEffectEventFunctions = new WeakSet();
 
     // For a given scope, iterate through the references and add all useEffectEvent definitions. We can
@@ -190,7 +192,7 @@ const rule = {
       // Maintain code path stack as we traverse.
       onCodePathStart: () =>
         codePathReactHooksMapStack.push(
-          new Map<Rule.CodePathSegment, Node[]>(),
+          new Map<Rule.CodePathSegment, Array<Node>>(),
         ),
 
       // Process our code path.
@@ -561,7 +563,7 @@ const rule = {
                 context.report({node: hook, message});
               }
             } else if (
-              codePathNode.parent &&
+              codePathNode.parent != null &&
               (codePathNode.parent.type === 'MethodDefinition' ||
                 // @ts-expect-error `ClassProperty` was removed from typescript-estree in https://github.com/typescript-eslint/typescript-eslint/pull/3806
                 codePathNode.parent.type === 'ClassProperty' ||
@@ -758,7 +760,7 @@ function getFunctionName(node: Node) {
 /**
  * Convenience function for peeking the last item in a stack.
  */
-function last<T>(array: T[]): T {
+function last<T>(array: Array<T>): T {
   return array[array.length - 1] as T;
 }
 
diff --git a/yarn.lock b/yarn.lock
index ba71ba7abe323..7bc936afae4bd 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -2410,6 +2410,11 @@
   dependencies:
     eslint-visitor-keys "^3.3.0"
 
+"@eslint-community/regexpp@^4.5.1":
+  version "4.12.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
+  integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
+
 "@eslint-community/regexpp@^4.6.1":
   version "4.10.0"
   resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.10.0.tgz#548f6de556857c8bb73bbee70c35dc82a2e74d63"
@@ -3718,6 +3723,23 @@
   dependencies:
     "@types/node" "*"
 
+"@typescript-eslint/eslint-plugin@^6.21.0":
+  version "6.21.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/eslint-plugin/-/eslint-plugin-6.21.0.tgz#30830c1ca81fd5f3c2714e524c4303e0194f9cd3"
+  integrity sha512-oy9+hTPCUFpngkEZUSzbf9MxI65wbKFoQYsgPdILTfbUldp5ovUuphZVe4i30emU9M/kP+T64Di0mxl7dSw3MA==
+  dependencies:
+    "@eslint-community/regexpp" "^4.5.1"
+    "@typescript-eslint/scope-manager" "6.21.0"
+    "@typescript-eslint/type-utils" "6.21.0"
+    "@typescript-eslint/utils" "6.21.0"
+    "@typescript-eslint/visitor-keys" "6.21.0"
+    debug "^4.3.4"
+    graphemer "^1.4.0"
+    ignore "^5.2.4"
+    natural-compare "^1.4.0"
+    semver "^7.5.4"
+    ts-api-utils "^1.0.1"
+
 "@typescript-eslint/experimental-utils@2.34.0":
   version "2.34.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/experimental-utils/-/experimental-utils-2.34.0.tgz#d3524b644cdb40eebceca67f8cf3e4cc9c8f980f"
@@ -3780,6 +3802,17 @@
     "@typescript-eslint/typescript-estree" "5.62.0"
     debug "^4.3.4"
 
+"@typescript-eslint/parser@^6.21.0":
+  version "6.21.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/parser/-/parser-6.21.0.tgz#af8fcf66feee2edc86bc5d1cf45e33b0630bf35b"
+  integrity sha512-tbsV1jPne5CkFQCgPBcDOt30ItF7aJoZL997JSF7MhGQqOeT3svWRYxiqlfA5RUdlHN6Fi+EI9bxqbdyAUZjYQ==
+  dependencies:
+    "@typescript-eslint/scope-manager" "6.21.0"
+    "@typescript-eslint/types" "6.21.0"
+    "@typescript-eslint/typescript-estree" "6.21.0"
+    "@typescript-eslint/visitor-keys" "6.21.0"
+    debug "^4.3.4"
+
 "@typescript-eslint/scope-manager@4.1.0":
   version "4.1.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/scope-manager/-/scope-manager-4.1.0.tgz#9e389745ee9cfe12252ed1e9958808abd6b3a683"
@@ -3804,6 +3837,16 @@
     "@typescript-eslint/types" "6.21.0"
     "@typescript-eslint/visitor-keys" "6.21.0"
 
+"@typescript-eslint/type-utils@6.21.0":
+  version "6.21.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/type-utils/-/type-utils-6.21.0.tgz#6473281cfed4dacabe8004e8521cee0bd9d4c01e"
+  integrity sha512-rZQI7wHfao8qMX3Rd3xqeYSMCL3SoiSQLBATSiVKARdFGCYSRvmViieZjqc58jKgs8Y8i9YvVVhRbHSTA4VBag==
+  dependencies:
+    "@typescript-eslint/typescript-estree" "6.21.0"
+    "@typescript-eslint/utils" "6.21.0"
+    debug "^4.3.4"
+    ts-api-utils "^1.0.1"
+
 "@typescript-eslint/types@3.10.1":
   version "3.10.1"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/types/-/types-3.10.1.tgz#1d7463fa7c32d8a23ab508a803ca2fe26e758727"
@@ -3892,7 +3935,7 @@
     semver "^7.5.4"
     ts-api-utils "^1.0.1"
 
-"@typescript-eslint/utils@^6.0.0":
+"@typescript-eslint/utils@6.21.0", "@typescript-eslint/utils@^6.0.0":
   version "6.21.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/utils/-/utils-6.21.0.tgz#4714e7a6b39e773c1c8e97ec587f520840cd8134"
   integrity sha512-NfWVaC8HP9T8cbKQxHcsJBY5YE1O33+jpMwN45qzWWaPDZgLIbo12toGMWnmhvCpd3sIxkpDw3Wv1B3dYrbDQQ==
@@ -9799,6 +9842,11 @@ ignore@^5.2.0:
   resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.1.tgz#5073e554cd42c5b33b394375f538b8593e34d4ef"
   integrity sha512-5Fytz/IraMjqpwfd34ke28PTVMjZjJG2MPn5t7OE4eUCUNf8BAa7b5WUS9/Qvr6mwOQS7Mk6vdsMno5he+T8Xw==
 
+ignore@^5.2.4:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.2.tgz#3cd40e729f3643fd87cb04e50bf0eb722bc596f5"
+  integrity sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==
+
 image-size@1.1.1:
   version "1.1.1"
   resolved "https://registry.yarnpkg.com/image-size/-/image-size-1.1.1.tgz#ddd67d4dc340e52ac29ce5f546a09f4e29e840ac"

From 8a7b487e3b171c91f2fe18e9142af53f4dd83454 Mon Sep 17 00:00:00 2001
From: Ricky <rickhanlonii@gmail.com>
Date: Tue, 18 Feb 2025 10:29:40 -0500
Subject: [PATCH 36/73] [flags] enable owner stacks everywhere (#32376)

this is now canary and on everywhere
---
 .../shared/forks/ReactFeatureFlags.native-fb-dynamic.js     | 2 --
 packages/shared/forks/ReactFeatureFlags.native-fb.js        | 6 ++++--
 packages/shared/forks/ReactFeatureFlags.native-oss.js       | 4 ++--
 .../forks/ReactFeatureFlags.test-renderer.native-fb.js      | 4 ++--
 .../shared/forks/ReactFeatureFlags.test-renderer.www.js     | 4 ++--
 packages/shared/forks/ReactFeatureFlags.www-dynamic.js      | 2 --
 packages/shared/forks/ReactFeatureFlags.www.js              | 6 ++++--
 scripts/jest/setupTests.www.js                              | 1 +
 scripts/jest/setupTests.xplat.js                            | 2 ++
 9 files changed, 17 insertions(+), 14 deletions(-)

diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index ffcec9334d663..d3c5de81bd909 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -25,7 +25,5 @@ export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseEffectCRUDOverload = __VARIANT__;
-export const enableOwnerStacks = __VARIANT__;
-export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
 export const enableLazyPublicInstanceInFabric = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 470e148959327..a0544dc161173 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -27,12 +27,14 @@ export const {
   enableUseEffectCRUDOverload,
   passChildrenWhenCloningPersistedNodes,
   enableSiblingPrerendering,
-  enableOwnerStacks,
-  enableRemoveConsolePatches,
   enableFastAddPropertiesInDiffing,
   enableLazyPublicInstanceInFabric,
 } = dynamicFlags;
 
+// These two can be removed
+export const enableOwnerStacks = true;
+export const enableRemoveConsolePatches = true;
+
 // The rest of the flags are static for better dead code elimination.
 export const disableClientCache = true;
 export const disableCommentsAsDOMContainers = true;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index 361ebde4136ce..fd846cf312212 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -40,7 +40,7 @@ export const enableLegacyFBSupport = false;
 export const enableLegacyHidden = false;
 export const enableNoCloningMemoCache = false;
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enablePersistedModeClonedFlag = false;
 export const enablePostpone = false;
 export const enableReactTestRendererWarning = false;
@@ -80,7 +80,7 @@ export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
 export const enableUpdaterTracking = __PROFILE__;
-export const enableRemoveConsolePatches = false;
+export const enableRemoveConsolePatches = true;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index 18172fdfe5724..e4f1210c29f00 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -35,7 +35,7 @@ export const enableLegacyFBSupport = false;
 export const enableLegacyHidden = false;
 export const enableNoCloningMemoCache = false;
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enablePersistedModeClonedFlag = false;
 export const enablePostpone = false;
 export const enableProfilerCommitHooks = __PROFILE__;
@@ -67,8 +67,8 @@ export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableRemoveConsolePatches = true;
 export const enableSwipeTransition = false;
-export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 628a834133f2f..112b30fe04a81 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -70,7 +70,7 @@ export const disableDefaultPropsExceptForClasses = true;
 export const renameElementSymbol = false;
 
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enableShallowPropDiffing = false;
 export const enableSiblingPrerendering = true;
 
@@ -82,8 +82,8 @@ export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableRemoveConsolePatches = true;
 export const enableSwipeTransition = false;
-export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
index d0b4404a3e946..e0f431fe7f10c 100644
--- a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
@@ -26,7 +26,6 @@ export const enableRetryLaneExpiration = __VARIANT__;
 export const enableTransitionTracing = __VARIANT__;
 export const favorSafetyOverHydrationPerf = __VARIANT__;
 export const renameElementSymbol = __VARIANT__;
-export const enableOwnerStacks = __VARIANT__;
 export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
@@ -37,7 +36,6 @@ export const enableInfiniteRenderLoopDetection = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 
 export const enableUseEffectCRUDOverload = __VARIANT__;
-export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
 export const enableLazyPublicInstanceInFabric = false;
 export const enableViewTransition = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index 5932c6eddf6f1..ec0337382e957 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -35,8 +35,6 @@ export const {
   retryLaneExpirationMs,
   syncLaneExpirationMs,
   transitionLaneExpirationMs,
-  enableOwnerStacks,
-  enableRemoveConsolePatches,
   enableFastAddPropertiesInDiffing,
   enableViewTransition,
 } = dynamicFeatureFlags;
@@ -44,6 +42,10 @@ export const {
 // On WWW, __EXPERIMENTAL__ is used for a new modern build.
 // It's not used anywhere in production yet.
 
+// Can remove these two
+export const enableOwnerStacks = true;
+export const enableRemoveConsolePatches = true;
+
 export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
diff --git a/scripts/jest/setupTests.www.js b/scripts/jest/setupTests.www.js
index b0b653bb78ff9..9ac7ffc6db002 100644
--- a/scripts/jest/setupTests.www.js
+++ b/scripts/jest/setupTests.www.js
@@ -11,6 +11,7 @@ jest.mock('shared/ReactFeatureFlags', () => {
   // Flags that aren't currently used, but we still want to force variants to keep the
   // code live.
   actual.disableInputAttributeSyncing = __VARIANT__;
+  actual.enableOwnerStacks = __VARIANT__;
 
   // These are hardcoded to true for the next release,
   // but still run the tests against both variants until
diff --git a/scripts/jest/setupTests.xplat.js b/scripts/jest/setupTests.xplat.js
index 859a5065988d6..87fbf8bef8ac5 100644
--- a/scripts/jest/setupTests.xplat.js
+++ b/scripts/jest/setupTests.xplat.js
@@ -11,6 +11,8 @@ jest.mock('shared/ReactFeatureFlags', () => {
     'shared/forks/ReactFeatureFlags.native-fb.js'
   );
 
+  actual.enableOwnerStacks = __VARIANT__;
+
   // Lots of tests use these, but we don't want to expose it to RN.
   // Ideally, tests for xplat wouldn't use react-dom, but many of our tests do.
   // Since the xplat tests run with the www entry points, some of these flags

From d99f8bba2e07e3bb953f0821d4da5e341136fe5c Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:32:49 -0700
Subject: [PATCH 37/73] [compiler] Delete LoweredFunction.dependencies and
 hoisted instructions (#32096)

LoweredFunction dependencies were exclusively used for dependency
extraction (in `propagateScopeDeps`). Now that we have a
`propagateScopeDepsHIR` that recursively traverses into nested
functions, we can delete `dependencies` and their associated synthetic
`LoadLocal`/`PropertyLoad` instructions.

[Internal snapshot
diff](https://www.internalfb.com/phabricator/paste/view/P1716950202) for
this change shows ~.2% of files changed. I [read through ~60 of the
changed
files](https://www.internalfb.com/phabricator/paste/view/P1733074307)
- most changes are due to better outlining (due to better DCE)
- a few changes in memo inference are due to changed ordering
```
// source
arr.map(() => contextVar.inner);

// previous instructions
$0 = LoadLocal arr
$1 = $0.map
// Below instructions are synthetic
$2 = LoadLocal contextVar
$3 = $2.inner
$4 = Function deps=$3 context=contextVar {
  ...
}
```
- a few changes are effectively bugfixes (see
`aliased-nested-scope-fn-expr`)
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32096).
* #32099
* #32286
* #32104
* #32098
* #32097
* __->__ #32096
---
 .../src/HIR/BuildHIR.ts                       | 154 +-----------
 .../src/HIR/CollectHoistablePropertyLoads.ts  |  37 +--
 .../src/HIR/Environment.ts                    |   2 -
 .../src/HIR/HIR.ts                            |   1 -
 .../HIR/MergeOverlappingReactiveScopesHIR.ts  |  17 +-
 .../src/HIR/PrintHIR.ts                       |   5 +-
 .../src/HIR/PropagateScopeDependenciesHIR.ts  |   5 +-
 .../src/HIR/visitors.ts                       |   7 +-
 .../src/Inference/AnalyseFunctions.ts         | 146 +++---------
 .../Inference/InferMutableContextVariables.ts |  23 +-
 .../src/Inference/InferReferenceEffects.ts    |  48 ++--
 .../src/Optimization/LowerContextAccess.ts    |   1 -
 .../src/Optimization/OutlineFunctions.ts      |   1 -
 .../InferReactiveScopeVariables.ts            |   8 +
 .../src/SSA/EliminateRedundantPhi.ts          |  19 ++
 .../src/SSA/EnterSSA.ts                       |   3 -
 .../src/Transform/TransformFire.ts            |  53 +----
 .../aliased-nested-scope-fn-expr.expect.md    | 120 ++++++++++
 .../compiler/aliased-nested-scope-fn-expr.tsx |  46 ++++
 ...iased-nested-scope-truncated-dep.expect.md | 221 ++++++++++++++++++
 .../aliased-nested-scope-truncated-dep.tsx    |  93 ++++++++
 ...access-in-unused-callback-nested.expect.md |  40 ++--
 .../capturing-func-mutate-2.expect.md         |   1 -
 .../capturing-func-no-mutate.expect.md        |  12 +-
 ...capturing-func-simple-alias-iife.expect.md |   1 -
 ...ction-alias-computed-load-2-iife.expect.md |   1 -
 ...ction-alias-computed-load-3-iife.expect.md |   2 -
 ...ction-alias-computed-load-4-iife.expect.md |   1 -
 ...unction-alias-computed-load-iife.expect.md |   1 -
 ...capturing-reference-changes-type.expect.md |   1 -
 .../codegen-inline-iife-reassign.expect.md    |   3 +-
 ...-into-function-expression-global.expect.md |   7 +-
 ...to-function-expression-primitive.expect.md |   7 +-
 ...gation-into-function-expressions.expect.md |   9 +-
 ...text-variable-as-jsx-element-tag.expect.md |   3 +-
 ...ting-simple-function-declaration.expect.md |  10 +-
 ...call-freezes-captured-identifier.expect.md |  41 ++++
 ....hook-call-freezes-captured-identifier.tsx |  20 ++
 ...call-freezes-captured-memberexpr.expect.md |  41 ++++
 ....hook-call-freezes-captured-memberexpr.jsx |  20 ++
 ...on-with-shadowed-local-same-name.expect.md |   2 +-
 ...setstate-captured-indirectly-jsx.expect.md |  81 +++++++
 ...isting-setstate-captured-indirectly-jsx.js |  17 ++
 .../compiler/hoisting-setstate.expect.md      |  77 ++++++
 .../fixtures/compiler/hoisting-setstate.js    |  28 +++
 ...call-freezes-captured-memberexpr.expect.md |  87 +++++++
 .../hook-call-freezes-captured-memberexpr.tsx |  21 ++
 .../jsx-local-tag-in-lambda.expect.md         |   7 +-
 .../jsx-memberexpr-tag-in-lambda.expect.md    |   7 +-
 ...mutated-non-reactive-to-reactive.expect.md |   1 -
 .../lambda-mutated-ref-non-reactive.expect.md |   1 -
 ...ed-function-shadowed-identifiers.expect.md |   5 +-
 ...o-reordering-depslist-assignment.expect.md |   1 -
 ...e-phis-in-lambda-capture-context.expect.md |  29 +--
 .../use-operator-conditional.expect.md        |   1 -
 55 files changed, 1123 insertions(+), 473 deletions(-)
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
index d5c3ea6a492a9..67cdcab0381f2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
@@ -7,7 +7,6 @@
 
 import {NodePath, Scope} from '@babel/traverse';
 import * as t from '@babel/types';
-import {Expression} from '@babel/types';
 import invariant from 'invariant';
 import {
   CompilerError,
@@ -75,7 +74,7 @@ export function lower(
   parent: NodePath<t.Function> | null = null,
 ): Result<HIRFunction, CompilerError> {
   const builder = new HIRBuilder(env, parent ?? func, bindings, capturedRefs);
-  const context: Array<Place> = [];
+  const context: HIRFunction['context'] = [];
 
   for (const ref of capturedRefs ?? []) {
     context.push({
@@ -3378,7 +3377,7 @@ function lowerFunction(
   >,
 ): LoweredFunction | null {
   const componentScope: Scope = builder.parentFunction.scope;
-  const captured = gatherCapturedDeps(builder, expr, componentScope);
+  const capturedContext = gatherCapturedContext(expr, componentScope);
 
   /*
    * TODO(gsn): In the future, we could only pass in the context identifiers
@@ -3392,7 +3391,7 @@ function lowerFunction(
     expr,
     builder.environment,
     builder.bindings,
-    [...builder.context, ...captured.identifiers],
+    [...builder.context, ...capturedContext],
     builder.parentFunction,
   );
   let loweredFunc: HIRFunction;
@@ -3405,7 +3404,6 @@ function lowerFunction(
   loweredFunc = lowering.unwrap();
   return {
     func: loweredFunc,
-    dependencies: captured.refs,
   };
 }
 
@@ -4079,14 +4077,6 @@ function lowerAssignment(
   }
 }
 
-function isValidDependency(path: NodePath<t.MemberExpression>): boolean {
-  const parent: NodePath<t.Node> = path.parentPath;
-  return (
-    !path.node.computed &&
-    !(parent.isCallExpression() && parent.get('callee') === path)
-  );
-}
-
 function captureScopes({from, to}: {from: Scope; to: Scope}): Set<Scope> {
   let scopes: Set<Scope> = new Set();
   while (from) {
@@ -4101,8 +4091,7 @@ function captureScopes({from, to}: {from: Scope; to: Scope}): Set<Scope> {
   return scopes;
 }
 
-function gatherCapturedDeps(
-  builder: HIRBuilder,
+function gatherCapturedContext(
   fn: NodePath<
     | t.FunctionExpression
     | t.ArrowFunctionExpression
@@ -4110,10 +4099,8 @@ function gatherCapturedDeps(
     | t.ObjectMethod
   >,
   componentScope: Scope,
-): {identifiers: Array<t.Identifier>; refs: Array<Place>} {
-  const capturedIds: Map<t.Identifier, number> = new Map();
-  const capturedRefs: Set<Place> = new Set();
-  const seenPaths: Set<string> = new Set();
+): Array<t.Identifier> {
+  const capturedIds = new Set<t.Identifier>();
 
   /*
    * Capture all the scopes from the parent of this function up to and including
@@ -4124,33 +4111,11 @@ function gatherCapturedDeps(
     to: componentScope,
   });
 
-  function addCapturedId(bindingIdentifier: t.Identifier): number {
-    if (!capturedIds.has(bindingIdentifier)) {
-      const index = capturedIds.size;
-      capturedIds.set(bindingIdentifier, index);
-      return index;
-    } else {
-      return capturedIds.get(bindingIdentifier)!;
-    }
-  }
-
   function handleMaybeDependency(
-    path:
-      | NodePath<t.MemberExpression>
-      | NodePath<t.Identifier>
-      | NodePath<t.JSXOpeningElement>,
+    path: NodePath<t.Identifier> | NodePath<t.JSXOpeningElement>,
   ): void {
     // Base context variable to depend on
     let baseIdentifier: NodePath<t.Identifier> | NodePath<t.JSXIdentifier>;
-    /*
-     * Base expression to depend on, which (for now) may contain non side-effectful
-     * member expressions
-     */
-    let dependency:
-      | NodePath<t.MemberExpression>
-      | NodePath<t.JSXMemberExpression>
-      | NodePath<t.Identifier>
-      | NodePath<t.JSXIdentifier>;
     if (path.isJSXOpeningElement()) {
       const name = path.get('name');
       if (!(name.isJSXMemberExpression() || name.isJSXIdentifier())) {
@@ -4166,115 +4131,20 @@ function gatherCapturedDeps(
         'Invalid logic in gatherCapturedDeps',
       );
       baseIdentifier = current;
-
-      /*
-       * Get the expression to depend on, which may involve PropertyLoads
-       * for member expressions
-       */
-      let currentDep:
-        | NodePath<t.JSXMemberExpression>
-        | NodePath<t.Identifier>
-        | NodePath<t.JSXIdentifier> = baseIdentifier;
-
-      while (true) {
-        const nextDep: null | NodePath<t.Node> = currentDep.parentPath;
-        if (nextDep && nextDep.isJSXMemberExpression()) {
-          currentDep = nextDep;
-        } else {
-          break;
-        }
-      }
-      dependency = currentDep;
-    } else if (path.isMemberExpression()) {
-      // Calculate baseIdentifier
-      let currentId: NodePath<Expression> = path;
-      while (currentId.isMemberExpression()) {
-        currentId = currentId.get('object');
-      }
-      if (!currentId.isIdentifier()) {
-        return;
-      }
-      baseIdentifier = currentId;
-
-      /*
-       * Get the expression to depend on, which may involve PropertyLoads
-       * for member expressions
-       */
-      let currentDep:
-        | NodePath<t.MemberExpression>
-        | NodePath<t.Identifier>
-        | NodePath<t.JSXIdentifier> = baseIdentifier;
-
-      while (true) {
-        const nextDep: null | NodePath<t.Node> = currentDep.parentPath;
-        if (
-          nextDep &&
-          nextDep.isMemberExpression() &&
-          isValidDependency(nextDep)
-        ) {
-          currentDep = nextDep;
-        } else {
-          break;
-        }
-      }
-
-      dependency = currentDep;
     } else {
       baseIdentifier = path;
-      dependency = path;
     }
 
     /*
      * Skip dependency path, as we already tried to recursively add it (+ all subexpressions)
      * as a dependency.
      */
-    dependency.skip();
+    path.skip();
 
     // Add the base identifier binding as a dependency.
     const binding = baseIdentifier.scope.getBinding(baseIdentifier.node.name);
-    if (binding === undefined || !pureScopes.has(binding.scope)) {
-      return;
-    }
-    const idKey = String(addCapturedId(binding.identifier));
-
-    // Add the expression (potentially a memberexpr path) as a dependency.
-    let exprKey = idKey;
-    if (dependency.isMemberExpression()) {
-      let pathTokens = [];
-      let current: NodePath<Expression> = dependency;
-      while (current.isMemberExpression()) {
-        const property = current.get('property') as NodePath<t.Identifier>;
-        pathTokens.push(property.node.name);
-        current = current.get('object');
-      }
-
-      exprKey += '.' + pathTokens.reverse().join('.');
-    } else if (dependency.isJSXMemberExpression()) {
-      let pathTokens = [];
-      let current: NodePath<t.JSXMemberExpression | t.JSXIdentifier> =
-        dependency;
-      while (current.isJSXMemberExpression()) {
-        const property = current.get('property');
-        pathTokens.push(property.node.name);
-        current = current.get('object');
-      }
-    }
-
-    if (!seenPaths.has(exprKey)) {
-      let loweredDep: Place;
-      if (dependency.isJSXIdentifier()) {
-        loweredDep = lowerValueToTemporary(builder, {
-          kind: 'LoadLocal',
-          place: lowerIdentifier(builder, dependency),
-          loc: path.node.loc ?? GeneratedSource,
-        });
-      } else if (dependency.isJSXMemberExpression()) {
-        loweredDep = lowerJsxMemberExpression(builder, dependency);
-      } else {
-        loweredDep = lowerExpressionToTemporary(builder, dependency);
-      }
-      capturedRefs.add(loweredDep);
-      seenPaths.add(exprKey);
+    if (binding !== undefined && pureScopes.has(binding.scope)) {
+      capturedIds.add(binding.identifier);
     }
   }
 
@@ -4305,13 +4175,13 @@ function gatherCapturedDeps(
         return;
       } else if (path.isJSXElement()) {
         handleMaybeDependency(path.get('openingElement'));
-      } else if (path.isMemberExpression() || path.isIdentifier()) {
+      } else if (path.isIdentifier()) {
         handleMaybeDependency(path);
       }
     },
   });
 
-  return {identifiers: [...capturedIds.keys()], refs: [...capturedRefs]};
+  return [...capturedIds.keys()];
 }
 
 function notNull<T>(value: T | null): value is T {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
index d3c919a6d8afe..a422570fffead 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
@@ -131,15 +131,7 @@ function collectHoistablePropertyLoadsImpl(
   fn: HIRFunction,
   context: CollectHoistablePropertyLoadsContext,
 ): ReadonlyMap<BlockId, BlockInfo> {
-  const functionExpressionLoads = collectFunctionExpressionFakeLoads(fn);
-  const actuallyEvaluatedTemporaries = new Map(
-    [...context.temporaries].filter(([id]) => !functionExpressionLoads.has(id)),
-  );
-
-  const nodes = collectNonNullsInBlocks(fn, {
-    ...context,
-    temporaries: actuallyEvaluatedTemporaries,
-  });
+  const nodes = collectNonNullsInBlocks(fn, context);
   propagateNonNull(fn, nodes, context.registry);
 
   if (DEBUG_PRINT) {
@@ -598,30 +590,3 @@ function reduceMaybeOptionalChains(
     }
   } while (changed);
 }
-
-function collectFunctionExpressionFakeLoads(
-  fn: HIRFunction,
-): Set<IdentifierId> {
-  const sources = new Map<IdentifierId, IdentifierId>();
-  const functionExpressionReferences = new Set<IdentifierId>();
-
-  for (const [_, block] of fn.body.blocks) {
-    for (const {lvalue, value} of block.instructions) {
-      if (
-        value.kind === 'FunctionExpression' ||
-        value.kind === 'ObjectMethod'
-      ) {
-        for (const reference of value.loweredFunc.dependencies) {
-          let curr: IdentifierId | undefined = reference.identifier.id;
-          while (curr != null) {
-            functionExpressionReferences.add(curr);
-            curr = sources.get(curr);
-          }
-        }
-      } else if (value.kind === 'PropertyLoad') {
-        sources.set(lvalue.identifier.id, value.object.identifier.id);
-      }
-    }
-  }
-  return functionExpressionReferences;
-}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
index 113af2025dd2b..8de9218a662e2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
@@ -245,8 +245,6 @@ const EnvironmentConfigSchema = z.object({
    */
   enableUseTypeAnnotations: z.boolean().default(false),
 
-  enableFunctionDependencyRewrite: z.boolean().default(true),
-
   /**
    * Enables inference of optional dependency chains. Without this flag
    * a property chain such as `props?.items?.foo` will infer as a dep on
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
index a6a9cbcd48ec5..4df6da6c1704c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
@@ -722,7 +722,6 @@ export type ObjectProperty = {
 };
 
 export type LoweredFunction = {
-  dependencies: Array<Place>;
   func: HIRFunction;
 };
 
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts
index a3740539b295b..5b286e917d0d3 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts
@@ -148,6 +148,14 @@ function collectScopeInfo(fn: HIRFunction): ScopeInfo {
     const scope = place.identifier.scope;
     if (scope != null) {
       placeScopes.set(place, scope);
+      /**
+       * Record both mutating and non-mutating scopes to merge scopes with
+       * still-mutating values with inner scopes that alias those values
+       * (see `nonmutating-capture-in-unsplittable-memo-block`)
+       *
+       * Note that this isn't perfect, as it also leads to merging of mutating
+       * scopes with JSX single-instruction scopes (see `mutation-within-jsx`)
+       */
       if (scope.range.start !== scope.range.end) {
         getOrInsertDefault(scopeStarts, scope.range.start, new Set()).add(
           scope,
@@ -254,7 +262,7 @@ function visitPlace(
    * of the stack to the mutated outer scope.
    */
   const placeScope = getPlaceScope(id, place);
-  if (placeScope != null && isMutable({id} as any, place)) {
+  if (placeScope != null && isMutable({id}, place)) {
     const placeScopeIdx = activeScopes.indexOf(placeScope);
     if (placeScopeIdx !== -1 && placeScopeIdx !== activeScopes.length - 1) {
       joined.union([placeScope, ...activeScopes.slice(placeScopeIdx + 1)]);
@@ -275,6 +283,13 @@ function getOverlappingReactiveScopes(
     for (const instr of block.instructions) {
       visitInstructionId(instr.id, context, state);
       for (const place of eachInstructionOperand(instr)) {
+        if (
+          (instr.value.kind === 'FunctionExpression' ||
+            instr.value.kind === 'ObjectMethod') &&
+          place.identifier.type.kind === 'Primitive'
+        ) {
+          continue;
+        }
         visitPlace(instr.id, place, state);
       }
       for (const place of eachInstructionLValue(instr)) {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
index a6f6c606e118d..7a6586730f9c1 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
@@ -538,9 +538,6 @@ export function printInstructionValue(instrValue: ReactiveValue): string {
         .split('\n')
         .map(line => `      ${line}`)
         .join('\n');
-      const deps = instrValue.loweredFunc.dependencies
-        .map(dep => printPlace(dep))
-        .join(',');
       const context = instrValue.loweredFunc.func.context
         .map(dep => printPlace(dep))
         .join(',');
@@ -557,7 +554,7 @@ export function printInstructionValue(instrValue: ReactiveValue): string {
           })
           .join(', ') ?? '';
       const type = printType(instrValue.loweredFunc.func.returnType).trim();
-      value = `${kind} ${name} @deps[${deps}] @context[${context}] @effects[${effects}]${type !== '' ? ` return${type}` : ''}:\n${fn}`;
+      value = `${kind} ${name} @context[${context}] @effects[${effects}]${type !== '' ? ` return${type}` : ''}:\n${fn}`;
       break;
     }
     case 'TaggedTemplateExpression': {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
index 08856e9143139..4cb84870a8a33 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
@@ -738,9 +738,8 @@ function collectDependencies(
       }
       for (const instr of block.instructions) {
         if (
-          fn.env.config.enableFunctionDependencyRewrite &&
-          (instr.value.kind === 'FunctionExpression' ||
-            instr.value.kind === 'ObjectMethod')
+          instr.value.kind === 'FunctionExpression' ||
+          instr.value.kind === 'ObjectMethod'
         ) {
           context.declare(instr.lvalue.identifier, {
             id: instr.id,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts
index c9ee803bfaffd..49ff3c256e016 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts
@@ -193,7 +193,7 @@ export function* eachInstructionValueOperand(
     }
     case 'ObjectMethod':
     case 'FunctionExpression': {
-      yield* instrValue.loweredFunc.dependencies;
+      yield* instrValue.loweredFunc.func.context;
       break;
     }
     case 'TaggedTemplateExpression': {
@@ -517,8 +517,9 @@ export function mapInstructionValueOperands(
     }
     case 'ObjectMethod':
     case 'FunctionExpression': {
-      instrValue.loweredFunc.dependencies =
-        instrValue.loweredFunc.dependencies.map(d => fn(d));
+      instrValue.loweredFunc.func.context =
+        instrValue.loweredFunc.func.context.map(d => fn(d));
+
       break;
     }
     case 'TaggedTemplateExpression': {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
index 75bd8f6811ffb..5381262874369 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
@@ -10,9 +10,8 @@ import {
   Effect,
   HIRFunction,
   Identifier,
-  IdentifierName,
+  IdentifierId,
   LoweredFunction,
-  Place,
   isRefOrRefValue,
   makeInstructionId,
 } from '../HIR';
@@ -23,78 +22,39 @@ import {inferMutableContextVariables} from './InferMutableContextVariables';
 import {inferMutableRanges} from './InferMutableRanges';
 import inferReferenceEffects from './InferReferenceEffects';
 
-type Dependency = {
-  identifier: Identifier;
-  path: Array<string>;
-};
-
 // Helper class to track indirections such as LoadLocal and PropertyLoad.
 export class IdentifierState {
-  properties: Map<Identifier, Dependency> = new Map();
+  properties: Map<IdentifierId, Identifier> = new Map();
 
   resolve(identifier: Identifier): Identifier {
-    const resolved = this.properties.get(identifier);
+    const resolved = this.properties.get(identifier.id);
     if (resolved !== undefined) {
-      return resolved.identifier;
+      return resolved;
     }
     return identifier;
   }
 
-  declareProperty(lvalue: Place, object: Place, property: string): void {
-    const objectDependency = this.properties.get(object.identifier);
-    let nextDependency: Dependency;
-    if (objectDependency === undefined) {
-      nextDependency = {identifier: object.identifier, path: [property]};
-    } else {
-      nextDependency = {
-        identifier: objectDependency.identifier,
-        path: [...objectDependency.path, property],
-      };
-    }
-    this.properties.set(lvalue.identifier, nextDependency);
-  }
-
-  declareTemporary(lvalue: Place, value: Place): void {
-    const resolved: Dependency = this.properties.get(value.identifier) ?? {
-      identifier: value.identifier,
-      path: [],
-    };
-    this.properties.set(lvalue.identifier, resolved);
+  alias(lvalue: Identifier, value: Identifier): void {
+    this.properties.set(lvalue.id, this.properties.get(value.id) ?? value);
   }
 }
 
 export default function analyseFunctions(func: HIRFunction): void {
-  const state = new IdentifierState();
-
   for (const [_, block] of func.body.blocks) {
     for (const instr of block.instructions) {
       switch (instr.value.kind) {
         case 'ObjectMethod':
         case 'FunctionExpression': {
           lower(instr.value.loweredFunc.func);
-          infer(instr.value.loweredFunc, state, func.context);
-          break;
-        }
-        case 'PropertyLoad': {
-          state.declareProperty(
-            instr.lvalue,
-            instr.value.object,
-            instr.value.property,
-          );
-          break;
-        }
-        case 'ComputedLoad': {
-          /*
-           * The path is set to an empty string as the path doesn't really
-           * matter for a computed load.
+          infer(instr.value.loweredFunc);
+
+          /**
+           * Reset mutable range for outer inferReferenceEffects
            */
-          state.declareProperty(instr.lvalue, instr.value.object, '');
-          break;
-        }
-        case 'LoadLocal':
-        case 'LoadContext': {
-          if (instr.lvalue.identifier.name === null) {
-            state.declareTemporary(instr.lvalue, instr.value.place);
+          for (const operand of instr.value.loweredFunc.func.context) {
+            operand.identifier.mutableRange.start = makeInstructionId(0);
+            operand.identifier.mutableRange.end = makeInstructionId(0);
+            operand.identifier.scope = null;
           }
           break;
         }
@@ -110,7 +70,6 @@ function lower(func: HIRFunction): void {
   inferMutableRanges(func);
   rewriteInstructionKindsBasedOnReassignment(func);
   inferReactiveScopeVariables(func);
-  inferMutableContextVariables(func);
   func.env.logger?.debugLogIRs?.({
     kind: 'hir',
     name: 'AnalyseFunction (inner)',
@@ -118,32 +77,16 @@ function lower(func: HIRFunction): void {
   });
 }
 
-function infer(
-  loweredFunc: LoweredFunction,
-  state: IdentifierState,
-  context: Array<Place>,
-): void {
-  const mutations = new Map<string, Effect>();
+function infer(loweredFunc: LoweredFunction): void {
+  const knownMutated = inferMutableContextVariables(loweredFunc.func);
   for (const operand of loweredFunc.func.context) {
-    if (
-      isMutatedOrReassigned(operand.identifier) &&
-      operand.identifier.name !== null
-    ) {
-      mutations.set(operand.identifier.name.value, operand.effect);
-    }
-  }
-
-  for (const dep of loweredFunc.dependencies) {
-    let name: IdentifierName | null = null;
-
-    if (state.properties.has(dep.identifier)) {
-      const receiver = state.properties.get(dep.identifier)!;
-      name = receiver.identifier.name;
-    } else {
-      name = dep.identifier.name;
-    }
-
-    if (isRefOrRefValue(dep.identifier)) {
+    const identifier = operand.identifier;
+    CompilerError.invariant(operand.effect === Effect.Unknown, {
+      reason:
+        '[AnalyseFunctions] Expected Function context effects to not have been set',
+      loc: operand.loc,
+    });
+    if (isRefOrRefValue(identifier)) {
       /*
        * TODO: this is a hack to ensure we treat functions which reference refs
        * as having a capture and therefore being considered mutable. this ensures
@@ -151,43 +94,16 @@ function infer(
        * could be called, and allows us to help ensure it isn't called during
        * render
        */
-      dep.effect = Effect.Capture;
-    } else if (name !== null) {
-      const effect = mutations.get(name.value);
-      if (effect !== undefined) {
-        dep.effect = effect === Effect.Unknown ? Effect.Capture : effect;
-      }
-    }
-  }
-
-  /*
-   * This could potentially add duplicate deps to mutatedDeps in the case of
-   * mutating a context ref in the child function and in this parent function.
-   * It might be useful to dedupe this.
-   *
-   * In practice this never really matters because the Component function has no
-   * context refs, so it will never have duplicate deps.
-   */
-  for (const place of context) {
-    CompilerError.invariant(place.identifier.name !== null, {
-      reason: 'context refs should always have a name',
-      description: null,
-      loc: place.loc,
-      suggestions: null,
-    });
-
-    const effect = mutations.get(place.identifier.name.value);
-    if (effect !== undefined) {
-      place.effect = effect === Effect.Unknown ? Effect.Capture : effect;
-      loweredFunc.dependencies.push(place);
+      operand.effect = Effect.Capture;
+    } else if (knownMutated.has(operand)) {
+      operand.effect = Effect.Mutate;
+    } else if (isMutatedOrReassigned(identifier)) {
+      // Note that this also reflects if identifier is ConditionallyMutated
+      operand.effect = Effect.Capture;
+    } else {
+      operand.effect = Effect.Read;
     }
   }
-
-  for (const operand of loweredFunc.func.context) {
-    operand.identifier.mutableRange.start = makeInstructionId(0);
-    operand.identifier.mutableRange.end = makeInstructionId(0);
-    operand.identifier.scope = null;
-  }
 }
 
 function isMutatedOrReassigned(id: Identifier): boolean {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
index 67babf43db22f..0025472721542 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
@@ -55,32 +55,21 @@ import {IdentifierState} from './AnalyseFunctions';
  * fn();
  * ```
  */
-export function inferMutableContextVariables(fn: HIRFunction): void {
+export function inferMutableContextVariables(fn: HIRFunction): Set<Place> {
   const state = new IdentifierState();
   const knownMutatedIdentifiers = new Set<Identifier>();
   for (const [, block] of fn.body.blocks) {
     for (const instr of block.instructions) {
       switch (instr.value.kind) {
-        case 'PropertyLoad': {
-          state.declareProperty(
-            instr.lvalue,
-            instr.value.object,
-            instr.value.property,
-          );
-          break;
-        }
+        case 'PropertyLoad':
         case 'ComputedLoad': {
-          /*
-           * The path is set to an empty string as the path doesn't really
-           * matter for a computed load.
-           */
-          state.declareProperty(instr.lvalue, instr.value.object, '');
+          state.alias(instr.lvalue.identifier, instr.value.object.identifier);
           break;
         }
         case 'LoadLocal':
         case 'LoadContext': {
           if (instr.lvalue.identifier.name === null) {
-            state.declareTemporary(instr.lvalue, instr.value.place);
+            state.alias(instr.lvalue.identifier, instr.value.place.identifier);
           }
           break;
         }
@@ -95,11 +84,13 @@ export function inferMutableContextVariables(fn: HIRFunction): void {
       visitOperand(state, knownMutatedIdentifiers, operand);
     }
   }
+  const results = new Set<Place>();
   for (const operand of fn.context) {
     if (knownMutatedIdentifiers.has(operand.identifier)) {
-      operand.effect = Effect.Mutate;
+      results.add(operand);
     }
   }
+  return results;
 }
 
 function visitOperand(
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
index 0afe479df08dd..6420e74a2fd20 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
@@ -390,29 +390,31 @@ class InferenceState {
 
   freezeValues(values: Set<InstructionValue>, reason: Set<ValueReason>): void {
     for (const value of values) {
+      if (value.kind === 'DeclareContext') {
+        /**
+         * Avoid freezing hoisted context declarations
+         * function Component() {
+         *   const cb = useBar(() => foo(2)); // produces a hoisted context declaration
+         *   const foo = useFoo();            // reassigns to the context variable
+         *   return <Foo cb={cb} />;
+         * }
+         */
+        continue;
+      }
       this.#values.set(value, {
         kind: ValueKind.Frozen,
         reason,
         context: new Set(),
       });
-      if (value.kind === 'FunctionExpression') {
-        if (
-          this.#env.config.enablePreserveExistingMemoizationGuarantees ||
-          this.#env.config.enableTransitivelyFreezeFunctionExpressions
-        ) {
-          if (value.kind === 'FunctionExpression') {
-            /*
-             * We want to freeze the captured values, not mark the operands
-             * themselves as frozen. There could be mutations that occur
-             * before the freeze we are processing, and it would be invalid
-             * to overwrite those mutations as a freeze.
-             */
-            for (const operand of eachInstructionValueOperand(value)) {
-              const operandValues = this.#variables.get(operand.identifier.id);
-              if (operandValues !== undefined) {
-                this.freezeValues(operandValues, reason);
-              }
-            }
+      if (
+        value.kind === 'FunctionExpression' &&
+        (this.#env.config.enablePreserveExistingMemoizationGuarantees ||
+          this.#env.config.enableTransitivelyFreezeFunctionExpressions)
+      ) {
+        for (const operand of value.loweredFunc.func.context) {
+          const operandValues = this.#variables.get(operand.identifier.id);
+          if (operandValues !== undefined) {
+            this.freezeValues(operandValues, reason);
           }
         }
       }
@@ -1143,17 +1145,17 @@ function inferBlock(
       case 'ObjectMethod':
       case 'FunctionExpression': {
         let hasMutableOperand = false;
-        const mutableOperands: Array<Place> = [];
         for (const operand of eachInstructionOperand(instr)) {
+          CompilerError.invariant(operand.effect !== Effect.Unknown, {
+            reason: 'Expected fn effects to be populated',
+            loc: operand.loc,
+          });
           state.referenceAndRecordEffects(
             freezeActions,
             operand,
-            operand.effect === Effect.Unknown ? Effect.Read : operand.effect,
+            operand.effect,
             ValueReason.Other,
           );
-          if (isMutableEffect(operand.effect, operand.loc)) {
-            mutableOperands.push(operand);
-          }
           hasMutableOperand ||= isMutableEffect(operand.effect, operand.loc);
         }
         /*
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
index e27b8f952148a..5b700b23b4049 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
@@ -270,7 +270,6 @@ function emitSelectorFn(env: Environment, keys: Array<string>): Instruction {
       name: null,
       loweredFunc: {
         func: fn,
-        dependencies: [],
       },
       type: 'ArrowFunctionExpression',
       loc: GeneratedSource,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts
index 7a1473be40c87..0e6d1fd59201f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts
@@ -24,7 +24,6 @@ export function outlineFunctions(
       }
       if (
         value.kind === 'FunctionExpression' &&
-        value.loweredFunc.dependencies.length === 0 &&
         value.loweredFunc.func.context.length === 0 &&
         // TODO: handle outlining named functions
         value.loweredFunc.func.id === null &&
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts
index 1108422f070d7..1f104d8592fab 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts
@@ -379,6 +379,14 @@ export function findDisjointMutableValues(
              */
             operand.identifier.mutableRange.start > 0
           ) {
+            if (
+              instr.value.kind === 'FunctionExpression' ||
+              instr.value.kind === 'ObjectMethod'
+            ) {
+              if (operand.identifier.type.kind === 'Primitive') {
+                continue;
+              }
+            }
             operands.push(operand.identifier);
           }
         }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts b/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts
index bae038f9bd9df..12c8c0e2e6221 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts
@@ -13,6 +13,8 @@ import {
   eachTerminalOperand,
 } from '../HIR/visitors';
 
+const DEBUG = false;
+
 /*
  * Pass to eliminate redundant phi nodes:
  * - all operands are the same identifier, ie `x2 = phi(x1, x1, x1)`.
@@ -141,6 +143,23 @@ export function eliminateRedundantPhi(
      * have already propagated forwards since we visit in reverse postorder.
      */
   } while (rewrites.size > size && hasBackEdge);
+
+  if (DEBUG) {
+    for (const [, block] of ir.blocks) {
+      for (const phi of block.phis) {
+        CompilerError.invariant(!rewrites.has(phi.place.identifier), {
+          reason: '[EliminateRedundantPhis]: rewrite not complete',
+          loc: phi.place.loc,
+        });
+        for (const [, operand] of phi.operands) {
+          CompilerError.invariant(!rewrites.has(operand.identifier), {
+            reason: '[EliminateRedundantPhis]: rewrite not complete',
+            loc: phi.place.loc,
+          });
+        }
+      }
+    }
+  }
 }
 
 function rewritePlace(
diff --git a/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts b/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts
index caba0d3c36992..820f7388dc41b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts
@@ -301,9 +301,6 @@ function enterSSAImpl(
         entry.preds.add(blockId);
         builder.defineFunction(loweredFunc);
         builder.enter(() => {
-          loweredFunc.context = loweredFunc.context.map(p =>
-            builder.getPlace(p),
-          );
           loweredFunc.params = loweredFunc.params.map(param => {
             if (param.kind === 'Identifier') {
               return builder.definePlace(param);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts b/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts
index a35c4ddb0182c..a480b5d7c78de 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts
@@ -319,51 +319,6 @@ function visitFunctionExpressionAndPropagateFireDependencies(
     replaceFireFunctions(fnExpr.loweredFunc.func, context),
   );
 
-  /*
-   * Make a mapping from each dependency to the corresponding LoadLocal for it so that
-   * we can replace the loaded place with the generated fire function binding
-   */
-  const loadLocalsToDepLoads = new Map<IdentifierId, LoadLocal>();
-  for (const dep of fnExpr.loweredFunc.dependencies) {
-    const loadLocal = context.getLoadLocalInstr(dep.identifier.id);
-    if (loadLocal != null) {
-      loadLocalsToDepLoads.set(loadLocal.place.identifier.id, loadLocal);
-    }
-  }
-
-  const replacedCallees = new Map<IdentifierId, Place>();
-  for (const [
-    calleeIdentifierId,
-    loadedFireFunctionBindingPlace,
-  ] of calleesCapturedByFnExpression.entries()) {
-    /*
-     * Given the ids of captured fire callees, look at the deps for loads of those identifiers
-     * and replace them with the new fire function binding
-     */
-    const loadLocal = loadLocalsToDepLoads.get(calleeIdentifierId);
-    if (loadLocal == null) {
-      context.pushError({
-        loc: fnExpr.loc,
-        description: null,
-        severity: ErrorSeverity.Invariant,
-        reason:
-          '[InsertFire] No loadLocal found for fire call argument for lambda',
-        suggestions: null,
-      });
-      continue;
-    }
-
-    const oldPlaceId = loadLocal.place.identifier.id;
-    loadLocal.place = {
-      ...loadedFireFunctionBindingPlace.fireFunctionBinding,
-    };
-
-    replacedCallees.set(
-      oldPlaceId,
-      loadedFireFunctionBindingPlace.fireFunctionBinding,
-    );
-  }
-
   // For each replaced callee, update the context of the function expression to track it
   for (
     let contextIdx = 0;
@@ -371,9 +326,13 @@ function visitFunctionExpressionAndPropagateFireDependencies(
     contextIdx++
   ) {
     const contextItem = fnExpr.loweredFunc.func.context[contextIdx];
-    const replacedCallee = replacedCallees.get(contextItem.identifier.id);
+    const replacedCallee = calleesCapturedByFnExpression.get(
+      contextItem.identifier.id,
+    );
     if (replacedCallee != null) {
-      fnExpr.loweredFunc.func.context[contextIdx] = replacedCallee;
+      fnExpr.loweredFunc.func.context[contextIdx] = {
+        ...replacedCallee.fireFunctionBinding,
+      };
     }
   }
 
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md
new file mode 100644
index 0000000000000..b30ee7e0d6817
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md
@@ -0,0 +1,120 @@
+
+## Input
+
+```javascript
+// @enableTransitivelyFreezeFunctionExpressions:false
+import {
+  Stringify,
+  mutate,
+  identity,
+  setPropertyByKey,
+  shallowCopy,
+} from 'shared-runtime';
+/**
+ * Function expression version of `aliased-nested-scope-truncated-dep`.
+ *
+ * In this fixture, the output would be invalid if propagateScopeDeps did not
+ * avoid adding MemberExpression dependencies which would other evaluate during
+ * the mutable ranges of their base objects.
+ * This is different from `aliased-nested-scope-truncated-dep` which *does*
+ * produce correct output regardless of MemberExpression dependency truncation.
+ *
+ * Note while other expressions evaluate inline, function expressions *always*
+ * represent deferred evaluation. This means that
+ * (1) it's always safe to reorder function expression creation until its
+ *     earliest potential invocation
+ * (2) it's invalid to eagerly evaluate function expression dependencies during
+ *     their respective mutable ranges.
+ */
+
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+
+  const aliasedObj = identity(obj);
+
+  // When `obj` is mutable (either directly or through aliases), taking a
+  // dependency on `obj.id` is invalid as it may change before getId() is invoked
+  const getId = () => obj.id;
+
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  // Calling getId() should return prop.id + 1, not the prev
+  return <Stringify getId={getId} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime"; // @enableTransitivelyFreezeFunctionExpressions:false
+import {
+  Stringify,
+  mutate,
+  identity,
+  setPropertyByKey,
+  shallowCopy,
+} from "shared-runtime";
+/**
+ * Function expression version of `aliased-nested-scope-truncated-dep`.
+ *
+ * In this fixture, the output would be invalid if propagateScopeDeps did not
+ * avoid adding MemberExpression dependencies which would other evaluate during
+ * the mutable ranges of their base objects.
+ * This is different from `aliased-nested-scope-truncated-dep` which *does*
+ * produce correct output regardless of MemberExpression dependency truncation.
+ *
+ * Note while other expressions evaluate inline, function expressions *always*
+ * represent deferred evaluation. This means that
+ * (1) it's always safe to reorder function expression creation until its
+ *     earliest potential invocation
+ * (2) it's invalid to eagerly evaluate function expression dependencies during
+ *     their respective mutable ranges.
+ */
+
+function Component(t0) {
+  const $ = _c(2);
+  const { prop } = t0;
+  let t1;
+  if ($[0] !== prop) {
+    const obj = shallowCopy(prop);
+
+    const aliasedObj = identity(obj);
+
+    const getId = () => obj.id;
+
+    mutate(aliasedObj);
+    setPropertyByKey(aliasedObj, "id", prop.id + 1);
+
+    t1 = <Stringify getId={getId} shouldInvokeFns={true} />;
+    $[0] = prop;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ prop: { id: 1 } }],
+  sequentialRenders: [
+    { prop: { id: 1 } },
+    { prop: { id: 1 } },
+    { prop: { id: 2 } },
+  ],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"getId":{"kind":"Function","result":2},"shouldInvokeFns":true}</div>
+<div>{"getId":{"kind":"Function","result":2},"shouldInvokeFns":true}</div>
+<div>{"getId":{"kind":"Function","result":3},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx
new file mode 100644
index 0000000000000..40022c6f651fd
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx
@@ -0,0 +1,46 @@
+// @enableTransitivelyFreezeFunctionExpressions:false
+import {
+  Stringify,
+  mutate,
+  identity,
+  setPropertyByKey,
+  shallowCopy,
+} from 'shared-runtime';
+/**
+ * Function expression version of `aliased-nested-scope-truncated-dep`.
+ *
+ * In this fixture, the output would be invalid if propagateScopeDeps did not
+ * avoid adding MemberExpression dependencies which would other evaluate during
+ * the mutable ranges of their base objects.
+ * This is different from `aliased-nested-scope-truncated-dep` which *does*
+ * produce correct output regardless of MemberExpression dependency truncation.
+ *
+ * Note while other expressions evaluate inline, function expressions *always*
+ * represent deferred evaluation. This means that
+ * (1) it's always safe to reorder function expression creation until its
+ *     earliest potential invocation
+ * (2) it's invalid to eagerly evaluate function expression dependencies during
+ *     their respective mutable ranges.
+ */
+
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+
+  const aliasedObj = identity(obj);
+
+  // When `obj` is mutable (either directly or through aliases), taking a
+  // dependency on `obj.id` is invalid as it may change before getId() is invoked
+  const getId = () => obj.id;
+
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  // Calling getId() should return prop.id + 1, not the prev
+  return <Stringify getId={getId} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md
new file mode 100644
index 0000000000000..933fafff5f1ba
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md
@@ -0,0 +1,221 @@
+
+## Input
+
+```javascript
+import {
+  Stringify,
+  mutate,
+  identity,
+  shallowCopy,
+  setPropertyByKey,
+} from 'shared-runtime';
+
+/**
+ * This fixture is similar to `bug-aliased-capture-aliased-mutate` and
+ * `nonmutating-capture-in-unsplittable-memo-block`, but with a focus on
+ * dependency extraction.
+ *
+ * NOTE: this fixture is currently valid, but will break with optimizations:
+ * - Scope and mutable-range based reordering may move the array creation
+ *     *after* the `mutate(aliasedObj)` call. This is invalid if mutate
+ *     reassigns inner properties.
+ * - RecycleInto or other deeper-equality optimizations may produce invalid
+ *     output -- it may compare the array's contents / dependencies too early.
+ * - Runtime validation for immutable values will break if `mutate` does
+ *     interior mutation of the value captured into the array.
+ *
+ * Before scope block creation, HIR looks like this:
+ *  //
+ *  // $1 is unscoped as obj's mutable range will be
+ *  // extended in a later pass
+ *  //
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  //
+ *  // $3 gets assigned a scope as Array is an allocating
+ *  // instruction, but this does *not* get extended or
+ *  // merged into the later mutation site.
+ *  // (explained in `bug-aliased-capture-aliased-mutate`)
+ *  //
+ *  $3@1  = Array[$2]
+ *  ...
+ *  $10@0 = LoadLocal shallowCopy@0[0, 12]
+ *  $11   = LoadGlobal mutate
+ *  $12   = $11($10@0[0, 12])
+ *
+ * When filling in scope dependencies, we find that it's incorrect to depend on
+ * PropertyLoads from obj as it hasn't completed its mutable range. Following
+ * the immutable / mutable-new typing system, we check the identity of obj to
+ * detect whether it was newly created (and thus mutable) in this render pass.
+ *
+ * HIR with scopes looks like this.
+ * bb0:
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  scopeTerminal deps=[obj@0] block=bb1 fallt=bb2
+ * bb1:
+ *  $3@1  = Array[$2]
+ *  goto bb2
+ * bb2:
+ *  ...
+ *
+ * This is surprising as deps now is entirely decoupled from temporaries used
+ * by the block itself. scope @1's instructions now reference a value (1)
+ * produced outside its scope range and (2) not represented in its dependencies
+ *
+ * The right thing to do is to ensure that all Loads from a value get assigned
+ * the value's reactive scope. This also requires track mutating and aliasing
+ * separately from scope range. In this example, that would correctly merge
+ * the scopes of $3 with obj.
+ * Runtime validation and optimizations such as ReactiveGraph-based reordering
+ * require this as well.
+ *
+ * A tempting fix is to instead extend $3's ReactiveScope range up to include
+ * $2 (the PropertyLoad). This fixes dependency deduping but not reordering
+ * and mutability.
+ */
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+  const aliasedObj = identity(obj);
+
+  // [obj.id] currently is assigned its own reactive scope
+  const id = [obj.id];
+
+  // Writing to the alias may reassign to previously captured references.
+  // The compiler currently produces valid output, but this breaks with
+  // reordering, recycleInto, and other potential optimizations.
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  return <Stringify id={id} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import {
+  Stringify,
+  mutate,
+  identity,
+  shallowCopy,
+  setPropertyByKey,
+} from "shared-runtime";
+
+/**
+ * This fixture is similar to `bug-aliased-capture-aliased-mutate` and
+ * `nonmutating-capture-in-unsplittable-memo-block`, but with a focus on
+ * dependency extraction.
+ *
+ * NOTE: this fixture is currently valid, but will break with optimizations:
+ * - Scope and mutable-range based reordering may move the array creation
+ *     *after* the `mutate(aliasedObj)` call. This is invalid if mutate
+ *     reassigns inner properties.
+ * - RecycleInto or other deeper-equality optimizations may produce invalid
+ *     output -- it may compare the array's contents / dependencies too early.
+ * - Runtime validation for immutable values will break if `mutate` does
+ *     interior mutation of the value captured into the array.
+ *
+ * Before scope block creation, HIR looks like this:
+ *  //
+ *  // $1 is unscoped as obj's mutable range will be
+ *  // extended in a later pass
+ *  //
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  //
+ *  // $3 gets assigned a scope as Array is an allocating
+ *  // instruction, but this does *not* get extended or
+ *  // merged into the later mutation site.
+ *  // (explained in `bug-aliased-capture-aliased-mutate`)
+ *  //
+ *  $3@1  = Array[$2]
+ *  ...
+ *  $10@0 = LoadLocal shallowCopy@0[0, 12]
+ *  $11   = LoadGlobal mutate
+ *  $12   = $11($10@0[0, 12])
+ *
+ * When filling in scope dependencies, we find that it's incorrect to depend on
+ * PropertyLoads from obj as it hasn't completed its mutable range. Following
+ * the immutable / mutable-new typing system, we check the identity of obj to
+ * detect whether it was newly created (and thus mutable) in this render pass.
+ *
+ * HIR with scopes looks like this.
+ * bb0:
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  scopeTerminal deps=[obj@0] block=bb1 fallt=bb2
+ * bb1:
+ *  $3@1  = Array[$2]
+ *  goto bb2
+ * bb2:
+ *  ...
+ *
+ * This is surprising as deps now is entirely decoupled from temporaries used
+ * by the block itself. scope @1's instructions now reference a value (1)
+ * produced outside its scope range and (2) not represented in its dependencies
+ *
+ * The right thing to do is to ensure that all Loads from a value get assigned
+ * the value's reactive scope. This also requires track mutating and aliasing
+ * separately from scope range. In this example, that would correctly merge
+ * the scopes of $3 with obj.
+ * Runtime validation and optimizations such as ReactiveGraph-based reordering
+ * require this as well.
+ *
+ * A tempting fix is to instead extend $3's ReactiveScope range up to include
+ * $2 (the PropertyLoad). This fixes dependency deduping but not reordering
+ * and mutability.
+ */
+function Component(t0) {
+  const $ = _c(4);
+  const { prop } = t0;
+  let t1;
+  if ($[0] !== prop) {
+    const obj = shallowCopy(prop);
+    const aliasedObj = identity(obj);
+    let t2;
+    if ($[2] !== obj) {
+      t2 = [obj.id];
+      $[2] = obj;
+      $[3] = t2;
+    } else {
+      t2 = $[3];
+    }
+    const id = t2;
+
+    mutate(aliasedObj);
+    setPropertyByKey(aliasedObj, "id", prop.id + 1);
+
+    t1 = <Stringify id={id} />;
+    $[0] = prop;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ prop: { id: 1 } }],
+  sequentialRenders: [
+    { prop: { id: 1 } },
+    { prop: { id: 1 } },
+    { prop: { id: 2 } },
+  ],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"id":[1]}</div>
+<div>{"id":[1]}</div>
+<div>{"id":[2]}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx
new file mode 100644
index 0000000000000..4d9d7e78fb309
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx
@@ -0,0 +1,93 @@
+import {
+  Stringify,
+  mutate,
+  identity,
+  shallowCopy,
+  setPropertyByKey,
+} from 'shared-runtime';
+
+/**
+ * This fixture is similar to `bug-aliased-capture-aliased-mutate` and
+ * `nonmutating-capture-in-unsplittable-memo-block`, but with a focus on
+ * dependency extraction.
+ *
+ * NOTE: this fixture is currently valid, but will break with optimizations:
+ * - Scope and mutable-range based reordering may move the array creation
+ *     *after* the `mutate(aliasedObj)` call. This is invalid if mutate
+ *     reassigns inner properties.
+ * - RecycleInto or other deeper-equality optimizations may produce invalid
+ *     output -- it may compare the array's contents / dependencies too early.
+ * - Runtime validation for immutable values will break if `mutate` does
+ *     interior mutation of the value captured into the array.
+ *
+ * Before scope block creation, HIR looks like this:
+ *  //
+ *  // $1 is unscoped as obj's mutable range will be
+ *  // extended in a later pass
+ *  //
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  //
+ *  // $3 gets assigned a scope as Array is an allocating
+ *  // instruction, but this does *not* get extended or
+ *  // merged into the later mutation site.
+ *  // (explained in `bug-aliased-capture-aliased-mutate`)
+ *  //
+ *  $3@1  = Array[$2]
+ *  ...
+ *  $10@0 = LoadLocal shallowCopy@0[0, 12]
+ *  $11   = LoadGlobal mutate
+ *  $12   = $11($10@0[0, 12])
+ *
+ * When filling in scope dependencies, we find that it's incorrect to depend on
+ * PropertyLoads from obj as it hasn't completed its mutable range. Following
+ * the immutable / mutable-new typing system, we check the identity of obj to
+ * detect whether it was newly created (and thus mutable) in this render pass.
+ *
+ * HIR with scopes looks like this.
+ * bb0:
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  scopeTerminal deps=[obj@0] block=bb1 fallt=bb2
+ * bb1:
+ *  $3@1  = Array[$2]
+ *  goto bb2
+ * bb2:
+ *  ...
+ *
+ * This is surprising as deps now is entirely decoupled from temporaries used
+ * by the block itself. scope @1's instructions now reference a value (1)
+ * produced outside its scope range and (2) not represented in its dependencies
+ *
+ * The right thing to do is to ensure that all Loads from a value get assigned
+ * the value's reactive scope. This also requires track mutating and aliasing
+ * separately from scope range. In this example, that would correctly merge
+ * the scopes of $3 with obj.
+ * Runtime validation and optimizations such as ReactiveGraph-based reordering
+ * require this as well.
+ *
+ * A tempting fix is to instead extend $3's ReactiveScope range up to include
+ * $2 (the PropertyLoad). This fixes dependency deduping but not reordering
+ * and mutability.
+ */
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+  const aliasedObj = identity(obj);
+
+  // [obj.id] currently is assigned its own reactive scope
+  const id = [obj.id];
+
+  // Writing to the alias may reassign to previously captured references.
+  // The compiler currently produces valid output, but this breaks with
+  // reordering, recycleInto, and other potential optimizations.
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  return <Stringify id={id} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md
index 37a510b8c290a..3584faf699f86 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md
@@ -44,48 +44,44 @@ import { c as _c } from "react/compiler-runtime"; // @validateRefAccessDuringRen
 import { useEffect, useRef, useState } from "react";
 
 function Component() {
-  const $ = _c(6);
+  const $ = _c(5);
   const ref = useRef(null);
   const [state, setState] = useState(false);
   let t0;
-  let t1;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    t0 = () => {};
-
-    t1 = [];
+    t0 = [];
     $[0] = t0;
-    $[1] = t1;
   } else {
     t0 = $[0];
-    t1 = $[1];
   }
-  useEffect(t0, t1);
+  useEffect(_temp, t0);
+  let t1;
   let t2;
-  let t3;
-  if ($[2] === Symbol.for("react.memo_cache_sentinel")) {
-    t2 = () => {
+  if ($[1] === Symbol.for("react.memo_cache_sentinel")) {
+    t1 = () => {
       setState(true);
     };
-    t3 = [];
+    t2 = [];
+    $[1] = t1;
     $[2] = t2;
-    $[3] = t3;
   } else {
+    t1 = $[1];
     t2 = $[2];
-    t3 = $[3];
   }
-  useEffect(t2, t3);
+  useEffect(t1, t2);
 
-  const t4 = String(state);
-  let t5;
-  if ($[4] !== t4) {
-    t5 = <Child key={t4} ref={ref} />;
+  const t3 = String(state);
+  let t4;
+  if ($[3] !== t3) {
+    t4 = <Child key={t3} ref={ref} />;
+    $[3] = t3;
     $[4] = t4;
-    $[5] = t5;
   } else {
-    t5 = $[5];
+    t4 = $[4];
   }
-  return t5;
+  return t4;
 }
+function _temp() {}
 
 function Child(t0) {
   const { ref } = t0;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md
index c071d5d20ed99..6836544c5d337 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md
@@ -27,7 +27,6 @@ export const FIXTURE_ENTRYPOINT = {
 import { c as _c } from "react/compiler-runtime";
 function component(a, b) {
   const $ = _c(2);
-  const y = { b };
   let z;
   if ($[0] !== a) {
     z = { a };
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md
index aa32b3260ef50..14bf94e770a6b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md
@@ -31,12 +31,20 @@ export const FIXTURE_ENTRYPOINT = {
 ```javascript
 import { c as _c } from "react/compiler-runtime";
 function Component(t0) {
-  const $ = _c(3);
+  const $ = _c(5);
   const { a, b } = t0;
   let z;
   if ($[0] !== a || $[1] !== b) {
     z = { a };
-    const y = { b };
+    let t1;
+    if ($[3] !== b) {
+      t1 = { b };
+      $[3] = b;
+      $[4] = t1;
+    } else {
+      t1 = $[4];
+    }
+    const y = t1;
     const x = function () {
       z.a = 2;
       return Math.max(y.b, 0);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md
index 1b91bc1a11275..a071dddba6b4c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md
@@ -34,7 +34,6 @@ function component(a) {
     const x = { a };
     y = {};
 
-    y;
     y = x;
 
     mutate(y);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md
index f4721a507f31f..2afc5fd25dbac 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md
@@ -31,7 +31,6 @@ function bar(a) {
     const x = [a];
     y = {};
 
-    y;
     y = x[0][1];
     $[0] = a;
     $[1] = y;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md
index 5c0be290a6930..3e57b7dc7c255 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md
@@ -37,8 +37,6 @@ function bar(a, b) {
     let t;
     t = {};
 
-    y;
-    t;
     y = x[0][1];
     t = x[1][0];
     $[0] = a;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md
index 34b927d91e5f7..22728aaf4323d 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md
@@ -31,7 +31,6 @@ function bar(a) {
     const x = [a];
     y = {};
 
-    y;
     y = x[0].a[1];
     $[0] = a;
     $[1] = y;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md
index 0978be54acb46..60f829cdc4d66 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md
@@ -30,7 +30,6 @@ function bar(a) {
     const x = [a];
     y = {};
 
-    y;
     y = x[0];
     $[0] = a;
     $[1] = y;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
index 1bdc1c09a3483..299aa5a31dff2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
@@ -25,7 +25,6 @@ function component(a) {
     const x = { a };
     y = 1;
 
-    y;
     y = x;
 
     mutate(y);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md
index d17c934b3b42c..cf85967682607 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md
@@ -38,9 +38,8 @@ function useTest() {
 
     const t1 = (w = 42);
     const t2 = w;
-
-    w;
     let t3;
+
     w = 999;
     t3 = 2;
     t0 = makeArray(t1, t2, t3);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md
index e42ea8ce933b8..04b6c4f17f41a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md
@@ -19,10 +19,10 @@ function foo() {
 import { c as _c } from "react/compiler-runtime";
 function foo() {
   const $ = _c(1);
+
+  const getJSX = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const getJSX = () => <Child x={GLOBAL_IS_X} />;
-
     t0 = getJSX();
     $[0] = t0;
   } else {
@@ -31,6 +31,9 @@ function foo() {
   const result = t0;
   return result;
 }
+function _temp() {
+  return <Child x={GLOBAL_IS_X} />;
+}
 
 ```
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md
index 6686c0b5301bf..60fe0808d922a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md
@@ -23,13 +23,14 @@ export const FIXTURE_ENTRYPOINT = {
 
 ```javascript
 function foo() {
-  const f = () => {
-    console.log(42);
-  };
+  const f = _temp;
 
   f();
   return 42;
 }
+function _temp() {
+  console.log(42);
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: foo,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
index 8ea2190480003..8822eddcdb69f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
@@ -18,12 +18,10 @@ function Component(props) {
 import { c as _c } from "react/compiler-runtime";
 function Component(props) {
   const $ = _c(1);
+
+  const onEvent = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const onEvent = () => {
-      console.log(42);
-    };
-
     t0 = <Foo onEvent={onEvent} />;
     $[0] = t0;
   } else {
@@ -31,6 +29,9 @@ function Component(props) {
   }
   return t0;
 }
+function _temp() {
+  console.log(42);
+}
 
 ```
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md
index 3dc0dba27c364..da3bb94ed5ed4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md
@@ -34,9 +34,8 @@ function Component(props) {
   let Component;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
     Component = Stringify;
-
-    Component;
     let t0;
+
     t0 = Component;
     Component = t0;
     $[0] = Component;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md
index 2045ee7901e96..1ba0d59e17265 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md
@@ -24,13 +24,17 @@ export const FIXTURE_ENTRYPOINT = {
 ## Error
 
 ```
+   4 |   }
    5 |   return baz(); // OK: FuncDecls are HoistableDeclarations that have both declaration and value hoisting
-   6 |   function baz() {
+>  6 |   function baz() {
+     |   ^^^^^^^^^^^^^^^^
 >  7 |     return bar();
-     |            ^^^ Todo: Support functions with unreachable code that may contain hoisted declarations (7:7)
-   8 |   }
+     | ^^^^^^^^^^^^^^^^^
+>  8 |   }
+     | ^^^^ Todo: Support functions with unreachable code that may contain hoisted declarations (6:8)
    9 | }
   10 |
+  11 | export const FIXTURE_ENTRYPOINT = {
 ```
           
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md
new file mode 100644
index 0000000000000..7babe57b000e2
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md
@@ -0,0 +1,41 @@
+
+## Input
+
+```javascript
+// @enableTransitivelyFreezeFunctionExpressions
+import {setPropertyByKey, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    setPropertyByKey(x, 'value', count);
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
+
+```
+
+
+## Error
+
+```
+  11 |   });
+  12 |
+> 13 |   x.value += count;
+     |   ^ InvalidReact: This mutates a variable that React considers immutable (13:13)
+  14 |   return <Stringify x={x} cb={cb} />;
+  15 | }
+  16 |
+```
+          
+      
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx
new file mode 100644
index 0000000000000..b71626a435b78
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx
@@ -0,0 +1,20 @@
+// @enableTransitivelyFreezeFunctionExpressions
+import {setPropertyByKey, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    setPropertyByKey(x, 'value', count);
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md
new file mode 100644
index 0000000000000..fcc47ddc2b14f
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md
@@ -0,0 +1,41 @@
+
+## Input
+
+```javascript
+// @enableTransitivelyFreezeFunctionExpressions
+import {mutate, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    x.value++;
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
+
+```
+
+
+## Error
+
+```
+  11 |   });
+  12 |
+> 13 |   x.value += count;
+     |   ^ InvalidReact: This mutates a variable that React considers immutable (13:13)
+  14 |   return <Stringify x={x} cb={cb} />;
+  15 | }
+  16 |
+```
+          
+      
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx
new file mode 100644
index 0000000000000..2a94559c1f026
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx
@@ -0,0 +1,20 @@
+// @enableTransitivelyFreezeFunctionExpressions
+import {mutate, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    x.value++;
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md
index db3a192eaf604..f66b970f00dd4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md
@@ -22,7 +22,7 @@ function Component(props) {
    7 |     return hasErrors;
    8 |   }
 >  9 |   return hasErrors();
-     |          ^^^^^^^^^ Invariant: [hoisting] Expected value for identifier to be initialized. hasErrors_0$16 (9:9)
+     |          ^^^^^^^^^ Invariant: [hoisting] Expected value for identifier to be initialized. hasErrors_0$14 (9:9)
   10 | }
   11 |
 ```
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md
new file mode 100644
index 0000000000000..55cab1e9f3bd1
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md
@@ -0,0 +1,81 @@
+
+## Input
+
+```javascript
+// @validatePreserveExistingMemoizationGuarantees
+function useFoo() {
+  const onClick = response => {
+    setState(DISABLED_FORM);
+  };
+
+  const [state, setState] = useState();
+  const handleLogout = useCallback(() => {
+    setState(DISABLED_FORM);
+  }, [setState]);
+  const getComponent = () => {
+    return <ColumnItem onPress={() => handleLogout()} />;
+  };
+
+  // this `getComponent` call should not be inferred as mutating setState
+  return [getComponent(), onClick]; // pass onClick to avoid dce
+}
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime"; // @validatePreserveExistingMemoizationGuarantees
+function useFoo() {
+  const $ = _c(9);
+  const onClick = (response) => {
+    setState(DISABLED_FORM);
+  };
+
+  const [, t0] = useState();
+  const setState = t0;
+  let t1;
+  if ($[0] !== setState) {
+    t1 = () => {
+      setState(DISABLED_FORM);
+    };
+    $[0] = setState;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  setState;
+  const handleLogout = t1;
+  let t2;
+  if ($[2] !== handleLogout) {
+    t2 = () => <ColumnItem onPress={() => handleLogout()} />;
+    $[2] = handleLogout;
+    $[3] = t2;
+  } else {
+    t2 = $[3];
+  }
+  const getComponent = t2;
+  let t3;
+  if ($[4] !== getComponent) {
+    t3 = getComponent();
+    $[4] = getComponent;
+    $[5] = t3;
+  } else {
+    t3 = $[5];
+  }
+  let t4;
+  if ($[6] !== onClick || $[7] !== t3) {
+    t4 = [t3, onClick];
+    $[6] = onClick;
+    $[7] = t3;
+    $[8] = t4;
+  } else {
+    t4 = $[8];
+  }
+  return t4;
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js
new file mode 100644
index 0000000000000..4a44679390a80
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js
@@ -0,0 +1,17 @@
+// @validatePreserveExistingMemoizationGuarantees
+function useFoo() {
+  const onClick = response => {
+    setState(DISABLED_FORM);
+  };
+
+  const [state, setState] = useState();
+  const handleLogout = useCallback(() => {
+    setState(DISABLED_FORM);
+  }, [setState]);
+  const getComponent = () => {
+    return <ColumnItem onPress={() => handleLogout()} />;
+  };
+
+  // this `getComponent` call should not be inferred as mutating setState
+  return [getComponent(), onClick]; // pass onClick to avoid dce
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md
new file mode 100644
index 0000000000000..483d9b1a8e2da
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md
@@ -0,0 +1,77 @@
+
+## Input
+
+```javascript
+import {useEffect, useState} from 'react';
+import {Stringify} from 'shared-runtime';
+
+function Foo() {
+  /**
+   * Previously, this lowered to
+   * $1 = LoadContext capture setState
+   * $2 = FunctionExpression deps=$1 context=setState
+   *  [[ at this point, we freeze the `LoadContext setState` instruction, but it will never be referenced again ]]
+   *
+   * Now, this function expression directly references `setState`, which freezes
+   * the source `DeclareContext HoistedConst setState`. Freezing source identifiers
+   * (instead of the one level removed `LoadContext`) is more semantically correct
+   * for everything *other* than hoisted context declarations.
+   *
+   * $2 = Function context=setState
+   */
+  useEffect(() => setState(2), []);
+
+  const [state, setState] = useState(0);
+  return <Stringify state={state} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import { useEffect, useState } from "react";
+import { Stringify } from "shared-runtime";
+
+function Foo() {
+  const $ = _c(3);
+  let t0;
+  if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
+    t0 = [];
+    $[0] = t0;
+  } else {
+    t0 = $[0];
+  }
+  useEffect(() => setState(2), t0);
+
+  const [state, t1] = useState(0);
+  const setState = t1;
+  let t2;
+  if ($[1] !== state) {
+    t2 = <Stringify state={state} />;
+    $[1] = state;
+    $[2] = t2;
+  } else {
+    t2 = $[2];
+  }
+  return t2;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"state":2}</div>
+<div>{"state":2}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js
new file mode 100644
index 0000000000000..7b26c8d086491
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js
@@ -0,0 +1,28 @@
+import {useEffect, useState} from 'react';
+import {Stringify} from 'shared-runtime';
+
+function Foo() {
+  /**
+   * Previously, this lowered to
+   * $1 = LoadContext capture setState
+   * $2 = FunctionExpression deps=$1 context=setState
+   *  [[ at this point, we freeze the `LoadContext setState` instruction, but it will never be referenced again ]]
+   *
+   * Now, this function expression directly references `setState`, which freezes
+   * the source `DeclareContext HoistedConst setState`. Freezing source identifiers
+   * (instead of the one level removed `LoadContext`) is more semantically correct
+   * for everything *other* than hoisted context declarations.
+   *
+   * $2 = Function context=setState
+   */
+  useEffect(() => setState(2), []);
+
+  const [state, setState] = useState(0);
+  return <Stringify state={state} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md
new file mode 100644
index 0000000000000..957919516d09d
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md
@@ -0,0 +1,87 @@
+
+## Input
+
+```javascript
+import {useIdentity, Stringify, identity} from 'shared-runtime';
+
+function Foo({val1}) {
+  // `x={inner: val1}` should be able to be memoized
+  const x = {inner: val1};
+
+  // Any references to `x` after this hook call should be read-only
+  const cb = useIdentity(() => x.inner);
+
+  // With enableTransitivelyFreezeFunctionExpressions, it's invalid
+  // to write to `x` after it's been frozen.
+  // TODO: runtime validation for DX
+  const copy = identity(x);
+  return <Stringify copy={copy} cb={cb} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{val1: 1}],
+  sequentialRenders: [{val1: 1}, {val1: 1}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import { useIdentity, Stringify, identity } from "shared-runtime";
+
+function Foo(t0) {
+  const $ = _c(9);
+  const { val1 } = t0;
+  let t1;
+  if ($[0] !== val1) {
+    t1 = { inner: val1 };
+    $[0] = val1;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  const x = t1;
+  let t2;
+  if ($[2] !== x.inner) {
+    t2 = () => x.inner;
+    $[2] = x.inner;
+    $[3] = t2;
+  } else {
+    t2 = $[3];
+  }
+  const cb = useIdentity(t2);
+  let t3;
+  if ($[4] !== x) {
+    t3 = identity(x);
+    $[4] = x;
+    $[5] = t3;
+  } else {
+    t3 = $[5];
+  }
+  const copy = t3;
+  let t4;
+  if ($[6] !== cb || $[7] !== copy) {
+    t4 = <Stringify copy={copy} cb={cb} shouldInvokeFns={true} />;
+    $[6] = cb;
+    $[7] = copy;
+    $[8] = t4;
+  } else {
+    t4 = $[8];
+  }
+  return t4;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{ val1: 1 }],
+  sequentialRenders: [{ val1: 1 }, { val1: 1 }],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"copy":{"inner":1},"cb":{"kind":"Function","result":1},"shouldInvokeFns":true}</div>
+<div>{"copy":{"inner":1},"cb":{"kind":"Function","result":1},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx
new file mode 100644
index 0000000000000..68e8e034379e1
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx
@@ -0,0 +1,21 @@
+import {useIdentity, Stringify, identity} from 'shared-runtime';
+
+function Foo({val1}) {
+  // `x={inner: val1}` should be able to be memoized
+  const x = {inner: val1};
+
+  // Any references to `x` after this hook call should be read-only
+  const cb = useIdentity(() => x.inner);
+
+  // With enableTransitivelyFreezeFunctionExpressions, it's invalid
+  // to write to `x` after it's been frozen.
+  // TODO: runtime validation for DX
+  const copy = identity(x);
+  return <Stringify copy={copy} cb={cb} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{val1: 1}],
+  sequentialRenders: [{val1: 1}, {val1: 1}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md
index 74e01a72d52ba..a7d27bc38193f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md
@@ -25,10 +25,10 @@ import { c as _c } from "react/compiler-runtime";
 import { Stringify } from "shared-runtime";
 function useFoo() {
   const $ = _c(1);
+
+  const callback = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const callback = () => <Stringify value={4} />;
-
     t0 = callback();
     $[0] = t0;
   } else {
@@ -36,6 +36,9 @@ function useFoo() {
   }
   return t0;
 }
+function _temp() {
+  return <Stringify value={4} />;
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: useFoo,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md
index 22fa3b2e2a2e3..e5ead2479dd40 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md
@@ -25,10 +25,10 @@ import { c as _c } from "react/compiler-runtime";
 import * as SharedRuntime from "shared-runtime";
 function useFoo() {
   const $ = _c(1);
+
+  const callback = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const callback = () => <SharedRuntime.Text value={4} />;
-
     t0 = callback();
     $[0] = t0;
   } else {
@@ -36,6 +36,9 @@ function useFoo() {
   }
   return t0;
 }
+function _temp() {
+  return <SharedRuntime.Text value={4} />;
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: useFoo,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md
index d34db46d6aa28..ed0ddda55b32f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md
@@ -26,7 +26,6 @@ function f(a) {
   const $ = _c(4);
   let x;
   if ($[0] !== a) {
-    x;
     x = { a };
     $[0] = a;
     $[1] = x;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md
index 2aa5d4d06dfb6..8dc4839085ee5 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md
@@ -27,7 +27,6 @@ function f(a) {
   const $ = _c(2);
   let x;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    x;
     x = {};
     $[0] = x;
   } else {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md
index 13ba6d17986bb..3c624de9ebe57 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md
@@ -31,7 +31,7 @@ function Component(props) {
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
     t0 = (e) => {
-      setX((currentX) => currentX + null);
+      setX(_temp);
     };
     $[0] = t0;
   } else {
@@ -48,6 +48,9 @@ function Component(props) {
   }
   return t1;
 }
+function _temp(currentX) {
+  return currentX + null;
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: Component,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md
index e8a3e2d627c59..3fffec6a7dc20 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md
@@ -35,7 +35,6 @@ function useFoo(arr1, arr2) {
   if ($[0] !== arr1 || $[1] !== arr2) {
     const x = [arr1];
 
-    y;
     (y = x.concat(arr2)), y;
     $[0] = arr1;
     $[1] = arr2;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md
index 2e451d8948988..0c66dee6a85b1 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md
@@ -22,26 +22,21 @@ function Component() {
 ## Code
 
 ```javascript
-import { c as _c } from "react/compiler-runtime";
 function Component() {
-  const $ = _c(1);
-  let t0;
-  if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    t0 = () => {
-      while (bar()) {
-        if (baz) {
-          bar();
-        }
-      }
-      return () => 4;
-    };
-    $[0] = t0;
-  } else {
-    t0 = $[0];
-  }
-  const get4 = t0;
+  const get4 = _temp2;
   return get4;
 }
+function _temp2() {
+  while (bar()) {
+    if (baz) {
+      bar();
+    }
+  }
+  return _temp;
+}
+function _temp() {
+  return 4;
+}
 
 ```
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md
index e335273026791..6ad460347fa50 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md
@@ -85,7 +85,6 @@ function Inner(props) {
     input = use(FooContext);
   }
 
-  input;
   input;
   let t0;
   let t1;

From a92acdb188990b2b64130d74ccd6437dc9db1901 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:37:21 -0700
Subject: [PATCH 38/73] [compiler] Remove redundant
 InferMutableContextVariables (#32097)

This removes special casing for `PropertyStore` mutability inference
within FunctionExpressions.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32097).
* #32287
* #32104
* #32098
* __->__ #32097
---
 .../src/Inference/AnalyseFunctions.ts         |  27 +----
 .../Inference/InferMutableContextVariables.ts | 105 ------------------
 ...mutate-global-in-effect-fixpoint.expect.md |  66 ++++++-----
 .../allow-mutate-global-in-effect-fixpoint.js |   7 +-
 .../reanimated-shared-value-writes.expect.md  |  23 ++--
 5 files changed, 54 insertions(+), 174 deletions(-)
 delete mode 100644 compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
index 5381262874369..a439b4cd01232 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
@@ -10,7 +10,6 @@ import {
   Effect,
   HIRFunction,
   Identifier,
-  IdentifierId,
   LoweredFunction,
   isRefOrRefValue,
   makeInstructionId,
@@ -18,27 +17,9 @@ import {
 import {deadCodeElimination} from '../Optimization';
 import {inferReactiveScopeVariables} from '../ReactiveScopes';
 import {rewriteInstructionKindsBasedOnReassignment} from '../SSA';
-import {inferMutableContextVariables} from './InferMutableContextVariables';
 import {inferMutableRanges} from './InferMutableRanges';
 import inferReferenceEffects from './InferReferenceEffects';
 
-// Helper class to track indirections such as LoadLocal and PropertyLoad.
-export class IdentifierState {
-  properties: Map<IdentifierId, Identifier> = new Map();
-
-  resolve(identifier: Identifier): Identifier {
-    const resolved = this.properties.get(identifier.id);
-    if (resolved !== undefined) {
-      return resolved;
-    }
-    return identifier;
-  }
-
-  alias(lvalue: Identifier, value: Identifier): void {
-    this.properties.set(lvalue.id, this.properties.get(value.id) ?? value);
-  }
-}
-
 export default function analyseFunctions(func: HIRFunction): void {
   for (const [_, block] of func.body.blocks) {
     for (const instr of block.instructions) {
@@ -78,7 +59,6 @@ function lower(func: HIRFunction): void {
 }
 
 function infer(loweredFunc: LoweredFunction): void {
-  const knownMutated = inferMutableContextVariables(loweredFunc.func);
   for (const operand of loweredFunc.func.context) {
     const identifier = operand.identifier;
     CompilerError.invariant(operand.effect === Effect.Unknown, {
@@ -95,10 +75,11 @@ function infer(loweredFunc: LoweredFunction): void {
        * render
        */
       operand.effect = Effect.Capture;
-    } else if (knownMutated.has(operand)) {
-      operand.effect = Effect.Mutate;
     } else if (isMutatedOrReassigned(identifier)) {
-      // Note that this also reflects if identifier is ConditionallyMutated
+      /**
+       * Reflects direct reassignments, PropertyStores, and ConditionallyMutate
+       * (directly or through maybe-aliases)
+       */
       operand.effect = Effect.Capture;
     } else {
       operand.effect = Effect.Read;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
deleted file mode 100644
index 0025472721542..0000000000000
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
+++ /dev/null
@@ -1,105 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-import {Effect, HIRFunction, Identifier, Place} from '../HIR';
-import {
-  eachInstructionValueOperand,
-  eachTerminalOperand,
-} from '../HIR/visitors';
-import {IdentifierState} from './AnalyseFunctions';
-
-/*
- * This pass infers which of the given function's context (free) variables
- * are definitively mutated by the function. This analysis is *partial*,
- * and only annotates provable mutations, and may miss mutations via indirections.
- * The intent of this pass is to drive validations, rejecting known-bad code
- * while avoiding false negatives, and the inference should *not* be used to
- * drive changes in output.
- *
- * Note that a complete analysis is possible but would have too many false negatives.
- * The approach would be to run LeaveSSA and InferReactiveScopeVariables in order to
- * find all possible aliases of a context variable which may be mutated. However, this
- * can lead to false negatives:
- *
- * ```
- * const [x, setX] = useState(null); // x is frozen
- * const fn = () => { // context=[x]
- *    const z = {}; // z is mutable
- *    foo(z, x); // potentially mutate z and x
- *    z.a = true; // definitively mutate z
- * }
- * fn();
- * ```
- *
- * When we analyze function expressions we assume that context variables are mutable,
- * so we assume that `x` is mutable. We infer that `foo(z, x)` could be mutating the
- * two variables to alias each other, such that `z.a = true` could be mutating `x`,
- * and we would infer that `x` is definitively mutated. Then when we run
- * InferReferenceEffects on the outer code we'd reject it, since there is a definitive
- * mutation of a frozen value.
- *
- * Thus the actual implementation looks at only basic aliasing. The above example would
- * pass, since z does not directly alias `x`. However, mutations through trivial aliases
- * are detected:
- *
- * ```
- * const [x, setX] = useState(null); // x is frozen
- * const fn = () => { // context=[x]
- *    const z = x;
- *    z.a = true; // ERROR: mutates x
- * }
- * fn();
- * ```
- */
-export function inferMutableContextVariables(fn: HIRFunction): Set<Place> {
-  const state = new IdentifierState();
-  const knownMutatedIdentifiers = new Set<Identifier>();
-  for (const [, block] of fn.body.blocks) {
-    for (const instr of block.instructions) {
-      switch (instr.value.kind) {
-        case 'PropertyLoad':
-        case 'ComputedLoad': {
-          state.alias(instr.lvalue.identifier, instr.value.object.identifier);
-          break;
-        }
-        case 'LoadLocal':
-        case 'LoadContext': {
-          if (instr.lvalue.identifier.name === null) {
-            state.alias(instr.lvalue.identifier, instr.value.place.identifier);
-          }
-          break;
-        }
-        default: {
-          for (const operand of eachInstructionValueOperand(instr.value)) {
-            visitOperand(state, knownMutatedIdentifiers, operand);
-          }
-        }
-      }
-    }
-    for (const operand of eachTerminalOperand(block.terminal)) {
-      visitOperand(state, knownMutatedIdentifiers, operand);
-    }
-  }
-  const results = new Set<Place>();
-  for (const operand of fn.context) {
-    if (knownMutatedIdentifiers.has(operand.identifier)) {
-      results.add(operand);
-    }
-  }
-  return results;
-}
-
-function visitOperand(
-  state: IdentifierState,
-  knownMutatedIdentifiers: Set<Identifier>,
-  operand: Place,
-): void {
-  const resolved = state.resolve(operand.identifier);
-  if (operand.effect === Effect.Mutate || operand.effect === Effect.Store) {
-    knownMutatedIdentifiers.add(resolved);
-  }
-}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md
index 942daec1dd08c..76e4432fe90d9 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md
@@ -19,9 +19,14 @@ function Component() {
 
   // capture into a separate variable that is not a context variable.
   const y = x;
+  /**
+   * Note that this fixture currently produces a stale effect closure if `y = x
+   * = someGlobal` changes between renders. Under current compiler assumptions,
+   * that would be a rule of react violation.
+   */
   useEffect(() => {
     y.value = 'hello';
-  }, []);
+  });
 
   useEffect(() => {
     setState(someGlobal.value);
@@ -46,57 +51,50 @@ import { useEffect, useState } from "react";
 let someGlobal = { value: null };
 
 function Component() {
-  const $ = _c(7);
+  const $ = _c(5);
   const [state, setState] = useState(someGlobal);
+
+  let x = someGlobal;
+  while (x == null) {
+    x = someGlobal;
+  }
+
+  const y = x;
   let t0;
-  let t1;
-  let t2;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    let x = someGlobal;
-    while (x == null) {
-      x = someGlobal;
-    }
-
-    const y = x;
-    t0 = useEffect;
-    t1 = () => {
+    t0 = () => {
       y.value = "hello";
     };
-    t2 = [];
     $[0] = t0;
+  } else {
+    t0 = $[0];
+  }
+  useEffect(t0);
+  let t1;
+  let t2;
+  if ($[1] === Symbol.for("react.memo_cache_sentinel")) {
+    t1 = () => {
+      setState(someGlobal.value);
+    };
+    t2 = [someGlobal];
     $[1] = t1;
     $[2] = t2;
   } else {
-    t0 = $[0];
     t1 = $[1];
     t2 = $[2];
   }
-  t0(t1, t2);
-  let t3;
+  useEffect(t1, t2);
+
+  const t3 = String(state);
   let t4;
-  if ($[3] === Symbol.for("react.memo_cache_sentinel")) {
-    t3 = () => {
-      setState(someGlobal.value);
-    };
-    t4 = [someGlobal];
+  if ($[3] !== t3) {
+    t4 = <div>{t3}</div>;
     $[3] = t3;
     $[4] = t4;
   } else {
-    t3 = $[3];
     t4 = $[4];
   }
-  useEffect(t3, t4);
-
-  const t5 = String(state);
-  let t6;
-  if ($[5] !== t5) {
-    t6 = <div>{t5}</div>;
-    $[5] = t5;
-    $[6] = t6;
-  } else {
-    t6 = $[6];
-  }
-  return t6;
+  return t4;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js
index 84bd42aaefd18..6e44adf204101 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js
@@ -15,9 +15,14 @@ function Component() {
 
   // capture into a separate variable that is not a context variable.
   const y = x;
+  /**
+   * Note that this fixture currently produces a stale effect closure if `y = x
+   * = someGlobal` changes between renders. Under current compiler assumptions,
+   * that would be a rule of react violation.
+   */
   useEffect(() => {
     y.value = 'hello';
-  }, []);
+  });
 
   useEffect(() => {
     setState(someGlobal.value);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md
index 8f808c94b3043..0a19a85428939 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md
@@ -36,21 +36,22 @@ import { useSharedValue } from "react-native-reanimated";
  * of render
  */
 function SomeComponent() {
-  const $ = _c(3);
+  const $ = _c(2);
   const sharedVal = useSharedValue(0);
-
-  const T0 = Button;
-  const t0 = () => (sharedVal.value = Math.random());
-  let t1;
-  if ($[0] !== T0 || $[1] !== t0) {
-    t1 = <T0 onPress={t0} title="Randomize" />;
-    $[0] = T0;
+  let t0;
+  if ($[0] !== sharedVal) {
+    t0 = (
+      <Button
+        onPress={() => (sharedVal.value = Math.random())}
+        title="Randomize"
+      />
+    );
+    $[0] = sharedVal;
     $[1] = t0;
-    $[2] = t1;
   } else {
-    t1 = $[2];
+    t0 = $[1];
   }
-  return t1;
+  return t0;
 }
 
 ```

From 498514c04d824f88a9b77595c18c1323f4d1006f Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:37:34 -0700
Subject: [PATCH 39/73] [compiler] Clean up deadcode: ReactiveFunctionValue
 (#32098)

(title)
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32098).
* #32287
* #32104
* __->__ #32098
* #32097
---
 .../src/HIR/HIR.ts                            | 11 +-------
 .../src/HIR/PrintHIR.ts                       |  5 ----
 .../ReactiveScopes/CodegenReactiveFunction.ts |  1 -
 .../ReactiveScopes/PruneNonEscapingScopes.ts  |  8 ------
 .../src/ReactiveScopes/visitors.ts            | 25 -------------------
 .../ValidatePreservedManualMemoization.ts     |  7 ------
 6 files changed, 1 insertion(+), 56 deletions(-)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
index 4df6da6c1704c..e124caee7a23f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
@@ -108,16 +108,7 @@ export type ReactiveValue =
   | ReactiveLogicalValue
   | ReactiveSequenceValue
   | ReactiveTernaryValue
-  | ReactiveOptionalCallValue
-  | ReactiveFunctionValue;
-
-export type ReactiveFunctionValue = {
-  kind: 'ReactiveFunctionValue';
-  fn: ReactiveFunction;
-  dependencies: Array<Place>;
-  returnType: t.FlowType | t.TSType | null;
-  loc: SourceLocation;
-};
+  | ReactiveOptionalCallValue;
 
 export type ReactiveLogicalValue = {
   kind: 'LogicalExpression';
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
index 7a6586730f9c1..19d3f707b9199 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
@@ -6,7 +6,6 @@
  */
 
 import generate from '@babel/generator';
-import {printReactiveFunction} from '..';
 import {CompilerError} from '../CompilerError';
 import {printReactiveScopeSummary} from '../ReactiveScopes/PrintReactiveFunction';
 import DisjointSet from '../Utils/DisjointSet';
@@ -701,10 +700,6 @@ export function printInstructionValue(instrValue: ReactiveValue): string {
       value = `FinishMemoize decl=${printPlace(instrValue.decl)}`;
       break;
     }
-    case 'ReactiveFunctionValue': {
-      value = `FunctionValue ${printReactiveFunction(instrValue.fn)}`;
-      break;
-    }
     default: {
       assertExhaustive(
         instrValue,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
index cf40d86abc552..93b70bd7d1da3 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
@@ -2231,7 +2231,6 @@ function codegenInstructionValue(
       );
       break;
     }
-    case 'ReactiveFunctionValue':
     case 'StartMemoize':
     case 'FinishMemoize':
     case 'Debugger':
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts
index 5a9aa6b2a7368..441d529b39616 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts
@@ -772,14 +772,6 @@ function computeMemoizationInputs(
         rvalues: operands,
       };
     }
-    case 'ReactiveFunctionValue': {
-      CompilerError.invariant(false, {
-        reason: `Unexpected ReactiveFunctionValue node`,
-        description: null,
-        loc: value.loc,
-        suggestions: null,
-      });
-    }
     case 'UnsupportedNode': {
       CompilerError.invariant(false, {
         reason: `Unexpected unsupported node`,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts
index 487de2767a516..4ad05aa302ac1 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts
@@ -73,15 +73,6 @@ export class ReactiveFunctionVisitor<TState = void> {
         this.visitValue(value.id, value.value, state);
         break;
       }
-      case 'ReactiveFunctionValue': {
-        this.visitReactiveFunctionValue(
-          id,
-          value.dependencies,
-          value.fn,
-          state,
-        );
-        break;
-      }
       default: {
         for (const place of eachInstructionValueOperand(value)) {
           this.visitPlace(id, place, state);
@@ -434,18 +425,6 @@ export class ReactiveFunctionTransform<
         }
         break;
       }
-      case 'ReactiveFunctionValue': {
-        const nextValue = this.transformReactiveFunctionValue(
-          id,
-          value.dependencies,
-          value.fn,
-          state,
-        );
-        if (nextValue.kind === 'replace') {
-          value.fn = nextValue.value;
-        }
-        break;
-      }
       default: {
         for (const place of eachInstructionValueOperand(value)) {
           this.visitPlace(id, place, state);
@@ -619,10 +598,6 @@ export function* eachReactiveValueOperand(
       yield* eachReactiveValueOperand(instrValue.alternate);
       break;
     }
-    case 'ReactiveFunctionValue': {
-      yield* instrValue.dependencies;
-      break;
-    }
     default: {
       yield* eachInstructionValueOperand(instrValue);
     }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts
index e7615320c7b95..28be6c166d2e4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts
@@ -327,13 +327,6 @@ class Visitor extends ReactiveFunctionVisitor<VisitorState> {
       case 'OptionalExpression': {
         return this.recordDepsInValue(value.value, state);
       }
-      case 'ReactiveFunctionValue': {
-        CompilerError.throwTodo({
-          reason:
-            'Handle ReactiveFunctionValue in ValidatePreserveManualMemoization',
-          loc: value.loc,
-        });
-      }
       case 'ConditionalExpression': {
         this.recordDepsInValue(value.test, state);
         this.recordDepsInValue(value.consequent, state);

From 19cc5af41ead904100a55fd2a1cfb40b1380f4be Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:38:02 -0700
Subject: [PATCH 40/73] [compiler] Clean up deadcode: DeriveMinimalDeps
 (non-hir fork) (#32104)

(title)
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32104).
* #32287
* __->__ #32104
* #32098
* #32097
---
 .../src/HIR/DeriveMinimalDependenciesHIR.ts   |   3 +-
 .../DeriveMinimalDependencies.ts              | 639 ------------------
 2 files changed, 1 insertion(+), 641 deletions(-)
 delete mode 100644 compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
index f5567b3e536d1..07f44a59a26de 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
@@ -13,7 +13,6 @@ import {
   ReactiveScopeDependency,
 } from '../HIR';
 import {printIdentifier} from '../HIR/PrintHIR';
-import {ReactiveScopePropertyDependency} from '../ReactiveScopes/DeriveMinimalDependencies';
 
 /**
  * Simpler fork of DeriveMinimalDependencies, see PropagateScopeDependenciesHIR
@@ -91,7 +90,7 @@ export class ReactiveScopeDependencyTreeHIR {
    * dependency. This effectively truncates @param dep to its maximal
    * safe-to-evaluate subpath
    */
-  addDependency(dep: ReactiveScopePropertyDependency): void {
+  addDependency(dep: ReactiveScopeDependency): void {
     const {identifier, path} = dep;
     let depCursor = ReactiveScopeDependencyTreeHIR.#getOrCreateRoot(
       identifier,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts
deleted file mode 100644
index c7e16cce7ac86..0000000000000
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts
+++ /dev/null
@@ -1,639 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-import {CompilerError} from '../CompilerError';
-import {DependencyPath, Identifier, ReactiveScopeDependency} from '../HIR';
-import {printIdentifier} from '../HIR/PrintHIR';
-import {assertExhaustive} from '../Utils/utils';
-
-/*
- * We need to understand optional member expressions only when determining
- * dependencies of a ReactiveScope (i.e. in {@link PropagateScopeDependencies}),
- * hence why this type lives here (not in HIR.ts)
- */
-export type ReactiveScopePropertyDependency = ReactiveScopeDependency;
-
-/*
- * Finalizes a set of ReactiveScopeDependencies to produce a set of minimal unconditional
- * dependencies, preserving granular accesses when possible.
- *
- * Correctness properties:
- *   - All dependencies to a ReactiveBlock must be tracked.
- *     We can always truncate a dependency's path to a subpath, due to Forget assuming
- *     deep immutability. If the value produced by a subpath has not changed, then
- *     dependency must have not changed.
- *     i.e. props.a === $[..] implies props.a.b === $[..]
- *
- *     Note the inverse is not true, but this only means a false positive (we run the
- *     reactive block more than needed).
- *     i.e. props.a !== $[..] does not imply props.a.b !== $[..]
- *
- *   - The dependencies of a finalized ReactiveBlock must be all safe to access
- *     unconditionally (i.e. preserve program semantics with respect to nullthrows).
- *     If a dependency is only accessed within a conditional, we must track the nearest
- *     unconditionally accessed subpath instead.
- * @param initialDeps
- * @returns
- */
-export class ReactiveScopeDependencyTree {
-  #roots: Map<Identifier, DependencyNode> = new Map();
-
-  #getOrCreateRoot(identifier: Identifier): DependencyNode {
-    // roots can always be accessed unconditionally in JS
-    let rootNode = this.#roots.get(identifier);
-
-    if (rootNode === undefined) {
-      rootNode = {
-        properties: new Map(),
-        accessType: PropertyAccessType.UnconditionalAccess,
-      };
-      this.#roots.set(identifier, rootNode);
-    }
-    return rootNode;
-  }
-
-  add(dep: ReactiveScopePropertyDependency, inConditional: boolean): void {
-    const {path} = dep;
-    let currNode = this.#getOrCreateRoot(dep.identifier);
-
-    for (const item of path) {
-      // all properties read 'on the way' to a dependency are marked as 'access'
-      let currChild = getOrMakeProperty(currNode, item.property);
-      const accessType = inConditional
-        ? PropertyAccessType.ConditionalAccess
-        : item.optional
-          ? PropertyAccessType.OptionalAccess
-          : PropertyAccessType.UnconditionalAccess;
-      currChild.accessType = merge(currChild.accessType, accessType);
-      currNode = currChild;
-    }
-
-    /**
-     * The final property node should be marked as an conditional/unconditional
-     * `dependency` as based on control flow.
-     */
-    const depType = inConditional
-      ? PropertyAccessType.ConditionalDependency
-      : isOptional(currNode.accessType)
-        ? PropertyAccessType.OptionalDependency
-        : PropertyAccessType.UnconditionalDependency;
-
-    currNode.accessType = merge(currNode.accessType, depType);
-  }
-
-  deriveMinimalDependencies(): Set<ReactiveScopeDependency> {
-    const results = new Set<ReactiveScopeDependency>();
-    for (const [rootId, rootNode] of this.#roots.entries()) {
-      const deps = deriveMinimalDependenciesInSubtree(rootNode, null);
-      CompilerError.invariant(
-        deps.every(
-          dep =>
-            dep.accessType === PropertyAccessType.UnconditionalDependency ||
-            dep.accessType == PropertyAccessType.OptionalDependency,
-        ),
-        {
-          reason:
-            '[PropagateScopeDependencies] All dependencies must be reduced to unconditional dependencies.',
-          description: null,
-          loc: null,
-          suggestions: null,
-        },
-      );
-
-      for (const dep of deps) {
-        results.add({
-          identifier: rootId,
-          path: dep.relativePath,
-        });
-      }
-    }
-
-    return results;
-  }
-
-  addDepsFromInnerScope(
-    depsFromInnerScope: ReactiveScopeDependencyTree,
-    innerScopeInConditionalWithinParent: boolean,
-    checkValidDepIdFn: (dep: ReactiveScopeDependency) => boolean,
-  ): void {
-    for (const [id, otherRoot] of depsFromInnerScope.#roots) {
-      if (!checkValidDepIdFn({identifier: id, path: []})) {
-        continue;
-      }
-      let currRoot = this.#getOrCreateRoot(id);
-      addSubtree(currRoot, otherRoot, innerScopeInConditionalWithinParent);
-      if (!isUnconditional(currRoot.accessType)) {
-        currRoot.accessType = isDependency(currRoot.accessType)
-          ? PropertyAccessType.UnconditionalDependency
-          : PropertyAccessType.UnconditionalAccess;
-      }
-    }
-  }
-
-  promoteDepsFromExhaustiveConditionals(
-    trees: Array<ReactiveScopeDependencyTree>,
-  ): void {
-    CompilerError.invariant(trees.length > 1, {
-      reason: 'Expected trees to be at least 2 elements long.',
-      description: null,
-      loc: null,
-      suggestions: null,
-    });
-
-    for (const [id, root] of this.#roots) {
-      const nodesForRootId = mapNonNull(trees, tree => {
-        const node = tree.#roots.get(id);
-        if (node != null && isUnconditional(node.accessType)) {
-          return node;
-        } else {
-          return null;
-        }
-      });
-      if (nodesForRootId) {
-        addSubtreeIntersection(
-          root.properties,
-          nodesForRootId.map(root => root.properties),
-        );
-      }
-    }
-  }
-
-  /*
-   * Prints dependency tree to string for debugging.
-   * @param includeAccesses
-   * @returns string representation of DependencyTree
-   */
-  printDeps(includeAccesses: boolean): string {
-    let res = [];
-
-    for (const [rootId, rootNode] of this.#roots.entries()) {
-      const rootResults = printSubtree(rootNode, includeAccesses).map(
-        result => `${printIdentifier(rootId)}.${result}`,
-      );
-      res.push(rootResults);
-    }
-    return res.flat().join('\n');
-  }
-
-  debug(): string {
-    const buf: Array<string> = [`tree() [`];
-    for (const [rootId, rootNode] of this.#roots) {
-      buf.push(`${printIdentifier(rootId)} (${rootNode.accessType}):`);
-      this.#debugImpl(buf, rootNode, 1);
-    }
-    buf.push(']');
-    return buf.length > 2 ? buf.join('\n') : buf.join('');
-  }
-
-  #debugImpl(
-    buf: Array<string>,
-    node: DependencyNode,
-    depth: number = 0,
-  ): void {
-    for (const [property, childNode] of node.properties) {
-      buf.push(`${'  '.repeat(depth)}.${property} (${childNode.accessType}):`);
-      this.#debugImpl(buf, childNode, depth + 1);
-    }
-  }
-}
-
-/*
- * Enum representing the access type of single property on a parent object.
- * We distinguish on two independent axes:
- * Conditional / Unconditional:
- *    - whether this property is accessed unconditionally (within the ReactiveBlock)
- * Access / Dependency:
- *    - Access: this property is read on the path of a dependency. We do not
- *      need to track change variables for accessed properties. Tracking accesses
- *      helps Forget do more granular dependency tracking.
- *    - Dependency: this property is read as a dependency and we must track changes
- *      to it for correctness.
- *
- *    ```javascript
- *    // props.a is a dependency here and must be tracked
- *    deps: {props.a, props.a.b} ---> minimalDeps: {props.a}
- *    // props.a is just an access here and does not need to be tracked
- *    deps: {props.a.b} ---> minimalDeps: {props.a.b}
- *    ```
- */
-enum PropertyAccessType {
-  ConditionalAccess = 'ConditionalAccess',
-  OptionalAccess = 'OptionalAccess',
-  UnconditionalAccess = 'UnconditionalAccess',
-  ConditionalDependency = 'ConditionalDependency',
-  OptionalDependency = 'OptionalDependency',
-  UnconditionalDependency = 'UnconditionalDependency',
-}
-
-const MIN_ACCESS_TYPE = PropertyAccessType.ConditionalAccess;
-function isUnconditional(access: PropertyAccessType): boolean {
-  return (
-    access === PropertyAccessType.UnconditionalAccess ||
-    access === PropertyAccessType.UnconditionalDependency
-  );
-}
-function isDependency(access: PropertyAccessType): boolean {
-  return (
-    access === PropertyAccessType.ConditionalDependency ||
-    access === PropertyAccessType.OptionalDependency ||
-    access === PropertyAccessType.UnconditionalDependency
-  );
-}
-function isOptional(access: PropertyAccessType): boolean {
-  return (
-    access === PropertyAccessType.OptionalAccess ||
-    access === PropertyAccessType.OptionalDependency
-  );
-}
-
-function merge(
-  access1: PropertyAccessType,
-  access2: PropertyAccessType,
-): PropertyAccessType {
-  const resultIsUnconditional =
-    isUnconditional(access1) || isUnconditional(access2);
-  const resultIsDependency = isDependency(access1) || isDependency(access2);
-  const resultIsOptional = isOptional(access1) || isOptional(access2);
-
-  /*
-   * Straightforward merge.
-   * This can be represented as bitwise OR, but is written out for readability
-   *
-   * Observe that `UnconditionalAccess | ConditionalDependency` produces an
-   * unconditionally accessed conditional dependency. We currently use these
-   * as we use unconditional dependencies. (i.e. to codegen change variables)
-   */
-  if (resultIsUnconditional) {
-    if (resultIsDependency) {
-      return PropertyAccessType.UnconditionalDependency;
-    } else {
-      return PropertyAccessType.UnconditionalAccess;
-    }
-  } else if (resultIsOptional) {
-    if (resultIsDependency) {
-      return PropertyAccessType.OptionalDependency;
-    } else {
-      return PropertyAccessType.OptionalAccess;
-    }
-  } else {
-    if (resultIsDependency) {
-      return PropertyAccessType.ConditionalDependency;
-    } else {
-      return PropertyAccessType.ConditionalAccess;
-    }
-  }
-}
-
-type DependencyNode = {
-  properties: Map<string, DependencyNode>;
-  accessType: PropertyAccessType;
-};
-
-type ReduceResultNode = {
-  relativePath: DependencyPath;
-  accessType: PropertyAccessType;
-};
-
-function promoteResult(
-  accessType: PropertyAccessType,
-  path: {property: string; optional: boolean} | null,
-): Array<ReduceResultNode> {
-  const result: ReduceResultNode = {
-    relativePath: [],
-    accessType,
-  };
-  if (path !== null) {
-    result.relativePath.push(path);
-  }
-  return [result];
-}
-
-function prependPath(
-  results: Array<ReduceResultNode>,
-  path: {property: string; optional: boolean} | null,
-): Array<ReduceResultNode> {
-  if (path === null) {
-    return results;
-  }
-  return results.map(result => {
-    return {
-      accessType: result.accessType,
-      relativePath: [path, ...result.relativePath],
-    };
-  });
-}
-
-/*
- * Recursively calculates minimal dependencies in a subtree.
- * @param dep DependencyNode representing a dependency subtree.
- * @returns a minimal list of dependencies in this subtree.
- */
-function deriveMinimalDependenciesInSubtree(
-  dep: DependencyNode,
-  property: string | null,
-): Array<ReduceResultNode> {
-  const results: Array<ReduceResultNode> = [];
-  for (const [childName, childNode] of dep.properties) {
-    const childResult = deriveMinimalDependenciesInSubtree(
-      childNode,
-      childName,
-    );
-    results.push(...childResult);
-  }
-
-  switch (dep.accessType) {
-    case PropertyAccessType.UnconditionalDependency: {
-      return promoteResult(
-        PropertyAccessType.UnconditionalDependency,
-        property !== null ? {property, optional: false} : null,
-      );
-    }
-    case PropertyAccessType.UnconditionalAccess: {
-      if (
-        results.every(
-          ({accessType}) =>
-            accessType === PropertyAccessType.UnconditionalDependency ||
-            accessType === PropertyAccessType.OptionalDependency,
-        )
-      ) {
-        // all children are unconditional dependencies, return them to preserve granularity
-        return prependPath(
-          results,
-          property !== null ? {property, optional: false} : null,
-        );
-      } else {
-        /*
-         * at least one child is accessed conditionally, so this node needs to be promoted to
-         * unconditional dependency
-         */
-        return promoteResult(
-          PropertyAccessType.UnconditionalDependency,
-          property !== null ? {property, optional: false} : null,
-        );
-      }
-    }
-    case PropertyAccessType.OptionalDependency: {
-      return promoteResult(
-        PropertyAccessType.OptionalDependency,
-        property !== null ? {property, optional: true} : null,
-      );
-    }
-    case PropertyAccessType.OptionalAccess: {
-      if (
-        results.every(
-          ({accessType}) =>
-            accessType === PropertyAccessType.UnconditionalDependency ||
-            accessType === PropertyAccessType.OptionalDependency,
-        )
-      ) {
-        // all children are unconditional dependencies, return them to preserve granularity
-        return prependPath(
-          results,
-          property !== null ? {property, optional: true} : null,
-        );
-      } else {
-        /*
-         * at least one child is accessed conditionally, so this node needs to be promoted to
-         * unconditional dependency
-         */
-        return promoteResult(
-          PropertyAccessType.OptionalDependency,
-          property !== null ? {property, optional: true} : null,
-        );
-      }
-    }
-    case PropertyAccessType.ConditionalAccess:
-    case PropertyAccessType.ConditionalDependency: {
-      if (
-        results.every(
-          ({accessType}) =>
-            accessType === PropertyAccessType.ConditionalDependency,
-        )
-      ) {
-        /*
-         * No children are accessed unconditionally, so we cannot promote this node to
-         * unconditional access.
-         * Truncate results of child nodes here, since we shouldn't access them anyways
-         */
-        return promoteResult(
-          PropertyAccessType.ConditionalDependency,
-          property !== null ? {property, optional: true} : null,
-        );
-      } else {
-        /*
-         * at least one child is accessed unconditionally, so this node can be promoted to
-         * unconditional dependency
-         */
-        return promoteResult(
-          PropertyAccessType.UnconditionalDependency,
-          property !== null ? {property, optional: true} : null,
-        );
-      }
-    }
-    default: {
-      assertExhaustive(
-        dep.accessType,
-        '[PropgateScopeDependencies] Unhandled access type!',
-      );
-    }
-  }
-}
-
-/*
- * Demote all unconditional accesses + dependencies in subtree to the
- * conditional equivalent, mutating subtree in place.
- * @param subtree unconditional node representing a subtree of dependencies
- */
-function demoteSubtreeToConditional(subtree: DependencyNode): void {
-  const stack: Array<DependencyNode> = [subtree];
-
-  let node;
-  while ((node = stack.pop()) !== undefined) {
-    const {accessType, properties} = node;
-    if (!isUnconditional(accessType)) {
-      // A conditionally accessed node should not have unconditional children
-      continue;
-    }
-    node.accessType = isDependency(accessType)
-      ? PropertyAccessType.ConditionalDependency
-      : PropertyAccessType.ConditionalAccess;
-
-    for (const childNode of properties.values()) {
-      if (isUnconditional(accessType)) {
-        /*
-         * No conditional node can have an unconditional node as a child, so
-         * we only process childNode if it is unconditional
-         */
-        stack.push(childNode);
-      }
-    }
-  }
-}
-
-/*
- * Calculates currNode = union(currNode, otherNode), mutating currNode in place
- * If demoteOtherNode is specified, we demote the subtree represented by
- * otherNode to conditional access/deps before taking the union.
- *
- * This is a helper function used to join an inner scope to its parent scope.
- * @param currNode (mutable) return by argument
- * @param otherNode (move) {@link addSubtree} takes ownership of the subtree
- * represented by otherNode, which may be mutated or moved to currNode. It is
- * invalid to use otherNode after this call.
- *
- * Note that @param otherNode may contain both conditional and unconditional nodes,
- * due to inner control flow and conditional member expressions
- *
- * @param demoteOtherNode
- */
-function addSubtree(
-  currNode: DependencyNode,
-  otherNode: DependencyNode,
-  demoteOtherNode: boolean,
-): void {
-  let otherType = otherNode.accessType;
-  if (demoteOtherNode) {
-    otherType = isDependency(otherType)
-      ? PropertyAccessType.ConditionalDependency
-      : PropertyAccessType.ConditionalAccess;
-  }
-  currNode.accessType = merge(currNode.accessType, otherType);
-
-  for (const [propertyName, otherChild] of otherNode.properties) {
-    const currChild = currNode.properties.get(propertyName);
-    if (currChild) {
-      // recursively calculate currChild = union(currChild, otherChild)
-      addSubtree(currChild, otherChild, demoteOtherNode);
-    } else {
-      /*
-       * if currChild doesn't exist, we can just move otherChild
-       * currChild = otherChild.
-       */
-      if (demoteOtherNode) {
-        demoteSubtreeToConditional(otherChild);
-      }
-      currNode.properties.set(propertyName, otherChild);
-    }
-  }
-}
-
-/*
- * Adds intersection(otherProperties) to currProperties, mutating
- * currProperties in place. i.e.
- *    currProperties = union(currProperties, intersection(otherProperties))
- *
- * Used to merge unconditional accesses from exhaustive conditional branches
- * into the parent ReactiveDeps Tree.
- * intersection(currProperties) is determined as such:
- *   - a node is present in the intersection iff it is present in all every
- *     branch
- *   - the type of an added node is `UnconditionalDependency` if it is a
- *     dependency in at least one branch (otherwise `UnconditionalAccess`)
- *
- * @param otherProperties (read-only) an array of node properties containing
- *         conditionally and unconditionally accessed nodes. Each element
- *         represents asubtree of reactive dependencies from a single CFG
- *         branch.
- *        otherProperties must represent all reachable branches.
- * @param currProperties (mutable) return by argument properties of a node
- *
- * otherProperties and currProperties must be properties of disjoint nodes
- * that represent the same dependency (identifier + path).
- */
-function addSubtreeIntersection(
-  currProperties: Map<string, DependencyNode>,
-  otherProperties: Array<Map<string, DependencyNode>>,
-): void {
-  CompilerError.invariant(otherProperties.length > 1, {
-    reason:
-      '[DeriveMinimalDependencies] Expected otherProperties to be at least 2 elements long.',
-    description: null,
-    loc: null,
-    suggestions: null,
-  });
-
-  /*
-   * otherProperties here may contain unconditional nodes as the result of
-   * recursively merging exhaustively conditional children with unconditionally
-   * accessed nodes (e.g. in the test condition itself)
-   * See `reduce-reactive-cond-deps-cfg-nested-testifelse` fixture for example
-   */
-
-  for (const [propertyName, currNode] of currProperties) {
-    const otherNodes = mapNonNull(otherProperties, properties => {
-      const node = properties.get(propertyName);
-      if (node != null && isUnconditional(node.accessType)) {
-        return node;
-      } else {
-        return null;
-      }
-    });
-
-    /*
-     * intersection(otherNodes[propertyName]) only exists if each element in
-     * otherProperties accesses propertyName.
-     */
-    if (otherNodes) {
-      addSubtreeIntersection(
-        currNode.properties,
-        otherNodes.map(node => node.properties),
-      );
-
-      const isDep = otherNodes.some(tree => isDependency(tree.accessType));
-      const externalAccessType = isDep
-        ? PropertyAccessType.UnconditionalDependency
-        : PropertyAccessType.UnconditionalAccess;
-      currNode.accessType = merge(externalAccessType, currNode.accessType);
-    }
-  }
-}
-
-function printSubtree(
-  node: DependencyNode,
-  includeAccesses: boolean,
-): Array<string> {
-  const results: Array<string> = [];
-  for (const [propertyName, propertyNode] of node.properties) {
-    if (includeAccesses || isDependency(propertyNode.accessType)) {
-      results.push(`${propertyName} (${propertyNode.accessType})`);
-    }
-    const propertyResults = printSubtree(propertyNode, includeAccesses);
-    results.push(...propertyResults.map(result => `${propertyName}.${result}`));
-  }
-  return results;
-}
-
-function getOrMakeProperty(
-  node: DependencyNode,
-  property: string,
-): DependencyNode {
-  let child = node.properties.get(property);
-  if (child == null) {
-    child = {
-      properties: new Map(),
-      accessType: MIN_ACCESS_TYPE,
-    };
-    node.properties.set(property, child);
-  }
-  return child;
-}
-
-function mapNonNull<T extends NonNullable<V>, V, U>(
-  arr: Array<U>,
-  fn: (arg0: U) => T | undefined | null,
-): Array<T> | null {
-  const result = [];
-  for (let i = 0; i < arr.length; i++) {
-    const element = fn(arr[i]);
-    if (element) {
-      result.push(element);
-    } else {
-      return null;
-    }
-  }
-  return result;
-}

From a9575dcf62e5cb6f8b1d8f738aa75ece216d9054 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 11:54:20 -0700
Subject: [PATCH 41/73] [compiler] Represent array accesses with PropertyLoad
 (#32287)

Prior to this PR, our HIR represented property access with numeric
literals (e.g. `myVar[0]`) as ComputedLoads. This means that they were
subject to some deopts (most notably, not being easily dedupable /
hoistable as dependencies).

Now, `PropertyLoad`, `PropertyStore`, etc reference numeric and string
literals (although not yet string literals that aren't valid babel
identifiers). The difference between PropertyLoad and ComputedLoad is
fuzzy now (maybe we should rename these).
- PropertyLoad: property keys are string and numeric literals, only when
the string literals are valid babel identifiers
- ComputedLoad: non-valid babel identifier string literals (rare) and
other non-literal expressions

The biggest feature from this PR is that it trivially enables
array-indicing expressions as dependencies. The compiler can also
specify global and imported types for arrays (e.g. return value of
`useState`)


I'm happy to close this if it complicates more than it helps --
alternative options are to entirely rely on instruction reordering-based
approaches like ReactiveGraphIR or make dependency-specific parsing +
hoisting logic more robust.
---
 .../src/HIR/BuildHIR.ts                       | 59 +++++++++-----
 .../src/HIR/CollectHoistablePropertyLoads.ts  |  9 ++-
 .../HIR/CollectOptionalChainDependencies.ts   |  3 +-
 .../src/HIR/DeriveMinimalDependenciesHIR.ts   |  5 +-
 .../src/HIR/HIR.ts                            | 18 ++++-
 .../src/HIR/PropagateScopeDependenciesHIR.ts  |  9 ++-
 .../src/HIR/Types.ts                          |  3 +-
 .../src/Inference/DropManualMemoization.ts    |  5 +-
 .../src/Optimization/ConstantPropagation.ts   | 15 ++--
 .../src/Optimization/InlineJsxTransform.ts    |  3 +-
 .../src/Optimization/LowerContextAccess.ts    |  3 +-
 .../ReactiveScopes/CodegenReactiveFunction.ts | 62 ++++++++-------
 .../ReactiveScopes/PropagateEarlyReturns.ts   |  3 +-
 .../PruneInitializationDependencies.ts        | 18 +++--
 .../src/TypeInference/InferTypes.ts           | 15 ++--
 .../src/Validation/ValidateHooksUsage.ts      |  4 +-
 .../Validation/ValidateNoCapitalizedCalls.ts  |  5 +-
 .../Validation/ValidateNoRefAccesInRender.ts  |  2 +-
 .../mixedreadonly-mutating-map.expect.md      | 19 +++--
 ...error.useMemo-dep-not-recognized.expect.md | 40 ----------
 ...useMemo-dep-array-literal-access.expect.md | 71 +++++++++++++++++
 ...ts => useMemo-dep-array-literal-access.ts} |  0
 ...ivity-via-aliased-mutation-array.expect.md | 24 ++----
 ...vity-via-aliased-mutation-lambda.expect.md | 24 ++----
 ...r-store-capture-namespace-import.expect.md | 78 +++++++++----------
 .../type-provider-store-capture.expect.md     | 78 +++++++++----------
 26 files changed, 322 insertions(+), 253 deletions(-)
 delete mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/{error.useMemo-dep-not-recognized.ts => useMemo-dep-array-literal-access.ts} (100%)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
index 67cdcab0381f2..c60bbd0e1ba3d 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
@@ -36,12 +36,14 @@ import {
   ObjectProperty,
   ObjectPropertyKey,
   Place,
+  PropertyLiteral,
   ReturnTerminal,
   SourceLocation,
   SpreadPattern,
   ThrowTerminal,
   Type,
   makeInstructionId,
+  makePropertyLiteral,
   makeType,
   promoteTemporary,
 } from './HIR';
@@ -2017,11 +2019,11 @@ function lowerExpression(
           });
 
           // Save the result back to the property
-          if (typeof property === 'string') {
+          if (typeof property === 'string' || typeof property === 'number') {
             return {
               kind: 'PropertyStore',
               object: {...object},
-              property,
+              property: makePropertyLiteral(property),
               value: {...newValuePlace},
               loc: leftExpr.node.loc ?? GeneratedSource,
             };
@@ -2316,11 +2318,11 @@ function lowerExpression(
         const argument = expr.get('argument');
         if (argument.isMemberExpression()) {
           const {object, property} = lowerMemberExpression(builder, argument);
-          if (typeof property === 'string') {
+          if (typeof property === 'string' || typeof property === 'number') {
             return {
               kind: 'PropertyDelete',
               object,
-              property,
+              property: makePropertyLiteral(property),
               loc: exprLoc,
             };
           } else {
@@ -2427,11 +2429,11 @@ function lowerExpression(
 
         // Save the result back to the property
         let newValuePlace;
-        if (typeof property === 'string') {
+        if (typeof property === 'string' || typeof property === 'number') {
           newValuePlace = lowerValueToTemporary(builder, {
             kind: 'PropertyStore',
             object: {...object},
-            property,
+            property: makePropertyLiteral(property),
             value: {...updatedValue},
             loc: leftExpr.node.loc ?? GeneratedSource,
           });
@@ -3057,7 +3059,7 @@ function lowerArguments(
 
 type LoweredMemberExpression = {
   object: Place;
-  property: Place | string;
+  property: Place | string | number;
   value: InstructionValue;
 };
 function lowerMemberExpression(
@@ -3072,8 +3074,13 @@ function lowerMemberExpression(
   const object =
     loweredObject ?? lowerExpressionToTemporary(builder, objectNode);
 
-  if (!expr.node.computed) {
-    if (!propertyNode.isIdentifier()) {
+  if (!expr.node.computed || expr.node.property.type === 'NumericLiteral') {
+    let property: PropertyLiteral;
+    if (propertyNode.isIdentifier()) {
+      property = makePropertyLiteral(propertyNode.node.name);
+    } else if (propertyNode.isNumericLiteral()) {
+      property = makePropertyLiteral(propertyNode.node.value);
+    } else {
       builder.errors.push({
         reason: `(BuildHIR::lowerMemberExpression) Handle ${propertyNode.type} property`,
         severity: ErrorSeverity.Todo,
@@ -3089,10 +3096,10 @@ function lowerMemberExpression(
     const value: InstructionValue = {
       kind: 'PropertyLoad',
       object: {...object},
-      property: propertyNode.node.name,
+      property,
       loc: exprLoc,
     };
-    return {object, property: propertyNode.node.name, value};
+    return {object, property, value};
   } else {
     if (!propertyNode.isExpression()) {
       builder.errors.push({
@@ -3210,7 +3217,7 @@ function lowerJsxMemberExpression(
   return lowerValueToTemporary(builder, {
     kind: 'PropertyLoad',
     object: objectPlace,
-    property,
+    property: makePropertyLiteral(property),
     loc,
   });
 }
@@ -3626,8 +3633,25 @@ function lowerAssignment(
       const lvalue = lvaluePath as NodePath<t.MemberExpression>;
       const property = lvalue.get('property');
       const object = lowerExpressionToTemporary(builder, lvalue.get('object'));
-      if (!lvalue.node.computed) {
-        if (!property.isIdentifier()) {
+      if (!lvalue.node.computed || lvalue.get('property').isNumericLiteral()) {
+        let temporary;
+        if (property.isIdentifier()) {
+          temporary = lowerValueToTemporary(builder, {
+            kind: 'PropertyStore',
+            object,
+            property: makePropertyLiteral(property.node.name),
+            value,
+            loc,
+          });
+        } else if (property.isNumericLiteral()) {
+          temporary = lowerValueToTemporary(builder, {
+            kind: 'PropertyStore',
+            object,
+            property: makePropertyLiteral(property.node.value),
+            value,
+            loc,
+          });
+        } else {
           builder.errors.push({
             reason: `(BuildHIR::lowerAssignment) Handle ${property.type} properties in MemberExpression`,
             severity: ErrorSeverity.Todo,
@@ -3636,13 +3660,6 @@ function lowerAssignment(
           });
           return {kind: 'UnsupportedNode', node: lvalueNode, loc};
         }
-        const temporary = lowerValueToTemporary(builder, {
-          kind: 'PropertyStore',
-          object,
-          property: property.node.name,
-          value,
-          loc,
-        });
         return {kind: 'LoadLocal', place: temporary, loc: temporary.loc};
       } else {
         if (!property.isExpression()) {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
index a422570fffead..7b352696860e8 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
@@ -18,6 +18,7 @@ import {
   IdentifierId,
   InstructionId,
   InstructionValue,
+  PropertyLiteral,
   ReactiveScopeDependency,
   ScopeId,
 } from './HIR';
@@ -172,8 +173,8 @@ export type BlockInfo = {
  * and make computing sets intersections simpler.
  */
 type RootNode = {
-  properties: Map<string, PropertyPathNode>;
-  optionalProperties: Map<string, PropertyPathNode>;
+  properties: Map<PropertyLiteral, PropertyPathNode>;
+  optionalProperties: Map<PropertyLiteral, PropertyPathNode>;
   parent: null;
   // Recorded to make later computations simpler
   fullPath: ReactiveScopeDependency;
@@ -183,8 +184,8 @@ type RootNode = {
 
 type PropertyPathNode =
   | {
-      properties: Map<string, PropertyPathNode>;
-      optionalProperties: Map<string, PropertyPathNode>;
+      properties: Map<PropertyLiteral, PropertyPathNode>;
+      optionalProperties: Map<PropertyLiteral, PropertyPathNode>;
       parent: PropertyPathNode;
       fullPath: ReactiveScopeDependency;
       hasOptional: boolean;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts
index 2b7c9f2134e71..02a28b9f35776 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts
@@ -16,6 +16,7 @@ import {
   DependencyPathEntry,
   Instruction,
   Terminal,
+  PropertyLiteral,
 } from './HIR';
 import {printIdentifier} from './PrintHIR';
 
@@ -157,7 +158,7 @@ function matchOptionalTestBlock(
   blocks: ReadonlyMap<BlockId, BasicBlock>,
 ): {
   consequentId: IdentifierId;
-  property: string;
+  property: PropertyLiteral;
   propertyId: IdentifierId;
   storeLocalInstr: Instruction;
   consequentGoto: BlockId;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
index 07f44a59a26de..7f6fb9e88f817 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
@@ -10,6 +10,7 @@ import {
   DependencyPathEntry,
   GeneratedSource,
   Identifier,
+  PropertyLiteral,
   ReactiveScopeDependency,
 } from '../HIR';
 import {printIdentifier} from '../HIR/PrintHIR';
@@ -286,7 +287,7 @@ function merge(
 }
 
 type TreeNode<T extends string> = {
-  properties: Map<string, TreeNode<T>>;
+  properties: Map<PropertyLiteral, TreeNode<T>>;
   accessType: T;
 };
 type HoistableNode = TreeNode<'Optional' | 'NonNull'>;
@@ -343,7 +344,7 @@ function printSubtree(
 
 function makeOrMergeProperty(
   node: DependencyNode,
-  property: string,
+  property: PropertyLiteral,
   accessType: PropertyAccessType,
 ): DependencyNode {
   let child = node.properties.get(property);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
index e124caee7a23f..1ca00ef5877c4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
@@ -937,7 +937,7 @@ export type InstructionValue =
   | {
       kind: 'PropertyStore';
       object: Place;
-      property: string;
+      property: PropertyLiteral;
       value: Place;
       loc: SourceLocation;
     }
@@ -947,7 +947,7 @@ export type InstructionValue =
   | {
       kind: 'PropertyDelete';
       object: Place;
-      property: string;
+      property: PropertyLiteral;
       loc: SourceLocation;
     }
 
@@ -1121,7 +1121,7 @@ export type StoreLocal = {
 export type PropertyLoad = {
   kind: 'PropertyLoad';
   object: Place;
-  property: string;
+  property: PropertyLiteral;
   loc: SourceLocation;
 };
 
@@ -1502,7 +1502,17 @@ export type ReactiveScopeDeclaration = {
   scope: ReactiveScope; // the scope in which the variable was originally declared
 };
 
-export type DependencyPathEntry = {property: string; optional: boolean};
+const opaquePropertyLiteral = Symbol();
+export type PropertyLiteral = (string | number) & {
+  [opaquePropertyLiteral]: 'PropertyLiteral';
+};
+export function makePropertyLiteral(value: string | number): PropertyLiteral {
+  return value as PropertyLiteral;
+}
+export type DependencyPathEntry = {
+  property: PropertyLiteral;
+  optional: boolean;
+};
 export type DependencyPath = Array<DependencyPathEntry>;
 export type ReactiveScopeDependency = {
   identifier: Identifier;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
index 4cb84870a8a33..e12d10b40612b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
@@ -22,6 +22,7 @@ import {
   TInstruction,
   FunctionExpression,
   ObjectMethod,
+  PropertyLiteral,
 } from './HIR';
 import {
   collectHoistablePropertyLoads,
@@ -321,7 +322,7 @@ function collectTemporariesSidemapImpl(
 
 function getProperty(
   object: Place,
-  propertyName: string,
+  propertyName: PropertyLiteral,
   optional: boolean,
   temporaries: ReadonlyMap<IdentifierId, ReactiveScopeDependency>,
 ): ReactiveScopeDependency {
@@ -519,7 +520,11 @@ class Context {
     );
   }
 
-  visitProperty(object: Place, property: string, optional: boolean): void {
+  visitProperty(
+    object: Place,
+    property: PropertyLiteral,
+    optional: boolean,
+  ): void {
     const nextDependency = getProperty(
       object,
       property,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts
index 55cd1531aee93..a67b580a6728b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts
@@ -6,6 +6,7 @@
  */
 
 import {CompilerError} from '../CompilerError';
+import {PropertyLiteral} from './HIR';
 
 export type BuiltInType = PrimitiveType | FunctionType | ObjectType;
 
@@ -59,7 +60,7 @@ export type PropType = {
   kind: 'Property';
   objectType: Type;
   objectName: string;
-  propertyName: string;
+  propertyName: PropertyLiteral;
 };
 
 export type ObjectMethod = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts
index 4dcdc21e15ac5..8d123845c3739 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts
@@ -145,9 +145,10 @@ function collectTemporaries(
     }
     case 'PropertyLoad': {
       if (sidemap.react.has(value.object.identifier.id)) {
-        if (value.property === 'useMemo' || value.property === 'useCallback') {
+        const property = value.property;
+        if (property === 'useMemo' || property === 'useCallback') {
           sidemap.manualMemos.set(instr.lvalue.identifier.id, {
-            kind: value.property,
+            kind: property as 'useMemo' | 'useCallback',
             loadInstr: instr as TInstruction<PropertyLoad>,
           });
         }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts
index a9f62c1986efa..07cd419230ac4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts
@@ -19,6 +19,7 @@ import {
   Primitive,
   assertConsistentIdentifiers,
   assertTerminalSuccessorsExist,
+  makePropertyLiteral,
   markInstructionIds,
   markPredecessors,
   mergeConsecutiveBlocks,
@@ -238,13 +239,14 @@ function evaluateInstruction(
       if (
         property !== null &&
         property.kind === 'Primitive' &&
-        typeof property.value === 'string' &&
-        isValidIdentifier(property.value)
+        ((typeof property.value === 'string' &&
+          isValidIdentifier(property.value)) ||
+          typeof property.value === 'number')
       ) {
         const nextValue: InstructionValue = {
           kind: 'PropertyLoad',
           loc: value.loc,
-          property: property.value,
+          property: makePropertyLiteral(property.value),
           object: value.object,
         };
         instr.value = nextValue;
@@ -256,13 +258,14 @@ function evaluateInstruction(
       if (
         property !== null &&
         property.kind === 'Primitive' &&
-        typeof property.value === 'string' &&
-        isValidIdentifier(property.value)
+        ((typeof property.value === 'string' &&
+          isValidIdentifier(property.value)) ||
+          typeof property.value === 'number')
       ) {
         const nextValue: InstructionValue = {
           kind: 'PropertyStore',
           loc: value.loc,
-          property: property.value,
+          property: makePropertyLiteral(property.value),
           object: value.object,
           value: value.value,
         };
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts
index 9ffc64864f397..29c59c7b3644a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts
@@ -21,6 +21,7 @@ import {
   InstructionKind,
   JsxAttribute,
   makeInstructionId,
+  makePropertyLiteral,
   ObjectProperty,
   Phi,
   Place,
@@ -446,7 +447,7 @@ function createSymbolProperty(
     value: {
       kind: 'PropertyLoad',
       object: {...symbolInstruction.lvalue},
-      property: 'for',
+      property: makePropertyLiteral('for'),
       loc: instr.value.loc,
     },
     loc: instr.loc,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
index 5b700b23b4049..b636c7b1718cc 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
@@ -23,6 +23,7 @@ import {
   isUseContextHookType,
   makeBlockId,
   makeInstructionId,
+  makePropertyLiteral,
   makeType,
   markInstructionIds,
   promoteTemporary,
@@ -195,7 +196,7 @@ function emitPropertyLoad(
   const loadProp: PropertyLoad = {
     kind: 'PropertyLoad',
     object,
-    property,
+    property: makePropertyLiteral(property),
     loc: GeneratedSource,
   };
   const element: Place = createTemporaryPlace(env, GeneratedSource);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
index 93b70bd7d1da3..6c89aea45ea45 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
@@ -1453,15 +1453,20 @@ function codegenDependency(
   if (dependency.path.length !== 0) {
     const hasOptional = dependency.path.some(path => path.optional);
     for (const path of dependency.path) {
+      const property =
+        typeof path.property === 'string'
+          ? t.identifier(path.property)
+          : t.numericLiteral(path.property);
+      const isComputed = typeof path.property !== 'string';
       if (hasOptional) {
         object = t.optionalMemberExpression(
           object,
-          t.identifier(path.property),
-          false,
+          property,
+          isComputed,
           path.optional,
         );
       } else {
-        object = t.memberExpression(object, t.identifier(path.property));
+        object = t.memberExpression(object, property, isComputed);
       }
     }
   }
@@ -1962,38 +1967,37 @@ function codegenInstructionValue(
       value = node;
       break;
     }
-    case 'PropertyStore': {
-      value = t.assignmentExpression(
-        '=',
-        t.memberExpression(
-          codegenPlaceToExpression(cx, instrValue.object),
-          t.identifier(instrValue.property),
-        ),
-        codegenPlaceToExpression(cx, instrValue.value),
-      );
-      break;
-    }
-    case 'PropertyLoad': {
-      const object = codegenPlaceToExpression(cx, instrValue.object);
+    case 'PropertyStore':
+    case 'PropertyLoad':
+    case 'PropertyDelete': {
+      let memberExpr;
       /*
        * We currently only lower single chains of optional memberexpr.
        * (See BuildHIR.ts for more detail.)
        */
-      value = t.memberExpression(
-        object,
-        t.identifier(instrValue.property),
-        undefined,
-      );
-      break;
-    }
-    case 'PropertyDelete': {
-      value = t.unaryExpression(
-        'delete',
-        t.memberExpression(
+      if (typeof instrValue.property === 'string') {
+        memberExpr = t.memberExpression(
           codegenPlaceToExpression(cx, instrValue.object),
           t.identifier(instrValue.property),
-        ),
-      );
+        );
+      } else {
+        memberExpr = t.memberExpression(
+          codegenPlaceToExpression(cx, instrValue.object),
+          t.numericLiteral(instrValue.property),
+          true,
+        );
+      }
+      if (instrValue.kind === 'PropertyStore') {
+        value = t.assignmentExpression(
+          '=',
+          memberExpr,
+          codegenPlaceToExpression(cx, instrValue.value),
+        );
+      } else if (instrValue.kind === 'PropertyLoad') {
+        value = memberExpr;
+      } else {
+        value = t.unaryExpression('delete', memberExpr);
+      }
       break;
     }
     case 'ComputedStore': {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts
index b8ba19628451b..522aaf5a5df28 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts
@@ -17,6 +17,7 @@ import {
   ReactiveStatement,
   ReactiveTerminalStatement,
   makeInstructionId,
+  makePropertyLiteral,
   promoteTemporary,
 } from '../HIR';
 import {createTemporaryPlace} from '../HIR/HIRBuilder';
@@ -189,7 +190,7 @@ class Transform extends ReactiveFunctionTransform<State> {
               value: {
                 kind: 'PropertyLoad',
                 object: {...symbolTemp},
-                property: 'for',
+                property: makePropertyLiteral('for'),
                 loc,
               },
             },
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts
index 2a9d0b9793d9f..9ef9d382c2834 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts
@@ -12,6 +12,7 @@ import {
   IdentifierId,
   InstructionId,
   Place,
+  PropertyLiteral,
   ReactiveBlock,
   ReactiveFunction,
   ReactiveInstruction,
@@ -64,13 +65,13 @@ type KindMap = Map<IdentifierId, CreateUpdate>;
 class Visitor extends ReactiveFunctionVisitor<CreateUpdate> {
   map: KindMap = new Map();
   aliases: DisjointSet<IdentifierId>;
-  paths: Map<IdentifierId, Map<string, IdentifierId>>;
+  paths: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>;
   env: Environment;
 
   constructor(
     env: Environment,
     aliases: DisjointSet<IdentifierId>,
-    paths: Map<IdentifierId, Map<string, IdentifierId>>,
+    paths: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>,
   ) {
     super();
     this.aliases = aliases;
@@ -218,9 +219,9 @@ export default function pruneInitializationDependencies(
 }
 
 function update(
-  map: Map<IdentifierId, Map<string, IdentifierId>>,
+  map: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>,
   key: IdentifierId,
-  path: string,
+  path: PropertyLiteral,
   value: IdentifierId,
 ): void {
   const inner = map.get(key) ?? new Map();
@@ -230,7 +231,7 @@ function update(
 
 class AliasVisitor extends ReactiveFunctionVisitor {
   scopeIdentifiers: DisjointSet<IdentifierId> = new DisjointSet<IdentifierId>();
-  scopePaths: Map<IdentifierId, Map<string, IdentifierId>> = new Map();
+  scopePaths: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>> = new Map();
 
   override visitInstruction(instr: ReactiveInstruction): void {
     if (
@@ -271,11 +272,14 @@ class AliasVisitor extends ReactiveFunctionVisitor {
 
 function getAliases(
   fn: ReactiveFunction,
-): [DisjointSet<IdentifierId>, Map<IdentifierId, Map<string, IdentifierId>>] {
+): [
+  DisjointSet<IdentifierId>,
+  Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>,
+] {
   const visitor = new AliasVisitor();
   visitReactiveFunction(fn, visitor, null);
   let disjoint = visitor.scopeIdentifiers;
-  let scopePaths = new Map<IdentifierId, Map<string, IdentifierId>>();
+  let scopePaths = new Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>();
   for (const [key, value] of visitor.scopePaths) {
     for (const [path, id] of value) {
       update(
diff --git a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
index 44bf539e847bb..3054a83c76138 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
@@ -14,6 +14,7 @@ import {
   Identifier,
   IdentifierId,
   Instruction,
+  makePropertyLiteral,
   makeType,
   PropType,
   Type,
@@ -335,7 +336,7 @@ function* generateInstructionTypes(
               kind: 'Property',
               objectType: value.value.identifier.type,
               objectName: getName(names, value.value.identifier.id),
-              propertyName,
+              propertyName: makePropertyLiteral(propertyName),
             });
           } else {
             break;
@@ -352,7 +353,7 @@ function* generateInstructionTypes(
                 kind: 'Property',
                 objectType: value.value.identifier.type,
                 objectName: getName(names, value.value.identifier.id),
-                propertyName: property.key.name,
+                propertyName: makePropertyLiteral(property.key.name),
               });
             }
           }
@@ -453,10 +454,12 @@ class Unifier {
         return;
       }
       const objectType = this.get(tB.objectType);
-      const propertyType = this.env.getPropertyType(
-        objectType,
-        tB.propertyName,
-      );
+      let propertyType;
+      if (typeof tB.propertyName === 'number') {
+        propertyType = null;
+      } else {
+        propertyType = this.env.getPropertyType(objectType, tB.propertyName);
+      }
       if (propertyType !== null) {
         this.unify(tA, propertyType);
       }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts
index 53640da5020bd..ed23693f61439 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts
@@ -257,7 +257,9 @@ export function validateHooksUsage(fn: HIRFunction): void {
         }
         case 'PropertyLoad': {
           const objectKind = getKindForPlace(instr.value.object);
-          const isHookProperty = isHookName(instr.value.property);
+          const isHookProperty =
+            typeof instr.value.property === 'string' &&
+            isHookName(instr.value.property);
           let kind: Kind;
           switch (objectKind) {
             case Kind.Error: {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts
index 2988d1cc02430..2f9b0a1c7e2ce 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts
@@ -61,7 +61,10 @@ export function validateNoCapitalizedCalls(fn: HIRFunction): void {
         }
         case 'PropertyLoad': {
           // Start conservative and disallow all capitalized method calls
-          if (/^[A-Z]/.test(value.property)) {
+          if (
+            typeof value.property === 'string' &&
+            /^[A-Z]/.test(value.property)
+          ) {
             capitalizedProperties.set(lvalue.identifier.id, value.property);
           }
           break;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts
index 4db8c700f387f..779207b22e646 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts
@@ -285,7 +285,7 @@ function validateNoRefAccessInRenderImpl(
           }
           case 'ComputedLoad':
           case 'PropertyLoad': {
-            if (typeof instr.value.property !== 'string') {
+            if (instr.value.kind === 'ComputedLoad') {
               validateNoDirectRefValueAccess(errors, instr.value.property, env);
             }
             const objType = env.get(instr.value.object.identifier.id);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md
index 4867388a864d2..6dd05cbe7c619 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md
@@ -125,22 +125,21 @@ function Component(t0) {
   } else {
     t1 = $[2];
   }
-  const t2 = jsx[0];
-  let t3;
-  if ($[3] !== t1 || $[4] !== t2) {
-    t3 = (
+  let t2;
+  if ($[3] !== jsx[0] || $[4] !== t1) {
+    t2 = (
       <>
         {t1}
-        {t2}
+        {jsx[0]}
       </>
     );
-    $[3] = t1;
-    $[4] = t2;
-    $[5] = t3;
+    $[3] = jsx[0];
+    $[4] = t1;
+    $[5] = t2;
   } else {
-    t3 = $[5];
+    t2 = $[5];
   }
-  return t3;
+  return t2;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md
deleted file mode 100644
index bf22790a51c12..0000000000000
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md
+++ /dev/null
@@ -1,40 +0,0 @@
-
-## Input
-
-```javascript
-// @validatePreserveExistingMemoizationGuarantees
-
-import {useMemo} from 'react';
-import {makeArray} from 'shared-runtime';
-
-// We currently only recognize "hoistable" values (e.g. variable reads
-// and property loads from named variables) in the source depslist.
-// This makes validation logic simpler and follows the same constraints
-// from the eslint react-hooks-deps plugin.
-function Foo(props) {
-  const x = makeArray(props);
-  // react-hooks-deps lint would already fail here
-  return useMemo(() => [x[0]], [x[0]]);
-}
-
-export const FIXTURE_ENTRYPOINT = {
-  fn: Foo,
-  params: [{val: 1}],
-};
-
-```
-
-
-## Error
-
-```
-  11 |   const x = makeArray(props);
-  12 |   // react-hooks-deps lint would already fail here
-> 13 |   return useMemo(() => [x[0]], [x[0]]);
-     |                                 ^^^^ InvalidReact: Expected the dependency list to be an array of simple expressions (e.g. `x`, `x.y.z`, `x?.y?.z`) (13:13)
-  14 | }
-  15 |
-  16 | export const FIXTURE_ENTRYPOINT = {
-```
-          
-      
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md
new file mode 100644
index 0000000000000..dafe2b63e35ae
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md
@@ -0,0 +1,71 @@
+
+## Input
+
+```javascript
+// @validatePreserveExistingMemoizationGuarantees
+
+import {useMemo} from 'react';
+import {makeArray} from 'shared-runtime';
+
+// We currently only recognize "hoistable" values (e.g. variable reads
+// and property loads from named variables) in the source depslist.
+// This makes validation logic simpler and follows the same constraints
+// from the eslint react-hooks-deps plugin.
+function Foo(props) {
+  const x = makeArray(props);
+  // react-hooks-deps lint would already fail here
+  return useMemo(() => [x[0]], [x[0]]);
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{val: 1}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime"; // @validatePreserveExistingMemoizationGuarantees
+
+import { useMemo } from "react";
+import { makeArray } from "shared-runtime";
+
+// We currently only recognize "hoistable" values (e.g. variable reads
+// and property loads from named variables) in the source depslist.
+// This makes validation logic simpler and follows the same constraints
+// from the eslint react-hooks-deps plugin.
+function Foo(props) {
+  const $ = _c(4);
+  let t0;
+  if ($[0] !== props) {
+    t0 = makeArray(props);
+    $[0] = props;
+    $[1] = t0;
+  } else {
+    t0 = $[1];
+  }
+  const x = t0;
+  let t1;
+  let t2;
+  if ($[2] !== x[0]) {
+    t2 = [x[0]];
+    $[2] = x[0];
+    $[3] = t2;
+  } else {
+    t2 = $[3];
+  }
+  t1 = t2;
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{ val: 1 }],
+};
+
+```
+      
+### Eval output
+(kind: ok) [{"val":1}]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.ts b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.ts
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.ts
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.ts
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md
index ee52047fbe982..b9ff24519e50f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md
@@ -32,28 +32,20 @@ export const FIXTURE_ENTRYPOINT = {
 ```javascript
 import { c as _c } from "react/compiler-runtime";
 function Component(props) {
-  const $ = _c(4);
-  let x;
+  const $ = _c(2);
+  let t0;
   if ($[0] !== props.input) {
-    x = [];
+    const x = [];
     const y = x;
     y.push(props.input);
-    $[0] = props.input;
-    $[1] = x;
-  } else {
-    x = $[1];
-  }
 
-  const t0 = x[0];
-  let t1;
-  if ($[2] !== t0) {
-    t1 = [t0];
-    $[2] = t0;
-    $[3] = t1;
+    t0 = [x[0]];
+    $[0] = props.input;
+    $[1] = t0;
   } else {
-    t1 = $[3];
+    t0 = $[1];
   }
-  return t1;
+  return t0;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md
index 3a338af5ab58f..ebf30d9d28560 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md
@@ -35,32 +35,24 @@ export const FIXTURE_ENTRYPOINT = {
 ```javascript
 import { c as _c } from "react/compiler-runtime";
 function Component(props) {
-  const $ = _c(4);
-  let x;
+  const $ = _c(2);
+  let t0;
   if ($[0] !== props.input) {
-    x = [];
+    const x = [];
     const f = (arg) => {
       const y = x;
       y.push(arg);
     };
 
     f(props.input);
-    $[0] = props.input;
-    $[1] = x;
-  } else {
-    x = $[1];
-  }
 
-  const t0 = x[0];
-  let t1;
-  if ($[2] !== t0) {
-    t1 = [t0];
-    $[2] = t0;
-    $[3] = t1;
+    t0 = [x[0]];
+    $[0] = props.input;
+    $[1] = t0;
   } else {
-    t1 = $[3];
+    t0 = $[1];
   }
-  return t1;
+  return t0;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md
index 5016b0c4dfdfd..87b5d7a09e28d 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md
@@ -94,69 +94,67 @@ export function Component(t0) {
   } else {
     t6 = $[8];
   }
-  const t7 = items_0[0];
-  let t8;
-  if ($[9] !== t6 || $[10] !== t7) {
-    t8 = <SharedRuntime.ValidateMemoization inputs={t6} output={t7} />;
-    $[9] = t6;
-    $[10] = t7;
-    $[11] = t8;
+  let t7;
+  if ($[9] !== items_0[0] || $[10] !== t6) {
+    t7 = <SharedRuntime.ValidateMemoization inputs={t6} output={items_0[0]} />;
+    $[9] = items_0[0];
+    $[10] = t6;
+    $[11] = t7;
   } else {
-    t8 = $[11];
+    t7 = $[11];
   }
-  let t9;
+  let t8;
   if ($[12] !== b) {
-    t9 = [b];
+    t8 = [b];
     $[12] = b;
-    $[13] = t9;
+    $[13] = t8;
   } else {
-    t9 = $[13];
+    t8 = $[13];
   }
-  const t10 = items_0[1];
-  let t11;
-  if ($[14] !== t10 || $[15] !== t9) {
-    t11 = <SharedRuntime.ValidateMemoization inputs={t9} output={t10} />;
-    $[14] = t10;
-    $[15] = t9;
-    $[16] = t11;
+  let t9;
+  if ($[14] !== items_0[1] || $[15] !== t8) {
+    t9 = <SharedRuntime.ValidateMemoization inputs={t8} output={items_0[1]} />;
+    $[14] = items_0[1];
+    $[15] = t8;
+    $[16] = t9;
   } else {
-    t11 = $[16];
+    t9 = $[16];
   }
-  let t12;
+  let t10;
   if ($[17] !== a || $[18] !== b) {
-    t12 = [a, b];
+    t10 = [a, b];
     $[17] = a;
     $[18] = b;
-    $[19] = t12;
+    $[19] = t10;
   } else {
-    t12 = $[19];
+    t10 = $[19];
   }
-  let t13;
-  if ($[20] !== items_0 || $[21] !== t12) {
-    t13 = <SharedRuntime.ValidateMemoization inputs={t12} output={items_0} />;
+  let t11;
+  if ($[20] !== items_0 || $[21] !== t10) {
+    t11 = <SharedRuntime.ValidateMemoization inputs={t10} output={items_0} />;
     $[20] = items_0;
-    $[21] = t12;
-    $[22] = t13;
+    $[21] = t10;
+    $[22] = t11;
   } else {
-    t13 = $[22];
+    t11 = $[22];
   }
-  let t14;
-  if ($[23] !== t11 || $[24] !== t13 || $[25] !== t8) {
-    t14 = (
+  let t12;
+  if ($[23] !== t11 || $[24] !== t7 || $[25] !== t9) {
+    t12 = (
       <>
-        {t8}
+        {t7}
+        {t9}
         {t11}
-        {t13}
       </>
     );
     $[23] = t11;
-    $[24] = t13;
-    $[25] = t8;
-    $[26] = t14;
+    $[24] = t7;
+    $[25] = t9;
+    $[26] = t12;
   } else {
-    t14 = $[26];
+    t12 = $[26];
   }
-  return t14;
+  return t12;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md
index 3f341fc6650d5..c71e4c2530fce 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md
@@ -94,69 +94,67 @@ export function Component(t0) {
   } else {
     t6 = $[8];
   }
-  const t7 = items_0[0];
-  let t8;
-  if ($[9] !== t6 || $[10] !== t7) {
-    t8 = <ValidateMemoization inputs={t6} output={t7} />;
-    $[9] = t6;
-    $[10] = t7;
-    $[11] = t8;
+  let t7;
+  if ($[9] !== items_0[0] || $[10] !== t6) {
+    t7 = <ValidateMemoization inputs={t6} output={items_0[0]} />;
+    $[9] = items_0[0];
+    $[10] = t6;
+    $[11] = t7;
   } else {
-    t8 = $[11];
+    t7 = $[11];
   }
-  let t9;
+  let t8;
   if ($[12] !== b) {
-    t9 = [b];
+    t8 = [b];
     $[12] = b;
-    $[13] = t9;
+    $[13] = t8;
   } else {
-    t9 = $[13];
+    t8 = $[13];
   }
-  const t10 = items_0[1];
-  let t11;
-  if ($[14] !== t10 || $[15] !== t9) {
-    t11 = <ValidateMemoization inputs={t9} output={t10} />;
-    $[14] = t10;
-    $[15] = t9;
-    $[16] = t11;
+  let t9;
+  if ($[14] !== items_0[1] || $[15] !== t8) {
+    t9 = <ValidateMemoization inputs={t8} output={items_0[1]} />;
+    $[14] = items_0[1];
+    $[15] = t8;
+    $[16] = t9;
   } else {
-    t11 = $[16];
+    t9 = $[16];
   }
-  let t12;
+  let t10;
   if ($[17] !== a || $[18] !== b) {
-    t12 = [a, b];
+    t10 = [a, b];
     $[17] = a;
     $[18] = b;
-    $[19] = t12;
+    $[19] = t10;
   } else {
-    t12 = $[19];
+    t10 = $[19];
   }
-  let t13;
-  if ($[20] !== items_0 || $[21] !== t12) {
-    t13 = <ValidateMemoization inputs={t12} output={items_0} />;
+  let t11;
+  if ($[20] !== items_0 || $[21] !== t10) {
+    t11 = <ValidateMemoization inputs={t10} output={items_0} />;
     $[20] = items_0;
-    $[21] = t12;
-    $[22] = t13;
+    $[21] = t10;
+    $[22] = t11;
   } else {
-    t13 = $[22];
+    t11 = $[22];
   }
-  let t14;
-  if ($[23] !== t11 || $[24] !== t13 || $[25] !== t8) {
-    t14 = (
+  let t12;
+  if ($[23] !== t11 || $[24] !== t7 || $[25] !== t9) {
+    t12 = (
       <>
-        {t8}
+        {t7}
+        {t9}
         {t11}
-        {t13}
       </>
     );
     $[23] = t11;
-    $[24] = t13;
-    $[25] = t8;
-    $[26] = t14;
+    $[24] = t7;
+    $[25] = t9;
+    $[26] = t12;
   } else {
-    t14 = $[26];
+    t12 = $[26];
   }
-  return t14;
+  return t12;
 }
 
 export const FIXTURE_ENTRYPOINT = {

From 86b191347474fa98f002217ed88926efc8164c1e Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 12:25:33 -0700
Subject: [PATCH 42/73] [compiler][be] Clean up bug test fixtures; evaluate
 more fixtures (#31812)

Test fixtures testing different compiler features (e.g. non-auto
memoization) should live in separate directories.

Remove bug-prefixed fixtures that have since been fixed

Add test evaluator export to more fixtures
---
 .../fixtures/compiler/call-spread.expect.md   | 22 ++++++-
 .../fixtures/compiler/call-spread.js          |  9 ++-
 ...ring-fun-alias-captured-mutate-2.expect.md | 38 +++++++++++-
 .../capturing-fun-alias-captured-mutate-2.js  | 15 ++++-
 ...-fun-alias-captured-mutate-arr-2.expect.md | 38 +++++++++++-
 ...pturing-fun-alias-captured-mutate-arr-2.js | 15 ++++-
 ...g-func-alias-captured-mutate-arr.expect.md | 36 +++++++++++-
 ...apturing-func-alias-captured-mutate-arr.js | 14 ++++-
 ...uring-func-alias-computed-mutate.expect.md | 25 +++++++-
 .../capturing-func-alias-computed-mutate.js   |  9 ++-
 .../capturing-func-alias-mutate.expect.md     | 25 +++++++-
 .../compiler/capturing-func-alias-mutate.js   |  9 ++-
 ...c-alias-receiver-computed-mutate.expect.md | 27 ++++++++-
 ...ing-func-alias-receiver-computed-mutate.js | 10 +++-
 ...uring-func-alias-receiver-mutate.expect.md | 27 ++++++++-
 .../capturing-func-alias-receiver-mutate.js   | 10 +++-
 .../capturing-func-simple-alias.expect.md     | 27 ++++++++-
 .../compiler/capturing-func-simple-alias.js   | 10 +++-
 ...nction-capture-ref-before-rename.expect.md | 58 ++++++++++++++-----
 ...ring-function-capture-ref-before-rename.js | 15 ++++-
 ...ction-conditional-capture-mutate.expect.md |  7 +--
 ...ing-function-conditional-capture-mutate.js |  3 +-
 .../capturing-function-renamed-ref.expect.md  | 48 ++++++++++++---
 .../capturing-function-renamed-ref.js         | 15 ++++-
 ...apturing-function-runs-inference.expect.md | 56 ++++++++++++------
 .../capturing-function-runs-inference.js      | 10 +++-
 ...pturing-function-shadow-captured.expect.md | 40 +++++++++++--
 .../capturing-function-shadow-captured.js     | 12 +++-
 ...capturing-reference-changes-type.expect.md | 25 +++++++-
 .../capturing-reference-changes-type.js       |  9 ++-
 .../compiler/computed-store-alias.expect.md   | 33 ++++++++++-
 .../fixtures/compiler/computed-store-alias.js | 13 ++++-
 ...gation-into-function-expressions.expect.md | 29 ++++++++--
 ...t-propagation-into-function-expressions.js | 12 +++-
 ...ng-functionexpr-conditional-dep.expect.md} |  4 +-
 ...hoisting-functionexpr-conditional-dep.tsx} |  0
 ...-uncond-optional-chain-and-cond.expect.md} |  5 +-
 ...e-merge-uncond-optional-chain-and-cond.ts} |  0
 ...unction-cond-access-not-hoisted.expect.md} |  6 +-
 ...nfer-function-cond-access-not-hoisted.tsx} |  0
 ...try-catch-maybe-null-dependency.expect.md} |  7 ++-
 ....ts => try-catch-maybe-null-dependency.ts} |  0
 .../packages/snap/src/SproutTodoFilter.ts     | 30 +---------
 43 files changed, 664 insertions(+), 139 deletions(-)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-invalid-hoisting-functionexpr.expect.md => hoisting-functionexpr-conditional-dep.expect.md} (95%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-invalid-hoisting-functionexpr.tsx => hoisting-functionexpr-conditional-dep.tsx} (100%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-merge-uncond-optional-chain-and-cond.expect.md => edge-case-merge-uncond-optional-chain-and-cond.expect.md} (94%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-merge-uncond-optional-chain-and-cond.ts => edge-case-merge-uncond-optional-chain-and-cond.ts} (100%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-infer-function-cond-access-not-hoisted.expect.md => infer-function-cond-access-not-hoisted.expect.md} (82%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-infer-function-cond-access-not-hoisted.tsx => infer-function-cond-access-not-hoisted.tsx} (100%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-try-catch-maybe-null-dependency.expect.md => try-catch-maybe-null-dependency.expect.md} (95%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-try-catch-maybe-null-dependency.ts => try-catch-maybe-null-dependency.ts} (100%)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md
index 7a3ddf443f43f..2d7bc3f046e45 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md
@@ -2,22 +2,31 @@
 ## Input
 
 ```javascript
+import {makeArray} from 'shared-runtime';
+
 function Component(props) {
-  const x = foo(...props.a, null, ...props.b);
+  const x = makeArray(...props.a, null, ...props.b);
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: [1, 2], b: [2, 3, 4]}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
+import { makeArray } from "shared-runtime";
+
 function Component(props) {
   const $ = _c(3);
   let t0;
   if ($[0] !== props.a || $[1] !== props.b) {
-    t0 = foo(...props.a, null, ...props.b);
+    t0 = makeArray(...props.a, null, ...props.b);
     $[0] = props.a;
     $[1] = props.b;
     $[2] = t0;
@@ -28,5 +37,12 @@ function Component(props) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: [1, 2], b: [2, 3, 4] }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) [1,2,null,2,3,4]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js
index 5e73773bd1d24..8b7767c3bf890 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js
@@ -1,4 +1,11 @@
+import {makeArray} from 'shared-runtime';
+
 function Component(props) {
-  const x = foo(...props.a, null, ...props.b);
+  const x = makeArray(...props.a, null, ...props.b);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: [1, 2], b: [2, 3, 4]}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md
index f9ce3f2e98cf5..061e64222eef0 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -15,14 +17,28 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(foo, bar) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(3);
+  const { foo, bar } = t0;
   let x;
   if ($[0] !== bar || $[1] !== foo) {
     x = { foo };
@@ -44,5 +60,21 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ foo: 2, bar: 3 }],
+  sequentialRenders: [
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 4 },
+    { foo: 3, bar: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"foo":2}
+{"foo":2}
+{"foo":2}
+{"foo":3}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js
index a83acfcdb0e46..8579e8c4943f6 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js
@@ -1,4 +1,6 @@
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -10,3 +12,14 @@ function component(foo, bar) {
   mutate(y);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md
index 38590d1559bb5..fb44f2c7b8f24 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -15,14 +17,28 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(foo, bar) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(3);
+  const { foo, bar } = t0;
   let x;
   if ($[0] !== bar || $[1] !== foo) {
     x = { foo };
@@ -44,5 +60,21 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ foo: 2, bar: 3 }],
+  sequentialRenders: [
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 4 },
+    { foo: 3, bar: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"foo":2}
+{"foo":2}
+{"foo":2}
+{"foo":3}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js
index 2a30bfbce197d..24dddd4910e08 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js
@@ -1,4 +1,6 @@
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -10,3 +12,14 @@ function component(foo, bar) {
   mutate(y);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md
index 7c94c33e495a8..e9cb3c4fd145b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -15,14 +16,27 @@ function component(foo, bar) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(foo, bar) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(3);
+  const { foo, bar } = t0;
   let y;
   if ($[0] !== bar || $[1] !== foo) {
     const x = { foo };
@@ -44,5 +58,21 @@ function component(foo, bar) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ foo: 2, bar: 3 }],
+  sequentialRenders: [
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 4 },
+    { foo: 3, bar: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"bar":3,"wat0":"joe"}
+{"bar":3,"wat0":"joe"}
+{"bar":4,"wat0":"joe"}
+{"bar":4,"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js
index 5b7665498dfd6..f757078e73266 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js
@@ -1,4 +1,5 @@
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -10,3 +11,14 @@ function component(foo, bar) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md
index 1a561453a915e..513718ba8606b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -13,14 +14,22 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -39,5 +48,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js
index a66039c9ad283..daa4fffb28df8 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js
@@ -1,4 +1,5 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -8,3 +9,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md
index 386cbec42db64..ae145f4d9e2eb 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -13,14 +14,22 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -39,5 +48,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js
index f528a8c02bc9a..524dc8af35601 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js
@@ -1,4 +1,5 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -8,3 +9,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md
index 90df65c6ae425..d65e9cca92740 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -14,14 +16,23 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -41,5 +52,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js
index d0a1f62320605..b4f645846c5be 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js
@@ -1,4 +1,6 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -9,3 +11,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md
index e26f048efba9a..deb78c79e08ed 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -14,14 +16,23 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -41,5 +52,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js
index e34a03ec87742..a82df6b27fff8 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js
@@ -1,4 +1,6 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -9,3 +11,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md
index bdee721b5820e..0e2d77023996a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -13,14 +15,23 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -39,5 +50,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"a":2,"wat0":"joe"}
+{"a":2,"wat0":"joe"}
+{"a":3,"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js
index 39e87de8c089d..22764fec72e6e 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js
@@ -1,4 +1,6 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -8,3 +10,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md
index 4087dc53c98f2..6364e83deb9a2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function Component({a, b}) {
   let z = {a};
   (function () {
     mutate(z);
@@ -17,14 +19,28 @@ function component(a, b) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(7);
+  const { a, b } = t0;
   let z;
   if ($[0] !== a) {
     z = { a };
@@ -37,27 +53,43 @@ function component(a, b) {
   }
 
   let y = z;
-  let t0;
+  let t1;
   if ($[2] !== b) {
-    t0 = { b };
+    t1 = { b };
     $[2] = b;
-    $[3] = t0;
+    $[3] = t1;
   } else {
-    t0 = $[3];
+    t1 = $[3];
   }
-  const z_0 = t0;
-  let t1;
+  const z_0 = t1;
+  let t2;
   if ($[4] !== y || $[5] !== z_0) {
-    t1 = { y, z: z_0 };
+    t2 = { y, z: z_0 };
     $[4] = y;
     $[5] = z_0;
-    $[6] = t1;
+    $[6] = t2;
   } else {
-    t1 = $[6];
+    t2 = $[6];
   }
-  y = t1;
+  y = t2;
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2, b: 3 }],
+  sequentialRenders: [
+    { a: 2, b: 3 },
+    { a: 2, b: 3 },
+    { a: 2, b: 4 },
+    { a: 3, b: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"y":{"a":2,"wat0":"joe"},"z":{"b":3}}
+{"y":{"a":2,"wat0":"joe"},"z":{"b":3}}
+{"y":{"a":2,"wat0":"joe"},"z":{"b":4}}
+{"y":{"a":3,"wat0":"joe"},"z":{"b":4}}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js
index ad1a1f03c105c..b13e563ea820f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js
@@ -1,4 +1,6 @@
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function Component({a, b}) {
   let z = {a};
   (function () {
     mutate(z);
@@ -12,3 +14,14 @@ function component(a, b) {
   }
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md
index 2f827d699a90c..c42aa4c48c5fd 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md
@@ -2,8 +2,7 @@
 ## Input
 
 ```javascript
-// @debug
-function component(a, b) {
+function useHook(a, b) {
   let z = {a};
   let y = b;
   let x = function () {
@@ -22,8 +21,8 @@ function component(a, b) {
 ## Code
 
 ```javascript
-import { c as _c } from "react/compiler-runtime"; // @debug
-function component(a, b) {
+import { c as _c } from "react/compiler-runtime";
+function useHook(a, b) {
   const $ = _c(5);
   let t0;
   if ($[0] !== a) {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js
index 3a1a7d0d297a8..04d6ca29e1fea 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js
@@ -1,5 +1,4 @@
-// @debug
-function component(a, b) {
+function useHook(a, b) {
   let z = {a};
   let y = b;
   let x = function () {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md
index edc6fb6d6cba4..034e9781b2356 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function useHook({a, b}) {
   let z = {a};
   {
     let z = {b};
@@ -13,23 +15,37 @@ function component(a, b) {
   return z;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { mutate } from "shared-runtime";
+
+function useHook(t0) {
   const $ = _c(2);
-  let t0;
+  const { a, b } = t0;
+  let t1;
   if ($[0] !== a) {
-    t0 = { a };
+    t1 = { a };
     $[0] = a;
-    $[1] = t0;
+    $[1] = t1;
   } else {
-    t0 = $[1];
+    t1 = $[1];
   }
-  const z = t0;
+  const z = t1;
 
   const z_0 = { b };
 
@@ -37,5 +53,21 @@ function component(a, b) {
   return z;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{ a: 2, b: 3 }],
+  sequentialRenders: [
+    { a: 2, b: 3 },
+    { a: 2, b: 3 },
+    { a: 2, b: 4 },
+    { a: 3, b: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"a":2}
+{"a":2}
+{"a":2}
+{"a":3}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js
index 1022a8604ab9c..49595f19d7e6f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js
@@ -1,4 +1,6 @@
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function useHook({a, b}) {
   let z = {a};
   {
     let z = {b};
@@ -8,3 +10,14 @@ function component(a, b) {
   }
   return z;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md
index 344b9439078ca..dc0961c61264c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md
@@ -2,11 +2,17 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {Stringify} from 'shared-runtime';
+function Component({a, b}) {
   let z = {a};
-  let p = () => <Foo>{z}</Foo>;
+  let p = () => <Stringify>{z}</Stringify>;
   return p();
 }
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
 
 ```
 
@@ -14,36 +20,48 @@ function component(a, b) {
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { Stringify } from "shared-runtime";
+function Component(t0) {
   const $ = _c(6);
-  let t0;
+  const { a } = t0;
+  let t1;
   if ($[0] !== a) {
-    t0 = { a };
+    t1 = { a };
     $[0] = a;
-    $[1] = t0;
+    $[1] = t1;
   } else {
-    t0 = $[1];
+    t1 = $[1];
   }
-  const z = t0;
-  let t1;
+  const z = t1;
+  let t2;
   if ($[2] !== z) {
-    t1 = () => <Foo>{z}</Foo>;
+    t2 = () => <Stringify>{z}</Stringify>;
     $[2] = z;
-    $[3] = t1;
+    $[3] = t2;
   } else {
-    t1 = $[3];
+    t2 = $[3];
   }
-  const p = t1;
-  let t2;
+  const p = t2;
+  let t3;
   if ($[4] !== p) {
-    t2 = p();
+    t3 = p();
     $[4] = p;
-    $[5] = t2;
+    $[5] = t3;
   } else {
-    t2 = $[5];
+    t3 = $[5];
   }
-  return t2;
+  return t3;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 1 }],
+  sequentialRenders: [{ a: 1 }, { a: 1 }, { a: 2 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"children":{"a":1}}</div>
+<div>{"children":{"a":1}}</div>
+<div>{"children":{"a":2}}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js
index c4335e757feac..d5a4bb842f96c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js
@@ -1,5 +1,11 @@
-function component(a, b) {
+import {Stringify} from 'shared-runtime';
+function Component({a, b}) {
   let z = {a};
-  let p = () => <Foo>{z}</Foo>;
+  let p = () => <Stringify>{z}</Stringify>;
   return p();
 }
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md
index 82012899616cd..d409bd32965f9 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md
@@ -2,28 +2,58 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate, Stringify} from 'shared-runtime';
+function Component({a}) {
   let z = {a};
   let x = function () {
     let z;
     mutate(z);
+    return z;
   };
-  return x;
+  return <Stringify fn={x} shouldInvokeFns={true} />;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
+
 ```
 
 ## Code
 
 ```javascript
-function component(a) {
+import { c as _c } from "react/compiler-runtime";
+import { mutate, Stringify } from "shared-runtime";
+function Component(t0) {
+  const $ = _c(1);
+
   const x = _temp;
-  return x;
+  let t1;
+  if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
+    t1 = <Stringify fn={x} shouldInvokeFns={true} />;
+    $[0] = t1;
+  } else {
+    t1 = $[0];
+  }
+  return t1;
 }
 function _temp() {
   let z_0;
   mutate(z_0);
+  return z_0;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 1 }],
+  sequentialRenders: [{ a: 1 }, { a: 1 }, { a: 2 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"fn":{"kind":"Function"},"shouldInvokeFns":true}</div>
+<div>{"fn":{"kind":"Function"},"shouldInvokeFns":true}</div>
+<div>{"fn":{"kind":"Function"},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js
index 0361ef08bb13e..a0ce67e4d00b6 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js
@@ -1,8 +1,16 @@
-function component(a) {
+import {mutate, Stringify} from 'shared-runtime';
+function Component({a}) {
   let z = {a};
   let x = function () {
     let z;
     mutate(z);
+    return z;
   };
-  return x;
+  return <Stringify fn={x} shouldInvokeFns={true} />;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
index 299aa5a31dff2..f5d4b94ae5410 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = 1;
   (function () {
@@ -12,14 +13,22 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -36,5 +45,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"a":2,"wat0":"joe"}
+{"a":2,"wat0":"joe"}
+{"a":3,"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js
index 0a454b19b45e7..2b4b1b47ecc31 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js
@@ -1,4 +1,5 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = 1;
   (function () {
@@ -7,3 +8,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md
index 6d8782f74b50c..9af46bbfd9889 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+function useHook({a, b}) {
   let y = {a};
   let x = {b};
   x['y'] = y;
@@ -10,14 +11,26 @@ function component(a, b) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 3, b: 3},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { mutate } from "shared-runtime";
+function useHook(t0) {
   const $ = _c(3);
+  const { a, b } = t0;
   let x;
   if ($[0] !== a || $[1] !== b) {
     const y = { a };
@@ -33,5 +46,19 @@ function component(a, b) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{ a: 2, b: 3 }],
+  sequentialRenders: [
+    { a: 2, b: 3 },
+    { a: 2, b: 3 },
+    { a: 3, b: 3 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"b":3,"y":{"a":2},"wat0":"joe"}
+{"b":3,"y":{"a":2},"wat0":"joe"}
+{"b":3,"y":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js
index e28a2c0928c04..85d0c398bcffc 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js
@@ -1,7 +1,18 @@
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+function useHook({a, b}) {
   let y = {a};
   let x = {b};
   x['y'] = y;
   mutate(x);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 3, b: 3},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
index 8822eddcdb69f..503ee6d716813 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
@@ -2,27 +2,37 @@
 ## Input
 
 ```javascript
+import {Stringify, identity} from 'shared-runtime';
+
 function Component(props) {
   const x = 42;
   const onEvent = () => {
-    console.log(x);
+    return identity(x);
   };
-  return <Foo onEvent={onEvent} />;
+  return <Stringify onEvent={onEvent} shouldInvokeFns={true} />;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
+import { Stringify, identity } from "shared-runtime";
+
 function Component(props) {
   const $ = _c(1);
 
   const onEvent = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    t0 = <Foo onEvent={onEvent} />;
+    t0 = <Stringify onEvent={onEvent} shouldInvokeFns={true} />;
     $[0] = t0;
   } else {
     t0 = $[0];
@@ -30,8 +40,17 @@ function Component(props) {
   return t0;
 }
 function _temp() {
-  console.log(42);
+  return identity(42);
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"onEvent":{"kind":"Function","result":42},"shouldInvokeFns":true}</div>
+<div>{"onEvent":{"kind":"Function","result":42},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js
index c98bd9b670056..d1df503ad9736 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js
@@ -1,7 +1,15 @@
+import {Stringify, identity} from 'shared-runtime';
+
 function Component(props) {
   const x = 42;
   const onEvent = () => {
-    console.log(x);
+    return identity(x);
   };
-  return <Foo onEvent={onEvent} />;
+  return <Stringify onEvent={onEvent} shouldInvokeFns={true} />;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.expect.md
similarity index 95%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.expect.md
index d6331db4e7ea3..e99e9e1c80226 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.expect.md
@@ -90,4 +90,6 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"shouldInvokeFns":true,"callback":{"kind":"Function","result":null}}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.tsx
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.tsx
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.tsx
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.expect.md
similarity index 94%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.expect.md
index fa265ae1f8d74..d9361bee322e3 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.expect.md
@@ -85,4 +85,7 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {}
+[[ (exception in render) TypeError: Cannot read properties of null (reading 'title_text') ]]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.ts b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.ts
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.ts
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.ts
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.expect.md
similarity index 82%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.expect.md
index f68c826507207..263dd4d2e78d0 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.expect.md
@@ -70,4 +70,8 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) [[ (exception in render) TypeError: Cannot read properties of null (reading 'b') ]]
+<div>{"fn":{"kind":"Function","result":null},"shouldInvokeFns":true}</div>
+<div>{"fn":{"kind":"Function","result":4},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.tsx
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.tsx
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.tsx
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.expect.md
similarity index 95%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.expect.md
index 839821b349a6f..52b359839f220 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.expect.md
@@ -70,4 +70,9 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) ["null"]
+[null]
+[null]
+["null"]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.ts b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.ts
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.ts
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.ts
diff --git a/compiler/packages/snap/src/SproutTodoFilter.ts b/compiler/packages/snap/src/SproutTodoFilter.ts
index f363fd922e51a..0817bbf89c582 100644
--- a/compiler/packages/snap/src/SproutTodoFilter.ts
+++ b/compiler/packages/snap/src/SproutTodoFilter.ts
@@ -229,31 +229,15 @@ const skipFilter = new Set([
   'builtin-jsx-tag-lowered-between-mutations',
   'call-args-assignment',
   'call-args-destructuring-assignment',
-  'call-spread',
   'call-with-independently-memoizable-arg',
   'capture-param-mutate',
-  'capturing-fun-alias-captured-mutate-2',
-  'capturing-fun-alias-captured-mutate-arr-2',
-  'capturing-func-alias-captured-mutate-arr',
-  'capturing-func-alias-computed-mutate',
-  'capturing-func-alias-mutate',
-  'capturing-func-alias-receiver-computed-mutate',
-  'capturing-func-alias-receiver-mutate',
-  'capturing-func-simple-alias',
-  'capturing-function-capture-ref-before-rename',
   'capturing-function-conditional-capture-mutate',
   'capturing-function-member-expr-arguments',
   'capturing-function-member-expr-call',
-  'capturing-function-renamed-ref',
-  'capturing-function-runs-inference',
-  'capturing-function-shadow-captured',
-  'capturing-reference-changes-type',
   'codegen-emit-imports-same-source',
   'codegen-emit-make-read-only',
   'computed-call-spread',
   'computed-load-primitive-as-dependency',
-  'computed-store-alias',
-  'constant-propagation-into-function-expressions',
   'destructuring-mixed-scope-declarations-and-locals',
   'destructuring-property-inference',
   'do-while-conditional-break',
@@ -477,23 +461,15 @@ const skipFilter = new Set([
   'invalid-jsx-lowercase-localvar',
 
   // bugs
-  'fbt/bug-fbt-plural-multiple-function-calls',
-  'fbt/bug-fbt-plural-multiple-mixed-call-tag',
-  `bug-capturing-func-maybealias-captured-mutate`,
   'bug-object-expression-computed-key-modified-during-after-construction-hoisted-sequence-expr',
-  'bug-invalid-hoisting-functionexpr',
+  `bug-capturing-func-maybealias-captured-mutate`,
   'bug-aliased-capture-aliased-mutate',
   'bug-aliased-capture-mutate',
   'bug-functiondecl-hoisting',
-  'bug-try-catch-maybe-null-dependency',
-  'bug-invalid-mixedreadonly-map-shape',
   'bug-type-inference-control-flow',
-  'reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted',
+  'fbt/bug-fbt-plural-multiple-function-calls',
+  'fbt/bug-fbt-plural-multiple-mixed-call-tag',
   'bug-invalid-phi-as-dependency',
-  'reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond',
-  'original-reactive-scopes-fork/bug-nonmutating-capture-in-unsplittable-memo-block',
-  'original-reactive-scopes-fork/bug-hoisted-declaration-with-scope',
-  'bug-codegen-inline-iife',
 
   // 'react-compiler-runtime' not yet supported
   'flag-enable-emit-hook-guards',

From a84862dbdc8dada08a9d1df1c72144cd767704b6 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 18 Feb 2025 16:56:02 -0500
Subject: [PATCH 43/73] [eslint] Target ES5 (#32420)

Update eslint-plugin-react-hooks to be built targetting ES5 instead. For
various reasons our internal infra relies on these files being built
already downleveled.
---
 packages/eslint-plugin-react-hooks/tsconfig.json | 5 +++--
 1 file changed, 3 insertions(+), 2 deletions(-)

diff --git a/packages/eslint-plugin-react-hooks/tsconfig.json b/packages/eslint-plugin-react-hooks/tsconfig.json
index e67b840d3fd7a..068ca0315a7b5 100644
--- a/packages/eslint-plugin-react-hooks/tsconfig.json
+++ b/packages/eslint-plugin-react-hooks/tsconfig.json
@@ -2,12 +2,13 @@
   "extends": "@tsconfig/strictest/tsconfig.json",
   "compilerOptions": {
     "module": "ES2015",
-    "target": "ES2015",
+    "target": "ES5",
     "moduleResolution": "Bundler",
     "lib": ["ES2020"],
     "rootDir": ".",
     "sourceMap": false,
-    "types": ["estree-jsx", "node"]
+    "types": ["estree-jsx", "node"],
+    "downlevelIteration": true
   },
   "exclude": ["node_modules"],
   "include": ["src/**/*.ts"]

From fcb4e0f137db6efa6e180ad12dcfaabd0c590219 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Wed, 19 Feb 2025 14:22:53 -0700
Subject: [PATCH 44/73] [compiler] remove invariant to account for backedges
 (#32417)

Fixes https://github.com/facebook/react/issues/32269, see comments for
details.

Added test fixture for repro
---
 .../src/Inference/InferReferenceEffects.ts    | 18 ++---
 .../repro-backedge-reference-effect.expect.md | 71 +++++++++++++++++++
 .../repro-backedge-reference-effect.js        | 23 ++++++
 3 files changed, 101 insertions(+), 11 deletions(-)
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
index 6420e74a2fd20..e6883250705d4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
@@ -1598,18 +1598,14 @@ function inferBlock(
         break;
       }
       case 'LoadLocal': {
+        /**
+         * Due to backedges in the CFG, we may revisit LoadLocal lvalues
+         * multiple times. Unlike StoreLocal which may reassign to existing
+         * identifiers, LoadLocal always evaluates to store a new temporary.
+         * This means that we should always model LoadLocal as a Capture effect
+         * on the rvalue.
+         */
         const lvalue = instr.lvalue;
-        CompilerError.invariant(
-          !(
-            state.isDefined(lvalue) &&
-            state.kind(lvalue).kind === ValueKind.Context
-          ),
-          {
-            reason:
-              '[InferReferenceEffects] Unexpected LoadLocal with context kind',
-            loc: lvalue.loc,
-          },
-        );
         state.referenceAndRecordEffects(
           freezeActions,
           instrValue.place,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md
new file mode 100644
index 0000000000000..cc33cfc0846ce
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md
@@ -0,0 +1,71 @@
+
+## Input
+
+```javascript
+import {Stringify} from 'shared-runtime';
+
+function Foo({userIds}) {
+  return (
+    <Stringify
+      fn={() => {
+        const arr = [];
+
+        for (const selectedUser of userIds) {
+          arr.push(selectedUser);
+        }
+        return arr;
+      }}
+      shouldInvokeFns={true}
+    />
+  );
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{userIds: [1, 2, 3]}],
+  sequentialRenders: [{userIds: [1, 2, 4]}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import { Stringify } from "shared-runtime";
+
+function Foo(t0) {
+  const $ = _c(2);
+  const { userIds } = t0;
+  let t1;
+  if ($[0] !== userIds) {
+    t1 = (
+      <Stringify
+        fn={() => {
+          const arr = [];
+          for (const selectedUser of userIds) {
+            arr.push(selectedUser);
+          }
+          return arr;
+        }}
+        shouldInvokeFns={true}
+      />
+    );
+    $[0] = userIds;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{ userIds: [1, 2, 3] }],
+  sequentialRenders: [{ userIds: [1, 2, 4] }],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"fn":{"kind":"Function","result":[1,2,4]},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js
new file mode 100644
index 0000000000000..03145445ec5b2
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js
@@ -0,0 +1,23 @@
+import {Stringify} from 'shared-runtime';
+
+function Foo({userIds}) {
+  return (
+    <Stringify
+      fn={() => {
+        const arr = [];
+
+        for (const selectedUser of userIds) {
+          arr.push(selectedUser);
+        }
+        return arr;
+      }}
+      shouldInvokeFns={true}
+    />
+  );
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{userIds: [1, 2, 3]}],
+  sequentialRenders: [{userIds: [1, 2, 4]}],
+};

From 5f31228d7d17f5959a99456d89a52d467ee2f329 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Thu, 20 Feb 2025 12:28:34 -0500
Subject: [PATCH 45/73] [compiler][playground] Upgrade to Next 15.2.0-canary.64
 (#32428)

Upgrade compiler playground to use the newest nextjs release, which
includes react compiler transform pipeline optimizations
https://github.com/vercel/next.js/pull/75676/.

Also made a drive-by fix to avoid the error `Cannot update a component
('Router') while rendering a different component ('StoreProvider'). To
locate the bad setState() call inside 'StoreProvider', follow the stack
trace as described in https://react.dev/link/setstate-in-render`. The
bad setState came from `history.replaceState({}, '', \`#${hash}\`);`.

Prior to this, playground ran side effects in a reducer (i.e. during
render). These have now been moved an effect.
---
 .../playground/components/StoreContext.tsx    |  15 +-
 compiler/apps/playground/next-env.d.ts        |   2 +-
 compiler/apps/playground/package.json         |   2 +-
 compiler/apps/playground/yarn.lock            | 129 +++++++++---------
 4 files changed, 76 insertions(+), 72 deletions(-)

diff --git a/compiler/apps/playground/components/StoreContext.tsx b/compiler/apps/playground/components/StoreContext.tsx
index 8529a3c9f84d2..10ad614b05554 100644
--- a/compiler/apps/playground/components/StoreContext.tsx
+++ b/compiler/apps/playground/components/StoreContext.tsx
@@ -6,11 +6,10 @@
  */
 
 import type {Dispatch, ReactNode} from 'react';
-import {useReducer} from 'react';
+import {useEffect, useReducer} from 'react';
 import createContext from '../lib/createContext';
 import {emptyStore} from '../lib/defaultStore';
-import type {Store} from '../lib/stores';
-import {saveStore} from '../lib/stores';
+import {saveStore, type Store} from '../lib/stores';
 
 const StoreContext = createContext<Store>();
 
@@ -31,6 +30,11 @@ export const useStoreDispatch = StoreDispatchContext.useContext;
  */
 export function StoreProvider({children}: {children: ReactNode}): JSX.Element {
   const [store, dispatch] = useReducer(storeReducer, emptyStore);
+  useEffect(() => {
+    if (store !== emptyStore) {
+      saveStore(store);
+    }
+  }, [store]);
 
   return (
     <StoreContext.Provider value={store}>
@@ -59,19 +63,14 @@ function storeReducer(store: Store, action: ReducerAction): Store {
   switch (action.type) {
     case 'setStore': {
       const newStore = action.payload.store;
-
-      saveStore(newStore);
       return newStore;
     }
     case 'updateFile': {
       const {source} = action.payload;
-
       const newStore = {
         ...store,
         source,
       };
-
-      saveStore(newStore);
       return newStore;
     }
   }
diff --git a/compiler/apps/playground/next-env.d.ts b/compiler/apps/playground/next-env.d.ts
index 40c3d68096c27..1b3be0840f3f6 100644
--- a/compiler/apps/playground/next-env.d.ts
+++ b/compiler/apps/playground/next-env.d.ts
@@ -2,4 +2,4 @@
 /// <reference types="next/image-types/global" />
 
 // NOTE: This file should not be edited
-// see https://nextjs.org/docs/app/building-your-application/configuring/typescript for more information.
+// see https://nextjs.org/docs/app/api-reference/config/typescript for more information.
diff --git a/compiler/apps/playground/package.json b/compiler/apps/playground/package.json
index 9b43f18f0e8c4..b8360ae06f5a7 100644
--- a/compiler/apps/playground/package.json
+++ b/compiler/apps/playground/package.json
@@ -34,7 +34,7 @@
     "invariant": "^2.2.4",
     "lz-string": "^1.5.0",
     "monaco-editor": "^0.52.0",
-    "next": "^15.0.1",
+    "next": "^15.2.0-canary.64",
     "notistack": "^3.0.0-alpha.7",
     "prettier": "^3.3.3",
     "pretty-format": "^29.3.1",
diff --git a/compiler/apps/playground/yarn.lock b/compiler/apps/playground/yarn.lock
index dc5362548a7f7..ea0487b01c901 100644
--- a/compiler/apps/playground/yarn.lock
+++ b/compiler/apps/playground/yarn.lock
@@ -589,10 +589,10 @@
   dependencies:
     "@monaco-editor/loader" "^1.4.0"
 
-"@next/env@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/env/-/env-15.0.1.tgz#660fe9303e255cec112d3f4198d2897a24bc60b3"
-  integrity sha512-lc4HeDUKO9gxxlM5G2knTRifqhsY6yYpwuHspBZdboZe0Gp+rZHBNNSIjmQKDJIdRXiXGyVnSD6gafrbQPvILQ==
+"@next/env@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/env/-/env-15.2.0-canary.66.tgz#c4ca0d502ad099c68927643df9c9b5d75c7b7fbb"
+  integrity sha512-/RxW1GJ7a6MJOQ7LOa2bcli7VTjqB7jPyzXwNJQflcYJH4gz1kP6uzg8+IptLJGFSRB58RBKHJk+q1cD8jongA==
 
 "@next/eslint-plugin-next@15.0.1":
   version "15.0.1"
@@ -601,45 +601,45 @@
   dependencies:
     fast-glob "3.3.1"
 
-"@next/swc-darwin-arm64@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-darwin-arm64/-/swc-darwin-arm64-15.0.1.tgz#b80a25f1569bd0ca03eca9473f7e93e64937e404"
-  integrity sha512-C9k/Xv4sxkQRTA37Z6MzNq3Yb1BJMmSqjmwowoWEpbXTkAdfOwnoKOpAb71ItSzoA26yUTIo6ZhN8rKGu4ExQw==
-
-"@next/swc-darwin-x64@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-darwin-x64/-/swc-darwin-x64-15.0.1.tgz#00dcf79ec7c638a85c3b9ff2e2de2bfb09c1c250"
-  integrity sha512-uHl13HXOuq1G7ovWFxCACDJHTSDVbn/sbLv8V1p+7KIvTrYQ5HNoSmKBdYeEKRRCbEmd+OohOgg9YOp8Ux3MBg==
-
-"@next/swc-linux-arm64-gnu@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-15.0.1.tgz#faab5f7ffcc6d1a15e8dea1cb9953966658b39bf"
-  integrity sha512-LvyhvxHOihFTEIbb35KxOc3q8w8G4xAAAH/AQnsYDEnOvwawjL2eawsB59AX02ki6LJdgDaHoTEnC54Gw+82xw==
-
-"@next/swc-linux-arm64-musl@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-15.0.1.tgz#97abada9a782ab5b3cb42cf0d4799cbc2e733351"
-  integrity sha512-vFmCGUFNyk/A5/BYcQNhAQqPIw01RJaK6dRO+ZEhz0DncoW+hJW1kZ8aH2UvTX27zPq3m85zN5waMSbZEmANcQ==
-
-"@next/swc-linux-x64-gnu@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-15.0.1.tgz#548bd47c49fe6d819302139aff8766eb704322e2"
-  integrity sha512-5by7IYq0NCF8rouz6Qg9T97jYU68kaClHPfGpQG2lCZpSYHtSPQF1kjnqBTd34RIqPKMbCa4DqCufirgr8HM5w==
-
-"@next/swc-linux-x64-musl@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-15.0.1.tgz#84423fbd3a058dd6ae8322e530878f0ec7a1027a"
-  integrity sha512-lmYr6H3JyDNBJLzklGXLfbehU3ay78a+b6UmBGlHls4xhDXBNZfgb0aI67sflrX+cGBnv1LgmWzFlYrAYxS1Qw==
-
-"@next/swc-win32-arm64-msvc@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-15.0.1.tgz#723c2ced12a998fb40dc901b8faea9170e788c2f"
-  integrity sha512-DS8wQtl6diAj0eZTdH0sefykm4iXMbHT4MOvLwqZiIkeezKpkgPFcEdFlz3vKvXa2R/2UEgMh48z1nEpNhjeOQ==
-
-"@next/swc-win32-x64-msvc@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-15.0.1.tgz#ec7e3befc0bcc47527537b1eda2b3745beb15a09"
-  integrity sha512-4Ho2ggvDdMKlZ/0e9HNdZ9ngeaBwtc+2VS5oCeqrbXqOgutX6I4U2X/42VBw0o+M5evn4/7v3zKgGHo+9v/VjA==
+"@next/swc-darwin-arm64@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-darwin-arm64/-/swc-darwin-arm64-15.2.0-canary.66.tgz#368438cf713c439b5b4c44d54b5c3b31ee5b772d"
+  integrity sha512-sVzNJWTekcLOdqkDMistBGr84AVh9eSu4o5JQNEOdxHry4jiF8lqixpOg0+Twj2RRuv4bx32h5xaRVvCSUpITQ==
+
+"@next/swc-darwin-x64@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-darwin-x64/-/swc-darwin-x64-15.2.0-canary.66.tgz#3ddc3f4f6e86e204727770e5984cabf52f852472"
+  integrity sha512-Avv6Nf/0j0WVqY72Q0mK2glGhvN7LT7iVF31iBYUe/Cbf2cXBjgpXUVmksJjg+2Fi6uTEpaMoZWSVEpJyPkjVQ==
+
+"@next/swc-linux-arm64-gnu@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-15.2.0-canary.66.tgz#cd3683bf569c66444340b1e4d876913584e93aea"
+  integrity sha512-kUPejaStjKpF79fz4525DKQKADtUuE+T6j7IvLQsZuWrSX3a5Mix+i52fdTzMJ+sFGg3v147wopZt6L6JMIxxA==
+
+"@next/swc-linux-arm64-musl@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-15.2.0-canary.66.tgz#453836b11efdb50b91cf8a6cfbce8779f6778dd9"
+  integrity sha512-U8l8jaZ+BAU5wn3bw7PRqq4vGTpObBt+7JbJLpbDqB1GfkZdCDc4nGtqAfLy3pY0O4lEfqal9jrsEVtUBCbfHg==
+
+"@next/swc-linux-x64-gnu@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-15.2.0-canary.66.tgz#f02b295febaacf8d041f9f149c30c41aea16a81f"
+  integrity sha512-c+AV8ZN1znGBHu5BACGym+9FhV8+213XVHFI7i2J7TSsJ6T+Eofhwn0tSn1Vy/XpVmpyoEdkwepL+djbdQAGhw==
+
+"@next/swc-linux-x64-musl@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-15.2.0-canary.66.tgz#f942c000ba3ffc0289520d25fa1067a75e72fa41"
+  integrity sha512-4mTIv86qyXuo8NfjigSQ7rk2cDwM8/f8R/kf3hNh8NF1Aaat2RrEet9a/SbsuNpdhhNnPI5RcRwpIJx2JQSPcQ==
+
+"@next/swc-win32-arm64-msvc@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-15.2.0-canary.66.tgz#0ffdcf5c74b5aa6214307f2ae4aa84f1526e6bf9"
+  integrity sha512-NPnfsDQXk44h8VtncWq2AgLjHDbUMsc8Tpz7pcLe9qb8lZSxZ9jYbV7NwKzgd+qJbjy/58vgCWhL5PhyXDlWwQ==
+
+"@next/swc-win32-x64-msvc@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-15.2.0-canary.66.tgz#458245850cf407d2551155e4662785c109f58bda"
+  integrity sha512-L/ef++GJqW+T3g2x6mrZ2vrBK+6QS9Ieam8EqK9dG7cFKv7Gqm9yrHvDuVse62hnNB11ZdxfDDKrs9vabuQLlw==
 
 "@nodelib/fs.scandir@2.1.5":
   version "2.1.5"
@@ -716,12 +716,12 @@
   resolved "https://registry.yarnpkg.com/@swc/counter/-/counter-0.1.3.tgz#cc7463bd02949611c6329596fccd2b0ec782b0e9"
   integrity sha512-e2BR4lsJkkRlKZ/qCHPw9ZaSxc0MVUd7gtbtaB7aMvHeJVYe8sOB8DBZkP2DtISHGSku9sCK6T6cnY0CtXrOCQ==
 
-"@swc/helpers@0.5.13":
-  version "0.5.13"
-  resolved "https://registry.yarnpkg.com/@swc/helpers/-/helpers-0.5.13.tgz#33e63ff3cd0cade557672bd7888a39ce7d115a8c"
-  integrity sha512-UoKGxQ3r5kYI9dALKJapMmuK+1zWM/H17Z1+iwnNmzcJRnfFuevZs375TA5rW31pu4BS4NoSy1fRsexDXfWn5w==
+"@swc/helpers@0.5.15":
+  version "0.5.15"
+  resolved "https://registry.yarnpkg.com/@swc/helpers/-/helpers-0.5.15.tgz#79efab344c5819ecf83a43f3f9f811fc84b516d7"
+  integrity sha512-JQ5TuMi45Owi4/BIMAJBoSQoOJu12oOk/gADqlcUL9JEdHB8vyjUSsxqeNXnmXHjYKMi2WcYtezGEEhqUI/E2g==
   dependencies:
-    tslib "^2.4.0"
+    tslib "^2.8.0"
 
 "@types/json5@^0.0.29":
   version "0.0.29"
@@ -2682,27 +2682,27 @@ natural-compare@^1.4.0:
   resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
   integrity sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==
 
-next@^15.0.1:
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/next/-/next-15.0.1.tgz#a0e8eda35d803cb7f8092b2a2eb9d072e22bf21d"
-  integrity sha512-PSkFkr/w7UnFWm+EP8y/QpHrJXMqpZzAXpergB/EqLPOh4SGPJXv1wj4mslr2hUZBAS9pX7/9YLIdxTv6fwytw==
+next@^15.2.0-canary.64:
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/next/-/next-15.2.0-canary.66.tgz#cb5ee4453c88f247b6e74fe33fd181eca58e7c86"
+  integrity sha512-S+gsEu8vxxejI7nKqtCLqZlTi9L40xelLRK/Fgtvm/XT8W8ziLp3KMtN4I9Si5nEMU5uv7bllIfd04kVX8+HIw==
   dependencies:
-    "@next/env" "15.0.1"
+    "@next/env" "15.2.0-canary.66"
     "@swc/counter" "0.1.3"
-    "@swc/helpers" "0.5.13"
+    "@swc/helpers" "0.5.15"
     busboy "1.6.0"
     caniuse-lite "^1.0.30001579"
     postcss "8.4.31"
     styled-jsx "5.1.6"
   optionalDependencies:
-    "@next/swc-darwin-arm64" "15.0.1"
-    "@next/swc-darwin-x64" "15.0.1"
-    "@next/swc-linux-arm64-gnu" "15.0.1"
-    "@next/swc-linux-arm64-musl" "15.0.1"
-    "@next/swc-linux-x64-gnu" "15.0.1"
-    "@next/swc-linux-x64-musl" "15.0.1"
-    "@next/swc-win32-arm64-msvc" "15.0.1"
-    "@next/swc-win32-x64-msvc" "15.0.1"
+    "@next/swc-darwin-arm64" "15.2.0-canary.66"
+    "@next/swc-darwin-x64" "15.2.0-canary.66"
+    "@next/swc-linux-arm64-gnu" "15.2.0-canary.66"
+    "@next/swc-linux-arm64-musl" "15.2.0-canary.66"
+    "@next/swc-linux-x64-gnu" "15.2.0-canary.66"
+    "@next/swc-linux-x64-musl" "15.2.0-canary.66"
+    "@next/swc-win32-arm64-msvc" "15.2.0-canary.66"
+    "@next/swc-win32-x64-msvc" "15.2.0-canary.66"
     sharp "^0.33.5"
 
 node-releases@^2.0.18:
@@ -3559,6 +3559,11 @@ tslib@^2.1.0, tslib@^2.4.0:
   resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.7.0.tgz#d9b40c5c40ab59e8738f297df3087bf1a2690c01"
   integrity sha512-gLXCKdN1/j47AiHiOkJN69hJmcbGTHI0ImLmbYLHykhgeN0jVGola9yVjFgzCUklsZQMW55o+dW7IXv3RCXDzA==
 
+tslib@^2.8.0:
+  version "2.8.1"
+  resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.8.1.tgz#612efe4ed235d567e8aba5f2a5fab70280ade83f"
+  integrity sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w==
+
 type-check@^0.4.0, type-check@~0.4.0:
   version "0.4.0"
   resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"

From 885532c124f32436723cd51627d06de6e8c13fdd Mon Sep 17 00:00:00 2001
From: Jack Pope <jackpope1@gmail.com>
Date: Thu, 20 Feb 2025 12:29:01 -0500
Subject: [PATCH 46/73] Revert "Ship enableFabricCompleteRootInCommitPhase
 (#32318)" (#32434)

This reverts commit 8759c5c8d6aef34df576827215ff7ebaeafc79ea /
https://github.com/facebook/react/pull/32318

We discovered that the experiment setup for this was faulty and we need
to re-run as a back test.
---
 .../src/ReactFiberConfigFabric.js                      | 10 ++++++++--
 packages/shared/ReactFeatureFlags.js                   |  5 +++++
 .../forks/ReactFeatureFlags.native-fb-dynamic.js       |  1 +
 packages/shared/forks/ReactFeatureFlags.native-fb.js   |  1 +
 packages/shared/forks/ReactFeatureFlags.native-oss.js  |  1 +
 .../shared/forks/ReactFeatureFlags.test-renderer.js    |  1 +
 .../forks/ReactFeatureFlags.test-renderer.native-fb.js |  1 +
 .../forks/ReactFeatureFlags.test-renderer.www.js       |  1 +
 packages/shared/forks/ReactFeatureFlags.www.js         |  1 +
 9 files changed, 20 insertions(+), 2 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactFiberConfigFabric.js b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
index d28b3400c66c3..6db223e4b4dc5 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigFabric.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
@@ -58,6 +58,7 @@ import {
 } from './ReactNativeFiberInspector';
 
 import {
+  enableFabricCompleteRootInCommitPhase,
   passChildrenWhenCloningPersistedNodes,
   enableLazyPublicInstanceInFabric,
 } from 'shared/ReactFeatureFlags';
@@ -533,14 +534,19 @@ export function finalizeContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  // Noop - children will be finalized in replaceContainerChildren
+  if (!enableFabricCompleteRootInCommitPhase) {
+    completeRoot(container.containerTag, newChildren);
+  }
 }
 
 export function replaceContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  completeRoot(container.containerTag, newChildren);
+  // Noop - children will be replaced in finalizeContainerChildren
+  if (enableFabricCompleteRootInCommitPhase) {
+    completeRoot(container.containerTag, newChildren);
+  }
 }
 
 export {getClosestInstanceFromNode as getInstanceFromNode};
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index ea09d0a3c76e3..f1f1a09373664 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -94,6 +94,11 @@ export const enableViewTransition = __EXPERIMENTAL__;
 
 export const enableSwipeTransition = __EXPERIMENTAL__;
 
+/**
+ * Switches the Fabric API from doing layout in commit work instead of complete work.
+ */
+export const enableFabricCompleteRootInCommitPhase = false;
+
 /**
  * Switches Fiber creation to a simple object instead of a constructor.
  */
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index d3c5de81bd909..6825b2b608b9b 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -23,6 +23,7 @@ export const enableHiddenSubtreeInsertionEffectCleanup = __VARIANT__;
 export const enablePersistedModeClonedFlag = __VARIANT__;
 export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
+export const enableFabricCompleteRootInCommitPhase = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index a0544dc161173..5c3015563d51c 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -20,6 +20,7 @@ const dynamicFlags: DynamicExportsType = (dynamicFlagsUntyped: any);
 // the exports object every time a flag is read.
 export const {
   alwaysThrottleRetries,
+  enableFabricCompleteRootInCommitPhase,
   enableHiddenSubtreeInsertionEffectCleanup,
   enableObjectFiber,
   enablePersistedModeClonedFlag,
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index fd846cf312212..f767b3427b25f 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -30,6 +30,7 @@ export const enableAsyncIterableChildren = false;
 export const enableCPUSuspense = false;
 export const enableCreateEventHandleAPI = false;
 export const enableDO_NOT_USE_disableStrictPassiveEffect = false;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableMoveBefore = true;
 export const enableFizzExternalRuntime = true;
 export const enableHalt = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 5945416050286..181e504ef7e1b 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -36,6 +36,7 @@ export const enableUseEffectEventHook = false;
 export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = false;
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index e4f1210c29f00..dcca098b21539 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -61,6 +61,7 @@ export const renameElementSymbol = false;
 export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableSiblingPrerendering = true;
 export const enableUseEffectCRUDOverload = true;
 export const enableHydrationLaneScheduling = true;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 112b30fe04a81..31ac32b253dd4 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -39,6 +39,7 @@ export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
 export const enableRenderableContext = false;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = true;
 
 export const enableRetryLaneExpiration = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index ec0337382e957..f3fdc1e4f489e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -50,6 +50,7 @@ export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
 export const enableUpdaterTracking = __PROFILE__;
+export const enableFabricCompleteRootInCommitPhase = false;
 
 export const enableSuspenseAvoidThisFallback = true;
 

From 70f1d766e8ae7ca3701193abb8c8a9f2fdbdaa9d Mon Sep 17 00:00:00 2001
From: Sam Zhou <sam@developersam.com>
Date: Thu, 20 Feb 2025 12:42:33 -0500
Subject: [PATCH 47/73] [flow] Eliminate usage of global React types in
 ReactNativeTypes.js (#32330)

---
 .../react-native-renderer/src/ReactNativeTypes.js   | 13 ++++++++++---
 packages/react/index.js                             |  1 +
 2 files changed, 11 insertions(+), 3 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 261e1f0b63104..1aa11cb3be0d7 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -9,7 +9,13 @@
  * @flow strict
  */
 
-import type {ElementRef, ElementType, MixedElement} from 'react';
+import type {
+  Component as ReactComponent,
+  ElementRef,
+  ElementType,
+  MixedElement,
+  RefSetter,
+} from 'react';
 // $FlowFixMe[nonstrict-import] TODO(@rubennorte)
 import {type PublicRootInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
@@ -135,7 +141,7 @@ declare const ensureNativeMethodsAreSynced: NativeMethods;
 
 export type HostInstance = NativeMethods;
 export type HostComponent<Config: {...}> = component(
-  ref: React$RefSetter<HostInstance>,
+  ref: RefSetter<HostInstance>,
   ...Config
 );
 
@@ -188,7 +194,8 @@ export type RenderRootOptions = {
     errorInfo: {
       +componentStack?: ?string,
       // $FlowFixMe[unclear-type] unknown props and state.
-      +errorBoundary?: ?React$Component<any, any>,
+      // $FlowFixMe[value-as-type] Component in react repo is any-typed, but it will be well typed externally.
+      +errorBoundary?: ?ReactComponent<any, any>,
     },
   ) => void,
   onRecoverableError?: (
diff --git a/packages/react/index.js b/packages/react/index.js
index af4cd4b0c1b17..92e1cf181ec1b 100644
--- a/packages/react/index.js
+++ b/packages/react/index.js
@@ -17,6 +17,7 @@ export type Key = React$Key;
 export type Node = React$Node;
 export type Context<T> = React$Context<T>;
 export type Portal = React$Portal;
+export type RefSetter<-I> = React$RefSetter<I>;
 export type ElementProps<C> = React$ElementProps<C>;
 export type ElementConfig<C> = React$ElementConfig<C>;
 export type ElementRef<C> = React$ElementRef<C>;

From 88479c6fc31ba2902587694338350ae95733d6b2 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Thu, 20 Feb 2025 18:13:09 -0500
Subject: [PATCH 48/73] Rerender useSwipeTransition when direction changes
 (#32379)

We can only render one direction at a time with View Transitions. When
the direction changes we need to do another render in the new direction
(returning previous or next).

To determine direction we store the position we started at and anything
moving to a lower value (left/up) is "previous" direction (`false`) and
anything else is "next" (`true`) direction.

For the very first render we won't know which direction you're going
since you're still on the initial position. It's useful to start the
render to allow the view transition to take control before anything
shifts around so we start from the original position. This is not
guaranteed though if the render suspends.

For now we start the first render by guessing the direction such as if
we know that prev/next are the same as current. With the upcoming auto
start mode we can guess more accurately there before we start. We can
also add explicit APIs to `startGesture` but ideally it wouldn't matter.
Ideally we could just start after the first change in direction from the
starting point.
---
 .eslintrc.js                                  |  1 +
 .../view-transition/src/components/Page.js    |  4 +-
 packages/react-art/src/ReactFiberConfigART.js |  9 +++
 .../src/client/ReactFiberConfigDOM.js         | 54 +++++++++++++++
 .../src/ReactFiberConfigNative.js             |  9 +++
 .../src/createReactNoop.js                    |  9 +++
 .../src/ReactFiberConfigWithNoMutation.js     |  2 +
 .../src/ReactFiberGestureScheduler.js         | 37 +++++++++-
 .../react-reconciler/src/ReactFiberHooks.js   | 67 ++++++++++++-------
 .../src/forks/ReactFiberConfig.custom.js      |  3 +
 .../src/ReactFiberConfigTestHost.js           |  9 +++
 packages/shared/ReactTypes.js                 |  2 +-
 scripts/error-codes/codes.json                |  5 +-
 scripts/flow/environment.js                   | 12 ++++
 scripts/rollup/validate/eslintrc.cjs.js       |  2 +
 scripts/rollup/validate/eslintrc.cjs2015.js   |  1 +
 scripts/rollup/validate/eslintrc.esm.js       |  2 +
 scripts/rollup/validate/eslintrc.fb.js        |  2 +
 scripts/rollup/validate/eslintrc.rn.js        |  2 +
 19 files changed, 200 insertions(+), 32 deletions(-)

diff --git a/.eslintrc.js b/.eslintrc.js
index 360bd5ba76a9c..ae108a37e3da1 100644
--- a/.eslintrc.js
+++ b/.eslintrc.js
@@ -614,6 +614,7 @@ module.exports = {
     KeyframeAnimationOptions: 'readonly',
     GetAnimationsOptions: 'readonly',
     Animatable: 'readonly',
+    ScrollTimeline: 'readonly',
 
     spyOnDev: 'readonly',
     spyOnDevAndProd: 'readonly',
diff --git a/fixtures/view-transition/src/components/Page.js b/fixtures/view-transition/src/components/Page.js
index 1c7a9bfeb32db..589d09a79ad7d 100644
--- a/fixtures/view-transition/src/components/Page.js
+++ b/fixtures/view-transition/src/components/Page.js
@@ -68,10 +68,12 @@ export default function Page({url, navigate}) {
       activeGesture.current = null;
       cancelGesture();
     }
+    // Reset scroll
+    swipeRecognizer.current.scrollLeft = !show ? 0 : 10000;
   }
 
   useLayoutEffect(() => {
-    swipeRecognizer.current.scrollLeft = show ? 0 : 10000;
+    swipeRecognizer.current.scrollLeft = !show ? 0 : 10000;
   }, [show]);
 
   const exclamation = (
diff --git a/packages/react-art/src/ReactFiberConfigART.js b/packages/react-art/src/ReactFiberConfigART.js
index 95acc9e541e99..18cc84b18e3c8 100644
--- a/packages/react-art/src/ReactFiberConfigART.js
+++ b/packages/react-art/src/ReactFiberConfigART.js
@@ -508,6 +508,15 @@ export function createViewTransitionInstance(
   return null;
 }
 
+export type GestureTimeline = null;
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  throw new Error('useSwipeTransition is not yet supported in react-art.');
+}
+
 export function clearContainer(container) {
   // TODO Implement this
 }
diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index e96810122da6e..626231a1fae6a 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -1478,6 +1478,60 @@ export function createViewTransitionInstance(
   };
 }
 
+export type GestureTimeline = AnimationTimeline; // TODO: More provider types.
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  const time = provider.currentTime;
+  if (time === null) {
+    throw new Error(
+      'Cannot start a gesture with a disconnected AnimationTimeline.',
+    );
+  }
+  const startTime = typeof time === 'number' ? time : time.value;
+  if (
+    typeof ScrollTimeline === 'function' &&
+    provider instanceof ScrollTimeline
+  ) {
+    // For ScrollTimeline we optimize to only update the current time on scroll events.
+    const element = provider.source;
+    const scrollCallback = () => {
+      const newTime = provider.currentTime;
+      if (newTime !== null) {
+        directionCallback(
+          typeof newTime === 'number'
+            ? newTime > startTime
+            : newTime.value > startTime,
+        );
+      }
+    };
+    element.addEventListener('scroll', scrollCallback, false);
+    return () => {
+      element.removeEventListener('scroll', scrollCallback, false);
+    };
+  } else {
+    // For other AnimationTimelines, such as DocumentTimeline, we just update every rAF.
+    // TODO: Optimize ViewTimeline using an IntersectionObserver if it becomes common.
+    const rafCallback = () => {
+      const newTime = provider.currentTime;
+      if (newTime !== null) {
+        directionCallback(
+          typeof newTime === 'number'
+            ? newTime > startTime
+            : newTime.value > startTime,
+        );
+      }
+      callbackID = requestAnimationFrame(rafCallback);
+    };
+    let callbackID = requestAnimationFrame(rafCallback);
+    return () => {
+      cancelAnimationFrame(callbackID);
+    };
+  }
+}
+
 export function clearContainer(container: Container): void {
   const nodeType = container.nodeType;
   if (nodeType === DOCUMENT_NODE) {
diff --git a/packages/react-native-renderer/src/ReactFiberConfigNative.js b/packages/react-native-renderer/src/ReactFiberConfigNative.js
index b565e89e9c524..7929ed7bd87e3 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigNative.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigNative.js
@@ -605,6 +605,15 @@ export function createViewTransitionInstance(
   return null;
 }
 
+export type GestureTimeline = null;
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  throw new Error('useSwipeTransition is not yet supported in React Native.');
+}
+
 export function clearContainer(container: Container): void {
   // TODO Implement this for React Native
   // UIManager does not expose a "remove all" type method.
diff --git a/packages/react-noop-renderer/src/createReactNoop.js b/packages/react-noop-renderer/src/createReactNoop.js
index f412f90f6c87f..985c715bd4130 100644
--- a/packages/react-noop-renderer/src/createReactNoop.js
+++ b/packages/react-noop-renderer/src/createReactNoop.js
@@ -95,6 +95,8 @@ export type FormInstance = Instance;
 
 export type ViewTransitionInstance = null | {name: string, ...};
 
+export type GestureTimeline = null;
+
 const NO_CONTEXT = {};
 const UPPERCASE_CONTEXT = {};
 if (__DEV__) {
@@ -794,6 +796,13 @@ function createReactNoop(reconciler: Function, useMutation: boolean) {
           return null;
         },
 
+        subscribeToGestureDirection(
+          provider: GestureTimeline,
+          directionCallback: (direction: boolean) => void,
+        ): () => void {
+          return () => {};
+        },
+
         resetTextContent(instance: Instance): void {
           instance.text = null;
         },
diff --git a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
index 5e54757807cd8..26231df8bfe52 100644
--- a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
+++ b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
@@ -48,3 +48,5 @@ export const hasInstanceAffectedParent = shim;
 export const startViewTransition = shim;
 export type ViewTransitionInstance = null | {name: string, ...};
 export const createViewTransitionInstance = shim;
+export type GestureTimeline = any;
+export const subscribeToGestureDirection = shim;
diff --git a/packages/react-reconciler/src/ReactFiberGestureScheduler.js b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
index 7664316b67558..acbc6ab765850 100644
--- a/packages/react-reconciler/src/ReactFiberGestureScheduler.js
+++ b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
@@ -8,22 +8,26 @@
  */
 
 import type {FiberRoot} from './ReactInternalTypes';
-import type {GestureProvider} from 'shared/ReactTypes';
+import type {GestureTimeline} from './ReactFiberConfig';
 
 import {GestureLane} from './ReactFiberLane';
 import {ensureRootIsScheduled} from './ReactFiberRootScheduler';
+import {subscribeToGestureDirection} from './ReactFiberConfig';
 
 // This type keeps track of any scheduled or active gestures.
 export type ScheduledGesture = {
-  provider: GestureProvider,
+  provider: GestureTimeline,
   count: number, // The number of times this same provider has been started.
+  direction: boolean, // false = previous, true = next
+  cancel: () => void, // Cancel the subscription to direction change.
   prev: null | ScheduledGesture, // The previous scheduled gesture in the queue for this root.
   next: null | ScheduledGesture, // The next scheduled gesture in the queue for this root.
 };
 
 export function scheduleGesture(
   root: FiberRoot,
-  provider: GestureProvider,
+  provider: GestureTimeline,
+  initialDirection: boolean,
 ): ScheduledGesture {
   let prev = root.gestures;
   while (prev !== null) {
@@ -39,9 +43,32 @@ export function scheduleGesture(
     prev = next;
   }
   // Add new instance to the end of the queue.
+  const cancel = subscribeToGestureDirection(provider, (direction: boolean) => {
+    if (gesture.direction !== direction) {
+      gesture.direction = direction;
+      if (gesture.prev === null && root.gestures !== gesture) {
+        // This gesture is not in the schedule, meaning it was already rendered.
+        // We need to rerender in the new direction. Insert it into the first slot
+        // in case other gestures are queued after the on-going one.
+        const existing = root.gestures;
+        gesture.next = existing;
+        if (existing !== null) {
+          existing.prev = gesture;
+        }
+        root.gestures = gesture;
+        // Schedule the lane on the root. The Fibers will already be marked as
+        // long as the gesture is active on that Hook.
+        root.pendingLanes |= GestureLane;
+        ensureRootIsScheduled(root);
+      }
+      // TODO: If we're currently rendering this gesture, we need to restart it.
+    }
+  });
   const gesture: ScheduledGesture = {
     provider: provider,
     count: 1,
+    direction: initialDirection,
+    cancel: cancel,
     prev: prev,
     next: null,
   };
@@ -60,8 +87,12 @@ export function cancelScheduledGesture(
 ): void {
   gesture.count--;
   if (gesture.count === 0) {
+    const cancelDirectionSubscription = gesture.cancel;
+    cancelDirectionSubscription();
     // Delete the scheduled gesture from the queue.
     deleteScheduledGesture(root, gesture);
+    // TODO: If we're currently rendering this gesture, we need to restart the render
+    // on a different gesture or cancel the render..
   }
 }
 
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 06e00441c3b8e..16ceb167683b4 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -27,7 +27,7 @@ import type {
 import type {Lanes, Lane} from './ReactFiberLane';
 import type {HookFlags} from './ReactHookEffectTags';
 import type {Flags} from './ReactFiberFlags';
-import type {TransitionStatus} from './ReactFiberConfig';
+import type {TransitionStatus, GestureTimeline} from './ReactFiberConfig';
 import type {ScheduledGesture} from './ReactFiberGestureScheduler';
 
 import {
@@ -3981,6 +3981,7 @@ type SwipeTransitionGestureUpdate = {
 type SwipeTransitionUpdateQueue = {
   pending: null | SwipeTransitionGestureUpdate,
   dispatch: StartGesture,
+  initialDirection: boolean,
 };
 
 function startGesture(
@@ -3996,9 +3997,14 @@ function startGesture(
       // Noop.
     };
   }
-  const scheduledGesture = scheduleGesture(root, gestureProvider);
+  const gestureTimeline: GestureTimeline = gestureProvider;
+  const scheduledGesture = scheduleGesture(
+    root,
+    gestureTimeline,
+    queue.initialDirection,
+  );
   // Add this particular instance to the queue.
-  // We add multiple of the same provider even if they get batched so
+  // We add multiple of the same timeline even if they get batched so
   // that if we cancel one but not the other we can keep track of this.
   // Order doesn't matter but we insert in the beginning to avoid two fields.
   const update: SwipeTransitionGestureUpdate = {
@@ -4041,6 +4047,7 @@ function mountSwipeTransition<T>(
   const queue: SwipeTransitionUpdateQueue = {
     pending: null,
     dispatch: (null: any),
+    initialDirection: previous === current,
   };
   const startGestureOnHook: StartGesture = (queue.dispatch = (startGesture.bind(
     null,
@@ -4062,31 +4069,34 @@ function updateSwipeTransition<T>(
   const startGestureOnHook: StartGesture = queue.dispatch;
   const rootRenderLanes = getWorkInProgressRootRenderLanes();
   let value = current;
-  if (isGestureRender(rootRenderLanes)) {
-    // We're inside a gesture render. We'll traverse the queue to see if
-    // this specific Hook is part of this gesture and, if so, which
-    // direction to render.
-    const root: FiberRoot | null = getWorkInProgressRoot();
-    if (root === null) {
-      throw new Error(
-        'Expected a work-in-progress root. This is a bug in React. Please file an issue.',
-      );
-    }
-    // We assume that the currently rendering gesture is the one first in the queue.
-    const rootRenderGesture = root.gestures;
-    let update = queue.pending;
-    while (update !== null) {
-      if (rootRenderGesture === update.gesture) {
-        // We had a match, meaning we're currently rendering a direction of this
-        // hook for this gesture.
-        // TODO: Determine which direction this gesture is currently rendering.
-        value = previous;
-        break;
+  if (queue.pending !== null) {
+    if (isGestureRender(rootRenderLanes)) {
+      // We're inside a gesture render. We'll traverse the queue to see if
+      // this specific Hook is part of this gesture and, if so, which
+      // direction to render.
+      const root: FiberRoot | null = getWorkInProgressRoot();
+      if (root === null) {
+        throw new Error(
+          'Expected a work-in-progress root. This is a bug in React. Please file an issue.',
+        );
       }
-      update = update.next;
+      // We assume that the currently rendering gesture is the one first in the queue.
+      const rootRenderGesture = root.gestures;
+      if (rootRenderGesture !== null) {
+        let update = queue.pending;
+        while (update !== null) {
+          if (rootRenderGesture === update.gesture) {
+            // We had a match, meaning we're currently rendering a direction of this
+            // hook for this gesture.
+            value = rootRenderGesture.direction ? next : previous;
+            break;
+          }
+          update = update.next;
+        }
+      }
+      // This lane cannot be cleared as long as we have active gestures.
+      markWorkInProgressReceivedUpdate();
     }
-  }
-  if (queue.pending !== null) {
     // As long as there are any active gestures we need to leave the lane on
     // in case we need to render it later. Since a gesture render doesn't commit
     // the only time it really fully gets cleared is if something else rerenders
@@ -4096,6 +4106,11 @@ function updateSwipeTransition<T>(
       GestureLane,
     );
   }
+  // By default, we don't know which direction we should start until a movement
+  // has happened. However, if one direction has the same value as current we
+  // know that it's probably not that direction since it won't do anything anyway.
+  // TODO: Add an explicit option to provide this.
+  queue.initialDirection = previous === current;
   return [value, startGestureOnHook];
 }
 
diff --git a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
index ee5f40ad829ad..3a5cccc6d3695 100644
--- a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
+++ b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
@@ -43,6 +43,7 @@ export opaque type FormInstance = mixed;
 export type ViewTransitionInstance = null | {name: string, ...};
 export opaque type InstanceMeasurement = mixed;
 export type EventResponder = any;
+export type GestureTimeline = any;
 
 export const rendererVersion = $$$config.rendererVersion;
 export const rendererPackageName = $$$config.rendererPackageName;
@@ -144,6 +145,8 @@ export const wasInstanceInViewport = $$$config.wasInstanceInViewport;
 export const hasInstanceChanged = $$$config.hasInstanceChanged;
 export const hasInstanceAffectedParent = $$$config.hasInstanceAffectedParent;
 export const startViewTransition = $$$config.startViewTransition;
+export const subscribeToGestureDirection =
+  $$$config.subscribeToGestureDirection;
 export const createViewTransitionInstance =
   $$$config.createViewTransitionInstance;
 export const clearContainer = $$$config.clearContainer;
diff --git a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
index aa8b34523b3b4..922155f35b8f3 100644
--- a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
+++ b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
@@ -391,6 +391,15 @@ export function getInstanceFromNode(mockNode: Object): Object | null {
   return null;
 }
 
+export type GestureTimeline = null;
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  return () => {};
+}
+
 export function beforeActiveInstanceBlur(internalInstanceHandle: Object) {
   // noop
 }
diff --git a/packages/shared/ReactTypes.js b/packages/shared/ReactTypes.js
index 0402f9aac1832..fbf4e9b06fce9 100644
--- a/packages/shared/ReactTypes.js
+++ b/packages/shared/ReactTypes.js
@@ -170,7 +170,7 @@ export type ReactFormState<S, ReferenceId> = [
 
 // Intrinsic GestureProvider. This type varies by Environment whether a particular
 // renderer supports it.
-export type GestureProvider = AnimationTimeline; // TODO: More provider types.
+export type GestureProvider = any;
 
 export type StartGesture = (gestureProvider: GestureProvider) => () => void;
 
diff --git a/scripts/error-codes/codes.json b/scripts/error-codes/codes.json
index f001b660bd2aa..a55d7505cebf9 100644
--- a/scripts/error-codes/codes.json
+++ b/scripts/error-codes/codes.json
@@ -533,5 +533,8 @@
   "545": "The %s tag may only be rendered once.",
   "546": "useEffect CRUD overload is not enabled in this build of React.",
   "547": "startGesture cannot be called during server rendering.",
-  "548": "Finished rendering the gesture lane but there were no pending gestures. React should not have started a render in this case. This is a bug in React."
+  "548": "Finished rendering the gesture lane but there were no pending gestures. React should not have started a render in this case. This is a bug in React.",
+  "549": "Cannot start a gesture with a disconnected AnimationTimeline.",
+  "550": "useSwipeTransition is not yet supported in react-art.",
+  "551": "useSwipeTransition is not yet supported in React Native."
 }
diff --git a/scripts/flow/environment.js b/scripts/flow/environment.js
index a083223ba1b5e..96784a8353383 100644
--- a/scripts/flow/environment.js
+++ b/scripts/flow/environment.js
@@ -33,6 +33,18 @@ declare interface ConsoleTask {
   run<T>(f: () => T): T;
 }
 
+type ScrollTimelineOptions = {
+  source: Element,
+  axis?: 'block' | 'inline' | 'x' | 'y',
+  ...
+};
+
+declare class ScrollTimeline extends AnimationTimeline {
+  constructor(options?: ScrollTimelineOptions): void;
+  axis: 'block' | 'inline' | 'x' | 'y';
+  source: Element;
+}
+
 // Flow hides the props of React$Element, this overrides it to unhide
 // them for React internals.
 // prettier-ignore
diff --git a/scripts/rollup/validate/eslintrc.cjs.js b/scripts/rollup/validate/eslintrc.cjs.js
index b974ecee0d903..88d17772d7b21 100644
--- a/scripts/rollup/validate/eslintrc.cjs.js
+++ b/scripts/rollup/validate/eslintrc.cjs.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.cjs2015.js b/scripts/rollup/validate/eslintrc.cjs2015.js
index 6efc8838f0326..8e87c8dbe0203 100644
--- a/scripts/rollup/validate/eslintrc.cjs2015.js
+++ b/scripts/rollup/validate/eslintrc.cjs2015.js
@@ -32,6 +32,7 @@ module.exports = {
     Reflect: 'readonly',
     globalThis: 'readonly',
     FinalizationRegistry: 'readonly',
+    ScrollTimeline: 'readonly',
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.esm.js b/scripts/rollup/validate/eslintrc.esm.js
index 20b5341a82ad8..8b4bba35796fa 100644
--- a/scripts/rollup/validate/eslintrc.esm.js
+++ b/scripts/rollup/validate/eslintrc.esm.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.fb.js b/scripts/rollup/validate/eslintrc.fb.js
index 9606d00b353ac..f0602e79e5074 100644
--- a/scripts/rollup/validate/eslintrc.fb.js
+++ b/scripts/rollup/validate/eslintrc.fb.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.rn.js b/scripts/rollup/validate/eslintrc.rn.js
index 941b1d1872efd..052edabdc0f92 100644
--- a/scripts/rollup/validate/eslintrc.rn.js
+++ b/scripts/rollup/validate/eslintrc.rn.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',

From 662957cc735a7f630b497ada45af8ff39684d2b9 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Fri, 21 Feb 2025 11:03:04 -0500
Subject: [PATCH 49/73] Allow passing range option to useSwipeTransition
 (#32412)

Stacked on #32379

Track the range offsets along the timeline where previous/current/next
is. This can also be specified as an option. This lets you model more
than three states along a timeline by clamping them and then updating
the "current" as you go.

It also allows specifying the "current" offset as something different
than what it was when the gesture started such as if it has to start
after scroll has already happened (such as what happens if you listen to
the "scroll" event).
---
 packages/react-art/src/ReactFiberConfigART.js |  5 ++
 .../src/client/ReactFiberConfigDOM.js         | 32 ++++++-----
 .../src/ReactFiberConfigNative.js             |  5 ++
 .../src/createReactNoop.js                    |  5 ++
 .../src/ReactFiberConfigWithNoMutation.js     |  1 +
 .../src/ReactFiberGestureScheduler.js         | 55 ++++++++++++-------
 .../react-reconciler/src/ReactFiberHooks.js   | 39 ++++++++++++-
 .../src/forks/ReactFiberConfig.custom.js      |  1 +
 .../src/ReactFiberConfigTestHost.js           |  5 ++
 packages/shared/ReactTypes.js                 | 10 +++-
 10 files changed, 122 insertions(+), 36 deletions(-)

diff --git a/packages/react-art/src/ReactFiberConfigART.js b/packages/react-art/src/ReactFiberConfigART.js
index 18cc84b18e3c8..a011bdf5c71c7 100644
--- a/packages/react-art/src/ReactFiberConfigART.js
+++ b/packages/react-art/src/ReactFiberConfigART.js
@@ -510,8 +510,13 @@ export function createViewTransitionInstance(
 
 export type GestureTimeline = null;
 
+export function getCurrentGestureOffset(provider: GestureTimeline): number {
+  throw new Error('useSwipeTransition is not yet supported in react-art.');
+}
+
 export function subscribeToGestureDirection(
   provider: GestureTimeline,
+  currentOffset: number,
   directionCallback: (direction: boolean) => void,
 ): () => void {
   throw new Error('useSwipeTransition is not yet supported in react-art.');
diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index 626231a1fae6a..52560d0b006b0 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -1480,17 +1480,21 @@ export function createViewTransitionInstance(
 
 export type GestureTimeline = AnimationTimeline; // TODO: More provider types.
 
-export function subscribeToGestureDirection(
-  provider: GestureTimeline,
-  directionCallback: (direction: boolean) => void,
-): () => void {
+export function getCurrentGestureOffset(provider: GestureTimeline): number {
   const time = provider.currentTime;
   if (time === null) {
     throw new Error(
       'Cannot start a gesture with a disconnected AnimationTimeline.',
     );
   }
-  const startTime = typeof time === 'number' ? time : time.value;
+  return typeof time === 'number' ? time : time.value;
+}
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  currentOffset: number,
+  directionCallback: (direction: boolean) => void,
+): () => void {
   if (
     typeof ScrollTimeline === 'function' &&
     provider instanceof ScrollTimeline
@@ -1500,11 +1504,10 @@ export function subscribeToGestureDirection(
     const scrollCallback = () => {
       const newTime = provider.currentTime;
       if (newTime !== null) {
-        directionCallback(
-          typeof newTime === 'number'
-            ? newTime > startTime
-            : newTime.value > startTime,
-        );
+        const newValue = typeof newTime === 'number' ? newTime : newTime.value;
+        if (newValue !== currentOffset) {
+          directionCallback(newValue > currentOffset);
+        }
       }
     };
     element.addEventListener('scroll', scrollCallback, false);
@@ -1517,11 +1520,10 @@ export function subscribeToGestureDirection(
     const rafCallback = () => {
       const newTime = provider.currentTime;
       if (newTime !== null) {
-        directionCallback(
-          typeof newTime === 'number'
-            ? newTime > startTime
-            : newTime.value > startTime,
-        );
+        const newValue = typeof newTime === 'number' ? newTime : newTime.value;
+        if (newValue !== currentOffset) {
+          directionCallback(newValue > currentOffset);
+        }
       }
       callbackID = requestAnimationFrame(rafCallback);
     };
diff --git a/packages/react-native-renderer/src/ReactFiberConfigNative.js b/packages/react-native-renderer/src/ReactFiberConfigNative.js
index 7929ed7bd87e3..00385547f23e7 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigNative.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigNative.js
@@ -607,8 +607,13 @@ export function createViewTransitionInstance(
 
 export type GestureTimeline = null;
 
+export function getCurrentGestureOffset(provider: GestureTimeline): number {
+  throw new Error('useSwipeTransition is not yet supported in React Native.');
+}
+
 export function subscribeToGestureDirection(
   provider: GestureTimeline,
+  currentOffset: number,
   directionCallback: (direction: boolean) => void,
 ): () => void {
   throw new Error('useSwipeTransition is not yet supported in React Native.');
diff --git a/packages/react-noop-renderer/src/createReactNoop.js b/packages/react-noop-renderer/src/createReactNoop.js
index 985c715bd4130..43853a864fb5e 100644
--- a/packages/react-noop-renderer/src/createReactNoop.js
+++ b/packages/react-noop-renderer/src/createReactNoop.js
@@ -796,8 +796,13 @@ function createReactNoop(reconciler: Function, useMutation: boolean) {
           return null;
         },
 
+        getCurrentGestureOffset(provider: GestureTimeline): number {
+          return 0;
+        },
+
         subscribeToGestureDirection(
           provider: GestureTimeline,
+          currentOffset: number,
           directionCallback: (direction: boolean) => void,
         ): () => void {
           return () => {};
diff --git a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
index 26231df8bfe52..da34b26084de5 100644
--- a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
+++ b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
@@ -49,4 +49,5 @@ export const startViewTransition = shim;
 export type ViewTransitionInstance = null | {name: string, ...};
 export const createViewTransitionInstance = shim;
 export type GestureTimeline = any;
+export const getCurrentGestureOffset = shim;
 export const subscribeToGestureDirection = shim;
diff --git a/packages/react-reconciler/src/ReactFiberGestureScheduler.js b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
index acbc6ab765850..fffb7d524d9e4 100644
--- a/packages/react-reconciler/src/ReactFiberGestureScheduler.js
+++ b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
@@ -19,6 +19,9 @@ export type ScheduledGesture = {
   provider: GestureTimeline,
   count: number, // The number of times this same provider has been started.
   direction: boolean, // false = previous, true = next
+  rangePrevious: number, // The end along the timeline where the previous state is reached.
+  rangeCurrent: number, // The starting offset along the timeline.
+  rangeNext: number, // The end along the timeline where the next state is reached.
   cancel: () => void, // Cancel the subscription to direction change.
   prev: null | ScheduledGesture, // The previous scheduled gesture in the queue for this root.
   next: null | ScheduledGesture, // The next scheduled gesture in the queue for this root.
@@ -28,6 +31,9 @@ export function scheduleGesture(
   root: FiberRoot,
   provider: GestureTimeline,
   initialDirection: boolean,
+  rangePrevious: number,
+  rangeCurrent: number,
+  rangeNext: number,
 ): ScheduledGesture {
   let prev = root.gestures;
   while (prev !== null) {
@@ -42,32 +48,43 @@ export function scheduleGesture(
     }
     prev = next;
   }
+  const isFlippedDirection = rangePrevious > rangeNext;
   // Add new instance to the end of the queue.
-  const cancel = subscribeToGestureDirection(provider, (direction: boolean) => {
-    if (gesture.direction !== direction) {
-      gesture.direction = direction;
-      if (gesture.prev === null && root.gestures !== gesture) {
-        // This gesture is not in the schedule, meaning it was already rendered.
-        // We need to rerender in the new direction. Insert it into the first slot
-        // in case other gestures are queued after the on-going one.
-        const existing = root.gestures;
-        gesture.next = existing;
-        if (existing !== null) {
-          existing.prev = gesture;
+  const cancel = subscribeToGestureDirection(
+    provider,
+    rangeCurrent,
+    (direction: boolean) => {
+      if (isFlippedDirection) {
+        direction = !direction;
+      }
+      if (gesture.direction !== direction) {
+        gesture.direction = direction;
+        if (gesture.prev === null && root.gestures !== gesture) {
+          // This gesture is not in the schedule, meaning it was already rendered.
+          // We need to rerender in the new direction. Insert it into the first slot
+          // in case other gestures are queued after the on-going one.
+          const existing = root.gestures;
+          gesture.next = existing;
+          if (existing !== null) {
+            existing.prev = gesture;
+          }
+          root.gestures = gesture;
+          // Schedule the lane on the root. The Fibers will already be marked as
+          // long as the gesture is active on that Hook.
+          root.pendingLanes |= GestureLane;
+          ensureRootIsScheduled(root);
         }
-        root.gestures = gesture;
-        // Schedule the lane on the root. The Fibers will already be marked as
-        // long as the gesture is active on that Hook.
-        root.pendingLanes |= GestureLane;
-        ensureRootIsScheduled(root);
+        // TODO: If we're currently rendering this gesture, we need to restart it.
       }
-      // TODO: If we're currently rendering this gesture, we need to restart it.
-    }
-  });
+    },
+  );
   const gesture: ScheduledGesture = {
     provider: provider,
     count: 1,
     direction: initialDirection,
+    rangePrevious: rangePrevious,
+    rangeCurrent: rangeCurrent,
+    rangeNext: rangeNext,
     cancel: cancel,
     prev: prev,
     next: null,
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 16ceb167683b4..645c6ce0e6122 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -16,6 +16,7 @@ import type {
   Awaited,
   StartGesture,
   GestureProvider,
+  GestureOptions,
 } from 'shared/ReactTypes';
 import type {
   Fiber,
@@ -35,6 +36,7 @@ import {
   NotPendingTransition as NoPendingHostTransition,
   setCurrentUpdatePriority,
   getCurrentUpdatePriority,
+  getCurrentGestureOffset,
 } from './ReactFiberConfig';
 import ReactSharedInternals from 'shared/ReactSharedInternals';
 import {
@@ -3988,6 +3990,7 @@ function startGesture(
   fiber: Fiber,
   queue: SwipeTransitionUpdateQueue,
   gestureProvider: GestureProvider,
+  gestureOptions?: GestureOptions,
 ): () => void {
   const root = enqueueGestureRender(fiber);
   if (root === null) {
@@ -3998,10 +4001,44 @@ function startGesture(
     };
   }
   const gestureTimeline: GestureTimeline = gestureProvider;
+  const currentOffset = getCurrentGestureOffset(gestureTimeline);
+  const range = gestureOptions && gestureOptions.range;
+  const rangePrevious: number = range ? range[0] : 0; // If no range is provider we assume it's the starting point of the range.
+  const rangeCurrent: number = range ? range[1] : currentOffset;
+  const rangeNext: number = range ? range[2] : 100; // If no range is provider we assume it's the starting point of the range.
+  if (__DEV__) {
+    if (
+      (rangePrevious > rangeCurrent && rangeNext > rangeCurrent) ||
+      (rangePrevious < rangeCurrent && rangeNext < rangeCurrent)
+    ) {
+      console.error(
+        'The range of a gesture needs "previous" and "next" to be on either side of ' +
+          'the "current" offset. Both cannot be above current and both cannot be below current.',
+      );
+    }
+  }
+  const isFlippedDirection = rangePrevious > rangeNext;
+  const initialDirection =
+    // If a range is specified we can imply initial direction if it's not the current
+    // value such as if the gesture starts after it has already moved.
+    currentOffset < rangeCurrent
+      ? isFlippedDirection
+      : currentOffset > rangeCurrent
+        ? !isFlippedDirection
+        : // Otherwise, look for an explicit option.
+          gestureOptions && gestureOptions.direction === 'next'
+          ? true
+          : gestureOptions && gestureOptions.direction === 'previous'
+            ? false
+            : // If no option is specified, imply from the values specified.
+              queue.initialDirection;
   const scheduledGesture = scheduleGesture(
     root,
     gestureTimeline,
-    queue.initialDirection,
+    initialDirection,
+    rangePrevious,
+    rangeCurrent,
+    rangeNext,
   );
   // Add this particular instance to the queue.
   // We add multiple of the same timeline even if they get batched so
diff --git a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
index 3a5cccc6d3695..6b2781c0ab2a5 100644
--- a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
+++ b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
@@ -145,6 +145,7 @@ export const wasInstanceInViewport = $$$config.wasInstanceInViewport;
 export const hasInstanceChanged = $$$config.hasInstanceChanged;
 export const hasInstanceAffectedParent = $$$config.hasInstanceAffectedParent;
 export const startViewTransition = $$$config.startViewTransition;
+export const getCurrentGestureOffset = $$$config.getCurrentGestureOffset;
 export const subscribeToGestureDirection =
   $$$config.subscribeToGestureDirection;
 export const createViewTransitionInstance =
diff --git a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
index 922155f35b8f3..8f4f81cabb9ce 100644
--- a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
+++ b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
@@ -393,8 +393,13 @@ export function getInstanceFromNode(mockNode: Object): Object | null {
 
 export type GestureTimeline = null;
 
+export function getCurrentGestureOffset(provider: GestureTimeline): number {
+  return 0;
+}
+
 export function subscribeToGestureDirection(
   provider: GestureTimeline,
+  currentOffset: number,
   directionCallback: (direction: boolean) => void,
 ): () => void {
   return () => {};
diff --git a/packages/shared/ReactTypes.js b/packages/shared/ReactTypes.js
index fbf4e9b06fce9..521575a5041b4 100644
--- a/packages/shared/ReactTypes.js
+++ b/packages/shared/ReactTypes.js
@@ -172,7 +172,15 @@ export type ReactFormState<S, ReferenceId> = [
 // renderer supports it.
 export type GestureProvider = any;
 
-export type StartGesture = (gestureProvider: GestureProvider) => () => void;
+export type StartGesture = (
+  gestureProvider: GestureProvider,
+  gestureOptions: GestureOptions,
+) => () => void;
+
+export type GestureOptions = {
+  direction?: 'previous' | 'next',
+  range?: [/*previous*/ number, /*current*/ number, /*next*/ number],
+};
 
 export type Awaited<T> = T extends null | void
   ? T // special case for `null | undefined` when not in `--strictNullChecks` mode

From 27ba5e8b1fcb5724e653caf154dcf4f9519f08f1 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Fri, 21 Feb 2025 11:27:05 -0500
Subject: [PATCH 50/73] Add Example of a SwipeRecognizer (#32422)

Stacked on #32412.

To effectively `useSwipeTransition` you need something to start and stop
the gesture as well as triggering an Action.

This adds an example Gesture Recognizer to the fixture. Instead of
having this built-in to React itself, instead the idea is to leave this
to various user space Component libraries. It can be done in different
ways for different use cases. It could use JS driven or native
ScrollTimeline or both.

This example uses a native scroll with scroll snapping to two edges. If
you swipe far enough to snap to the other edge, it triggers an Action at
the end.

This particular example uses a `position: sticky` to wrap the content of
the Gesture Recognizer. This means that it's inert by itself. It doesn't
scroll its content just like a plain JS recognizer using pointer events
would. This is useful because it means that scrolling doesn't affect
content before we start (the "scroll" event fires after scrolling has
already started) so we don't have to both trying to start it earlier. It
also means that scrolling doesn't affect the live content which can lead
to unexpected effects on the View Transition.

I find the inert recognizer the most useful pairing with
`useSwipeTransition` but it's not the only way to do it. E.g. you can
also have a scrollable surface that uses plain scrolling with snapping
and then just progressively enhances swiping between steps.
---
 .../view-transition/src/components/Chrome.css |   4 +
 .../view-transition/src/components/Page.css   |   5 -
 .../view-transition/src/components/Page.js    |  44 ++---
 .../src/components/SwipeRecognizer.js         | 165 ++++++++++++++++++
 4 files changed, 180 insertions(+), 38 deletions(-)
 create mode 100644 fixtures/view-transition/src/components/SwipeRecognizer.js

diff --git a/fixtures/view-transition/src/components/Chrome.css b/fixtures/view-transition/src/components/Chrome.css
index b019b57b1db81..ade2f73952f18 100644
--- a/fixtures/view-transition/src/components/Chrome.css
+++ b/fixtures/view-transition/src/components/Chrome.css
@@ -1,3 +1,7 @@
+html {
+  touch-action: pan-x pan-y;
+}
+
 body {
   margin: 10px;
   padding: 0;
diff --git a/fixtures/view-transition/src/components/Page.css b/fixtures/view-transition/src/components/Page.css
index a5a9373194ef8..4bdf5644efadf 100644
--- a/fixtures/view-transition/src/components/Page.css
+++ b/fixtures/view-transition/src/components/Page.css
@@ -9,11 +9,6 @@
 
 .swipe-recognizer {
   width: 200px;
-  overflow-x: scroll;
   border: 1px solid #333333;
   border-radius: 10px;
 }
-
-.swipe-overscroll {
-  width: 200%;
-}
diff --git a/fixtures/view-transition/src/components/Page.js b/fixtures/view-transition/src/components/Page.js
index 589d09a79ad7d..d12ab56203807 100644
--- a/fixtures/view-transition/src/components/Page.js
+++ b/fixtures/view-transition/src/components/Page.js
@@ -2,10 +2,10 @@ import React, {
   unstable_ViewTransition as ViewTransition,
   unstable_Activity as Activity,
   unstable_useSwipeTransition as useSwipeTransition,
-  useRef,
-  useLayoutEffect,
 } from 'react';
 
+import SwipeRecognizer from './SwipeRecognizer';
+
 import './Page.css';
 
 import transitions from './Transitions.module.css';
@@ -49,33 +49,10 @@ export default function Page({url, navigate}) {
     viewTransition.new.animate(keyframes, 250);
   }
 
-  const swipeRecognizer = useRef(null);
-  const activeGesture = useRef(null);
-  function onScroll() {
-    if (activeGesture.current !== null) {
-      return;
-    }
-    // eslint-disable-next-line no-undef
-    const scrollTimeline = new ScrollTimeline({
-      source: swipeRecognizer.current,
-      axis: 'x',
-    });
-    activeGesture.current = startGesture(scrollTimeline);
-  }
-  function onScrollEnd() {
-    if (activeGesture.current !== null) {
-      const cancelGesture = activeGesture.current;
-      activeGesture.current = null;
-      cancelGesture();
-    }
-    // Reset scroll
-    swipeRecognizer.current.scrollLeft = !show ? 0 : 10000;
+  function swipeAction() {
+    navigate(show ? '/?a' : '/?b');
   }
 
-  useLayoutEffect(() => {
-    swipeRecognizer.current.scrollLeft = !show ? 0 : 10000;
-  }, [show]);
-
   const exclamation = (
     <ViewTransition name="exclamation" onShare={onTransition}>
       <span>!</span>
@@ -122,12 +99,13 @@ export default function Page({url, navigate}) {
           <p></p>
           <p></p>
           <p></p>
-          <div
-            className="swipe-recognizer"
-            onScroll={onScroll}
-            onScrollEnd={onScrollEnd}
-            ref={swipeRecognizer}>
-            <div className="swipe-overscroll">Swipe me</div>
+          <div className="swipe-recognizer">
+            <SwipeRecognizer
+              action={swipeAction}
+              gesture={startGesture}
+              direction={show ? 'left' : 'right'}>
+              Swipe me
+            </SwipeRecognizer>
           </div>
           <p></p>
           <p></p>
diff --git a/fixtures/view-transition/src/components/SwipeRecognizer.js b/fixtures/view-transition/src/components/SwipeRecognizer.js
new file mode 100644
index 0000000000000..f332796fc8cdf
--- /dev/null
+++ b/fixtures/view-transition/src/components/SwipeRecognizer.js
@@ -0,0 +1,165 @@
+import React, {useRef, useEffect, startTransition} from 'react';
+
+// Example of a Component that can recognize swipe gestures using a ScrollTimeline
+// without scrolling its own content. Allowing it to be used as an inert gesture
+// recognizer to drive a View Transition.
+export default function SwipeRecognizer({
+  action,
+  children,
+  direction,
+  gesture,
+}) {
+  if (direction == null) {
+    direction = 'left';
+  }
+  const axis = direction === 'left' || direction === 'right' ? 'x' : 'y';
+
+  const scrollRef = useRef(null);
+  const activeGesture = useRef(null);
+  function onScroll() {
+    if (activeGesture.current !== null) {
+      return;
+    }
+    if (typeof ScrollTimeline !== 'function') {
+      return;
+    }
+    // eslint-disable-next-line no-undef
+    const scrollTimeline = new ScrollTimeline({
+      source: scrollRef.current,
+      axis: axis,
+    });
+    activeGesture.current = gesture(scrollTimeline, {
+      range: [0, direction === 'left' || direction === 'up' ? 100 : 0, 100],
+    });
+  }
+  function onScrollEnd() {
+    if (activeGesture.current !== null) {
+      const cancelGesture = activeGesture.current;
+      activeGesture.current = null;
+      cancelGesture();
+    }
+    let changed;
+    const scrollElement = scrollRef.current;
+    if (axis === 'x') {
+      const halfway =
+        (scrollElement.scrollWidth - scrollElement.clientWidth) / 2;
+      changed =
+        direction === 'left'
+          ? scrollElement.scrollLeft < halfway
+          : scrollElement.scrollLeft > halfway;
+    } else {
+      const halfway =
+        (scrollElement.scrollHeight - scrollElement.clientHeight) / 2;
+      changed =
+        direction === 'up'
+          ? scrollElement.scrollTop < halfway
+          : scrollElement.scrollTop > halfway;
+    }
+    // Reset scroll
+    if (changed) {
+      // Trigger side-effects
+      startTransition(action);
+    }
+  }
+
+  useEffect(() => {
+    const scrollElement = scrollRef.current;
+    switch (direction) {
+      case 'left':
+        scrollElement.scrollLeft =
+          scrollElement.scrollWidth - scrollElement.clientWidth;
+        break;
+      case 'right':
+        scrollElement.scrollLeft = 0;
+        break;
+      case 'up':
+        scrollElement.scrollTop =
+          scrollElement.scrollHeight - scrollElement.clientHeight;
+        break;
+      case 'down':
+        scrollElement.scrollTop = 0;
+        break;
+      default:
+        break;
+    }
+  }, [direction]);
+
+  const scrollStyle = {
+    position: 'relative',
+    padding: '0px',
+    margin: '0px',
+    border: '0px',
+    width: axis === 'x' ? '100%' : null,
+    height: axis === 'y' ? '100%' : null,
+    overflow: 'scroll hidden',
+    touchAction: 'pan-' + direction,
+    // Disable overscroll on Safari which moves the sticky content.
+    // Unfortunately, this also means that we disable chaining. We should only disable
+    // it if the parent is not scrollable in this axis.
+    overscrollBehaviorX: axis === 'x' ? 'none' : 'auto',
+    overscrollBehaviorY: axis === 'y' ? 'none' : 'auto',
+    scrollSnapType: axis + ' mandatory',
+    scrollbarWidth: 'none',
+  };
+
+  const overScrollStyle = {
+    position: 'relative',
+    padding: '0px',
+    margin: '0px',
+    border: '0px',
+    width: axis === 'x' ? '200%' : null,
+    height: axis === 'y' ? '200%' : null,
+  };
+
+  const snapStartStyle = {
+    position: 'absolute',
+    padding: '0px',
+    margin: '0px',
+    border: '0px',
+    width: axis === 'x' ? '50%' : '100%',
+    height: axis === 'y' ? '50%' : '100%',
+    left: '0px',
+    top: '0px',
+    scrollSnapAlign: 'center',
+  };
+
+  const snapEndStyle = {
+    position: 'absolute',
+    padding: '0px',
+    margin: '0px',
+    border: '0px',
+    width: axis === 'x' ? '50%' : '100%',
+    height: axis === 'y' ? '50%' : '100%',
+    right: '0px',
+    bottom: '0px',
+    scrollSnapAlign: 'center',
+  };
+
+  // By placing the content in a sticky box we ensure that it doesn't move when
+  // we scroll. Unless done so by the View Transition.
+  const stickyStyle = {
+    position: 'sticky',
+    padding: '0px',
+    margin: '0px',
+    border: '0px',
+    left: '0px',
+    top: '0px',
+    width: axis === 'x' ? '50%' : null,
+    height: axis === 'y' ? '50%' : null,
+    overflow: 'hidden',
+  };
+
+  return (
+    <div
+      style={scrollStyle}
+      onScroll={onScroll}
+      onScrollEnd={onScrollEnd}
+      ref={scrollRef}>
+      <div style={overScrollStyle}>
+        <div style={snapStartStyle} />
+        <div style={snapEndStyle} />
+        <div style={stickyStyle}>{children}</div>
+      </div>
+    </div>
+  );
+}

From 9b042f9d593f965d8c7a42f8f5fce322f403381b Mon Sep 17 00:00:00 2001
From: Josh Story <story@hey.com>
Date: Fri, 21 Feb 2025 09:48:32 -0800
Subject: [PATCH 51/73] [Fizz] Responsive images should not be preloaded with
 link headers (#32445)

Link headers are optionally supported for cases where you prefer to send
resource loading hints before you're ready to send the body of a
request. While many resources can be correctly preloaded from a link
header responsive images are currently not supported and end up
preloading the default src rather than the correctly sized image. Until
responsive images are supported React will not allow these images to
preload as headers and will retain them to preload as HTML.

closes: #32437
---
 .../src/server/ReactFizzConfigDOM.js          |  7 ++++
 .../src/__tests__/ReactDOMFizzServer-test.js  | 34 +++++++++++++++----
 2 files changed, 34 insertions(+), 7 deletions(-)

diff --git a/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js b/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
index 8fac981ab29f2..6a86cbb2652fa 100644
--- a/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
+++ b/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
@@ -2958,6 +2958,9 @@ function pushImg(
       if (
         headers &&
         headers.remainingCapacity > 0 &&
+        // browsers today don't support preloading responsive images from link headers so we bail out
+        // if the img has srcset defined
+        typeof props.srcSet !== 'string' &&
         // this is a hueristic similar to capping element preloads to 10 unless explicitly
         // fetchPriority="high". We use length here which means it will fit fewer images when
         // the urls are long and more when short. arguably byte size is a better hueristic because
@@ -5703,6 +5706,10 @@ function preload(href: string, as: string, options?: ?PreloadImplOptions) {
         if (
           headers &&
           headers.remainingCapacity > 0 &&
+          // browsers today don't support preloading responsive images from link headers so we bail out
+          // if the img has srcset defined
+          typeof imageSrcSet !== 'string' &&
+          // We only include high priority images in the link header
           fetchPriority === 'high' &&
           // Compute the header since we might be able to fit it in the max length
           ((header = getPreloadAsHeader(href, as, options)),
diff --git a/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js b/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
index d64167015eec9..38cb7798d5f6f 100644
--- a/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
@@ -3723,23 +3723,43 @@ describe('ReactDOMFizzServer', () => {
     });
   });
 
-  it('encodes img srcset and sizes into preload header params', async () => {
+  it('omits images from preload headers if they contain srcset and sizes', async () => {
     let headers = null;
     function onHeaders(x) {
       headers = x;
     }
 
     function App() {
-      ReactDOM.preload('presrc', {
+      ReactDOM.preload('responsive-preload-set-only', {
+        as: 'image',
+        fetchPriority: 'high',
+        imageSrcSet: 'srcset',
+      });
+      ReactDOM.preload('responsive-preload', {
+        as: 'image',
+        fetchPriority: 'high',
+        imageSrcSet: 'srcset',
+        imageSizes: 'sizes',
+      });
+      ReactDOM.preload('non-responsive-preload', {
         as: 'image',
         fetchPriority: 'high',
-        imageSrcSet: 'presrcset',
-        imageSizes: 'presizes',
       });
       return (
         <html>
           <body>
-            <img src="src" srcSet="srcset" sizes="sizes" />
+            <img
+              src="responsive-img-set-only"
+              fetchPriority="high"
+              srcSet="srcset"
+            />
+            <img
+              src="responsive-img"
+              fetchPriority="high"
+              srcSet="srcset"
+              sizes="sizes"
+            />
+            <img src="non-responsive-img" fetchPriority="high" />
           </body>
         </html>
       );
@@ -3751,8 +3771,8 @@ describe('ReactDOMFizzServer', () => {
 
     expect(headers).toEqual({
       Link: `
-<presrc>; rel=preload; as="image"; fetchpriority="high"; imagesrcset="presrcset"; imagesizes="presizes",
- <src>; rel=preload; as="image"; imagesrcset="srcset"; imagesizes="sizes"
+<non-responsive-preload>; rel=preload; as="image"; fetchpriority="high", 
+<non-responsive-img>; rel=preload; as="image"; fetchpriority="high"
 `
         .replaceAll('\n', '')
         .trim(),

From ad03c48a71cb7d5f7927b527cb9a8da1a3286875 Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Mon, 24 Feb 2025 13:01:59 +0100
Subject: [PATCH 52/73] use-sync-external-store: Add `exports` field to
 `package.json` (#25231)

---
 packages/use-sync-external-store/package.json    | 16 ++++++++++++++++
 .../{with-selector/index.js => with-selector.js} |  0
 2 files changed, 16 insertions(+)
 rename packages/use-sync-external-store/shim/{with-selector/index.js => with-selector.js} (100%)

diff --git a/packages/use-sync-external-store/package.json b/packages/use-sync-external-store/package.json
index d756ed20b6069..f34a1ab870b8a 100644
--- a/packages/use-sync-external-store/package.json
+++ b/packages/use-sync-external-store/package.json
@@ -2,6 +2,22 @@
   "name": "use-sync-external-store",
   "description": "Backwards compatible shim for React's useSyncExternalStore. Works with any React that supports hooks.",
   "version": "1.5.0",
+  "exports": {
+    ".": "./index.js",
+    "./with-selector": "./with-selector.js",
+    "./with-selector.js": "./with-selector.js",
+    "./shim": {
+      "react-native": "./shim/index.native.js",
+      "default": "./shim/index.js"
+    },
+    "./shim/index.js": "./shim/index.js",
+    "./shim/index.native": "./shim/index.native.js",
+    "./shim/index.native.js": "./shim/index.native.js",
+    "./shim/with-selector": "./shim/with-selector.js",
+    "./shim/with-selector.js": "./shim/with-selector.js",
+    "./package.json": "./package.json",
+    "./src/*": "./src/*.js"
+  },
   "repository": {
     "type": "git",
     "url": "https://github.com/facebook/react.git",
diff --git a/packages/use-sync-external-store/shim/with-selector/index.js b/packages/use-sync-external-store/shim/with-selector.js
similarity index 100%
rename from packages/use-sync-external-store/shim/with-selector/index.js
rename to packages/use-sync-external-store/shim/with-selector.js

From 9dd378ff1222335ff133bab2d61001fcc84a1c56 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Rub=C3=A9n=20Norte?= <rubennorte@meta.com>
Date: Mon, 24 Feb 2025 13:46:06 +0000
Subject: [PATCH 53/73] [RN] Move definition of public instances to
 ReactNativePrivateInterface (#32446)

## Summary

> [!NOTE]
> This only modifies types, so shouldn't have an impact at runtime.

Some time ago we moved some type definitions from React to React Native
in #26437.

This continues making progress on that so values that are created by
React Native and passed to the React renderer (in this case public
instances) are actually defined in React Native and not in React.

This will allow us to modify the definition of some of these types
without having to make changes in the React repository (in the short
term, we want to refactor PublicInstance from an object to an interface,
and then modify that interface to add all the new DOM methods).

## How did you test this change?

Manually synced `ReactNativeTypes` on top of
https://github.com/facebook/react-native/pull/49602 and verified Flow
passes.
---
 .../src/ReactNativeFiberHostComponent.js      | 13 ++-
 .../src/ReactNativeFiberInspector.js          |  1 +
 .../src/ReactNativePublicCompat.js            | 14 +--
 .../src/ReactNativeTypes.js                   | 94 ++++---------------
 .../ReactNativePrivateInterface.js            |  4 -
 scripts/flow/react-native-host-hooks.js       | 40 +++++++-
 6 files changed, 66 insertions(+), 100 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactNativeFiberHostComponent.js b/packages/react-native-renderer/src/ReactNativeFiberHostComponent.js
index 28d259fc5d0e5..7a253304fff07 100644
--- a/packages/react-native-renderer/src/ReactNativeFiberHostComponent.js
+++ b/packages/react-native-renderer/src/ReactNativeFiberHostComponent.js
@@ -7,14 +7,13 @@
  * @flow
  */
 
+import type {ViewConfig} from './ReactNativeTypes';
 import type {
-  HostInstance,
+  LegacyPublicInstance,
+  MeasureOnSuccessCallback,
   MeasureInWindowOnSuccessCallback,
   MeasureLayoutOnSuccessCallback,
-  MeasureOnSuccessCallback,
-  INativeMethods,
-  ViewConfig,
-} from './ReactNativeTypes';
+} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 import type {Instance} from './ReactFiberConfigNative';
 
 // Modules provided by RN:
@@ -29,7 +28,7 @@ import {
   warnForStyleProps,
 } from './NativeMethodsMixinUtils';
 
-class ReactNativeFiberHostComponent implements INativeMethods {
+class ReactNativeFiberHostComponent implements LegacyPublicInstance {
   _children: Array<Instance | number>;
   _nativeTag: number;
   _internalFiberInstanceHandleDEV: Object;
@@ -71,7 +70,7 @@ class ReactNativeFiberHostComponent implements INativeMethods {
   }
 
   measureLayout(
-    relativeToNativeNode: number | HostInstance,
+    relativeToNativeNode: number | LegacyPublicInstance,
     onSuccess: MeasureLayoutOnSuccessCallback,
     onFail?: () => void /* currently unused */,
   ) {
diff --git a/packages/react-native-renderer/src/ReactNativeFiberInspector.js b/packages/react-native-renderer/src/ReactNativeFiberInspector.js
index 47d588d448a18..e8be83f9a9f41 100644
--- a/packages/react-native-renderer/src/ReactNativeFiberInspector.js
+++ b/packages/react-native-renderer/src/ReactNativeFiberInspector.js
@@ -236,6 +236,7 @@ function getInspectorDataForViewAtPoint(
             pointerY: locationY,
             frame: {left, top, width, height},
             touchedViewTag: nativeViewTag,
+            // $FlowExpectedError[incompatible-call]
             closestPublicInstance: nativeViewTag,
           });
         },
diff --git a/packages/react-native-renderer/src/ReactNativePublicCompat.js b/packages/react-native-renderer/src/ReactNativePublicCompat.js
index c8883261f7fc4..e0193ddc37e0e 100644
--- a/packages/react-native-renderer/src/ReactNativePublicCompat.js
+++ b/packages/react-native-renderer/src/ReactNativePublicCompat.js
@@ -7,8 +7,9 @@
  * @flow
  */
 
-import type {Node, HostComponent} from './ReactNativeTypes';
+import type {Node} from './ReactNativeTypes';
 import type {ElementRef, ElementType} from 'react';
+import type {PublicInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
 // Modules provided by RN:
 import {
@@ -32,7 +33,7 @@ import {
 
 export function findHostInstance_DEPRECATED<TElementType: ElementType>(
   componentOrHandle: ?(ElementRef<TElementType> | number),
-): ?ElementRef<HostComponent<{...}>> {
+): ?PublicInstance {
   if (__DEV__) {
     const owner = currentOwner;
     if (owner !== null && isRendering && owner.stateNode !== null) {
@@ -222,15 +223,10 @@ export function getNodeFromInternalInstanceHandle(
   );
 }
 
-// Should have been PublicInstance from ReactFiberConfigFabric
-type FabricPublicInstance = mixed;
-// Should have been PublicInstance from ReactFiberConfigNative
-type PaperPublicInstance = HostComponent<empty>;
-
 // Remove this once Paper is no longer supported and DOM Node API are enabled by default in RN.
 export function isChildPublicInstance(
-  parentInstance: FabricPublicInstance | PaperPublicInstance,
-  childInstance: FabricPublicInstance | PaperPublicInstance,
+  parentInstance: PublicInstance,
+  childInstance: PublicInstance,
 ): boolean {
   if (__DEV__) {
     // Paper
diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 1aa11cb3be0d7..4fdf4ea09e0f1 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -14,33 +14,17 @@ import type {
   ElementRef,
   ElementType,
   MixedElement,
-  RefSetter,
 } from 'react';
-// $FlowFixMe[nonstrict-import] TODO(@rubennorte)
-import {type PublicRootInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
-
-export type MeasureOnSuccessCallback = (
-  x: number,
-  y: number,
-  width: number,
-  height: number,
-  pageX: number,
-  pageY: number,
-) => void;
-
-export type MeasureInWindowOnSuccessCallback = (
-  x: number,
-  y: number,
-  width: number,
-  height: number,
-) => void;
-
-export type MeasureLayoutOnSuccessCallback = (
-  left: number,
-  top: number,
-  width: number,
-  height: number,
-) => void;
+import type {
+  // $FlowFixMe[nonstrict-import] TODO(@rubennorte)
+  MeasureOnSuccessCallback,
+  // $FlowFixMe[nonstrict-import] TODO(@rubennorte)
+  PublicInstance,
+  // $FlowFixMe[nonstrict-import] TODO(@rubennorte)
+  PublicRootInstance,
+  // $FlowFixMe[nonstrict-import] TODO(@rubennorte)
+  PublicTextInstance,
+} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
 export type AttributeType<T, V> =
   | true
@@ -106,45 +90,6 @@ export type PartialViewConfig = $ReadOnly<{
   validAttributes?: PartialAttributeConfiguration,
 }>;
 
-/**
- * Current usages should migrate to this definition
- */
-export interface INativeMethods {
-  blur(): void;
-  focus(): void;
-  measure(callback: MeasureOnSuccessCallback): void;
-  measureInWindow(callback: MeasureInWindowOnSuccessCallback): void;
-  measureLayout(
-    relativeToNativeNode: number | HostInstance,
-    onSuccess: MeasureLayoutOnSuccessCallback,
-    onFail?: () => void,
-  ): void;
-  setNativeProps(nativeProps: {...}): void;
-}
-
-export type NativeMethods = $ReadOnly<{
-  blur(): void,
-  focus(): void,
-  measure(callback: MeasureOnSuccessCallback): void,
-  measureInWindow(callback: MeasureInWindowOnSuccessCallback): void,
-  measureLayout(
-    relativeToNativeNode: number | HostInstance,
-    onSuccess: MeasureLayoutOnSuccessCallback,
-    onFail?: () => void,
-  ): void,
-  setNativeProps(nativeProps: {...}): void,
-}>;
-
-// This validates that INativeMethods and NativeMethods stay in sync using Flow!
-declare const ensureNativeMethodsAreSynced: NativeMethods;
-(ensureNativeMethodsAreSynced: INativeMethods);
-
-export type HostInstance = NativeMethods;
-export type HostComponent<Config: {...}> = component(
-  ref: RefSetter<HostInstance>,
-  ...Config
-);
-
 type InspectorDataProps = $ReadOnly<{
   [propName: string]: string,
   ...
@@ -211,20 +156,17 @@ export type RenderRootOptions = {
 export type ReactNativeType = {
   findHostInstance_DEPRECATED<TElementType: ElementType>(
     componentOrHandle: ?(ElementRef<TElementType> | number),
-  ): ?HostInstance,
+  ): ?PublicInstance,
   findNodeHandle<TElementType: ElementType>(
     componentOrHandle: ?(ElementRef<TElementType> | number),
   ): ?number,
-  isChildPublicInstance(
-    parent: PublicInstance | HostComponent<empty>,
-    child: PublicInstance | HostComponent<empty>,
-  ): boolean,
+  isChildPublicInstance(parent: PublicInstance, child: PublicInstance): boolean,
   dispatchCommand(
-    handle: HostInstance,
+    handle: PublicInstance,
     command: string,
     args: Array<mixed>,
   ): void,
-  sendAccessibilityEvent(handle: HostInstance, eventType: string): void,
+  sendAccessibilityEvent(handle: PublicInstance, eventType: string): void,
   render(
     element: MixedElement,
     containerTag: number,
@@ -239,23 +181,21 @@ export type ReactNativeType = {
 
 export opaque type Node = mixed;
 export opaque type InternalInstanceHandle = mixed;
-type PublicInstance = mixed;
-type PublicTextInstance = mixed;
 
 export type ReactFabricType = {
   findHostInstance_DEPRECATED<TElementType: ElementType>(
     componentOrHandle: ?(ElementRef<TElementType> | number),
-  ): ?HostInstance,
+  ): ?PublicInstance,
   findNodeHandle<TElementType: ElementType>(
     componentOrHandle: ?(ElementRef<TElementType> | number),
   ): ?number,
   dispatchCommand(
-    handle: HostInstance,
+    handle: PublicInstance,
     command: string,
     args: Array<mixed>,
   ): void,
   isChildPublicInstance(parent: PublicInstance, child: PublicInstance): boolean,
-  sendAccessibilityEvent(handle: HostInstance, eventType: string): void,
+  sendAccessibilityEvent(handle: PublicInstance, eventType: string): void,
   render(
     element: MixedElement,
     containerTag: number,
diff --git a/packages/react-native-renderer/src/__mocks__/react-native/Libraries/ReactPrivate/ReactNativePrivateInterface.js b/packages/react-native-renderer/src/__mocks__/react-native/Libraries/ReactPrivate/ReactNativePrivateInterface.js
index bbc2df595cea6..5800e445dd30b 100644
--- a/packages/react-native-renderer/src/__mocks__/react-native/Libraries/ReactPrivate/ReactNativePrivateInterface.js
+++ b/packages/react-native-renderer/src/__mocks__/react-native/Libraries/ReactPrivate/ReactNativePrivateInterface.js
@@ -7,10 +7,6 @@
  * @flow strict-local
  */
 
-export opaque type PublicInstance = mixed;
-export opaque type PublicTextInstance = mixed;
-export opaque type PublicRootInstance = mixed;
-
 module.exports = {
   get BatchedBridge() {
     return require('./BatchedBridge.js');
diff --git a/scripts/flow/react-native-host-hooks.js b/scripts/flow/react-native-host-hooks.js
index 2620324b21287..78fa4891c1bfb 100644
--- a/scripts/flow/react-native-host-hooks.js
+++ b/scripts/flow/react-native-host-hooks.js
@@ -9,9 +9,26 @@
 
 // libdefs cannot actually import. These are supposed to be the types imported
 // from 'react-native-renderer/src/ReactNativeTypes'
-type __MeasureOnSuccessCallback = any;
-type __MeasureInWindowOnSuccessCallback = any;
-type __MeasureLayoutOnSuccessCallback = any;
+type __MeasureOnSuccessCallback = (
+  x: number,
+  y: number,
+  width: number,
+  height: number,
+  pageX: number,
+  pageY: number,
+) => void;
+type __MeasureInWindowOnSuccessCallback = (
+  x: number,
+  y: number,
+  width: number,
+  height: number,
+) => void;
+type __MeasureLayoutOnSuccessCallback = (
+  left: number,
+  top: number,
+  width: number,
+  height: number,
+) => void;
 type __ReactNativeBaseComponentViewConfig = any;
 type __ViewConfigGetter = any;
 type __ViewConfig = any;
@@ -144,6 +161,23 @@ declare module 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface'
   declare export opaque type PublicInstance;
   declare export opaque type PublicTextInstance;
   declare export opaque type PublicRootInstance;
+  declare export type MeasureOnSuccessCallback = __MeasureOnSuccessCallback;
+  declare export type MeasureInWindowOnSuccessCallback =
+    __MeasureInWindowOnSuccessCallback;
+  declare export type MeasureLayoutOnSuccessCallback =
+    __MeasureLayoutOnSuccessCallback;
+  declare export interface LegacyPublicInstance {
+    blur(): void;
+    focus(): void;
+    measure(callback: __MeasureOnSuccessCallback): void;
+    measureInWindow(callback: __MeasureInWindowOnSuccessCallback): void;
+    measureLayout(
+      relativeToNativeNode: number | LegacyPublicInstance,
+      onSuccess: __MeasureLayoutOnSuccessCallback,
+      onFail?: () => void,
+    ): void;
+    setNativeProps(nativeProps: {...}): void;
+  }
   declare export function getNodeFromPublicInstance(
     publicInstance: PublicInstance,
   ): Object;

From 25677265038b89c1ee3000e0669339ed160d9d75 Mon Sep 17 00:00:00 2001
From: Ricky <rickhanlonii@gmail.com>
Date: Mon, 24 Feb 2025 10:00:22 -0500
Subject: [PATCH 54/73] [flags] remove enableRemoveConsolePatches (#32425)

wait to merge until we sync
https://github.com/facebook/react/pull/32376, since that enables it in
some testing builds that might break
---
 .../src/ReactFiberDevToolsHook.js             |  2 -
 packages/shared/ReactFeatureFlags.js          |  2 -
 packages/shared/consoleWithStackDev.js        | 18 ----
 .../forks/ReactFeatureFlags.native-fb.js      |  1 -
 .../forks/ReactFeatureFlags.native-oss.js     |  1 -
 .../forks/ReactFeatureFlags.test-renderer.js  |  1 -
 ...actFeatureFlags.test-renderer.native-fb.js |  1 -
 .../ReactFeatureFlags.test-renderer.www.js    |  1 -
 .../shared/forks/ReactFeatureFlags.www.js     |  1 -
 .../shared/forks/consoleWithStackDev.rn.js    | 72 ----------------
 .../shared/forks/consoleWithStackDev.www.js   | 68 ---------------
 .../babel/transform-replace-console-calls.js  | 82 -------------------
 scripts/rollup/build.js                       | 17 ----
 scripts/rollup/forks.js                       | 12 ---
 14 files changed, 279 deletions(-)
 delete mode 100644 packages/shared/consoleWithStackDev.js
 delete mode 100644 packages/shared/forks/consoleWithStackDev.rn.js
 delete mode 100644 packages/shared/forks/consoleWithStackDev.www.js
 delete mode 100644 scripts/babel/transform-replace-console-calls.js

diff --git a/packages/react-reconciler/src/ReactFiberDevToolsHook.js b/packages/react-reconciler/src/ReactFiberDevToolsHook.js
index 98bad19a8e296..dc357f1ac1aad 100644
--- a/packages/react-reconciler/src/ReactFiberDevToolsHook.js
+++ b/packages/react-reconciler/src/ReactFiberDevToolsHook.js
@@ -36,7 +36,6 @@ import {
   log,
   unstable_setDisableYieldValue,
 } from './Scheduler';
-import {setSuppressWarning} from 'shared/consoleWithStackDev';
 
 declare const __REACT_DEVTOOLS_GLOBAL_HOOK__: Object | void;
 
@@ -191,7 +190,6 @@ export function setIsStrictModeForDevtools(newIsStrictMode: boolean) {
     // in SchedulerMock. To reduce the noise in strict mode tests,
     // suppress warnings and disable scheduler yielding during the double render
     unstable_setDisableYieldValue(newIsStrictMode);
-    setSuppressWarning(newIsStrictMode);
   }
 
   if (injectedHook && typeof injectedHook.setStrictMode === 'function') {
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index f1f1a09373664..1a2c260b5ba2d 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -267,5 +267,3 @@ export const enableUpdaterTracking = __PROFILE__;
 
 // Internal only.
 export const enableDO_NOT_USE_disableStrictPassiveEffect = false;
-
-export const enableRemoveConsolePatches = true;
diff --git a/packages/shared/consoleWithStackDev.js b/packages/shared/consoleWithStackDev.js
deleted file mode 100644
index 072f11859985f..0000000000000
--- a/packages/shared/consoleWithStackDev.js
+++ /dev/null
@@ -1,18 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-// We expect that our Rollup, Jest, and Flow configurations
-// always shim this module with the corresponding environment
-// (either rn or www).
-//
-// We should never resolve to this file, but it exists to make
-// sure that if we *do* accidentally break the configuration,
-// the failure isn't silent.
-
-export function setSuppressWarning() {
-  // TODO: Delete this and error when even importing this module.
-}
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 5c3015563d51c..8d72f54fc94cd 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -34,7 +34,6 @@ export const {
 
 // These two can be removed
 export const enableOwnerStacks = true;
-export const enableRemoveConsolePatches = true;
 
 // The rest of the flags are static for better dead code elimination.
 export const disableClientCache = true;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index f767b3427b25f..ea29191274af1 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -81,7 +81,6 @@ export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
 export const enableUpdaterTracking = __PROFILE__;
-export const enableRemoveConsolePatches = true;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 181e504ef7e1b..821a577026c32 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -91,7 +91,6 @@ export const disableDefaultPropsExceptForClasses = true;
 
 export const enableObjectFiber = false;
 export const enableOwnerStacks = true;
-export const enableRemoveConsolePatches = true;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index dcca098b21539..c239f61b78b6b 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -68,7 +68,6 @@ export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
-export const enableRemoveConsolePatches = true;
 export const enableSwipeTransition = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 31ac32b253dd4..443bed04b790f 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -83,7 +83,6 @@ export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
-export const enableRemoveConsolePatches = true;
 export const enableSwipeTransition = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index f3fdc1e4f489e..de1f2f316bb53 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -44,7 +44,6 @@ export const {
 
 // Can remove these two
 export const enableOwnerStacks = true;
-export const enableRemoveConsolePatches = true;
 
 export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
diff --git a/packages/shared/forks/consoleWithStackDev.rn.js b/packages/shared/forks/consoleWithStackDev.rn.js
deleted file mode 100644
index ec02866061c47..0000000000000
--- a/packages/shared/forks/consoleWithStackDev.rn.js
+++ /dev/null
@@ -1,72 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-import ReactSharedInternals from 'shared/ReactSharedInternals';
-import * as dynamicFlagsUntyped from 'ReactNativeInternalFeatureFlags';
-const enableRemoveConsolePatches =
-  dynamicFlagsUntyped && dynamicFlagsUntyped.enableRemoveConsolePatches;
-
-let suppressWarning = false;
-export function setSuppressWarning(newSuppressWarning) {
-  if (enableRemoveConsolePatches) {
-    return;
-  }
-  if (__DEV__) {
-    suppressWarning = newSuppressWarning;
-  }
-}
-
-// In DEV, calls to console.warn and console.error get replaced
-// by calls to these methods by a Babel plugin.
-//
-// In PROD (or in packages without access to React internals),
-// they are left as they are instead.
-
-export function warn(format, ...args) {
-  if (enableRemoveConsolePatches) {
-    if (__DEV__) {
-      console['warn'](format, ...args);
-    }
-  } else if (__DEV__) {
-    if (!suppressWarning) {
-      printWarning('warn', format, args);
-    }
-  }
-}
-
-export function error(format, ...args) {
-  if (enableRemoveConsolePatches) {
-    if (__DEV__) {
-      console['error'](format, ...args);
-    }
-  } else if (__DEV__) {
-    if (!suppressWarning) {
-      printWarning('error', format, args);
-    }
-  }
-}
-
-function printWarning(level, format, args) {
-  if (enableRemoveConsolePatches) {
-    return;
-  }
-  if (__DEV__) {
-    if (ReactSharedInternals.getCurrentStack) {
-      const stack = ReactSharedInternals.getCurrentStack();
-      if (stack !== '') {
-        format += '%s';
-        args = args.concat([stack]);
-      }
-    }
-
-    args.unshift(format);
-    // We intentionally don't use spread (or .apply) directly because it
-    // breaks IE9: https://github.com/facebook/react/issues/13610
-    // eslint-disable-next-line react-internal/no-production-logging
-    Function.prototype.apply.call(console[level], console, args);
-  }
-}
diff --git a/packages/shared/forks/consoleWithStackDev.www.js b/packages/shared/forks/consoleWithStackDev.www.js
deleted file mode 100644
index 84c5d186e4a8e..0000000000000
--- a/packages/shared/forks/consoleWithStackDev.www.js
+++ /dev/null
@@ -1,68 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-const {enableRemoveConsolePatches} = require('ReactFeatureFlags');
-
-// This refers to a WWW module.
-const warningWWW = require('warning');
-
-let suppressWarning = false;
-export function setSuppressWarning(newSuppressWarning) {
-  if (enableRemoveConsolePatches) {
-    return;
-  }
-  if (__DEV__) {
-    suppressWarning = newSuppressWarning;
-  }
-}
-
-export function warn(format, ...args) {
-  if (enableRemoveConsolePatches) {
-    if (__DEV__) {
-      console['warn'](format, ...args);
-    }
-  } else if (__DEV__) {
-    if (!suppressWarning) {
-      printWarning('warn', format, args);
-    }
-  }
-}
-
-export function error(format, ...args) {
-  if (enableRemoveConsolePatches) {
-    if (__DEV__) {
-      console['error'](format, ...args);
-    }
-  } else if (__DEV__) {
-    if (!suppressWarning) {
-      printWarning('error', format, args);
-    }
-  }
-}
-
-function printWarning(level, format, args) {
-  if (enableRemoveConsolePatches) {
-    return;
-  }
-  if (__DEV__) {
-    const React = require('react');
-    const ReactSharedInternals =
-      React.__CLIENT_INTERNALS_DO_NOT_USE_OR_WARN_USERS_THEY_CANNOT_UPGRADE;
-    // Defensive in case this is fired before React is initialized.
-    if (ReactSharedInternals != null && ReactSharedInternals.getCurrentStack) {
-      const stack = ReactSharedInternals.getCurrentStack();
-      if (stack !== '') {
-        format += '%s';
-        args.push(stack);
-      }
-    }
-    // TODO: don't ignore level and pass it down somewhere too.
-    args.unshift(format);
-    args.unshift(false);
-    warningWWW.apply(null, args);
-  }
-}
diff --git a/scripts/babel/transform-replace-console-calls.js b/scripts/babel/transform-replace-console-calls.js
deleted file mode 100644
index 387f88a5f948e..0000000000000
--- a/scripts/babel/transform-replace-console-calls.js
+++ /dev/null
@@ -1,82 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-'use strict';
-
-const helperModuleImports = require('@babel/helper-module-imports');
-
-module.exports = function replaceConsoleCalls(babel) {
-  let consoleErrors = new WeakMap();
-  function getConsoleError(path, file) {
-    if (!consoleErrors.has(file)) {
-      consoleErrors.set(
-        file,
-        helperModuleImports.addNamed(
-          path,
-          'error',
-          'shared/consoleWithStackDev',
-          {nameHint: 'consoleError'}
-        )
-      );
-    }
-    return babel.types.cloneDeep(consoleErrors.get(file));
-  }
-
-  let consoleWarns = new WeakMap();
-  function getConsoleWarn(path, file) {
-    if (!consoleWarns.has(file)) {
-      consoleWarns.set(
-        file,
-        helperModuleImports.addNamed(
-          path,
-          'warn',
-          'shared/consoleWithStackDev',
-          {nameHint: 'consoleWarn'}
-        )
-      );
-    }
-    return babel.types.cloneDeep(consoleWarns.get(file));
-  }
-
-  return {
-    visitor: {
-      CallExpression: function (path, pass) {
-        if (path.node.callee.type !== 'MemberExpression') {
-          return;
-        }
-        if (path.node.callee.property.type !== 'Identifier') {
-          // Don't process calls like console['error'](...)
-          // because they serve as an escape hatch.
-          return;
-        }
-        if (path.get('callee').matchesPattern('console.error')) {
-          if (this.opts.shouldError) {
-            throw path.buildCodeFrameError(
-              "This module has no access to the React object, so it can't " +
-                'use console.error() with automatically appended stack. ' +
-                "As a workaround, you can use console['error'] which won't " +
-                'be transformed.'
-            );
-          }
-          const id = getConsoleError(path, pass.file);
-          path.node.callee = id;
-        }
-        if (path.get('callee').matchesPattern('console.warn')) {
-          if (this.opts.shouldError) {
-            throw path.buildCodeFrameError(
-              "This module has no access to the React object, so it can't " +
-                'use console.warn() with automatically appended stack. ' +
-                "As a workaround, you can use console['warn'] which won't " +
-                'be transformed.'
-            );
-          }
-          const id = getConsoleWarn(path, pass.file);
-          path.node.callee = id;
-        }
-      },
-    },
-  };
-};
diff --git a/scripts/rollup/build.js b/scripts/rollup/build.js
index 53b308d16a2d8..874b5b139f37c 100644
--- a/scripts/rollup/build.js
+++ b/scripts/rollup/build.js
@@ -145,8 +145,6 @@ function getBabelConfig(
   isDevelopment,
   bundle
 ) {
-  const canAccessReactObject =
-    packageName === 'react' || externals.indexOf('react') !== -1;
   let options = {
     exclude: '/**/node_modules/**',
     babelrc: false,
@@ -158,21 +156,6 @@ function getBabelConfig(
   };
   if (isDevelopment) {
     options.plugins.push(...babelToES5Plugins);
-    if (
-      bundleType === FB_WWW_DEV ||
-      bundleType === RN_OSS_DEV ||
-      bundleType === RN_FB_DEV
-    ) {
-      options.plugins.push(
-        // Turn console.error/warn() into a custom wrapper
-        [
-          require('../babel/transform-replace-console-calls'),
-          {
-            shouldError: !canAccessReactObject,
-          },
-        ]
-      );
-    }
   }
   if (updateBabelOptions) {
     options = updateBabelOptions(options);
diff --git a/scripts/rollup/forks.js b/scripts/rollup/forks.js
index 5460304366253..33c7c96abbc06 100644
--- a/scripts/rollup/forks.js
+++ b/scripts/rollup/forks.js
@@ -209,18 +209,6 @@ const forks = Object.freeze({
     }
   },
 
-  './packages/shared/consoleWithStackDev.js': (bundleType, entry) => {
-    switch (bundleType) {
-      case FB_WWW_DEV:
-        return './packages/shared/forks/consoleWithStackDev.www.js';
-      case RN_OSS_DEV:
-      case RN_FB_DEV:
-        return './packages/shared/forks/consoleWithStackDev.rn.js';
-      default:
-        return null;
-    }
-  },
-
   './packages/shared/DefaultPrepareStackTrace.js': (
     bundleType,
     entry,

From 22e39ea72e9d10f6634ea580aaba49c2e759ef0e Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Tue, 25 Feb 2025 10:48:44 +0100
Subject: [PATCH 55/73] Include component name in "async/await is not
 supported" error message if available (#32435)

---
 .../react-reconciler/src/ReactFiberHooks.js   |  7 ++-
 .../src/ReactFiberThenable.js                 |  5 +-
 .../src/__tests__/ReactUse-test.js            | 51 ++++++++++++-------
 scripts/error-codes/codes.json                |  2 +-
 4 files changed, 41 insertions(+), 24 deletions(-)

diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 645c6ce0e6122..ddf051bcdb94f 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -475,10 +475,13 @@ function warnIfAsyncClientComponent(Component: Function) {
       if (!didWarnAboutAsyncClientComponent.has(componentName)) {
         didWarnAboutAsyncClientComponent.add(componentName);
         console.error(
-          'async/await is not yet supported in Client Components, only ' +
-            'Server Components. This error is often caused by accidentally ' +
+          '%s is an async Client Component. ' +
+            'Only Server Components can be async at the moment. This error is often caused by accidentally ' +
             "adding `'use client'` to a module that was originally written " +
             'for the server.',
+          componentName === null
+            ? 'An unknown Component'
+            : `<${componentName}>`,
         );
       }
     }
diff --git a/packages/react-reconciler/src/ReactFiberThenable.js b/packages/react-reconciler/src/ReactFiberThenable.js
index 88d32dc530790..d0d8ad84ee811 100644
--- a/packages/react-reconciler/src/ReactFiberThenable.js
+++ b/packages/react-reconciler/src/ReactFiberThenable.js
@@ -194,8 +194,9 @@ export function trackUsedThenable<T>(
           // this case include forcing a concurrent render, or putting the whole
           // root into offscreen mode.
           throw new Error(
-            'async/await is not yet supported in Client Components, only ' +
-              'Server Components. This error is often caused by accidentally ' +
+            'An unknown Component is an async Client Component. ' +
+              'Only Server Components can be async at the moment. ' +
+              'This error is often caused by accidentally ' +
               "adding `'use client'` to a module that was originally written " +
               'for the server.',
           );
diff --git a/packages/react-reconciler/src/__tests__/ReactUse-test.js b/packages/react-reconciler/src/__tests__/ReactUse-test.js
index a120d6f250c9e..fbe247c029a50 100644
--- a/packages/react-reconciler/src/__tests__/ReactUse-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactUse-test.js
@@ -1343,7 +1343,8 @@ describe('ReactUse', () => {
     });
     assertLog(['Async text requested [Hi]']);
     assertConsoleErrorDev([
-      'async/await is not yet supported in Client Components, only Server Components. ' +
+      '<App> is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
         "This error is often caused by accidentally adding `'use client'` " +
         'to a module that was originally written for the server.\n' +
         '    in App (at **)',
@@ -1443,7 +1444,8 @@ describe('ReactUse', () => {
     });
     assertLog(['A', 'Mount: A']);
     assertConsoleErrorDev([
-      'async/await is not yet supported in Client Components, only Server Components. ' +
+      '<App> is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
         "This error is often caused by accidentally adding `'use client'` " +
         'to a module that was originally written for the server.\n' +
         '    in App (at **)',
@@ -1915,25 +1917,29 @@ describe('ReactUse', () => {
       );
     });
     assertConsoleErrorDev([
-      'async/await is not yet supported in Client Components, only Server Components. ' +
+      '<AsyncClientComponent> is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
         "This error is often caused by accidentally adding `'use client'` " +
         'to a module that was originally written for the server.\n' +
         '    in AsyncClientComponent (at **)' +
         (gate('enableOwnerStacks') ? '' : '\n    in ErrorBoundary (at **)'),
     ]);
     assertLog([
-      'async/await is not yet supported in Client Components, only Server ' +
-        'Components. This error is often caused by accidentally adding ' +
+      'An unknown Component is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
+        'This error is often caused by accidentally adding ' +
         "`'use client'` to a module that was originally written for " +
         'the server.',
-      'async/await is not yet supported in Client Components, only Server ' +
-        'Components. This error is often caused by accidentally adding ' +
+      'An unknown Component is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
+        'This error is often caused by accidentally adding ' +
         "`'use client'` to a module that was originally written for " +
         'the server.',
     ]);
     expect(root).toMatchRenderedOutput(
-      'async/await is not yet supported in Client Components, only Server ' +
-        'Components. This error is often caused by accidentally adding ' +
+      'An unknown Component is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
+        'This error is often caused by accidentally adding ' +
         "`'use client'` to a module that was originally written for " +
         'the server.',
     );
@@ -1967,25 +1973,29 @@ describe('ReactUse', () => {
       );
     });
     assertConsoleErrorDev([
-      'async/await is not yet supported in Client Components, only Server Components. ' +
+      '<AsyncClientComponent> is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
         "This error is often caused by accidentally adding `'use client'` " +
         'to a module that was originally written for the server.\n' +
         '    in AsyncClientComponent (at **)' +
         (gate('enableOwnerStacks') ? '' : '\n    in ErrorBoundary (at **)'),
     ]);
     assertLog([
-      'async/await is not yet supported in Client Components, only Server ' +
-        'Components. This error is often caused by accidentally adding ' +
+      'An unknown Component is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
+        'This error is often caused by accidentally adding ' +
         "`'use client'` to a module that was originally written for " +
         'the server.',
-      'async/await is not yet supported in Client Components, only Server ' +
-        'Components. This error is often caused by accidentally adding ' +
+      'An unknown Component is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
+        'This error is often caused by accidentally adding ' +
         "`'use client'` to a module that was originally written for " +
         'the server.',
     ]);
     expect(root).toMatchRenderedOutput(
-      'async/await is not yet supported in Client Components, only Server ' +
-        'Components. This error is often caused by accidentally adding ' +
+      'An unknown Component is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
+        'This error is often caused by accidentally adding ' +
         "`'use client'` to a module that was originally written for " +
         'the server.',
     );
@@ -2012,7 +2022,8 @@ describe('ReactUse', () => {
         // decided to warn for _any_ async client component regardless of
         // whether the update is sync. But if we ever add back support for async
         // client components, we should add back the hook warning.
-        'async/await is not yet supported in Client Components, only Server Components. ' +
+        '<AsyncClientComponent> is an async Client Component. ' +
+          'Only Server Components can be async at the moment. ' +
           "This error is often caused by accidentally adding `'use client'` " +
           'to a module that was originally written for the server.\n' +
           '    in AsyncClientComponent (at **)',
@@ -2044,7 +2055,8 @@ describe('ReactUse', () => {
       // decided to warn for _any_ async client component regardless of
       // whether the update is sync. But if we ever add back support for async
       // client components, we should add back the hook warning.
-      'async/await is not yet supported in Client Components, only Server Components. ' +
+      '<AsyncClientComponent> is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
         "This error is often caused by accidentally adding `'use client'` " +
         'to a module that was originally written for the server.\n' +
         '    in AsyncClientComponent (at **)',
@@ -2079,7 +2091,8 @@ describe('ReactUse', () => {
       });
     });
     assertConsoleErrorDev([
-      'async/await is not yet supported in Client Components, only Server Components. ' +
+      '<App> is an async Client Component. ' +
+        'Only Server Components can be async at the moment. ' +
         "This error is often caused by accidentally adding `'use client'` " +
         'to a module that was originally written for the server.\n' +
         '    in App (at **)',
diff --git a/scripts/error-codes/codes.json b/scripts/error-codes/codes.json
index a55d7505cebf9..0722eba56d30d 100644
--- a/scripts/error-codes/codes.json
+++ b/scripts/error-codes/codes.json
@@ -467,7 +467,7 @@
   "479": "Cannot update optimistic state while rendering.",
   "480": "File/Blob fields are not yet supported in progressive forms. Will fallback to client hydration.",
   "481": "Tried to encode a Server Action from a different instance than the encoder is from. This is a bug in React.",
-  "482": "async/await is not yet supported in Client Components, only Server Components. This error is often caused by accidentally adding `'use client'` to a module that was originally written for the server.",
+  "482": "An unknown Component is an async Client Component. Only Server Components can be async at the moment. This error is often caused by accidentally adding `'use client'` to a module that was originally written for the server.",
   "483": "Hooks are not supported inside an async component. This error is often caused by accidentally adding `'use client'` to a module that was originally written for the server.",
   "484": "A Server Component was postponed. The reason is omitted in production builds to avoid leaking sensitive details.",
   "485": "Cannot update form state while rendering.",

From dd9974bbb86f14898c3f352672dd7232492802a2 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 25 Feb 2025 12:08:46 -0500
Subject: [PATCH 56/73] [forgive] Scaffold workspaces (#31917)

Basic workspace setup for Forgive.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/31917).
* #31918
* #31927
* __->__ #31917
---
 .github/workflows/compiler_typescript.yml     |   3 +
 .../react-forgive/client/package.json         |  22 +
 .../packages/react-forgive/client/yarn.lock   |  59 +++
 compiler/packages/react-forgive/package.json  |  57 +++
 .../react-forgive/server/package.json         |  20 +
 .../react-forgive/server/src/index.ts         |   6 +
 .../react-forgive/server/tsconfig.json        |  13 +
 .../packages/react-forgive/server/yarn.lock   |  33 ++
 compiler/yarn.lock                            | 460 +++++++++++++++++-
 9 files changed, 672 insertions(+), 1 deletion(-)
 create mode 100644 compiler/packages/react-forgive/client/package.json
 create mode 100644 compiler/packages/react-forgive/client/yarn.lock
 create mode 100644 compiler/packages/react-forgive/package.json
 create mode 100644 compiler/packages/react-forgive/server/package.json
 create mode 100644 compiler/packages/react-forgive/server/src/index.ts
 create mode 100644 compiler/packages/react-forgive/server/tsconfig.json
 create mode 100644 compiler/packages/react-forgive/server/yarn.lock

diff --git a/.github/workflows/compiler_typescript.yml b/.github/workflows/compiler_typescript.yml
index 95f8f1f26e112..6d9fa973350af 100644
--- a/.github/workflows/compiler_typescript.yml
+++ b/.github/workflows/compiler_typescript.yml
@@ -93,4 +93,7 @@ jobs:
           path: "**/node_modules"
           key: compiler-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('compiler/**/yarn.lock') }}
       - run: yarn install --frozen-lockfile
+      - run: xvfb-run -a yarn workspace ${{ matrix.workspace_name }} test
+        if: runner.os == 'Linux' && matrix.workspace_name == 'react-forgive'
       - run: yarn workspace ${{ matrix.workspace_name }} test
+        if: runner.os != 'Linux' && matrix.workspace_name != 'react-forgive'
diff --git a/compiler/packages/react-forgive/client/package.json b/compiler/packages/react-forgive/client/package.json
new file mode 100644
index 0000000000000..c90cee4b423d9
--- /dev/null
+++ b/compiler/packages/react-forgive/client/package.json
@@ -0,0 +1,22 @@
+{
+  "private": "true",
+  "name": "react-forgive-client",
+  "version": "0.0.0",
+  "description": "Experimental LSP client",
+  "license": "MIT",
+  "scripts": {
+    "build": "echo 'no build'",
+    "test": "echo 'no tests'"
+  },
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/facebook/react.git",
+    "directory": "compiler/packages/react-forgive-client"
+  },
+  "dependencies": {
+    "vscode-languageclient": "^9.0.1"
+  },
+  "devDependencies": {
+    "@types/vscode": "^1.95.0"
+  }
+}
diff --git a/compiler/packages/react-forgive/client/yarn.lock b/compiler/packages/react-forgive/client/yarn.lock
new file mode 100644
index 0000000000000..b96751788c77b
--- /dev/null
+++ b/compiler/packages/react-forgive/client/yarn.lock
@@ -0,0 +1,59 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@types/vscode@^1.95.0":
+  version "1.96.0"
+  resolved "https://registry.yarnpkg.com/@types/vscode/-/vscode-1.96.0.tgz#3181004bf25d71677ae4aacdd7605a3fd7edf08e"
+  integrity sha512-qvZbSZo+K4ZYmmDuaodMbAa67Pl6VDQzLKFka6rq+3WUTY4Kro7Bwoi0CuZLO/wema0ygcmpwow7zZfPJTs5jg==
+
+balanced-match@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.2.tgz#e83e3a7e3f300b34cb9d87f615fa0cbf357690ee"
+  integrity sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==
+
+brace-expansion@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-2.0.1.tgz#1edc459e0f0c548486ecf9fc99f2221364b9a0ae"
+  integrity sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==
+  dependencies:
+    balanced-match "^1.0.0"
+
+minimatch@^5.1.0:
+  version "5.1.6"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-5.1.6.tgz#1cfcb8cf5522ea69952cd2af95ae09477f122a96"
+  integrity sha512-lKwV/1brpG6mBUFHtb7NUmtABCb2WZZmm2wNiOA5hAb8VdCS4B3dtMWyvcoViccwAW/COERjXLt0zP1zXUN26g==
+  dependencies:
+    brace-expansion "^2.0.1"
+
+semver@^7.3.7:
+  version "7.6.3"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-7.6.3.tgz#980f7b5550bc175fb4dc09403085627f9eb33143"
+  integrity sha512-oVekP1cKtI+CTDvHWYFUcMtsK/00wmAEfyqKfNdARm8u1wNVhSgaX7A8d4UuIlUI5e84iEwOhs7ZPYRmzU9U6A==
+
+vscode-jsonrpc@8.2.0:
+  version "8.2.0"
+  resolved "https://registry.yarnpkg.com/vscode-jsonrpc/-/vscode-jsonrpc-8.2.0.tgz#f43dfa35fb51e763d17cd94dcca0c9458f35abf9"
+  integrity sha512-C+r0eKJUIfiDIfwJhria30+TYWPtuHJXHtI7J0YlOmKAo7ogxP20T0zxB7HZQIFhIyvoBPwWskjxrvAtfjyZfA==
+
+vscode-languageclient@^9.0.1:
+  version "9.0.1"
+  resolved "https://registry.yarnpkg.com/vscode-languageclient/-/vscode-languageclient-9.0.1.tgz#cdfe20267726c8d4db839dc1e9d1816e1296e854"
+  integrity sha512-JZiimVdvimEuHh5olxhxkht09m3JzUGwggb5eRUkzzJhZ2KjCN0nh55VfiED9oez9DyF8/fz1g1iBV3h+0Z2EA==
+  dependencies:
+    minimatch "^5.1.0"
+    semver "^7.3.7"
+    vscode-languageserver-protocol "3.17.5"
+
+vscode-languageserver-protocol@3.17.5:
+  version "3.17.5"
+  resolved "https://registry.yarnpkg.com/vscode-languageserver-protocol/-/vscode-languageserver-protocol-3.17.5.tgz#864a8b8f390835572f4e13bd9f8313d0e3ac4bea"
+  integrity sha512-mb1bvRJN8SVznADSGWM9u/b07H7Ecg0I3OgXDuLdn307rl/J3A9YD6/eYOssqhecL27hK1IPZAsaqh00i/Jljg==
+  dependencies:
+    vscode-jsonrpc "8.2.0"
+    vscode-languageserver-types "3.17.5"
+
+vscode-languageserver-types@3.17.5:
+  version "3.17.5"
+  resolved "https://registry.yarnpkg.com/vscode-languageserver-types/-/vscode-languageserver-types-3.17.5.tgz#3273676f0cf2eab40b3f44d085acbb7f08a39d8a"
+  integrity sha512-Ld1VelNuX9pdF39h2Hgaeb5hEZM2Z3jUrrMgWQAu82jMtZp7p3vJT3BzToKtZI7NgQssZje5o0zryOrhQvzQAg==
diff --git a/compiler/packages/react-forgive/package.json b/compiler/packages/react-forgive/package.json
new file mode 100644
index 0000000000000..30aec4235523e
--- /dev/null
+++ b/compiler/packages/react-forgive/package.json
@@ -0,0 +1,57 @@
+{
+  "name": "react-forgive",
+  "displayName": "React Analyzer",
+  "description": "React LSP",
+  "license": "MIT",
+  "version": "0.0.0",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/facebook/react.git",
+    "directory": "compiler/packages/react-forgive"
+  },
+  "categories": [
+    "Programming Languages"
+  ],
+  "keywords": [
+    "react",
+    "react analyzer",
+    "react compiler"
+  ],
+  "publisher": "Meta",
+  "engines": {
+    "vscode": "^1.75.0"
+  },
+  "activationEvents": [
+    "onLanguage:javascriptreact",
+    "onLanguage:typescriptreact"
+  ],
+  "main": "./dist/extension.js",
+  "contributes": {
+    "commands": [
+      {
+        "command": "react-forgive.toggleAll",
+        "title": "React Analyzer: Toggle on/off"
+      }
+    ]
+  },
+  "scripts": {
+    "compile": "yarn run esbuild-base -- --sourcemap",
+    "dev": "yarn run package && yarn run install-ext",
+    "esbuild-base": "esbuild ./src/extension.ts --bundle --outfile=dist/extension.js --external:vscode --format=cjs --platform=node",
+    "install-ext": "code --install-extension vscode-react-compiler-0.0.1.vsix",
+    "lint": "echo 'no tests'",
+    "package": "vsce package",
+    "postinstall": "cd client && yarn install && cd ../server && yarn install && cd ..",
+    "pretest": "yarn run compile && yarn run lint",
+    "test": "echo 'no tests'",
+    "test-compile": "tsc -p ./",
+    "vscode:prepublish": "yarn run esbuild-base -- --minify",
+    "watch": "yarn run esbuild-base -- --sourcemap --watch"
+  },
+  "devDependencies": {
+    "@eslint/js": "^9.13.0",
+    "@types/node": "^20",
+    "eslint": "^9.13.0",
+    "typescript-eslint": "^8.16.0"
+  }
+}
diff --git a/compiler/packages/react-forgive/server/package.json b/compiler/packages/react-forgive/server/package.json
new file mode 100644
index 0000000000000..4e4d54debbaa5
--- /dev/null
+++ b/compiler/packages/react-forgive/server/package.json
@@ -0,0 +1,20 @@
+{
+  "private": "true",
+  "name": "react-forgive-server",
+  "version": "0.0.0",
+  "description": "Experimental LSP server",
+  "license": "MIT",
+  "scripts": {
+    "build": "echo 'no build'",
+    "test": "echo 'no tests'"
+  },
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/facebook/react.git",
+    "directory": "compiler/packages/react-forgive-server"
+  },
+  "dependencies": {
+    "vscode-languageserver": "^9.0.1",
+    "vscode-languageserver-textdocument": "^1.0.12"
+  }
+}
diff --git a/compiler/packages/react-forgive/server/src/index.ts b/compiler/packages/react-forgive/server/src/index.ts
new file mode 100644
index 0000000000000..a265a953eed3d
--- /dev/null
+++ b/compiler/packages/react-forgive/server/src/index.ts
@@ -0,0 +1,6 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
diff --git a/compiler/packages/react-forgive/server/tsconfig.json b/compiler/packages/react-forgive/server/tsconfig.json
new file mode 100644
index 0000000000000..ccd17f5dff457
--- /dev/null
+++ b/compiler/packages/react-forgive/server/tsconfig.json
@@ -0,0 +1,13 @@
+{
+  "extends": "@tsconfig/strictest/tsconfig.json",
+  "compilerOptions": {
+    "module": "CommonJS",
+    "moduleResolution": "node",
+    "outDir": "dist",
+    "jsx": "react-jsxdev",
+    "lib": ["ES2020"],
+    "target": "ES2020",
+  },
+  "exclude": ["node_modules", ".vscode-test"],
+  "include": ["src/**/*.ts"],
+}
diff --git a/compiler/packages/react-forgive/server/yarn.lock b/compiler/packages/react-forgive/server/yarn.lock
new file mode 100644
index 0000000000000..fd60ddd6ad5f1
--- /dev/null
+++ b/compiler/packages/react-forgive/server/yarn.lock
@@ -0,0 +1,33 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+vscode-jsonrpc@8.2.0:
+  version "8.2.0"
+  resolved "https://registry.yarnpkg.com/vscode-jsonrpc/-/vscode-jsonrpc-8.2.0.tgz#f43dfa35fb51e763d17cd94dcca0c9458f35abf9"
+  integrity sha512-C+r0eKJUIfiDIfwJhria30+TYWPtuHJXHtI7J0YlOmKAo7ogxP20T0zxB7HZQIFhIyvoBPwWskjxrvAtfjyZfA==
+
+vscode-languageserver-protocol@3.17.5:
+  version "3.17.5"
+  resolved "https://registry.yarnpkg.com/vscode-languageserver-protocol/-/vscode-languageserver-protocol-3.17.5.tgz#864a8b8f390835572f4e13bd9f8313d0e3ac4bea"
+  integrity sha512-mb1bvRJN8SVznADSGWM9u/b07H7Ecg0I3OgXDuLdn307rl/J3A9YD6/eYOssqhecL27hK1IPZAsaqh00i/Jljg==
+  dependencies:
+    vscode-jsonrpc "8.2.0"
+    vscode-languageserver-types "3.17.5"
+
+vscode-languageserver-textdocument@^1.0.12:
+  version "1.0.12"
+  resolved "https://registry.yarnpkg.com/vscode-languageserver-textdocument/-/vscode-languageserver-textdocument-1.0.12.tgz#457ee04271ab38998a093c68c2342f53f6e4a631"
+  integrity sha512-cxWNPesCnQCcMPeenjKKsOCKQZ/L6Tv19DTRIGuLWe32lyzWhihGVJ/rcckZXJxfdKCFvRLS3fpBIsV/ZGX4zA==
+
+vscode-languageserver-types@3.17.5:
+  version "3.17.5"
+  resolved "https://registry.yarnpkg.com/vscode-languageserver-types/-/vscode-languageserver-types-3.17.5.tgz#3273676f0cf2eab40b3f44d085acbb7f08a39d8a"
+  integrity sha512-Ld1VelNuX9pdF39h2Hgaeb5hEZM2Z3jUrrMgWQAu82jMtZp7p3vJT3BzToKtZI7NgQssZje5o0zryOrhQvzQAg==
+
+vscode-languageserver@^9.0.1:
+  version "9.0.1"
+  resolved "https://registry.yarnpkg.com/vscode-languageserver/-/vscode-languageserver-9.0.1.tgz#500aef82097eb94df90d008678b0b6b5f474015b"
+  integrity sha512-woByF3PDpkHFUreUa7Hos7+pUWdeWMXRd26+ZX2A8cFx6v/JPTtd4/uN0/jB6XQHYaOlHbio03NTHCqrgG5n7g==
+  dependencies:
+    vscode-languageserver-protocol "3.17.5"
diff --git a/compiler/yarn.lock b/compiler/yarn.lock
index b5bd5f8eaf7b4..fe1d22eac864c 100644
--- a/compiler/yarn.lock
+++ b/compiler/yarn.lock
@@ -1714,86 +1714,171 @@
     enabled "2.0.x"
     kuler "^2.0.0"
 
+"@esbuild/aix-ppc64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.24.0.tgz#b57697945b50e99007b4c2521507dc613d4a648c"
+  integrity sha512-WtKdFM7ls47zkKHFVzMz8opM7LkcsIp9amDUBIAWirg70RM71WRSjdILPsY5Uv1D42ZpUfaPILDlfactHgsRkw==
+
 "@esbuild/aix-ppc64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.25.0.tgz#499600c5e1757a524990d5d92601f0ac3ce87f64"
   integrity sha512-O7vun9Sf8DFjH2UtqK8Ku3LkquL9SZL8OLY1T5NZkA34+wG3OQF7cl4Ql8vdNzM6fzBbYfLaiRLIOZ+2FOCgBQ==
 
+"@esbuild/android-arm64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.24.0.tgz#1add7e0af67acefd556e407f8497e81fddad79c0"
+  integrity sha512-Vsm497xFM7tTIPYK9bNTYJyF/lsP590Qc1WxJdlB6ljCbdZKU9SY8i7+Iin4kyhV/KV5J2rOKsBQbB77Ab7L/w==
+
 "@esbuild/android-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.25.0.tgz#b9b8231561a1dfb94eb31f4ee056b92a985c324f"
   integrity sha512-grvv8WncGjDSyUBjN9yHXNt+cq0snxXbDxy5pJtzMKGmmpPxeAmAhWxXI+01lU5rwZomDgD3kJwulEnhTRUd6g==
 
+"@esbuild/android-arm@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.24.0.tgz#ab7263045fa8e090833a8e3c393b60d59a789810"
+  integrity sha512-arAtTPo76fJ/ICkXWetLCc9EwEHKaeya4vMrReVlEIUCAUncH7M4bhMQ+M9Vf+FFOZJdTNMXNBrWwW+OXWpSew==
+
 "@esbuild/android-arm@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.25.0.tgz#ca6e7888942505f13e88ac9f5f7d2a72f9facd2b"
   integrity sha512-PTyWCYYiU0+1eJKmw21lWtC+d08JDZPQ5g+kFyxP0V+es6VPPSUhM6zk8iImp2jbV6GwjX4pap0JFbUQN65X1g==
 
+"@esbuild/android-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.24.0.tgz#e8f8b196cfdfdd5aeaebbdb0110983460440e705"
+  integrity sha512-t8GrvnFkiIY7pa7mMgJd7p8p8qqYIz1NYiAoKc75Zyv73L3DZW++oYMSHPRarcotTKuSs6m3hTOa5CKHaS02TQ==
+
 "@esbuild/android-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.25.0.tgz#e765ea753bac442dfc9cb53652ce8bd39d33e163"
   integrity sha512-m/ix7SfKG5buCnxasr52+LI78SQ+wgdENi9CqyCXwjVR2X4Jkz+BpC3le3AoBPYTC9NHklwngVXvbJ9/Akhrfg==
 
+"@esbuild/darwin-arm64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.24.0.tgz#2d0d9414f2acbffd2d86e98253914fca603a53dd"
+  integrity sha512-CKyDpRbK1hXwv79soeTJNHb5EiG6ct3efd/FTPdzOWdbZZfGhpbcqIpiD0+vwmpu0wTIL97ZRPZu8vUt46nBSw==
+
 "@esbuild/darwin-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.25.0.tgz#fa394164b0d89d4fdc3a8a21989af70ef579fa2c"
   integrity sha512-mVwdUb5SRkPayVadIOI78K7aAnPamoeFR2bT5nszFUZ9P8UpK4ratOdYbZZXYSqPKMHfS1wdHCJk1P1EZpRdvw==
 
+"@esbuild/darwin-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.24.0.tgz#33087aab31a1eb64c89daf3d2cf8ce1775656107"
+  integrity sha512-rgtz6flkVkh58od4PwTRqxbKH9cOjaXCMZgWD905JOzjFKW+7EiUObfd/Kav+A6Gyud6WZk9w+xu6QLytdi2OA==
+
 "@esbuild/darwin-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.25.0.tgz#91979d98d30ba6e7d69b22c617cc82bdad60e47a"
   integrity sha512-DgDaYsPWFTS4S3nWpFcMn/33ZZwAAeAFKNHNa1QN0rI4pUjgqf0f7ONmXf6d22tqTY+H9FNdgeaAa+YIFUn2Rg==
 
+"@esbuild/freebsd-arm64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.24.0.tgz#bb76e5ea9e97fa3c753472f19421075d3a33e8a7"
+  integrity sha512-6Mtdq5nHggwfDNLAHkPlyLBpE5L6hwsuXZX8XNmHno9JuL2+bg2BX5tRkwjyfn6sKbxZTq68suOjgWqCicvPXA==
+
 "@esbuild/freebsd-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.25.0.tgz#b97e97073310736b430a07b099d837084b85e9ce"
   integrity sha512-VN4ocxy6dxefN1MepBx/iD1dH5K8qNtNe227I0mnTRjry8tj5MRk4zprLEdG8WPyAPb93/e4pSgi1SoHdgOa4w==
 
+"@esbuild/freebsd-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.24.0.tgz#e0e2ce9249fdf6ee29e5dc3d420c7007fa579b93"
+  integrity sha512-D3H+xh3/zphoX8ck4S2RxKR6gHlHDXXzOf6f/9dbFt/NRBDIE33+cVa49Kil4WUjxMGW0ZIYBYtaGCa2+OsQwQ==
+
 "@esbuild/freebsd-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.25.0.tgz#f3b694d0da61d9910ec7deff794d444cfbf3b6e7"
   integrity sha512-mrSgt7lCh07FY+hDD1TxiTyIHyttn6vnjesnPoVDNmDfOmggTLXRv8Id5fNZey1gl/V2dyVK1VXXqVsQIiAk+A==
 
+"@esbuild/linux-arm64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.24.0.tgz#d1b2aa58085f73ecf45533c07c82d81235388e75"
+  integrity sha512-TDijPXTOeE3eaMkRYpcy3LarIg13dS9wWHRdwYRnzlwlA370rNdZqbcp0WTyyV/k2zSxfko52+C7jU5F9Tfj1g==
+
 "@esbuild/linux-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.25.0.tgz#f921f699f162f332036d5657cad9036f7a993f73"
   integrity sha512-9QAQjTWNDM/Vk2bgBl17yWuZxZNQIF0OUUuPZRKoDtqF2k4EtYbpyiG5/Dk7nqeK6kIJWPYldkOcBqjXjrUlmg==
 
+"@esbuild/linux-arm@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.24.0.tgz#8e4915df8ea3e12b690a057e77a47b1d5935ef6d"
+  integrity sha512-gJKIi2IjRo5G6Glxb8d3DzYXlxdEj2NlkixPsqePSZMhLudqPhtZ4BUrpIuTjJYXxvF9njql+vRjB2oaC9XpBw==
+
 "@esbuild/linux-arm@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.25.0.tgz#cc49305b3c6da317c900688995a4050e6cc91ca3"
   integrity sha512-vkB3IYj2IDo3g9xX7HqhPYxVkNQe8qTK55fraQyTzTX/fxaDtXiEnavv9geOsonh2Fd2RMB+i5cbhu2zMNWJwg==
 
+"@esbuild/linux-ia32@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.24.0.tgz#8200b1110666c39ab316572324b7af63d82013fb"
+  integrity sha512-K40ip1LAcA0byL05TbCQ4yJ4swvnbzHscRmUilrmP9Am7//0UjPreh4lpYzvThT2Quw66MhjG//20mrufm40mA==
+
 "@esbuild/linux-ia32@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.25.0.tgz#3e0736fcfab16cff042dec806247e2c76e109e19"
   integrity sha512-43ET5bHbphBegyeqLb7I1eYn2P/JYGNmzzdidq/w0T8E2SsYL1U6un2NFROFRg1JZLTzdCoRomg8Rvf9M6W6Gg==
 
+"@esbuild/linux-loong64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.24.0.tgz#6ff0c99cf647504df321d0640f0d32e557da745c"
+  integrity sha512-0mswrYP/9ai+CU0BzBfPMZ8RVm3RGAN/lmOMgW4aFUSOQBjA31UP8Mr6DDhWSuMwj7jaWOT0p0WoZ6jeHhrD7g==
+
 "@esbuild/linux-loong64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.25.0.tgz#ea2bf730883cddb9dfb85124232b5a875b8020c7"
   integrity sha512-fC95c/xyNFueMhClxJmeRIj2yrSMdDfmqJnyOY4ZqsALkDrrKJfIg5NTMSzVBr5YW1jf+l7/cndBfP3MSDpoHw==
 
+"@esbuild/linux-mips64el@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.24.0.tgz#3f720ccd4d59bfeb4c2ce276a46b77ad380fa1f3"
+  integrity sha512-hIKvXm0/3w/5+RDtCJeXqMZGkI2s4oMUGj3/jM0QzhgIASWrGO5/RlzAzm5nNh/awHE0A19h/CvHQe6FaBNrRA==
+
 "@esbuild/linux-mips64el@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.25.0.tgz#4cababb14eede09248980a2d2d8b966464294ff1"
   integrity sha512-nkAMFju7KDW73T1DdH7glcyIptm95a7Le8irTQNO/qtkoyypZAnjchQgooFUDQhNAy4iu08N79W4T4pMBwhPwQ==
 
+"@esbuild/linux-ppc64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.24.0.tgz#9d6b188b15c25afd2e213474bf5f31e42e3aa09e"
+  integrity sha512-HcZh5BNq0aC52UoocJxaKORfFODWXZxtBaaZNuN3PUX3MoDsChsZqopzi5UupRhPHSEHotoiptqikjN/B77mYQ==
+
 "@esbuild/linux-ppc64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.25.0.tgz#8860a4609914c065373a77242e985179658e1951"
   integrity sha512-NhyOejdhRGS8Iwv+KKR2zTq2PpysF9XqY+Zk77vQHqNbo/PwZCzB5/h7VGuREZm1fixhs4Q/qWRSi5zmAiO4Fw==
 
+"@esbuild/linux-riscv64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.24.0.tgz#f989fdc9752dfda286c9cd87c46248e4dfecbc25"
+  integrity sha512-bEh7dMn/h3QxeR2KTy1DUszQjUrIHPZKyO6aN1X4BCnhfYhuQqedHaa5MxSQA/06j3GpiIlFGSsy1c7Gf9padw==
+
 "@esbuild/linux-riscv64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.25.0.tgz#baf26e20bb2d38cfb86ee282dff840c04f4ed987"
   integrity sha512-5S/rbP5OY+GHLC5qXp1y/Mx//e92L1YDqkiBbO9TQOvuFXM+iDqUNG5XopAnXoRH3FjIUDkeGcY1cgNvnXp/kA==
 
+"@esbuild/linux-s390x@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.24.0.tgz#29ebf87e4132ea659c1489fce63cd8509d1c7319"
+  integrity sha512-ZcQ6+qRkw1UcZGPyrCiHHkmBaj9SiCD8Oqd556HldP+QlpUIe2Wgn3ehQGVoPOvZvtHm8HPx+bH20c9pvbkX3g==
+
 "@esbuild/linux-s390x@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.25.0.tgz#8323afc0d6cb1b6dc6e9fd21efd9e1542c3640a4"
   integrity sha512-XM2BFsEBz0Fw37V0zU4CXfcfuACMrppsMFKdYY2WuTS3yi8O1nFOhil/xhKTmE1nPmVyvQJjJivgDT+xh8pXJA==
 
+"@esbuild/linux-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.24.0.tgz#4af48c5c0479569b1f359ffbce22d15f261c0cef"
+  integrity sha512-vbutsFqQ+foy3wSSbmjBXXIJ6PL3scghJoM8zCL142cGaZKAdCZHyf+Bpu/MmX9zT9Q0zFBVKb36Ma5Fzfa8xA==
+
 "@esbuild/linux-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.25.0.tgz#08fcf60cb400ed2382e9f8e0f5590bac8810469a"
@@ -1804,36 +1889,71 @@
   resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.25.0.tgz#935c6c74e20f7224918fbe2e6c6fe865b6c6ea5b"
   integrity sha512-RuG4PSMPFfrkH6UwCAqBzauBWTygTvb1nxWasEJooGSJ/NwRw7b2HOwyRTQIU97Hq37l3npXoZGYMy3b3xYvPw==
 
+"@esbuild/netbsd-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.24.0.tgz#1ae73d23cc044a0ebd4f198334416fb26c31366c"
+  integrity sha512-hjQ0R/ulkO8fCYFsG0FZoH+pWgTTDreqpqY7UnQntnaKv95uP5iW3+dChxnx7C3trQQU40S+OgWhUVwCjVFLvg==
+
 "@esbuild/netbsd-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.25.0.tgz#414677cef66d16c5a4d210751eb2881bb9c1b62b"
   integrity sha512-jl+qisSB5jk01N5f7sPCsBENCOlPiS/xptD5yxOx2oqQfyourJwIKLRA2yqWdifj3owQZCL2sn6o08dBzZGQzA==
 
+"@esbuild/openbsd-arm64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.24.0.tgz#5d904a4f5158c89859fd902c427f96d6a9e632e2"
+  integrity sha512-MD9uzzkPQbYehwcN583yx3Tu5M8EIoTD+tUgKF982WYL9Pf5rKy9ltgD0eUgs8pvKnmizxjXZyLt0z6DC3rRXg==
+
 "@esbuild/openbsd-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.25.0.tgz#8fd55a4d08d25cdc572844f13c88d678c84d13f7"
   integrity sha512-21sUNbq2r84YE+SJDfaQRvdgznTD8Xc0oc3p3iW/a1EVWeNj/SdUCbm5U0itZPQYRuRTW20fPMWMpcrciH2EJw==
 
+"@esbuild/openbsd-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.24.0.tgz#4c8aa88c49187c601bae2971e71c6dc5e0ad1cdf"
+  integrity sha512-4ir0aY1NGUhIC1hdoCzr1+5b43mw99uNwVzhIq1OY3QcEwPDO3B7WNXBzaKY5Nsf1+N11i1eOfFcq+D/gOS15Q==
+
 "@esbuild/openbsd-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.25.0.tgz#0c48ddb1494bbc2d6bcbaa1429a7f465fa1dedde"
   integrity sha512-2gwwriSMPcCFRlPlKx3zLQhfN/2WjJ2NSlg5TKLQOJdV0mSxIcYNTMhk3H3ulL/cak+Xj0lY1Ym9ysDV1igceg==
 
+"@esbuild/sunos-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.24.0.tgz#8ddc35a0ea38575fa44eda30a5ee01ae2fa54dd4"
+  integrity sha512-jVzdzsbM5xrotH+W5f1s+JtUy1UWgjU0Cf4wMvffTB8m6wP5/kx0KiaLHlbJO+dMgtxKV8RQ/JvtlFcdZ1zCPA==
+
 "@esbuild/sunos-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.25.0.tgz#86ff9075d77962b60dd26203d7352f92684c8c92"
   integrity sha512-bxI7ThgLzPrPz484/S9jLlvUAHYMzy6I0XiU1ZMeAEOBcS0VePBFxh1JjTQt3Xiat5b6Oh4x7UC7IwKQKIJRIg==
 
+"@esbuild/win32-arm64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.24.0.tgz#6e79c8543f282c4539db684a207ae0e174a9007b"
+  integrity sha512-iKc8GAslzRpBytO2/aN3d2yb2z8XTVfNV0PjGlCxKo5SgWmNXx82I/Q3aG1tFfS+A2igVCY97TJ8tnYwpUWLCA==
+
 "@esbuild/win32-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.25.0.tgz#849c62327c3229467f5b5cd681bf50588442e96c"
   integrity sha512-ZUAc2YK6JW89xTbXvftxdnYy3m4iHIkDtK3CLce8wg8M2L+YZhIvO1DKpxrd0Yr59AeNNkTiic9YLf6FTtXWMw==
 
+"@esbuild/win32-ia32@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.24.0.tgz#057af345da256b7192d18b676a02e95d0fa39103"
+  integrity sha512-vQW36KZolfIudCcTnaTpmLQ24Ha1RjygBo39/aLkM2kmjkWmZGEJ5Gn9l5/7tzXA42QGIoWbICfg6KLLkIw6yw==
+
 "@esbuild/win32-ia32@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.25.0.tgz#f62eb480cd7cca088cb65bb46a6db25b725dc079"
   integrity sha512-eSNxISBu8XweVEWG31/JzjkIGbGIJN/TrRoiSVZwZ6pkC6VX4Im/WV2cz559/TXLcYbcrDN8JtKgd9DJVIo8GA==
 
+"@esbuild/win32-x64@0.24.0":
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.24.0.tgz#168ab1c7e1c318b922637fad8f339d48b01e1244"
+  integrity sha512-7IAFPrjSQIJrGsK6flwg7NFmwBoSTyF3rl7If0hNUFQU4ilTsEPL6GuMuU9BfIWVVGuRnuIidkSMC+c0Otu8IA==
+
 "@esbuild/win32-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.25.0.tgz#c8e119a30a7c8d60b9d2e22d2073722dde3b710b"
@@ -1851,11 +1971,32 @@
   resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.11.1.tgz#a547badfc719eb3e5f4b556325e542fbe9d7a18f"
   integrity sha512-m4DVN9ZqskZoLU5GlWZadwDnYo3vAEydiUayB9widCl9ffWx2IvPnp6n3on5rJmziJSw9Bv+Z3ChDVdMwXCY8Q==
 
+"@eslint-community/regexpp@^4.12.1":
+  version "4.12.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
+  integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
+
 "@eslint-community/regexpp@^4.5.1", "@eslint-community/regexpp@^4.6.1":
   version "4.10.0"
   resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.10.0.tgz#548f6de556857c8bb73bbee70c35dc82a2e74d63"
   integrity sha512-Cu96Sd2By9mCNTx2iyKOmq10v22jUVQv0lQnlGNy16oE9589yE+QADPbrMGCkA51cKZSg3Pu/aTJVTGfL/qjUA==
 
+"@eslint/config-array@^0.19.0":
+  version "0.19.1"
+  resolved "https://registry.yarnpkg.com/@eslint/config-array/-/config-array-0.19.1.tgz#734aaea2c40be22bbb1f2a9dac687c57a6a4c984"
+  integrity sha512-fo6Mtm5mWyKjA/Chy1BYTdn5mGJoDNjC7C64ug20ADsRDGrA85bN3uK3MaKbeRkRuuIEAR5N33Jr1pbm411/PA==
+  dependencies:
+    "@eslint/object-schema" "^2.1.5"
+    debug "^4.3.1"
+    minimatch "^3.1.2"
+
+"@eslint/core@^0.9.0":
+  version "0.9.1"
+  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.9.1.tgz#31763847308ef6b7084a4505573ac9402c51f9d1"
+  integrity sha512-GuUdqkyyzQI5RMIWkHhvTWLCyLo1jNK3vzkSyaExH5kHPDHcuL2VOpHjmMY+y3+NC69qAKToBqldTBgYeLSr9Q==
+  dependencies:
+    "@types/json-schema" "^7.0.15"
+
 "@eslint/eslintrc@^2.1.4":
   version "2.1.4"
   resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-2.1.4.tgz#388a269f0f25c1b6adc317b5a2c55714894c70ad"
@@ -1871,6 +2012,21 @@
     minimatch "^3.1.2"
     strip-json-comments "^3.1.1"
 
+"@eslint/eslintrc@^3.2.0":
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-3.2.0.tgz#57470ac4e2e283a6bf76044d63281196e370542c"
+  integrity sha512-grOjVNN8P3hjJn/eIETF1wwd12DdnwFDoyceUJLYYdkpbwq3nLi+4fqrTAONx7XDALqlL220wC/RHSC/QTI/0w==
+  dependencies:
+    ajv "^6.12.4"
+    debug "^4.3.2"
+    espree "^10.0.1"
+    globals "^14.0.0"
+    ignore "^5.2.0"
+    import-fresh "^3.2.1"
+    js-yaml "^4.1.0"
+    minimatch "^3.1.2"
+    strip-json-comments "^3.1.1"
+
 "@eslint/js@8.57.0":
   version "8.57.0"
   resolved "https://registry.yarnpkg.com/@eslint/js/-/js-8.57.0.tgz#a5417ae8427873f1dd08b70b3574b453e67b5f7f"
@@ -1881,6 +2037,23 @@
   resolved "https://registry.yarnpkg.com/@eslint/js/-/js-8.57.1.tgz#de633db3ec2ef6a3c89e2f19038063e8a122e2c2"
   integrity sha512-d9zaMRSTIKDLhctzH12MtXvJKSSUhaHcjV+2Z+GK+EEY7XKpP5yR4x+N3TAcHTcu963nIr+TMcCb4DBCYX1z6Q==
 
+"@eslint/js@9.17.0", "@eslint/js@^9.13.0":
+  version "9.17.0"
+  resolved "https://registry.yarnpkg.com/@eslint/js/-/js-9.17.0.tgz#1523e586791f80376a6f8398a3964455ecc651ec"
+  integrity sha512-Sxc4hqcs1kTu0iID3kcZDW3JHq2a77HO9P8CP6YEA/FpH3Ll8UXE2r/86Rz9YJLKme39S9vU5OWNjC6Xl0Cr3w==
+
+"@eslint/object-schema@^2.1.5":
+  version "2.1.5"
+  resolved "https://registry.yarnpkg.com/@eslint/object-schema/-/object-schema-2.1.5.tgz#8670a8f6258a2be5b2c620ff314a1d984c23eb2e"
+  integrity sha512-o0bhxnL89h5Bae5T318nFoFzGy+YE5i/gGkoPAgkmTVdRKTiv3p8JHevPiPaMwoloKfEiiaHlawCqaZMqRm+XQ==
+
+"@eslint/plugin-kit@^0.2.3":
+  version "0.2.4"
+  resolved "https://registry.yarnpkg.com/@eslint/plugin-kit/-/plugin-kit-0.2.4.tgz#2b78e7bb3755784bb13faa8932a1d994d6537792"
+  integrity sha512-zSkKow6H5Kdm0ZUQUB2kV5JIXqoG0+uH5YADhaEHswm664N9Db8dXSi0nMJpacpMf+MyyglF1vnZohpEg5yUtg==
+  dependencies:
+    levn "^0.4.1"
+
 "@hapi/hoek@^9.0.0", "@hapi/hoek@^9.3.0":
   version "9.3.0"
   resolved "https://registry.yarnpkg.com/@hapi/hoek/-/hoek-9.3.0.tgz#8368869dcb735be2e7f5cb7647de78e167a251fb"
@@ -1893,6 +2066,19 @@
   dependencies:
     "@hapi/hoek" "^9.0.0"
 
+"@humanfs/core@^0.19.1":
+  version "0.19.1"
+  resolved "https://registry.yarnpkg.com/@humanfs/core/-/core-0.19.1.tgz#17c55ca7d426733fe3c561906b8173c336b40a77"
+  integrity sha512-5DyQ4+1JEUzejeK1JGICcideyfUbGixgS9jNgex5nqkW+cY7WZhxBigmieN5Qnw9ZosSNVC9KQKyb+GUaGyKUA==
+
+"@humanfs/node@^0.16.6":
+  version "0.16.6"
+  resolved "https://registry.yarnpkg.com/@humanfs/node/-/node-0.16.6.tgz#ee2a10eaabd1131987bf0488fd9b820174cd765e"
+  integrity sha512-YuI2ZHQL78Q5HbhDiBA1X4LmYdXCKCMQIfw0pw7piHJwyREFebJUvrQN4cMssyES6x+vfUbx1CIpaQUKYdQZOw==
+  dependencies:
+    "@humanfs/core" "^0.19.1"
+    "@humanwhocodes/retry" "^0.3.0"
+
 "@humanwhocodes/config-array@^0.11.14":
   version "0.11.14"
   resolved "https://registry.yarnpkg.com/@humanwhocodes/config-array/-/config-array-0.11.14.tgz#d78e481a039f7566ecc9660b4ea7fe6b1fec442b"
@@ -1926,6 +2112,16 @@
   resolved "https://registry.yarnpkg.com/@humanwhocodes/object-schema/-/object-schema-2.0.3.tgz#4a2868d75d6d6963e423bcf90b7fd1be343409d3"
   integrity sha512-93zYdMES/c1D69yZiKDBj0V24vqNzB/koF26KPaagAfd3P/4gUlh3Dys5ogAK+Exi9QyzlD8x/08Zt7wIKcDcA==
 
+"@humanwhocodes/retry@^0.3.0":
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.3.1.tgz#c72a5c76a9fbaf3488e231b13dc52c0da7bab42a"
+  integrity sha512-JBxkERygn7Bv/GbN5Rv8Ul6LVknS+5Bp6RgDC/O8gEBU/yeH5Ui5C/OlWrTb6qct7LjjfT6Re2NxB0ln0yYybA==
+
+"@humanwhocodes/retry@^0.4.1":
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.4.1.tgz#9a96ce501bc62df46c4031fbd970e3cc6b10f07b"
+  integrity sha512-c7hNEllBlenFTHBky65mhq8WD2kbN9Q6gk0bTk8lSBvc554jpXSkST1iePudpt7+A/AQvuHs9EMqjHDXMY1lrA==
+
 "@isaacs/cliui@^8.0.2":
   version "8.0.2"
   resolved "https://registry.yarnpkg.com/@isaacs/cliui/-/cliui-8.0.2.tgz#b37667b7bc181c168782259bab42474fbf52b550"
@@ -2812,6 +3008,11 @@
   resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.5.tgz#a6ce3e556e00fd9895dd872dd172ad0d4bd687f4"
   integrity sha512-/kYRxGDLWzHOB7q+wtSUQlFrtcdUccpfy+X+9iMBpHK8QLLhx2wIPYuS5DYtR9Wa/YlZAbIovy7qVdB1Aq6Lyw==
 
+"@types/estree@^1.0.6":
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
+  integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
+
 "@types/fbt@^1.0.4":
   version "1.0.4"
   resolved "https://registry.yarnpkg.com/@types/fbt/-/fbt-1.0.4.tgz#0d9e427f91fcff46bdcf2ca42a63343096565451"
@@ -2891,7 +3092,7 @@
     "@types/tough-cookie" "*"
     parse5 "^7.0.0"
 
-"@types/json-schema@*", "@types/json-schema@^7.0.12":
+"@types/json-schema@*", "@types/json-schema@^7.0.12", "@types/json-schema@^7.0.15":
   version "7.0.15"
   resolved "https://registry.yarnpkg.com/@types/json-schema/-/json-schema-7.0.15.tgz#596a1747233694d50f6ad8a7869fcb6f56cf5841"
   integrity sha512-5+fP8P8MFNC+AyZCDxrB2pkZFPGzqQWUzpSeuuVLvm8VMcorNYavBqoFcxK8bQz4Qsbn4oUEEem4wDLfcysGHA==
@@ -2906,6 +3107,13 @@
   resolved "https://registry.yarnpkg.com/@types/node/-/node-18.7.19.tgz#ad83aa9b7af470fab7e0f562be87e97dc8ffe08e"
   integrity sha512-Sq1itGUKUX1ap7GgZlrzdBydjbsJL/NSQt/4wkAxUJ7/OS5c2WkoN6WSpWc2Yc5wtKMZOUA0VCs/j2XJadN3HA==
 
+"@types/node@^20":
+  version "20.17.10"
+  resolved "https://registry.yarnpkg.com/@types/node/-/node-20.17.10.tgz#3f7166190aece19a0d1d364d75c8b0b5778c1e18"
+  integrity sha512-/jrvh5h6NXhEauFFexRin69nA0uHJ5gwk4iDivp/DeoEua3uwCUto6PC86IpRITBOs4+6i2I56K5x5b6WYGXHA==
+  dependencies:
+    undici-types "~6.19.2"
+
 "@types/node@^20.2.5":
   version "20.2.5"
   resolved "https://registry.yarnpkg.com/@types/node/-/node-20.2.5.tgz#26d295f3570323b2837d322180dfbf1ba156fefb"
@@ -2981,6 +3189,21 @@
   dependencies:
     "@types/yargs-parser" "*"
 
+"@typescript-eslint/eslint-plugin@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/eslint-plugin/-/eslint-plugin-8.18.1.tgz#992e5ac1553ce20d0d46aa6eccd79dc36dedc805"
+  integrity sha512-Ncvsq5CT3Gvh+uJG0Lwlho6suwDfUXH0HztslDf5I+F2wAFAZMRwYLEorumpKLzmO2suAXZ/td1tBg4NZIi9CQ==
+  dependencies:
+    "@eslint-community/regexpp" "^4.10.0"
+    "@typescript-eslint/scope-manager" "8.18.1"
+    "@typescript-eslint/type-utils" "8.18.1"
+    "@typescript-eslint/utils" "8.18.1"
+    "@typescript-eslint/visitor-keys" "8.18.1"
+    graphemer "^1.4.0"
+    ignore "^5.3.1"
+    natural-compare "^1.4.0"
+    ts-api-utils "^1.3.0"
+
 "@typescript-eslint/eslint-plugin@^7.4.0":
   version "7.4.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/eslint-plugin/-/eslint-plugin-7.4.0.tgz#de61c3083842fc6ac889d2fc83c9a96b55ab8328"
@@ -3013,6 +3236,17 @@
     natural-compare "^1.4.0"
     ts-api-utils "^1.3.0"
 
+"@typescript-eslint/parser@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/parser/-/parser-8.18.1.tgz#c258bae062778b7696793bc492249027a39dfb95"
+  integrity sha512-rBnTWHCdbYM2lh7hjyXqxk70wvon3p2FyaniZuey5TrcGBpfhVp0OxOa6gxr9Q9YhZFKyfbEnxc24ZnVbbUkCA==
+  dependencies:
+    "@typescript-eslint/scope-manager" "8.18.1"
+    "@typescript-eslint/types" "8.18.1"
+    "@typescript-eslint/typescript-estree" "8.18.1"
+    "@typescript-eslint/visitor-keys" "8.18.1"
+    debug "^4.3.4"
+
 "@typescript-eslint/parser@^7.4.0":
   version "7.4.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/parser/-/parser-7.4.0.tgz#540f4321de1e52b886c0fa68628af1459954c1f1"
@@ -3043,6 +3277,14 @@
     "@typescript-eslint/types" "7.4.0"
     "@typescript-eslint/visitor-keys" "7.4.0"
 
+"@typescript-eslint/scope-manager@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/scope-manager/-/scope-manager-8.18.1.tgz#52cedc3a8178d7464a70beffed3203678648e55b"
+  integrity sha512-HxfHo2b090M5s2+/9Z3gkBhI6xBH8OJCFjH9MhQ+nnoZqxU3wNxkLT+VWXWSFWc3UF3Z+CfPAyqdCTdoXtDPCQ==
+  dependencies:
+    "@typescript-eslint/types" "8.18.1"
+    "@typescript-eslint/visitor-keys" "8.18.1"
+
 "@typescript-eslint/scope-manager@8.7.0":
   version "8.7.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/scope-manager/-/scope-manager-8.7.0.tgz#90ee7bf9bc982b9260b93347c01a8bc2b595e0b8"
@@ -3061,6 +3303,16 @@
     debug "^4.3.4"
     ts-api-utils "^1.0.1"
 
+"@typescript-eslint/type-utils@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/type-utils/-/type-utils-8.18.1.tgz#10f41285475c0bdee452b79ff7223f0e43a7781e"
+  integrity sha512-jAhTdK/Qx2NJPNOTxXpMwlOiSymtR2j283TtPqXkKBdH8OAMmhiUfP0kJjc/qSE51Xrq02Gj9NY7MwK+UxVwHQ==
+  dependencies:
+    "@typescript-eslint/typescript-estree" "8.18.1"
+    "@typescript-eslint/utils" "8.18.1"
+    debug "^4.3.4"
+    ts-api-utils "^1.3.0"
+
 "@typescript-eslint/type-utils@8.7.0":
   version "8.7.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/type-utils/-/type-utils-8.7.0.tgz#d56b104183bdcffcc434a23d1ce26cde5e42df93"
@@ -3076,6 +3328,11 @@
   resolved "https://registry.yarnpkg.com/@typescript-eslint/types/-/types-7.4.0.tgz#ee9dafa75c99eaee49de6dcc9348b45d354419b6"
   integrity sha512-mjQopsbffzJskos5B4HmbsadSJQWaRK0UxqQ7GuNA9Ga4bEKeiO6b2DnB6cM6bpc8lemaPseh0H9B/wyg+J7rw==
 
+"@typescript-eslint/types@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/types/-/types-8.18.1.tgz#d7f4f94d0bba9ebd088de840266fcd45408a8fff"
+  integrity sha512-7uoAUsCj66qdNQNpH2G8MyTFlgerum8ubf21s3TSM3XmKXuIn+H2Sifh/ES2nPOPiYSRJWAk0fDkW0APBWcpfw==
+
 "@typescript-eslint/types@8.7.0":
   version "8.7.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/types/-/types-8.7.0.tgz#21d987201c07b69ce7ddc03451d7196e5445ad19"
@@ -3095,6 +3352,20 @@
     semver "^7.5.4"
     ts-api-utils "^1.0.1"
 
+"@typescript-eslint/typescript-estree@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/typescript-estree/-/typescript-estree-8.18.1.tgz#2a86cd64b211a742f78dfa7e6f4860413475367e"
+  integrity sha512-z8U21WI5txzl2XYOW7i9hJhxoKKNG1kcU4RzyNvKrdZDmbjkmLBo8bgeiOJmA06kizLI76/CCBAAGlTlEeUfyg==
+  dependencies:
+    "@typescript-eslint/types" "8.18.1"
+    "@typescript-eslint/visitor-keys" "8.18.1"
+    debug "^4.3.4"
+    fast-glob "^3.3.2"
+    is-glob "^4.0.3"
+    minimatch "^9.0.4"
+    semver "^7.6.0"
+    ts-api-utils "^1.3.0"
+
 "@typescript-eslint/typescript-estree@8.7.0":
   version "8.7.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/typescript-estree/-/typescript-estree-8.7.0.tgz#6c7db6baa4380b937fa81466c546d052f362d0e8"
@@ -3122,6 +3393,16 @@
     "@typescript-eslint/typescript-estree" "7.4.0"
     semver "^7.5.4"
 
+"@typescript-eslint/utils@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/utils/-/utils-8.18.1.tgz#c4199ea23fc823c736e2c96fd07b1f7235fa92d5"
+  integrity sha512-8vikiIj2ebrC4WRdcAdDcmnu9Q/MXXwg+STf40BVfT8exDqBCUPdypvzcUPxEqRGKg9ALagZ0UWcYCtn+4W2iQ==
+  dependencies:
+    "@eslint-community/eslint-utils" "^4.4.0"
+    "@typescript-eslint/scope-manager" "8.18.1"
+    "@typescript-eslint/types" "8.18.1"
+    "@typescript-eslint/typescript-estree" "8.18.1"
+
 "@typescript-eslint/utils@8.7.0":
   version "8.7.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/utils/-/utils-8.7.0.tgz#cef3f70708b5b5fd7ed8672fc14714472bd8a011"
@@ -3140,6 +3421,14 @@
     "@typescript-eslint/types" "7.4.0"
     eslint-visitor-keys "^3.4.1"
 
+"@typescript-eslint/visitor-keys@8.18.1":
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/visitor-keys/-/visitor-keys-8.18.1.tgz#344b4f6bc83f104f514676facf3129260df7610a"
+  integrity sha512-Vj0WLm5/ZsD013YeUKn+K0y8p1M0jPpxOkKdbD1wB0ns53a5piVY02zjf072TblEweAbcYiFiPoSMF3kp+VhhQ==
+  dependencies:
+    "@typescript-eslint/types" "8.18.1"
+    eslint-visitor-keys "^4.2.0"
+
 "@typescript-eslint/visitor-keys@8.7.0":
   version "8.7.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/visitor-keys/-/visitor-keys-8.7.0.tgz#5e46f1777f9d69360a883c1a56ac3c511c9659a8"
@@ -3186,6 +3475,11 @@ acorn@^7.1.1:
   resolved "https://registry.yarnpkg.com/acorn/-/acorn-7.4.1.tgz#feaed255973d2e77555b83dbc08851a6c63520fa"
   integrity sha512-nQyp0o1/mNdbTO1PO6kHkwSrmgZ0MT/jCCpNiwbUjGoRN4dlBhqJtoQuCnEOKzgTVwg0ZWiCoQy6SxMebQVh8A==
 
+acorn@^8.14.0:
+  version "8.14.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.14.0.tgz#063e2c70cac5fb4f6467f0b11152e04c682795b0"
+  integrity sha512-cl669nCJTZBsL97OF4kUQm5g5hC2uihk0NxY3WENAC0TYdILVkAyHymAntgxGkl7K+t0cXIrH5siy5S4XkFycA==
+
 acorn@^8.4.1, acorn@^8.7.1:
   version "8.8.0"
   resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.8.0.tgz#88c0187620435c7f6015803f5539dae05a9dbea8"
@@ -3867,6 +4161,15 @@ cross-spawn@^7.0.0, cross-spawn@^7.0.2, cross-spawn@^7.0.3:
     shebang-command "^2.0.0"
     which "^2.0.1"
 
+cross-spawn@^7.0.6:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.6.tgz#8a58fe78f00dcd70c370451759dfbfaf03e8ee9f"
+  integrity sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==
+  dependencies:
+    path-key "^3.1.0"
+    shebang-command "^2.0.0"
+    which "^2.0.1"
+
 cssom@^0.5.0:
   version "0.5.0"
   resolved "https://registry.yarnpkg.com/cssom/-/cssom-0.5.0.tgz#d254fa92cd8b6fbd83811b9fbaed34663cc17c36"
@@ -4105,6 +4408,36 @@ es5-ext@0.8.x:
   resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.8.2.tgz#aba8d9e1943a895ac96837a62a39b3f55ecd94ab"
   integrity sha512-H19ompyhnKiBdjHR1DPHvf5RHgHPmJaY9JNzFGbMbPgdsUkvnUCN1Ke8J4Y0IMyTwFM2M9l4h2GoHwzwpSmXbA==
 
+esbuild@^0.24.0:
+  version "0.24.0"
+  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.24.0.tgz#f2d470596885fcb2e91c21eb3da3b3c89c0b55e7"
+  integrity sha512-FuLPevChGDshgSicjisSooU0cemp/sGXR841D5LHMB7mTVOmsEHcAxaH3irL53+8YDIeVNQEySh4DaYU/iuPqQ==
+  optionalDependencies:
+    "@esbuild/aix-ppc64" "0.24.0"
+    "@esbuild/android-arm" "0.24.0"
+    "@esbuild/android-arm64" "0.24.0"
+    "@esbuild/android-x64" "0.24.0"
+    "@esbuild/darwin-arm64" "0.24.0"
+    "@esbuild/darwin-x64" "0.24.0"
+    "@esbuild/freebsd-arm64" "0.24.0"
+    "@esbuild/freebsd-x64" "0.24.0"
+    "@esbuild/linux-arm" "0.24.0"
+    "@esbuild/linux-arm64" "0.24.0"
+    "@esbuild/linux-ia32" "0.24.0"
+    "@esbuild/linux-loong64" "0.24.0"
+    "@esbuild/linux-mips64el" "0.24.0"
+    "@esbuild/linux-ppc64" "0.24.0"
+    "@esbuild/linux-riscv64" "0.24.0"
+    "@esbuild/linux-s390x" "0.24.0"
+    "@esbuild/linux-x64" "0.24.0"
+    "@esbuild/netbsd-x64" "0.24.0"
+    "@esbuild/openbsd-arm64" "0.24.0"
+    "@esbuild/openbsd-x64" "0.24.0"
+    "@esbuild/sunos-x64" "0.24.0"
+    "@esbuild/win32-arm64" "0.24.0"
+    "@esbuild/win32-ia32" "0.24.0"
+    "@esbuild/win32-x64" "0.24.0"
+
 esbuild@^0.25.0:
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.25.0.tgz#0de1787a77206c5a79eeb634a623d39b5006ce92"
@@ -4181,6 +4514,14 @@ eslint-scope@^7.2.2:
     esrecurse "^4.3.0"
     estraverse "^5.2.0"
 
+eslint-scope@^8.2.0:
+  version "8.2.0"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-8.2.0.tgz#377aa6f1cb5dc7592cfd0b7f892fd0cf352ce442"
+  integrity sha512-PHlWUfG6lvPc3yvP5A4PNyBL1W8fkDUccmI21JUu/+GKZBoH/W5u6usENXUrWFRsyoW5ACUjFGgAFQp5gUlb/A==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^5.2.0"
+
 eslint-visitor-keys@^3.3.0:
   version "3.3.0"
   resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-3.3.0.tgz#f6480fa6b1f30efe2d1968aa8ac745b862469826"
@@ -4196,6 +4537,11 @@ eslint-visitor-keys@^3.4.3:
   resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz#0cd72fe8550e3c2eae156a96a4dddcd1c8ac5800"
   integrity sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==
 
+eslint-visitor-keys@^4.2.0:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-4.2.0.tgz#687bacb2af884fcdda8a6e7d65c606f46a14cd45"
+  integrity sha512-UyLnSehNt62FFhSwjZlHmeokpRK59rcz29j+F1/aDgbkbRTk7wIc9XzdoasMUbRNKDM0qQt/+BJ4BrpFeABemw==
+
 eslint@8.57.0:
   version "8.57.0"
   resolved "https://registry.yarnpkg.com/eslint/-/eslint-8.57.0.tgz#c786a6fd0e0b68941aaf624596fb987089195668"
@@ -4284,6 +4630,55 @@ eslint@^8.57.1:
     strip-ansi "^6.0.1"
     text-table "^0.2.0"
 
+eslint@^9.13.0:
+  version "9.17.0"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-9.17.0.tgz#faa1facb5dd042172fdc520106984b5c2421bb0c"
+  integrity sha512-evtlNcpJg+cZLcnVKwsai8fExnqjGPicK7gnUtlNuzu+Fv9bI0aLpND5T44VLQtoMEnI57LoXO9XAkIXwohKrA==
+  dependencies:
+    "@eslint-community/eslint-utils" "^4.2.0"
+    "@eslint-community/regexpp" "^4.12.1"
+    "@eslint/config-array" "^0.19.0"
+    "@eslint/core" "^0.9.0"
+    "@eslint/eslintrc" "^3.2.0"
+    "@eslint/js" "9.17.0"
+    "@eslint/plugin-kit" "^0.2.3"
+    "@humanfs/node" "^0.16.6"
+    "@humanwhocodes/module-importer" "^1.0.1"
+    "@humanwhocodes/retry" "^0.4.1"
+    "@types/estree" "^1.0.6"
+    "@types/json-schema" "^7.0.15"
+    ajv "^6.12.4"
+    chalk "^4.0.0"
+    cross-spawn "^7.0.6"
+    debug "^4.3.2"
+    escape-string-regexp "^4.0.0"
+    eslint-scope "^8.2.0"
+    eslint-visitor-keys "^4.2.0"
+    espree "^10.3.0"
+    esquery "^1.5.0"
+    esutils "^2.0.2"
+    fast-deep-equal "^3.1.3"
+    file-entry-cache "^8.0.0"
+    find-up "^5.0.0"
+    glob-parent "^6.0.2"
+    ignore "^5.2.0"
+    imurmurhash "^0.1.4"
+    is-glob "^4.0.0"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    lodash.merge "^4.6.2"
+    minimatch "^3.1.2"
+    natural-compare "^1.4.0"
+    optionator "^0.9.3"
+
+espree@^10.0.1, espree@^10.3.0:
+  version "10.3.0"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-10.3.0.tgz#29267cf5b0cb98735b65e64ba07e0ed49d1eed8a"
+  integrity sha512-0QYC8b24HWY8zjRnDTL6RiHfDbAWn63qb4LMj1Z4b076A4une81+z03Kg7l7mn/48PUTqoLptSXez8oknU8Clg==
+  dependencies:
+    acorn "^8.14.0"
+    acorn-jsx "^5.3.2"
+    eslint-visitor-keys "^4.2.0"
+
 espree@^9.6.0, espree@^9.6.1:
   version "9.6.1"
   resolved "https://registry.yarnpkg.com/espree/-/espree-9.6.1.tgz#a2a17b8e434690a5432f2f8018ce71d331a48c6f"
@@ -4305,6 +4700,13 @@ esquery@^1.4.2:
   dependencies:
     estraverse "^5.1.0"
 
+esquery@^1.5.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
 esrecurse@^4.3.0:
   version "4.3.0"
   resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
@@ -4470,6 +4872,13 @@ file-entry-cache@^6.0.1:
   dependencies:
     flat-cache "^3.0.4"
 
+file-entry-cache@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-8.0.0.tgz#7787bddcf1131bffb92636c69457bbc0edd6d81f"
+  integrity sha512-XXTUwCvisa5oacNGRP9SfNtYBNAMi+RPwBFmblZEF7N7swHYQS6/Zfk7SRwx4D5j3CH211YNRco1DEMNVfZCnQ==
+  dependencies:
+    flat-cache "^4.0.0"
+
 fill-range@^7.1.1:
   version "7.1.1"
   resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-7.1.1.tgz#44265d3cac07e3ea7dc247516380643754a05292"
@@ -4535,11 +4944,24 @@ flat-cache@^3.0.4:
     flatted "^3.1.0"
     rimraf "^3.0.2"
 
+flat-cache@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-4.0.1.tgz#0ece39fcb14ee012f4b0410bd33dd9c1f011127c"
+  integrity sha512-f7ccFPK3SXFHpx15UIGyRJ/FJQctuKZ0zVuN3frBo4HnK3cay9VEW0R6yPYFHC0AgqhukPzKjq22t5DmAyqGyw==
+  dependencies:
+    flatted "^3.2.9"
+    keyv "^4.5.4"
+
 flatted@^3.1.0:
   version "3.2.7"
   resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.2.7.tgz#609f39207cb614b89d0765b477cb2d437fbf9787"
   integrity sha512-5nqDSxl8nn5BSNxyR3n4I6eDmbolI6WT+QqR547RwxQapgjQBmtktdP+HTBb/a/zLsbzERTONyUB5pefh5TtjQ==
 
+flatted@^3.2.9:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.3.2.tgz#adba1448a9841bec72b42c532ea23dbbedef1a27"
+  integrity sha512-AiwGJM8YcNOaobumgtng+6NHuOqC3A7MixFeDafM3X9cIUM+xUXoS5Vfgf+OihAYe20fxqNM9yPBXJzRtZ/4eA==
+
 flow-enums-runtime@^0.0.4:
   version "0.0.4"
   resolved "https://registry.yarnpkg.com/flow-enums-runtime/-/flow-enums-runtime-0.0.4.tgz#038635c679030d08d4c197db29a2fad62722072f"
@@ -4714,6 +5136,11 @@ globals@^13.19.0:
   dependencies:
     type-fest "^0.20.2"
 
+globals@^14.0.0:
+  version "14.0.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-14.0.0.tgz#898d7413c29babcf6bafe56fcadded858ada724e"
+  integrity sha512-oahGvuMGQlPw/ivIYBjVSrWAfWLBeku5tpPE2fOPLi+WHffIWbuh2tCjhyQhTBPMf5E9jDEH4FOmTYgYwbKwtQ==
+
 globby@^11.1.0:
   version "11.1.0"
   resolved "https://registry.yarnpkg.com/globby/-/globby-11.1.0.tgz#bd4be98bb042f83d796f7e3811991fbe82a0d34b"
@@ -6277,6 +6704,11 @@ jsesc@~0.5.0:
   resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d"
   integrity sha512-uZz5UnB7u4T9LvwmFqXii7pZSouaRPorGs5who1Ip7VO0wxanFvBL7GkM6dTHlgX+jhBApRetaWpnDabOeTcnA==
 
+json-buffer@3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.1.tgz#9338802a30d3b6605fbe0613e094008ca8c05a13"
+  integrity sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==
+
 json-diff@^0.5.4:
   version "0.5.5"
   resolved "https://registry.yarnpkg.com/json-diff/-/json-diff-0.5.5.tgz#24658ad200dbdd64ae8a56baf4d87b2b33d7196e"
@@ -6318,6 +6750,13 @@ keypress@~0.2.1:
   resolved "https://registry.yarnpkg.com/keypress/-/keypress-0.2.1.tgz#1e80454250018dbad4c3fe94497d6e67b6269c77"
   integrity sha512-HjorDJFNhnM4SicvaUXac0X77NiskggxJdesG72+O5zBKpSqKFCrqmndKVqpu3pFqkla0St6uGk8Ju0sCurrmg==
 
+keyv@^4.5.4:
+  version "4.5.4"
+  resolved "https://registry.yarnpkg.com/keyv/-/keyv-4.5.4.tgz#a879a99e29452f942439f2a405e3af8b31d4de93"
+  integrity sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==
+  dependencies:
+    json-buffer "3.0.1"
+
 kind-of@^6.0.2:
   version "6.0.3"
   resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-6.0.3.tgz#07c05034a6c349fa06e24fa35aa76db4580ce4dd"
@@ -7747,11 +8186,30 @@ type-fest@^0.21.3:
   resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.21.3.tgz#d260a24b0198436e133fa26a524a6d65fa3b2e37"
   integrity sha512-t0rzBq87m3fVcduHDUFhKmyyX+9eo6WQjZvf51Ea/M0Q7+T374Jp1aUiyUl0GKxp8M/OETVHSDvmkyPgvX+X2w==
 
+typescript-eslint@^8.16.0:
+  version "8.18.1"
+  resolved "https://registry.yarnpkg.com/typescript-eslint/-/typescript-eslint-8.18.1.tgz#197b284b6769678ed77d9868df180eeaf61108eb"
+  integrity sha512-Mlaw6yxuaDEPQvb/2Qwu3/TfgeBHy9iTJ3mTwe7OvpPmF6KPQjVOfGyEJpPv6Ez2C34OODChhXrzYw/9phI0MQ==
+  dependencies:
+    "@typescript-eslint/eslint-plugin" "8.18.1"
+    "@typescript-eslint/parser" "8.18.1"
+    "@typescript-eslint/utils" "8.18.1"
+
 typescript@^5.4.3:
   version "5.4.3"
   resolved "https://registry.yarnpkg.com/typescript/-/typescript-5.4.3.tgz#5c6fedd4c87bee01cd7a528a30145521f8e0feff"
   integrity sha512-KrPd3PKaCLr78MalgiwJnA25Nm8HAmdwN3mYUYZgG/wizIo9EainNVQI9/yDavtVFRN2h3k8uf3GLHuhDMgEHg==
 
+typescript@^5.7.2:
+  version "5.7.2"
+  resolved "https://registry.yarnpkg.com/typescript/-/typescript-5.7.2.tgz#3169cf8c4c8a828cde53ba9ecb3d2b1d5dd67be6"
+  integrity sha512-i5t66RHxDvVN40HfDd1PsEThGNnlMCMT3jMUuoh9/0TaqWevNontacunWyN02LA9/fIbEWlcHZcgTKb9QoaLfg==
+
+undici-types@~6.19.2:
+  version "6.19.8"
+  resolved "https://registry.yarnpkg.com/undici-types/-/undici-types-6.19.8.tgz#35111c9d1437ab83a7cdc0abae2f26d88eda0a02"
+  integrity sha512-ve2KP6f/JnbPBFyobGHuerC9g1FYGn/F8n1LWTwNxCEzd6IfqTwUQcNXgEtmmQ6DlRrC1hrSrBnCZPokRrDHjw==
+
 unicode-canonical-property-names-ecmascript@^2.0.0:
   version "2.0.0"
   resolved "https://registry.yarnpkg.com/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-2.0.0.tgz#301acdc525631670d39f6146e0e77ff6bbdebddc"

From 58def9f2e6ddd2ae3dfa9606711f1aea63a220c1 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 25 Feb 2025 12:16:10 -0500
Subject: [PATCH 57/73] [forgive] Add build scripts (#31927)

Adds basic build scripts.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/31927).
* #31918
* __->__ #31927
---
 compiler/packages/react-forgive/.vscodeignore |  4 ++
 compiler/packages/react-forgive/package.json  | 16 ++---
 .../packages/react-forgive/scripts/build.mjs  | 58 +++++++++++++++++++
 .../packages/react-forgive/scripts/client.mjs | 39 +++++++++++++
 .../packages/react-forgive/scripts/server.mjs | 39 +++++++++++++
 5 files changed, 148 insertions(+), 8 deletions(-)
 create mode 100644 compiler/packages/react-forgive/.vscodeignore
 create mode 100755 compiler/packages/react-forgive/scripts/build.mjs
 create mode 100644 compiler/packages/react-forgive/scripts/client.mjs
 create mode 100644 compiler/packages/react-forgive/scripts/server.mjs

diff --git a/compiler/packages/react-forgive/.vscodeignore b/compiler/packages/react-forgive/.vscodeignore
new file mode 100644
index 0000000000000..91f9572794cd5
--- /dev/null
+++ b/compiler/packages/react-forgive/.vscodeignore
@@ -0,0 +1,4 @@
+**/node_modules
+client
+server
+scripts
diff --git a/compiler/packages/react-forgive/package.json b/compiler/packages/react-forgive/package.json
index 30aec4235523e..bc5f7310e98fe 100644
--- a/compiler/packages/react-forgive/package.json
+++ b/compiler/packages/react-forgive/package.json
@@ -35,23 +35,23 @@
     ]
   },
   "scripts": {
-    "compile": "yarn run esbuild-base -- --sourcemap",
+    "build": "yarn run compile",
+    "compile": "rimraf dist && concurrently -n server,client \"scripts/build.mjs -t server\" \"scripts/build.mjs -t client\"",
     "dev": "yarn run package && yarn run install-ext",
-    "esbuild-base": "esbuild ./src/extension.ts --bundle --outfile=dist/extension.js --external:vscode --format=cjs --platform=node",
-    "install-ext": "code --install-extension vscode-react-compiler-0.0.1.vsix",
+    "install-ext": "code --install-extension react-forgive-0.0.0.vsix",
     "lint": "echo 'no tests'",
-    "package": "vsce package",
+    "package": "rm -f react-forgive-0.0.0.vsix && vsce package --yarn",
     "postinstall": "cd client && yarn install && cd ../server && yarn install && cd ..",
     "pretest": "yarn run compile && yarn run lint",
     "test": "echo 'no tests'",
-    "test-compile": "tsc -p ./",
-    "vscode:prepublish": "yarn run esbuild-base -- --minify",
-    "watch": "yarn run esbuild-base -- --sourcemap --watch"
+    "vscode:prepublish": "yarn run compile",
+    "watch": "scripts/build.mjs --watch"
   },
   "devDependencies": {
     "@eslint/js": "^9.13.0",
     "@types/node": "^20",
     "eslint": "^9.13.0",
-    "typescript-eslint": "^8.16.0"
+    "typescript-eslint": "^8.16.0",
+    "yargs": "^17.7.2"
   }
 }
diff --git a/compiler/packages/react-forgive/scripts/build.mjs b/compiler/packages/react-forgive/scripts/build.mjs
new file mode 100755
index 0000000000000..5fc8828e6e749
--- /dev/null
+++ b/compiler/packages/react-forgive/scripts/build.mjs
@@ -0,0 +1,58 @@
+#!/usr/bin/env node
+
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+
+import * as esbuild from 'esbuild';
+import yargs from 'yargs';
+import * as Server from './server.mjs';
+import * as Client from './client.mjs';
+import path from 'path';
+import {fileURLToPath} from 'url';
+
+const IS_DEV = process.env.NODE_ENV === 'development';
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = path.dirname(__filename);
+
+const argv = yargs(process.argv.slice(2))
+  .choices('t', ['client', 'server'])
+  .options('w', {
+    alias: 'watch',
+    default: false,
+    type: 'boolean',
+  })
+  .parse();
+
+async function main() {
+  if (argv.w) {
+    const serverCtx = await esbuild.context(Server.config);
+    const clientCtx = await esbuild.context(Client.config);
+    await Promise.all([serverCtx.watch(), clientCtx.watch()]);
+    console.log('watching for changes...');
+  } else {
+    switch (argv.t) {
+      case 'server': {
+        await esbuild.build({
+          sourcemap: IS_DEV,
+          minify: IS_DEV === false,
+          ...Server.config,
+        });
+        break;
+      }
+      case 'client': {
+        await esbuild.build({
+          sourcemap: IS_DEV,
+          minify: IS_DEV === false,
+          ...Client.config,
+        });
+        break;
+      }
+    }
+  }
+}
+
+main();
diff --git a/compiler/packages/react-forgive/scripts/client.mjs b/compiler/packages/react-forgive/scripts/client.mjs
new file mode 100644
index 0000000000000..9a8987061b391
--- /dev/null
+++ b/compiler/packages/react-forgive/scripts/client.mjs
@@ -0,0 +1,39 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+
+import path from 'path';
+import {fileURLToPath} from 'url';
+
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = path.dirname(__filename);
+
+export const entryPoint = path.join(__dirname, '../client/src/extension.ts');
+export const outfile = path.join(__dirname, '../dist/extension.js');
+export const config = {
+  entryPoints: [entryPoint],
+  outfile,
+  bundle: true,
+  external: ['vscode'],
+  format: 'cjs',
+  platform: 'node',
+  banner: {
+    js: `/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @lightSyntaxTransform
+ * @noflow
+ * @nolint
+ * @preventMunge
+ * @preserve-invariant-messages
+ */
+
+`,
+  },
+};
diff --git a/compiler/packages/react-forgive/scripts/server.mjs b/compiler/packages/react-forgive/scripts/server.mjs
new file mode 100644
index 0000000000000..95afe8770d44b
--- /dev/null
+++ b/compiler/packages/react-forgive/scripts/server.mjs
@@ -0,0 +1,39 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+
+import path from 'path';
+import {fileURLToPath} from 'url';
+
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = path.dirname(__filename);
+
+export const entryPoint = path.join(__dirname, '../server/src/index.ts');
+export const outfile = path.join(__dirname, '../dist/extension.js');
+export const config = {
+  entryPoints: [entryPoint],
+  outfile,
+  bundle: true,
+  external: ['vscode'],
+  format: 'cjs',
+  platform: 'node',
+  banner: {
+    js: `/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @lightSyntaxTransform
+ * @noflow
+ * @nolint
+ * @preventMunge
+ * @preserve-invariant-messages
+ */
+
+`,
+  },
+};

From d42a90cf4f8a9eb9f41939c7d095a6a93b8816dc Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 25 Feb 2025 12:19:11 -0500
Subject: [PATCH 58/73] [forgive] Init (#31918)

Init basic LSP. At the moment the extension doesn't do anything
interesting, but it does compile successfully.
---
 .gitignore                                    |   1 +
 compiler/.gitignore                           |   6 +-
 .../packages/react-forgive/.vscode-test.mjs   |   3 +
 compiler/packages/react-forgive/.yarnrc       |   1 +
 compiler/packages/react-forgive/LICENSE       |  21 +
 .../react-forgive/client/package.json         |   2 +-
 .../react-forgive/client/src/extension.ts     |  60 ++
 compiler/packages/react-forgive/package.json  |   9 +-
 .../packages/react-forgive/scripts/server.mjs |   2 +-
 .../react-forgive/server/package.json         |  10 +-
 .../server/src/compiler/index.ts              |  58 ++
 .../server/src/compiler/options.ts            |  25 +
 .../react-forgive/server/src/index.ts         |  87 +++
 .../react-forgive/server/tsconfig.json        |  14 +-
 .../packages/react-forgive/server/yarn.lock   | 377 ++++++++++
 compiler/yarn.lock                            | 707 +++++++++++++-----
 16 files changed, 1184 insertions(+), 199 deletions(-)
 create mode 100644 compiler/packages/react-forgive/.vscode-test.mjs
 create mode 100644 compiler/packages/react-forgive/.yarnrc
 create mode 100644 compiler/packages/react-forgive/LICENSE
 create mode 100644 compiler/packages/react-forgive/client/src/extension.ts
 create mode 100644 compiler/packages/react-forgive/server/src/compiler/index.ts
 create mode 100644 compiler/packages/react-forgive/server/src/compiler/options.ts

diff --git a/.gitignore b/.gitignore
index 2a20fc2427c98..6432df4f054d8 100644
--- a/.gitignore
+++ b/.gitignore
@@ -37,3 +37,4 @@ packages/react-devtools-fusebox/dist
 packages/react-devtools-inline/dist
 packages/react-devtools-shell/dist
 packages/react-devtools-timeline/dist
+
diff --git a/compiler/.gitignore b/compiler/.gitignore
index 01003c659c622..d41f59333aa09 100644
--- a/compiler/.gitignore
+++ b/compiler/.gitignore
@@ -21,4 +21,8 @@ dist
 .spr.yml
 testfilter.txt
 
-bundle-oss.sh
\ No newline at end of file
+bundle-oss.sh
+
+# forgive
+*.vsix
+.vscode-test
diff --git a/compiler/packages/react-forgive/.vscode-test.mjs b/compiler/packages/react-forgive/.vscode-test.mjs
new file mode 100644
index 0000000000000..738bfc71b9ced
--- /dev/null
+++ b/compiler/packages/react-forgive/.vscode-test.mjs
@@ -0,0 +1,3 @@
+import {defineConfig} from '@vscode/test-cli';
+
+export default defineConfig({files: 'dist/test/**/*.test.js'});
diff --git a/compiler/packages/react-forgive/.yarnrc b/compiler/packages/react-forgive/.yarnrc
new file mode 100644
index 0000000000000..123ac74a0a3de
--- /dev/null
+++ b/compiler/packages/react-forgive/.yarnrc
@@ -0,0 +1 @@
+ignore-engines true
diff --git a/compiler/packages/react-forgive/LICENSE b/compiler/packages/react-forgive/LICENSE
new file mode 100644
index 0000000000000..b93be90515ccd
--- /dev/null
+++ b/compiler/packages/react-forgive/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) Meta Platforms, Inc. and affiliates.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/compiler/packages/react-forgive/client/package.json b/compiler/packages/react-forgive/client/package.json
index c90cee4b423d9..a975439726f23 100644
--- a/compiler/packages/react-forgive/client/package.json
+++ b/compiler/packages/react-forgive/client/package.json
@@ -11,7 +11,7 @@
   "repository": {
     "type": "git",
     "url": "git+https://github.com/facebook/react.git",
-    "directory": "compiler/packages/react-forgive-client"
+    "directory": "compiler/packages/react-forgive"
   },
   "dependencies": {
     "vscode-languageclient": "^9.0.1"
diff --git a/compiler/packages/react-forgive/client/src/extension.ts b/compiler/packages/react-forgive/client/src/extension.ts
new file mode 100644
index 0000000000000..402f298fd74c5
--- /dev/null
+++ b/compiler/packages/react-forgive/client/src/extension.ts
@@ -0,0 +1,60 @@
+import * as path from 'path';
+import {ExtensionContext, window as Window} from 'vscode';
+
+import {
+  LanguageClient,
+  LanguageClientOptions,
+  ServerOptions,
+  TransportKind,
+} from 'vscode-languageclient/node';
+
+let client: LanguageClient;
+
+export function activate(context: ExtensionContext) {
+  const serverModule = context.asAbsolutePath(path.join('dist', 'server.js'));
+
+  // If the extension is launched in debug mode then the debug server options are used
+  // Otherwise the run options are used
+  const serverOptions: ServerOptions = {
+    run: {
+      module: serverModule,
+      transport: TransportKind.ipc,
+    },
+    debug: {
+      module: serverModule,
+      transport: TransportKind.ipc,
+    },
+  };
+
+  const clientOptions: LanguageClientOptions = {
+    documentSelector: [
+      {scheme: 'file', language: 'javascriptreact'},
+      {scheme: 'file', language: 'typescriptreact'},
+    ],
+    progressOnInitialization: true,
+  };
+
+  // Create the language client and start the client.
+  try {
+    client = new LanguageClient(
+      'react-forgive',
+      'React Analyzer',
+      serverOptions,
+      clientOptions,
+    );
+  } catch {
+    Window.showErrorMessage(
+      `React Analyzer couldn't be started. See the output channel for details.`,
+    );
+    return;
+  }
+
+  client.registerProposedFeatures();
+  client.start();
+}
+
+export function deactivate(): Thenable<void> | undefined {
+  if (client !== undefined) {
+    return client.stop();
+  }
+}
diff --git a/compiler/packages/react-forgive/package.json b/compiler/packages/react-forgive/package.json
index bc5f7310e98fe..0bf48e232ecf4 100644
--- a/compiler/packages/react-forgive/package.json
+++ b/compiler/packages/react-forgive/package.json
@@ -19,7 +19,7 @@
   ],
   "publisher": "Meta",
   "engines": {
-    "vscode": "^1.75.0"
+    "vscode": "^1.96.0"
   },
   "activationEvents": [
     "onLanguage:javascriptreact",
@@ -43,14 +43,19 @@
     "package": "rm -f react-forgive-0.0.0.vsix && vsce package --yarn",
     "postinstall": "cd client && yarn install && cd ../server && yarn install && cd ..",
     "pretest": "yarn run compile && yarn run lint",
-    "test": "echo 'no tests'",
+    "test": "vscode-test",
     "vscode:prepublish": "yarn run compile",
     "watch": "scripts/build.mjs --watch"
   },
   "devDependencies": {
     "@eslint/js": "^9.13.0",
+    "@types/mocha": "^10.0.10",
     "@types/node": "^20",
+    "@types/vscode": "^1.96.0",
+    "@vscode/test-cli": "^0.0.10",
+    "@vscode/test-electron": "^2.4.1",
     "eslint": "^9.13.0",
+    "mocha": "^11.0.1",
     "typescript-eslint": "^8.16.0",
     "yargs": "^17.7.2"
   }
diff --git a/compiler/packages/react-forgive/scripts/server.mjs b/compiler/packages/react-forgive/scripts/server.mjs
index 95afe8770d44b..e6d120e341af9 100644
--- a/compiler/packages/react-forgive/scripts/server.mjs
+++ b/compiler/packages/react-forgive/scripts/server.mjs
@@ -12,7 +12,7 @@ const __filename = fileURLToPath(import.meta.url);
 const __dirname = path.dirname(__filename);
 
 export const entryPoint = path.join(__dirname, '../server/src/index.ts');
-export const outfile = path.join(__dirname, '../dist/extension.js');
+export const outfile = path.join(__dirname, '../dist/server.js');
 export const config = {
   entryPoints: [entryPoint],
   outfile,
diff --git a/compiler/packages/react-forgive/server/package.json b/compiler/packages/react-forgive/server/package.json
index 4e4d54debbaa5..fb6f4feebd7ac 100644
--- a/compiler/packages/react-forgive/server/package.json
+++ b/compiler/packages/react-forgive/server/package.json
@@ -5,15 +5,21 @@
   "description": "Experimental LSP server",
   "license": "MIT",
   "scripts": {
-    "build": "echo 'no build'",
+    "build": "rimraf dist && rollup --config --bundleConfigAsCjs",
     "test": "echo 'no tests'"
   },
   "repository": {
     "type": "git",
     "url": "git+https://github.com/facebook/react.git",
-    "directory": "compiler/packages/react-forgive-server"
+    "directory": "compiler/packages/react-forgive"
   },
   "dependencies": {
+    "@babel/core": "^7.26.0",
+    "@babel/parser": "^7.26.0",
+    "@babel/plugin-syntax-typescript": "^7.25.9",
+    "@babel/types": "^7.26.0",
+    "cosmiconfig": "^9.0.0",
+    "prettier": "^3.3.3",
     "vscode-languageserver": "^9.0.1",
     "vscode-languageserver-textdocument": "^1.0.12"
   }
diff --git a/compiler/packages/react-forgive/server/src/compiler/index.ts b/compiler/packages/react-forgive/server/src/compiler/index.ts
new file mode 100644
index 0000000000000..be2cca94ca154
--- /dev/null
+++ b/compiler/packages/react-forgive/server/src/compiler/index.ts
@@ -0,0 +1,58 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+
+import type * as BabelCore from '@babel/core';
+import {parseAsync, transformFromAstAsync} from '@babel/core';
+import BabelPluginReactCompiler, {
+  type PluginOptions,
+} from 'babel-plugin-react-compiler/src';
+import * as babelParser from 'prettier/plugins/babel.js';
+import * as estreeParser from 'prettier/plugins/estree';
+import * as typescriptParser from 'prettier/plugins/typescript';
+import * as prettier from 'prettier/standalone';
+
+type CompileOptions = {
+  text: string;
+  file: string;
+  options: PluginOptions | null;
+};
+export async function compile({
+  text,
+  file,
+  options,
+}: CompileOptions): Promise<BabelCore.BabelFileResult> {
+  const ast = await parseAsync(text, {
+    sourceFileName: file,
+    parserOpts: {
+      plugins: ['typescript', 'jsx'],
+    },
+    sourceType: 'module',
+  });
+  const plugins =
+    options != null
+      ? [[BabelPluginReactCompiler, options]]
+      : [[BabelPluginReactCompiler]];
+  const result = await transformFromAstAsync(ast, text, {
+    filename: file,
+    highlightCode: false,
+    retainLines: true,
+    plugins,
+    sourceType: 'module',
+    sourceFileName: file,
+  });
+  if (result?.code == null) {
+    throw new Error(
+      `Expected BabelPluginReactCompiler to compile successfully, got ${result}`,
+    );
+  }
+  result.code = await prettier.format(result.code, {
+    semi: false,
+    parser: 'babel-ts',
+    plugins: [babelParser, estreeParser, typescriptParser],
+  });
+  return result;
+}
diff --git a/compiler/packages/react-forgive/server/src/compiler/options.ts b/compiler/packages/react-forgive/server/src/compiler/options.ts
new file mode 100644
index 0000000000000..226be799d3abc
--- /dev/null
+++ b/compiler/packages/react-forgive/server/src/compiler/options.ts
@@ -0,0 +1,25 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+
+import {
+  parsePluginOptions,
+  type PluginOptions,
+} from 'babel-plugin-react-compiler/src';
+import {cosmiconfigSync} from 'cosmiconfig';
+
+export function resolveReactConfig(projectPath: string): PluginOptions | null {
+  const explorerSync = cosmiconfigSync('react', {
+    searchStrategy: 'project',
+    cache: true,
+  });
+  const result = explorerSync.search(projectPath);
+  if (result != null) {
+    return parsePluginOptions(result.config);
+  } else {
+    return null;
+  }
+}
diff --git a/compiler/packages/react-forgive/server/src/index.ts b/compiler/packages/react-forgive/server/src/index.ts
index a265a953eed3d..057df617c8d10 100644
--- a/compiler/packages/react-forgive/server/src/index.ts
+++ b/compiler/packages/react-forgive/server/src/index.ts
@@ -4,3 +4,90 @@
  * This source code is licensed under the MIT license found in the
  * LICENSE file in the root directory of this source tree.
  */
+
+import {TextDocument} from 'vscode-languageserver-textdocument';
+import {
+  createConnection,
+  type InitializeParams,
+  type InitializeResult,
+  ProposedFeatures,
+  TextDocuments,
+  TextDocumentSyncKind,
+} from 'vscode-languageserver/node';
+import {compile} from './compiler';
+import {type PluginOptions} from 'babel-plugin-react-compiler/src';
+import {resolveReactConfig} from './compiler/options';
+import {type BabelFileResult} from '@babel/core';
+
+const SUPPORTED_LANGUAGE_IDS = new Set([
+  'javascript',
+  'javascriptreact',
+  'typescript',
+  'typescriptreact',
+]);
+
+const connection = createConnection(ProposedFeatures.all);
+const documents = new TextDocuments(TextDocument);
+
+let compilerOptions: PluginOptions | null = null;
+let lastResult: BabelFileResult | null = null;
+
+connection.onInitialize((_params: InitializeParams) => {
+  // TODO(@poteto) get config fr
+  compilerOptions = resolveReactConfig('.');
+  const result: InitializeResult = {
+    capabilities: {
+      textDocumentSync: TextDocumentSyncKind.Full,
+      codeLensProvider: {resolveProvider: true},
+    },
+  };
+  return result;
+});
+
+connection.onInitialized(() => {
+  connection.console.log('initialized');
+});
+
+documents.onDidOpen(async event => {
+  if (SUPPORTED_LANGUAGE_IDS.has(event.document.languageId)) {
+    const text = event.document.getText();
+    const result = await compile({
+      text,
+      file: event.document.uri,
+      options: compilerOptions,
+    });
+    if (result.code != null) {
+      lastResult = result;
+    }
+  }
+});
+
+documents.onDidChangeContent(async event => {
+  if (SUPPORTED_LANGUAGE_IDS.has(event.document.languageId)) {
+    const text = event.document.getText();
+    const result = await compile({
+      text,
+      file: event.document.uri,
+      options: compilerOptions,
+    });
+    if (result.code != null) {
+      lastResult = result;
+    }
+  }
+});
+
+connection.onDidChangeWatchedFiles(change => {
+  connection.console.log(
+    change.changes.map(c => `File changed: ${c.uri}`).join('\n'),
+  );
+});
+
+connection.onCodeLens(params => {
+  connection.console.log('lastResult: ' + JSON.stringify(lastResult, null, 2));
+  connection.console.log('params: ' + JSON.stringify(params, null, 2));
+  return [];
+});
+
+documents.listen(connection);
+connection.listen();
+connection.console.info(`React Analyzer running in node ${process.version}`);
diff --git a/compiler/packages/react-forgive/server/tsconfig.json b/compiler/packages/react-forgive/server/tsconfig.json
index ccd17f5dff457..52efba4ebe5af 100644
--- a/compiler/packages/react-forgive/server/tsconfig.json
+++ b/compiler/packages/react-forgive/server/tsconfig.json
@@ -1,13 +1,15 @@
 {
   "extends": "@tsconfig/strictest/tsconfig.json",
   "compilerOptions": {
-    "module": "CommonJS",
-    "moduleResolution": "node",
-    "outDir": "dist",
+    "module": "ES2015",
+    "moduleResolution": "Bundler",
+    "rootDir": "../../..",
+    "noEmit": true,
     "jsx": "react-jsxdev",
-    "lib": ["ES2020"],
-    "target": "ES2020",
+    "target": "ES2015",
+    "sourceMap": false,
+    "removeComments": true,
   },
   "exclude": ["node_modules", ".vscode-test"],
-  "include": ["src/**/*.ts"],
+  "include": ["src/**/*.ts"]
 }
diff --git a/compiler/packages/react-forgive/server/yarn.lock b/compiler/packages/react-forgive/server/yarn.lock
index fd60ddd6ad5f1..b72063294ff08 100644
--- a/compiler/packages/react-forgive/server/yarn.lock
+++ b/compiler/packages/react-forgive/server/yarn.lock
@@ -2,6 +2,378 @@
 # yarn lockfile v1
 
 
+"@ampproject/remapping@^2.2.0":
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/@ampproject/remapping/-/remapping-2.3.0.tgz#ed441b6fa600072520ce18b43d2c8cc8caecc7f4"
+  integrity sha512-30iZtAPgz+LTIYoeivqYo853f02jBYSd5uGnGpkFV0M3xOt9aN73erkgYAmZU43x4VfqcnLxW9Kpg3R5LC4YYw==
+  dependencies:
+    "@jridgewell/gen-mapping" "^0.3.5"
+    "@jridgewell/trace-mapping" "^0.3.24"
+
+"@babel/code-frame@^7.0.0", "@babel/code-frame@^7.25.9", "@babel/code-frame@^7.26.0", "@babel/code-frame@^7.26.2":
+  version "7.26.2"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.26.2.tgz#4b5fab97d33338eff916235055f0ebc21e573a85"
+  integrity sha512-RJlIHRueQgwWitWgF8OdFYGZX328Ax5BCemNGlqHfplnRT9ESi8JkFlvaVYbS+UubVY6dpv87Fs2u5M29iNFVQ==
+  dependencies:
+    "@babel/helper-validator-identifier" "^7.25.9"
+    js-tokens "^4.0.0"
+    picocolors "^1.0.0"
+
+"@babel/compat-data@^7.25.9":
+  version "7.26.3"
+  resolved "https://registry.yarnpkg.com/@babel/compat-data/-/compat-data-7.26.3.tgz#99488264a56b2aded63983abd6a417f03b92ed02"
+  integrity sha512-nHIxvKPniQXpmQLb0vhY3VaFb3S0YrTAwpOWJZh1wn3oJPjJk9Asva204PsBdmAE8vpzfHudT8DB0scYvy9q0g==
+
+"@babel/core@^7.26.0":
+  version "7.26.0"
+  resolved "https://registry.yarnpkg.com/@babel/core/-/core-7.26.0.tgz#d78b6023cc8f3114ccf049eb219613f74a747b40"
+  integrity sha512-i1SLeK+DzNnQ3LL/CswPCa/E5u4lh1k6IAEphON8F+cXt0t9euTshDru0q7/IqMa1PMPz5RnHuHscF8/ZJsStg==
+  dependencies:
+    "@ampproject/remapping" "^2.2.0"
+    "@babel/code-frame" "^7.26.0"
+    "@babel/generator" "^7.26.0"
+    "@babel/helper-compilation-targets" "^7.25.9"
+    "@babel/helper-module-transforms" "^7.26.0"
+    "@babel/helpers" "^7.26.0"
+    "@babel/parser" "^7.26.0"
+    "@babel/template" "^7.25.9"
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.26.0"
+    convert-source-map "^2.0.0"
+    debug "^4.1.0"
+    gensync "^1.0.0-beta.2"
+    json5 "^2.2.3"
+    semver "^6.3.1"
+
+"@babel/generator@^7.26.0", "@babel/generator@^7.26.3":
+  version "7.26.3"
+  resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.26.3.tgz#ab8d4360544a425c90c248df7059881f4b2ce019"
+  integrity sha512-6FF/urZvD0sTeO7k6/B15pMLC4CHUv1426lzr3N01aHJTl046uCAh9LXW/fzeXXjPNCJ6iABW5XaWOsIZB93aQ==
+  dependencies:
+    "@babel/parser" "^7.26.3"
+    "@babel/types" "^7.26.3"
+    "@jridgewell/gen-mapping" "^0.3.5"
+    "@jridgewell/trace-mapping" "^0.3.25"
+    jsesc "^3.0.2"
+
+"@babel/helper-compilation-targets@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-compilation-targets/-/helper-compilation-targets-7.25.9.tgz#55af025ce365be3cdc0c1c1e56c6af617ce88875"
+  integrity sha512-j9Db8Suy6yV/VHa4qzrj9yZfZxhLWQdVnRlXxmKLYlhWUVB1sB2G5sxuWYXk/whHD9iW76PmNzxZ4UCnTQTVEQ==
+  dependencies:
+    "@babel/compat-data" "^7.25.9"
+    "@babel/helper-validator-option" "^7.25.9"
+    browserslist "^4.24.0"
+    lru-cache "^5.1.1"
+    semver "^6.3.1"
+
+"@babel/helper-module-imports@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.25.9.tgz#e7f8d20602ebdbf9ebbea0a0751fb0f2a4141715"
+  integrity sha512-tnUA4RsrmflIM6W6RFTLFSXITtl0wKjgpnLgXyowocVPrbYrLUXSBXDgTs8BlbmIzIdlBySRQjINYs2BAkiLtw==
+  dependencies:
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
+"@babel/helper-module-transforms@^7.26.0":
+  version "7.26.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.26.0.tgz#8ce54ec9d592695e58d84cd884b7b5c6a2fdeeae"
+  integrity sha512-xO+xu6B5K2czEnQye6BHA7DolFFmS3LB7stHZFaOLb1pAwO1HWLS8fXA+eh0A2yIvltPVmx3eNNDBJA2SLHXFw==
+  dependencies:
+    "@babel/helper-module-imports" "^7.25.9"
+    "@babel/helper-validator-identifier" "^7.25.9"
+    "@babel/traverse" "^7.25.9"
+
+"@babel/helper-plugin-utils@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.25.9.tgz#9cbdd63a9443a2c92a725cca7ebca12cc8dd9f46"
+  integrity sha512-kSMlyUVdWe25rEsRGviIgOWnoT/nfABVWlqt9N19/dIPWViAOW2s9wznP5tURbs/IDuNk4gPy3YdYRgH3uxhBw==
+
+"@babel/helper-string-parser@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-string-parser/-/helper-string-parser-7.25.9.tgz#1aabb72ee72ed35789b4bbcad3ca2862ce614e8c"
+  integrity sha512-4A/SCr/2KLd5jrtOMFzaKjVtAei3+2r/NChoBNoZ3EyP/+GlhoaEGoWOZUmFmoITP7zOJyHIMm+DYRd8o3PvHA==
+
+"@babel/helper-validator-identifier@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz#24b64e2c3ec7cd3b3c547729b8d16871f22cbdc7"
+  integrity sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==
+
+"@babel/helper-validator-option@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.25.9.tgz#86e45bd8a49ab7e03f276577f96179653d41da72"
+  integrity sha512-e/zv1co8pp55dNdEcCynfj9X7nyUKUXoUEwfXqaZt0omVOmDe9oOTdKStH4GmAw6zxMFs50ZayuMfHDKlO7Tfw==
+
+"@babel/helpers@^7.26.0":
+  version "7.26.0"
+  resolved "https://registry.yarnpkg.com/@babel/helpers/-/helpers-7.26.0.tgz#30e621f1eba5aa45fe6f4868d2e9154d884119a4"
+  integrity sha512-tbhNuIxNcVb21pInl3ZSjksLCvgdZy9KwJ8brv993QtIVKJBBkYXz4q4ZbAv31GdnC+R90np23L5FbEBlthAEw==
+  dependencies:
+    "@babel/template" "^7.25.9"
+    "@babel/types" "^7.26.0"
+
+"@babel/parser@^7.25.9", "@babel/parser@^7.26.0", "@babel/parser@^7.26.3":
+  version "7.26.3"
+  resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.26.3.tgz#8c51c5db6ddf08134af1ddbacf16aaab48bac234"
+  integrity sha512-WJ/CvmY8Mea8iDXo6a7RK2wbmJITT5fN3BEkRuFlxVyNx8jOKIIhmC4fSkTcPcf8JyavbBwIe6OpiCOBXt/IcA==
+  dependencies:
+    "@babel/types" "^7.26.3"
+
+"@babel/plugin-syntax-typescript@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.25.9.tgz#67dda2b74da43727cf21d46cf9afef23f4365399"
+  integrity sha512-hjMgRy5hb8uJJjUcdWunWVcoi9bGpJp8p5Ol1229PoN6aytsLwNMgmdftO23wnCLMfVmTwZDWMPNq/D1SY60JQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.25.9"
+
+"@babel/template@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.25.9.tgz#ecb62d81a8a6f5dc5fe8abfc3901fc52ddf15016"
+  integrity sha512-9DGttpmPvIxBb/2uwpVo3dqJ+O6RooAFOS+lB+xDqoE2PVCE8nfoHMdZLpfCQRLwvohzXISPZcgxt80xLfsuwg==
+  dependencies:
+    "@babel/code-frame" "^7.25.9"
+    "@babel/parser" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
+"@babel/traverse@^7.25.9":
+  version "7.26.4"
+  resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.26.4.tgz#ac3a2a84b908dde6d463c3bfa2c5fdc1653574bd"
+  integrity sha512-fH+b7Y4p3yqvApJALCPJcwb0/XaOSgtK4pzV6WVjPR5GLFQBRI7pfoX2V2iM48NXvX07NUxxm1Vw98YjqTcU5w==
+  dependencies:
+    "@babel/code-frame" "^7.26.2"
+    "@babel/generator" "^7.26.3"
+    "@babel/parser" "^7.26.3"
+    "@babel/template" "^7.25.9"
+    "@babel/types" "^7.26.3"
+    debug "^4.3.1"
+    globals "^11.1.0"
+
+"@babel/types@^7.25.9", "@babel/types@^7.26.0", "@babel/types@^7.26.3":
+  version "7.26.3"
+  resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.26.3.tgz#37e79830f04c2b5687acc77db97fbc75fb81f3c0"
+  integrity sha512-vN5p+1kl59GVKMvTHt55NzzmYVxprfJD+ql7U9NFIfKCBkYE55LYtS+WtPlaYOyzydrKI8Nezd+aZextrd+FMA==
+  dependencies:
+    "@babel/helper-string-parser" "^7.25.9"
+    "@babel/helper-validator-identifier" "^7.25.9"
+
+"@jridgewell/gen-mapping@^0.3.5":
+  version "0.3.8"
+  resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.8.tgz#4f0e06362e01362f823d348f1872b08f666d8142"
+  integrity sha512-imAbBGkb+ebQyxKgzv5Hu2nmROxoDOXHh80evxdoXNOrvAnVx7zimzc1Oo5h9RlfV4vPXaE2iM5pOFbvOCClWA==
+  dependencies:
+    "@jridgewell/set-array" "^1.2.1"
+    "@jridgewell/sourcemap-codec" "^1.4.10"
+    "@jridgewell/trace-mapping" "^0.3.24"
+
+"@jridgewell/resolve-uri@^3.1.0":
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz#7a0ee601f60f99a20c7c7c5ff0c80388c1189bd6"
+  integrity sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==
+
+"@jridgewell/set-array@^1.2.1":
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/@jridgewell/set-array/-/set-array-1.2.1.tgz#558fb6472ed16a4c850b889530e6b36438c49280"
+  integrity sha512-R8gLRTZeyp03ymzP/6Lil/28tGeGEzhx1q2k703KGWRAI1VdvPIXdG70VJc2pAMw3NA6JKL5hhFu1sJX0Mnn/A==
+
+"@jridgewell/sourcemap-codec@^1.4.10", "@jridgewell/sourcemap-codec@^1.4.14":
+  version "1.5.0"
+  resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.0.tgz#3188bcb273a414b0d215fd22a58540b989b9409a"
+  integrity sha512-gv3ZRaISU3fjPAgNsriBRqGWQL6quFx04YMPW/zD8XMLsU32mhCCbfbO6KZFLjvYpCZ8zyDEgqsgf+PwPaM7GQ==
+
+"@jridgewell/trace-mapping@^0.3.24", "@jridgewell/trace-mapping@^0.3.25":
+  version "0.3.25"
+  resolved "https://registry.yarnpkg.com/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz#15f190e98895f3fc23276ee14bc76b675c2e50f0"
+  integrity sha512-vNk6aEwybGtawWmy/PzwnGDOjCkLWSD2wqvjGGAgOAwCGWySYXfYoxt00IJkTF+8Lb57DwOb3Aa0o9CApepiYQ==
+  dependencies:
+    "@jridgewell/resolve-uri" "^3.1.0"
+    "@jridgewell/sourcemap-codec" "^1.4.14"
+
+argparse@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-2.0.1.tgz#246f50f3ca78a3240f6c997e8a9bd1eac49e4b38"
+  integrity sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==
+
+browserslist@^4.24.0:
+  version "4.24.3"
+  resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-4.24.3.tgz#5fc2725ca8fb3c1432e13dac278c7cc103e026d2"
+  integrity sha512-1CPmv8iobE2fyRMV97dAcMVegvvWKxmq94hkLiAkUGwKVTyDLw33K+ZxiFrREKmmps4rIw6grcCFCnTMSZ/YiA==
+  dependencies:
+    caniuse-lite "^1.0.30001688"
+    electron-to-chromium "^1.5.73"
+    node-releases "^2.0.19"
+    update-browserslist-db "^1.1.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+caniuse-lite@^1.0.30001688:
+  version "1.0.30001690"
+  resolved "https://registry.yarnpkg.com/caniuse-lite/-/caniuse-lite-1.0.30001690.tgz#f2d15e3aaf8e18f76b2b8c1481abde063b8104c8"
+  integrity sha512-5ExiE3qQN6oF8Clf8ifIDcMRCRE/dMGcETG/XGMD8/XiXm6HXQgQTh1yZYLXXpSOsEUlJm1Xr7kGULZTuGtP/w==
+
+convert-source-map@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-2.0.0.tgz#4b560f649fc4e918dd0ab75cf4961e8bc882d82a"
+  integrity sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==
+
+cosmiconfig@^9.0.0:
+  version "9.0.0"
+  resolved "https://registry.yarnpkg.com/cosmiconfig/-/cosmiconfig-9.0.0.tgz#34c3fc58287b915f3ae905ab6dc3de258b55ad9d"
+  integrity sha512-itvL5h8RETACmOTFc4UfIyB2RfEHi71Ax6E/PivVxq9NseKbOWpeyHEOIbmAw1rs8Ak0VursQNww7lf7YtUwzg==
+  dependencies:
+    env-paths "^2.2.1"
+    import-fresh "^3.3.0"
+    js-yaml "^4.1.0"
+    parse-json "^5.2.0"
+
+debug@^4.1.0, debug@^4.3.1:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+electron-to-chromium@^1.5.73:
+  version "1.5.74"
+  resolved "https://registry.yarnpkg.com/electron-to-chromium/-/electron-to-chromium-1.5.74.tgz#cb886b504a6467e4c00bea3317edb38393c53413"
+  integrity sha512-ck3//9RC+6oss/1Bh9tiAVFy5vfSKbRHAFh7Z3/eTRkEqJeWgymloShB17Vg3Z4nmDNp35vAd1BZ6CMW4Wt6Iw==
+
+env-paths@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/env-paths/-/env-paths-2.2.1.tgz#420399d416ce1fbe9bc0a07c62fa68d67fd0f8f2"
+  integrity sha512-+h1lkLKhZMTYjog1VEpJNG7NZJWcuc2DDk/qsqSTRRCOXiLjeQ1d1/udrUGhqMxUgAlwKNZ0cf2uqan5GLuS2A==
+
+error-ex@^1.3.1:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.2.tgz#b4ac40648107fdcdcfae242f428bea8a14d4f1bf"
+  integrity sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==
+  dependencies:
+    is-arrayish "^0.2.1"
+
+escalade@^3.2.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/escalade/-/escalade-3.2.0.tgz#011a3f69856ba189dffa7dc8fcce99d2a87903e5"
+  integrity sha512-WUj2qlxaQtO4g6Pq5c29GTcWGDyd8itL8zTlipgECz3JesAiiOKotd8JU6otB3PACgG6xkJUyVhboMS+bje/jA==
+
+gensync@^1.0.0-beta.2:
+  version "1.0.0-beta.2"
+  resolved "https://registry.yarnpkg.com/gensync/-/gensync-1.0.0-beta.2.tgz#32a6ee76c3d7f52d46b2b1ae5d93fea8580a25e0"
+  integrity sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==
+
+globals@^11.1.0:
+  version "11.12.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-11.12.0.tgz#ab8795338868a0babd8525758018c2a7eb95c42e"
+  integrity sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==
+
+import-fresh@^3.3.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.0.tgz#37162c25fcb9ebaa2e6e53d5b4d88ce17d9e0c2b"
+  integrity sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+is-arrayish@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.2.1.tgz#77c99840527aa8ecb1a8ba697b80645a7a926a9d"
+  integrity sha512-zz06S8t0ozoDXMG+ube26zeCTNXcKIPJZJi8hBrF4idCLms4CG9QtK7qBl1boi5ODzFpjswb5JPmHCbMpjaYzg==
+
+js-tokens@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499"
+  integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==
+
+js-yaml@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-4.1.0.tgz#c1fb65f8f5017901cdd2c951864ba18458a10602"
+  integrity sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==
+  dependencies:
+    argparse "^2.0.1"
+
+jsesc@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-3.1.0.tgz#74d335a234f67ed19907fdadfac7ccf9d409825d"
+  integrity sha512-/sM3dO2FOzXjKQhJuo0Q173wf2KOo8t4I8vHy6lF9poUp7bKT0/NHE8fPX23PwfhnykfqnC2xRxOnVw5XuGIaA==
+
+json-parse-even-better-errors@^2.3.0:
+  version "2.3.1"
+  resolved "https://registry.yarnpkg.com/json-parse-even-better-errors/-/json-parse-even-better-errors-2.3.1.tgz#7c47805a94319928e05777405dc12e1f7a4ee02d"
+  integrity sha512-xyFwyhro/JEof6Ghe2iz2NcXoj2sloNsWr/XsERDK/oiPCfaNhl5ONfp+jQdAZRQQ0IJWNzH9zIZF7li91kh2w==
+
+json5@^2.2.3:
+  version "2.2.3"
+  resolved "https://registry.yarnpkg.com/json5/-/json5-2.2.3.tgz#78cd6f1a19bdc12b73db5ad0c61efd66c1e29283"
+  integrity sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==
+
+lines-and-columns@^1.1.6:
+  version "1.2.4"
+  resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632"
+  integrity sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==
+
+lru-cache@^5.1.1:
+  version "5.1.1"
+  resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-5.1.1.tgz#1da27e6710271947695daf6848e847f01d84b920"
+  integrity sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==
+  dependencies:
+    yallist "^3.0.2"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+node-releases@^2.0.19:
+  version "2.0.19"
+  resolved "https://registry.yarnpkg.com/node-releases/-/node-releases-2.0.19.tgz#9e445a52950951ec4d177d843af370b411caf314"
+  integrity sha512-xxOWJsBKtzAq7DY0J+DTzuz58K8e7sJbdgwkbMWQe8UYB6ekmsQ45q0M/tJDsGaZmbC+l7n57UV8Hl5tHxO9uw==
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+parse-json@^5.2.0:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-5.2.0.tgz#c76fc66dee54231c962b22bcc8a72cf2f99753cd"
+  integrity sha512-ayCKvm/phCGxOkYRSCM82iDwct8/EonSEgCSxWxD7ve6jHggsFl4fZVQBPRNgQoKiuV/odhFrGzQXZwbifC8Rg==
+  dependencies:
+    "@babel/code-frame" "^7.0.0"
+    error-ex "^1.3.1"
+    json-parse-even-better-errors "^2.3.0"
+    lines-and-columns "^1.1.6"
+
+picocolors@^1.0.0, picocolors@^1.1.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
+  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
+
+prettier@^3.3.3:
+  version "3.4.2"
+  resolved "https://registry.yarnpkg.com/prettier/-/prettier-3.4.2.tgz#a5ce1fb522a588bf2b78ca44c6e6fe5aa5a2b13f"
+  integrity sha512-e9MewbtFo+Fevyuxn/4rrcDAaq0IYxPGLvObpQjiZBMAzB9IGmzlnG9RZy3FFas+eBMu2vA0CszMeduow5dIuQ==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+semver@^6.3.1:
+  version "6.3.1"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.1.tgz#556d2ef8689146e46dcea4bfdd095f3434dffcb4"
+  integrity sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==
+
+update-browserslist-db@^1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/update-browserslist-db/-/update-browserslist-db-1.1.1.tgz#80846fba1d79e82547fb661f8d141e0945755fe5"
+  integrity sha512-R8UzCaa9Az+38REPiJ1tXlImTJXlVfgHZsglwBD/k6nj76ctsH1E3q4doGrukiLQd3sGQYu56r5+lo5r94l29A==
+  dependencies:
+    escalade "^3.2.0"
+    picocolors "^1.1.0"
+
 vscode-jsonrpc@8.2.0:
   version "8.2.0"
   resolved "https://registry.yarnpkg.com/vscode-jsonrpc/-/vscode-jsonrpc-8.2.0.tgz#f43dfa35fb51e763d17cd94dcca0c9458f35abf9"
@@ -31,3 +403,8 @@ vscode-languageserver@^9.0.1:
   integrity sha512-woByF3PDpkHFUreUa7Hos7+pUWdeWMXRd26+ZX2A8cFx6v/JPTtd4/uN0/jB6XQHYaOlHbio03NTHCqrgG5n7g==
   dependencies:
     vscode-languageserver-protocol "3.17.5"
+
+yallist@^3.0.2:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/yallist/-/yallist-3.1.1.tgz#dbb7daf9bfd8bac9ab45ebf602b8cbad0d5d08fd"
+  integrity sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==
diff --git a/compiler/yarn.lock b/compiler/yarn.lock
index fe1d22eac864c..9c25b35b34b81 100644
--- a/compiler/yarn.lock
+++ b/compiler/yarn.lock
@@ -1714,171 +1714,86 @@
     enabled "2.0.x"
     kuler "^2.0.0"
 
-"@esbuild/aix-ppc64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.24.0.tgz#b57697945b50e99007b4c2521507dc613d4a648c"
-  integrity sha512-WtKdFM7ls47zkKHFVzMz8opM7LkcsIp9amDUBIAWirg70RM71WRSjdILPsY5Uv1D42ZpUfaPILDlfactHgsRkw==
-
 "@esbuild/aix-ppc64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.25.0.tgz#499600c5e1757a524990d5d92601f0ac3ce87f64"
   integrity sha512-O7vun9Sf8DFjH2UtqK8Ku3LkquL9SZL8OLY1T5NZkA34+wG3OQF7cl4Ql8vdNzM6fzBbYfLaiRLIOZ+2FOCgBQ==
 
-"@esbuild/android-arm64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.24.0.tgz#1add7e0af67acefd556e407f8497e81fddad79c0"
-  integrity sha512-Vsm497xFM7tTIPYK9bNTYJyF/lsP590Qc1WxJdlB6ljCbdZKU9SY8i7+Iin4kyhV/KV5J2rOKsBQbB77Ab7L/w==
-
 "@esbuild/android-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.25.0.tgz#b9b8231561a1dfb94eb31f4ee056b92a985c324f"
   integrity sha512-grvv8WncGjDSyUBjN9yHXNt+cq0snxXbDxy5pJtzMKGmmpPxeAmAhWxXI+01lU5rwZomDgD3kJwulEnhTRUd6g==
 
-"@esbuild/android-arm@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.24.0.tgz#ab7263045fa8e090833a8e3c393b60d59a789810"
-  integrity sha512-arAtTPo76fJ/ICkXWetLCc9EwEHKaeya4vMrReVlEIUCAUncH7M4bhMQ+M9Vf+FFOZJdTNMXNBrWwW+OXWpSew==
-
 "@esbuild/android-arm@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.25.0.tgz#ca6e7888942505f13e88ac9f5f7d2a72f9facd2b"
   integrity sha512-PTyWCYYiU0+1eJKmw21lWtC+d08JDZPQ5g+kFyxP0V+es6VPPSUhM6zk8iImp2jbV6GwjX4pap0JFbUQN65X1g==
 
-"@esbuild/android-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.24.0.tgz#e8f8b196cfdfdd5aeaebbdb0110983460440e705"
-  integrity sha512-t8GrvnFkiIY7pa7mMgJd7p8p8qqYIz1NYiAoKc75Zyv73L3DZW++oYMSHPRarcotTKuSs6m3hTOa5CKHaS02TQ==
-
 "@esbuild/android-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.25.0.tgz#e765ea753bac442dfc9cb53652ce8bd39d33e163"
   integrity sha512-m/ix7SfKG5buCnxasr52+LI78SQ+wgdENi9CqyCXwjVR2X4Jkz+BpC3le3AoBPYTC9NHklwngVXvbJ9/Akhrfg==
 
-"@esbuild/darwin-arm64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.24.0.tgz#2d0d9414f2acbffd2d86e98253914fca603a53dd"
-  integrity sha512-CKyDpRbK1hXwv79soeTJNHb5EiG6ct3efd/FTPdzOWdbZZfGhpbcqIpiD0+vwmpu0wTIL97ZRPZu8vUt46nBSw==
-
 "@esbuild/darwin-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.25.0.tgz#fa394164b0d89d4fdc3a8a21989af70ef579fa2c"
   integrity sha512-mVwdUb5SRkPayVadIOI78K7aAnPamoeFR2bT5nszFUZ9P8UpK4ratOdYbZZXYSqPKMHfS1wdHCJk1P1EZpRdvw==
 
-"@esbuild/darwin-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.24.0.tgz#33087aab31a1eb64c89daf3d2cf8ce1775656107"
-  integrity sha512-rgtz6flkVkh58od4PwTRqxbKH9cOjaXCMZgWD905JOzjFKW+7EiUObfd/Kav+A6Gyud6WZk9w+xu6QLytdi2OA==
-
 "@esbuild/darwin-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.25.0.tgz#91979d98d30ba6e7d69b22c617cc82bdad60e47a"
   integrity sha512-DgDaYsPWFTS4S3nWpFcMn/33ZZwAAeAFKNHNa1QN0rI4pUjgqf0f7ONmXf6d22tqTY+H9FNdgeaAa+YIFUn2Rg==
 
-"@esbuild/freebsd-arm64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.24.0.tgz#bb76e5ea9e97fa3c753472f19421075d3a33e8a7"
-  integrity sha512-6Mtdq5nHggwfDNLAHkPlyLBpE5L6hwsuXZX8XNmHno9JuL2+bg2BX5tRkwjyfn6sKbxZTq68suOjgWqCicvPXA==
-
 "@esbuild/freebsd-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.25.0.tgz#b97e97073310736b430a07b099d837084b85e9ce"
   integrity sha512-VN4ocxy6dxefN1MepBx/iD1dH5K8qNtNe227I0mnTRjry8tj5MRk4zprLEdG8WPyAPb93/e4pSgi1SoHdgOa4w==
 
-"@esbuild/freebsd-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.24.0.tgz#e0e2ce9249fdf6ee29e5dc3d420c7007fa579b93"
-  integrity sha512-D3H+xh3/zphoX8ck4S2RxKR6gHlHDXXzOf6f/9dbFt/NRBDIE33+cVa49Kil4WUjxMGW0ZIYBYtaGCa2+OsQwQ==
-
 "@esbuild/freebsd-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.25.0.tgz#f3b694d0da61d9910ec7deff794d444cfbf3b6e7"
   integrity sha512-mrSgt7lCh07FY+hDD1TxiTyIHyttn6vnjesnPoVDNmDfOmggTLXRv8Id5fNZey1gl/V2dyVK1VXXqVsQIiAk+A==
 
-"@esbuild/linux-arm64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.24.0.tgz#d1b2aa58085f73ecf45533c07c82d81235388e75"
-  integrity sha512-TDijPXTOeE3eaMkRYpcy3LarIg13dS9wWHRdwYRnzlwlA370rNdZqbcp0WTyyV/k2zSxfko52+C7jU5F9Tfj1g==
-
 "@esbuild/linux-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.25.0.tgz#f921f699f162f332036d5657cad9036f7a993f73"
   integrity sha512-9QAQjTWNDM/Vk2bgBl17yWuZxZNQIF0OUUuPZRKoDtqF2k4EtYbpyiG5/Dk7nqeK6kIJWPYldkOcBqjXjrUlmg==
 
-"@esbuild/linux-arm@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.24.0.tgz#8e4915df8ea3e12b690a057e77a47b1d5935ef6d"
-  integrity sha512-gJKIi2IjRo5G6Glxb8d3DzYXlxdEj2NlkixPsqePSZMhLudqPhtZ4BUrpIuTjJYXxvF9njql+vRjB2oaC9XpBw==
-
 "@esbuild/linux-arm@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.25.0.tgz#cc49305b3c6da317c900688995a4050e6cc91ca3"
   integrity sha512-vkB3IYj2IDo3g9xX7HqhPYxVkNQe8qTK55fraQyTzTX/fxaDtXiEnavv9geOsonh2Fd2RMB+i5cbhu2zMNWJwg==
 
-"@esbuild/linux-ia32@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.24.0.tgz#8200b1110666c39ab316572324b7af63d82013fb"
-  integrity sha512-K40ip1LAcA0byL05TbCQ4yJ4swvnbzHscRmUilrmP9Am7//0UjPreh4lpYzvThT2Quw66MhjG//20mrufm40mA==
-
 "@esbuild/linux-ia32@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.25.0.tgz#3e0736fcfab16cff042dec806247e2c76e109e19"
   integrity sha512-43ET5bHbphBegyeqLb7I1eYn2P/JYGNmzzdidq/w0T8E2SsYL1U6un2NFROFRg1JZLTzdCoRomg8Rvf9M6W6Gg==
 
-"@esbuild/linux-loong64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.24.0.tgz#6ff0c99cf647504df321d0640f0d32e557da745c"
-  integrity sha512-0mswrYP/9ai+CU0BzBfPMZ8RVm3RGAN/lmOMgW4aFUSOQBjA31UP8Mr6DDhWSuMwj7jaWOT0p0WoZ6jeHhrD7g==
-
 "@esbuild/linux-loong64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.25.0.tgz#ea2bf730883cddb9dfb85124232b5a875b8020c7"
   integrity sha512-fC95c/xyNFueMhClxJmeRIj2yrSMdDfmqJnyOY4ZqsALkDrrKJfIg5NTMSzVBr5YW1jf+l7/cndBfP3MSDpoHw==
 
-"@esbuild/linux-mips64el@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.24.0.tgz#3f720ccd4d59bfeb4c2ce276a46b77ad380fa1f3"
-  integrity sha512-hIKvXm0/3w/5+RDtCJeXqMZGkI2s4oMUGj3/jM0QzhgIASWrGO5/RlzAzm5nNh/awHE0A19h/CvHQe6FaBNrRA==
-
 "@esbuild/linux-mips64el@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.25.0.tgz#4cababb14eede09248980a2d2d8b966464294ff1"
   integrity sha512-nkAMFju7KDW73T1DdH7glcyIptm95a7Le8irTQNO/qtkoyypZAnjchQgooFUDQhNAy4iu08N79W4T4pMBwhPwQ==
 
-"@esbuild/linux-ppc64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.24.0.tgz#9d6b188b15c25afd2e213474bf5f31e42e3aa09e"
-  integrity sha512-HcZh5BNq0aC52UoocJxaKORfFODWXZxtBaaZNuN3PUX3MoDsChsZqopzi5UupRhPHSEHotoiptqikjN/B77mYQ==
-
 "@esbuild/linux-ppc64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.25.0.tgz#8860a4609914c065373a77242e985179658e1951"
   integrity sha512-NhyOejdhRGS8Iwv+KKR2zTq2PpysF9XqY+Zk77vQHqNbo/PwZCzB5/h7VGuREZm1fixhs4Q/qWRSi5zmAiO4Fw==
 
-"@esbuild/linux-riscv64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.24.0.tgz#f989fdc9752dfda286c9cd87c46248e4dfecbc25"
-  integrity sha512-bEh7dMn/h3QxeR2KTy1DUszQjUrIHPZKyO6aN1X4BCnhfYhuQqedHaa5MxSQA/06j3GpiIlFGSsy1c7Gf9padw==
-
 "@esbuild/linux-riscv64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.25.0.tgz#baf26e20bb2d38cfb86ee282dff840c04f4ed987"
   integrity sha512-5S/rbP5OY+GHLC5qXp1y/Mx//e92L1YDqkiBbO9TQOvuFXM+iDqUNG5XopAnXoRH3FjIUDkeGcY1cgNvnXp/kA==
 
-"@esbuild/linux-s390x@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.24.0.tgz#29ebf87e4132ea659c1489fce63cd8509d1c7319"
-  integrity sha512-ZcQ6+qRkw1UcZGPyrCiHHkmBaj9SiCD8Oqd556HldP+QlpUIe2Wgn3ehQGVoPOvZvtHm8HPx+bH20c9pvbkX3g==
-
 "@esbuild/linux-s390x@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.25.0.tgz#8323afc0d6cb1b6dc6e9fd21efd9e1542c3640a4"
   integrity sha512-XM2BFsEBz0Fw37V0zU4CXfcfuACMrppsMFKdYY2WuTS3yi8O1nFOhil/xhKTmE1nPmVyvQJjJivgDT+xh8pXJA==
 
-"@esbuild/linux-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.24.0.tgz#4af48c5c0479569b1f359ffbce22d15f261c0cef"
-  integrity sha512-vbutsFqQ+foy3wSSbmjBXXIJ6PL3scghJoM8zCL142cGaZKAdCZHyf+Bpu/MmX9zT9Q0zFBVKb36Ma5Fzfa8xA==
-
 "@esbuild/linux-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.25.0.tgz#08fcf60cb400ed2382e9f8e0f5590bac8810469a"
@@ -1889,71 +1804,36 @@
   resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.25.0.tgz#935c6c74e20f7224918fbe2e6c6fe865b6c6ea5b"
   integrity sha512-RuG4PSMPFfrkH6UwCAqBzauBWTygTvb1nxWasEJooGSJ/NwRw7b2HOwyRTQIU97Hq37l3npXoZGYMy3b3xYvPw==
 
-"@esbuild/netbsd-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.24.0.tgz#1ae73d23cc044a0ebd4f198334416fb26c31366c"
-  integrity sha512-hjQ0R/ulkO8fCYFsG0FZoH+pWgTTDreqpqY7UnQntnaKv95uP5iW3+dChxnx7C3trQQU40S+OgWhUVwCjVFLvg==
-
 "@esbuild/netbsd-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.25.0.tgz#414677cef66d16c5a4d210751eb2881bb9c1b62b"
   integrity sha512-jl+qisSB5jk01N5f7sPCsBENCOlPiS/xptD5yxOx2oqQfyourJwIKLRA2yqWdifj3owQZCL2sn6o08dBzZGQzA==
 
-"@esbuild/openbsd-arm64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.24.0.tgz#5d904a4f5158c89859fd902c427f96d6a9e632e2"
-  integrity sha512-MD9uzzkPQbYehwcN583yx3Tu5M8EIoTD+tUgKF982WYL9Pf5rKy9ltgD0eUgs8pvKnmizxjXZyLt0z6DC3rRXg==
-
 "@esbuild/openbsd-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.25.0.tgz#8fd55a4d08d25cdc572844f13c88d678c84d13f7"
   integrity sha512-21sUNbq2r84YE+SJDfaQRvdgznTD8Xc0oc3p3iW/a1EVWeNj/SdUCbm5U0itZPQYRuRTW20fPMWMpcrciH2EJw==
 
-"@esbuild/openbsd-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.24.0.tgz#4c8aa88c49187c601bae2971e71c6dc5e0ad1cdf"
-  integrity sha512-4ir0aY1NGUhIC1hdoCzr1+5b43mw99uNwVzhIq1OY3QcEwPDO3B7WNXBzaKY5Nsf1+N11i1eOfFcq+D/gOS15Q==
-
 "@esbuild/openbsd-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.25.0.tgz#0c48ddb1494bbc2d6bcbaa1429a7f465fa1dedde"
   integrity sha512-2gwwriSMPcCFRlPlKx3zLQhfN/2WjJ2NSlg5TKLQOJdV0mSxIcYNTMhk3H3ulL/cak+Xj0lY1Ym9ysDV1igceg==
 
-"@esbuild/sunos-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.24.0.tgz#8ddc35a0ea38575fa44eda30a5ee01ae2fa54dd4"
-  integrity sha512-jVzdzsbM5xrotH+W5f1s+JtUy1UWgjU0Cf4wMvffTB8m6wP5/kx0KiaLHlbJO+dMgtxKV8RQ/JvtlFcdZ1zCPA==
-
 "@esbuild/sunos-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.25.0.tgz#86ff9075d77962b60dd26203d7352f92684c8c92"
   integrity sha512-bxI7ThgLzPrPz484/S9jLlvUAHYMzy6I0XiU1ZMeAEOBcS0VePBFxh1JjTQt3Xiat5b6Oh4x7UC7IwKQKIJRIg==
 
-"@esbuild/win32-arm64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.24.0.tgz#6e79c8543f282c4539db684a207ae0e174a9007b"
-  integrity sha512-iKc8GAslzRpBytO2/aN3d2yb2z8XTVfNV0PjGlCxKo5SgWmNXx82I/Q3aG1tFfS+A2igVCY97TJ8tnYwpUWLCA==
-
 "@esbuild/win32-arm64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.25.0.tgz#849c62327c3229467f5b5cd681bf50588442e96c"
   integrity sha512-ZUAc2YK6JW89xTbXvftxdnYy3m4iHIkDtK3CLce8wg8M2L+YZhIvO1DKpxrd0Yr59AeNNkTiic9YLf6FTtXWMw==
 
-"@esbuild/win32-ia32@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.24.0.tgz#057af345da256b7192d18b676a02e95d0fa39103"
-  integrity sha512-vQW36KZolfIudCcTnaTpmLQ24Ha1RjygBo39/aLkM2kmjkWmZGEJ5Gn9l5/7tzXA42QGIoWbICfg6KLLkIw6yw==
-
 "@esbuild/win32-ia32@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.25.0.tgz#f62eb480cd7cca088cb65bb46a6db25b725dc079"
   integrity sha512-eSNxISBu8XweVEWG31/JzjkIGbGIJN/TrRoiSVZwZ6pkC6VX4Im/WV2cz559/TXLcYbcrDN8JtKgd9DJVIo8GA==
 
-"@esbuild/win32-x64@0.24.0":
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.24.0.tgz#168ab1c7e1c318b922637fad8f339d48b01e1244"
-  integrity sha512-7IAFPrjSQIJrGsK6flwg7NFmwBoSTyF3rl7If0hNUFQU4ilTsEPL6GuMuU9BfIWVVGuRnuIidkSMC+c0Otu8IA==
-
 "@esbuild/win32-x64@0.25.0":
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.25.0.tgz#c8e119a30a7c8d60b9d2e22d2073722dde3b710b"
@@ -2145,7 +2025,7 @@
     js-yaml "^3.13.1"
     resolve-from "^5.0.0"
 
-"@istanbuljs/schema@^0.1.2":
+"@istanbuljs/schema@^0.1.2", "@istanbuljs/schema@^0.1.3":
   version "0.1.3"
   resolved "https://registry.yarnpkg.com/@istanbuljs/schema/-/schema-0.1.3.tgz#e45e384e4b8ec16bce2fd903af78450f6bf7ec98"
   integrity sha512-ZXRY4jNvVgSVQ8DL3LTcakaAtXwTVUxE81hslsyD2AtoXW/wVob10HkOJ1X/pAlcI7D+2YoZKg5do8G/w6RYgA==
@@ -3102,6 +2982,11 @@
   resolved "https://registry.yarnpkg.com/@types/minimatch/-/minimatch-5.1.2.tgz#07508b45797cb81ec3f273011b054cd0755eddca"
   integrity sha512-K0VQKziLUWkVKiRVrx4a40iPaxTUefQmjtkQofBkYRcoaaL/8rhwDWww9qWbrgicNOgnpIsMxyNIUM4+n6dUIA==
 
+"@types/mocha@^10.0.10", "@types/mocha@^10.0.2":
+  version "10.0.10"
+  resolved "https://registry.yarnpkg.com/@types/mocha/-/mocha-10.0.10.tgz#91f62905e8d23cbd66225312f239454a23bebfa0"
+  integrity sha512-xPyYSz1cMPnJQhl0CLMH68j3gprKZaTjG3s5Vi+fDgx+uhG9NOXwbVt52eFS8ECyXhyKcjDLCBEqBExKuiZb7Q==
+
 "@types/node@*", "@types/node@^18.7.18":
   version "18.7.19"
   resolved "https://registry.yarnpkg.com/@types/node/-/node-18.7.19.tgz#ad83aa9b7af470fab7e0f562be87e97dc8ffe08e"
@@ -3170,6 +3055,11 @@
   resolved "https://registry.yarnpkg.com/@types/triple-beam/-/triple-beam-1.3.5.tgz#74fef9ffbaa198eb8b588be029f38b00299caa2c"
   integrity sha512-6WaYesThRMCl19iryMYP7/x2OVgCtbIVflDGFpWnb9irXI3UjYE4AzmYuiUKY1AJstGijoY+MgUszMgRxIYTYw==
 
+"@types/vscode@^1.96.0":
+  version "1.96.0"
+  resolved "https://registry.yarnpkg.com/@types/vscode/-/vscode-1.96.0.tgz#3181004bf25d71677ae4aacdd7605a3fd7edf08e"
+  integrity sha512-qvZbSZo+K4ZYmmDuaodMbAa67Pl6VDQzLKFka6rq+3WUTY4Kro7Bwoi0CuZLO/wema0ygcmpwow7zZfPJTs5jg==
+
 "@types/yargs-parser@*":
   version "21.0.0"
   resolved "https://registry.yarnpkg.com/@types/yargs-parser/-/yargs-parser-21.0.0.tgz#0c60e537fa790f5f9472ed2776c2b71ec117351b"
@@ -3442,6 +3332,32 @@
   resolved "https://registry.yarnpkg.com/@ungap/structured-clone/-/structured-clone-1.2.0.tgz#756641adb587851b5ccb3e095daf27ae581c8406"
   integrity sha512-zuVdFrMJiuCDQUMCzQaD6KL28MjnqqN8XnAqiEq9PNm/hCPTSGfrXCOfwj1ow4LFb/tNymJPwsNbVePc1xFqrQ==
 
+"@vscode/test-cli@^0.0.10":
+  version "0.0.10"
+  resolved "https://registry.yarnpkg.com/@vscode/test-cli/-/test-cli-0.0.10.tgz#35f0e81c2e0ff8daceb223e99d1b65306c15822c"
+  integrity sha512-B0mMH4ia+MOOtwNiLi79XhA+MLmUItIC8FckEuKrVAVriIuSWjt7vv4+bF8qVFiNFe4QRfzPaIZk39FZGWEwHA==
+  dependencies:
+    "@types/mocha" "^10.0.2"
+    c8 "^9.1.0"
+    chokidar "^3.5.3"
+    enhanced-resolve "^5.15.0"
+    glob "^10.3.10"
+    minimatch "^9.0.3"
+    mocha "^10.2.0"
+    supports-color "^9.4.0"
+    yargs "^17.7.2"
+
+"@vscode/test-electron@^2.4.1":
+  version "2.4.1"
+  resolved "https://registry.yarnpkg.com/@vscode/test-electron/-/test-electron-2.4.1.tgz#5c2760640bf692efbdaa18bafcd35fb519688941"
+  integrity sha512-Gc6EdaLANdktQ1t+zozoBVRynfIsMKMc94Svu1QreOBC8y76x4tvaK32TljrLi1LI2+PK58sDVbL7ALdqf3VRQ==
+  dependencies:
+    http-proxy-agent "^7.0.2"
+    https-proxy-agent "^7.0.5"
+    jszip "^3.10.1"
+    ora "^7.0.1"
+    semver "^7.6.2"
+
 abab@^2.0.6:
   version "2.0.6"
   resolved "https://registry.yarnpkg.com/abab/-/abab-2.0.6.tgz#41b80f2c871d19686216b82309231cfd3cb3d291"
@@ -3497,6 +3413,11 @@ agent-base@6:
   dependencies:
     debug "4"
 
+agent-base@^7.1.0, agent-base@^7.1.2:
+  version "7.1.3"
+  resolved "https://registry.yarnpkg.com/agent-base/-/agent-base-7.1.3.tgz#29435eb821bc4194633a5b89e5bc4703bafc25a1"
+  integrity sha512-jRR5wdylq8CkOe6hei19GGZnxM6rBGwFl3Bg0YItGDimvjGtAvdZk4Pu6Cl4u4Igsws4a1fd1Vq3ezrhn4KmFw==
+
 ajv@^6.12.4:
   version "6.12.6"
   resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
@@ -3507,6 +3428,11 @@ ajv@^6.12.4:
     json-schema-traverse "^0.4.1"
     uri-js "^4.2.2"
 
+ansi-colors@^4.1.3:
+  version "4.1.3"
+  resolved "https://registry.yarnpkg.com/ansi-colors/-/ansi-colors-4.1.3.tgz#37611340eb2243e70cc604cad35d63270d48781b"
+  integrity sha512-/6w/C21Pm1A7aZitlI5Ni/2J6FFQN8i1Cvz3kHABAAbw93v/NlvKdVOqz7CCWz/3iv/JplRSEEZ83XION15ovw==
+
 ansi-escapes@^4.2.1:
   version "4.3.2"
   resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-4.3.2.tgz#6b2291d1db7d98b6521d5f1efa42d0f3a9feb65e"
@@ -3561,6 +3487,14 @@ anymatch@^3.0.3:
     normalize-path "^3.0.0"
     picomatch "^2.0.4"
 
+anymatch@~3.1.2:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-3.1.3.tgz#790c58b19ba1720a84205b57c618d5ad8524973e"
+  integrity sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==
+  dependencies:
+    normalize-path "^3.0.0"
+    picomatch "^2.0.4"
+
 arg@^4.1.0:
   version "4.1.3"
   resolved "https://registry.yarnpkg.com/arg/-/arg-4.1.3.tgz#269fc7ad5b8e42cb63c896d5666017261c144089"
@@ -3820,6 +3754,11 @@ base64-js@^1.3.1:
   resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.5.1.tgz#1b1b440160a5bf7ad40b650f095963481903930a"
   integrity sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==
 
+binary-extensions@^2.0.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-2.3.0.tgz#f6e14a97858d327252200242d4ccfe522c445522"
+  integrity sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==
+
 bl@^4.1.0:
   version "4.1.0"
   resolved "https://registry.yarnpkg.com/bl/-/bl-4.1.0.tgz#451535264182bec2fbbc83a62ab98cf11d9f7b3a"
@@ -3829,6 +3768,15 @@ bl@^4.1.0:
     inherits "^2.0.4"
     readable-stream "^3.4.0"
 
+bl@^5.0.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/bl/-/bl-5.1.0.tgz#183715f678c7188ecef9fe475d90209400624273"
+  integrity sha512-tv1ZJHLfTDnXE6tMHv73YgSJaWR2AFuPwMntBe7XL/GBFHnT0CLnsHMogfk5+GzCDC5ZWarSCYaIGATZt9dNsQ==
+  dependencies:
+    buffer "^6.0.3"
+    inherits "^2.0.4"
+    readable-stream "^3.4.0"
+
 brace-expansion@^1.1.7:
   version "1.1.11"
   resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
@@ -3844,7 +3792,7 @@ brace-expansion@^2.0.1:
   dependencies:
     balanced-match "^1.0.0"
 
-braces@^3.0.3:
+braces@^3.0.3, braces@~3.0.2:
   version "3.0.3"
   resolved "https://registry.yarnpkg.com/braces/-/braces-3.0.3.tgz#490332f40919452272d55a8480adc0c441358789"
   integrity sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==
@@ -3856,6 +3804,11 @@ browser-process-hrtime@^1.0.0:
   resolved "https://registry.yarnpkg.com/browser-process-hrtime/-/browser-process-hrtime-1.0.0.tgz#3c9b4b7d782c8121e56f10106d84c0d0ffc94626"
   integrity sha512-9o5UecI3GhkpM6DrXr69PblIuWxPKk9Y0jHBRhdocZ2y7YECBFCsHm79Pr3OyR2AvjhDkabFJaDJMYRazHgsow==
 
+browser-stdout@^1.3.1:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/browser-stdout/-/browser-stdout-1.3.1.tgz#baa559ee14ced73452229bad7326467c61fabd60"
+  integrity sha512-qhAVI1+Av2X7qelOfAIYwXONood6XlZE/fXaBSmW/T5SzLAmCgzi+eiWE7fUvbHaeNBQH13UftjpXxsfLkMpgw==
+
 browserslist@^4.21.3, browserslist@^4.21.5:
   version "4.21.7"
   resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-4.21.7.tgz#e2b420947e5fb0a58e8f4668ae6e23488127e551"
@@ -3903,6 +3856,31 @@ buffer@^5.5.0:
     base64-js "^1.3.1"
     ieee754 "^1.1.13"
 
+buffer@^6.0.3:
+  version "6.0.3"
+  resolved "https://registry.yarnpkg.com/buffer/-/buffer-6.0.3.tgz#2ace578459cc8fbe2a70aaa8f52ee63b6a74c6c6"
+  integrity sha512-FTiCpNxtwiZZHEZbcbTIcZjERVICn9yq/pDFkTl95/AxzD1naBctN7YO68riM/gLSDY7sdrMby8hofADYuuqOA==
+  dependencies:
+    base64-js "^1.3.1"
+    ieee754 "^1.2.1"
+
+c8@^9.1.0:
+  version "9.1.0"
+  resolved "https://registry.yarnpkg.com/c8/-/c8-9.1.0.tgz#0e57ba3ab9e5960ab1d650b4a86f71e53cb68112"
+  integrity sha512-mBWcT5iqNir1zIkzSPyI3NCR9EZCVI3WUD+AVO17MVWTSFNyUueXE82qTeampNtTr+ilN/5Ua3j24LgbCKjDVg==
+  dependencies:
+    "@bcoe/v8-coverage" "^0.2.3"
+    "@istanbuljs/schema" "^0.1.3"
+    find-up "^5.0.0"
+    foreground-child "^3.1.1"
+    istanbul-lib-coverage "^3.2.0"
+    istanbul-lib-report "^3.0.1"
+    istanbul-reports "^3.1.6"
+    test-exclude "^6.0.0"
+    v8-to-istanbul "^9.0.0"
+    yargs "^17.7.2"
+    yargs-parser "^21.1.1"
+
 call-bind@^1.0.2:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/call-bind/-/call-bind-1.0.2.tgz#b1d4e89e688119c3c9a903ad30abb2f6a919be3c"
@@ -3926,7 +3904,7 @@ camelcase@^5.0.0, camelcase@^5.3.1:
   resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-5.3.1.tgz#e3c9b31569e106811df242f715725a1f4c494320"
   integrity sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==
 
-camelcase@^6.2.0:
+camelcase@^6.0.0, camelcase@^6.2.0:
   version "6.3.0"
   resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-6.3.0.tgz#5685b95eb209ac9c0c177467778c9c84df58ba9a"
   integrity sha512-Gmy6FhYlCY7uOElZUSbxo2UCDH8owEk996gkbrpsgGtrJLM3J7jGxl9Ic7Qwwj4ivOE5AWZWRMecDdF7hqGjFA==
@@ -3958,11 +3936,31 @@ chalk@4, chalk@^4.0.0, chalk@^4.1.0:
     ansi-styles "^4.1.0"
     supports-color "^7.1.0"
 
+chalk@^5.0.0, chalk@^5.3.0:
+  version "5.4.1"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-5.4.1.tgz#1b48bf0963ec158dce2aacf69c093ae2dd2092d8"
+  integrity sha512-zgVZuo2WcZgfUEmsn6eO3kINexW8RAE4maiQ8QNs8CtpPCSyMiYsULR3HQYkm3w8FIA3SberyMJMSldGsW+U3w==
+
 char-regex@^1.0.2:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/char-regex/-/char-regex-1.0.2.tgz#d744358226217f981ed58f479b1d6bcc29545dcf"
   integrity sha512-kWWXztvZ5SBQV+eRgKFeh8q5sLuZY2+8WUIzlxWVTg+oGwY14qylx1KbKzHd8P6ZYkAg0xyIDU9JMHhyJMZ1jw==
 
+chokidar@^3.5.3:
+  version "3.6.0"
+  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-3.6.0.tgz#197c6cc669ef2a8dc5e7b4d97ee4e092c3eb0d5b"
+  integrity sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==
+  dependencies:
+    anymatch "~3.1.2"
+    braces "~3.0.2"
+    glob-parent "~5.1.2"
+    is-binary-path "~2.1.0"
+    is-glob "~4.0.1"
+    normalize-path "~3.0.0"
+    readdirp "~3.6.0"
+  optionalDependencies:
+    fsevents "~2.3.2"
+
 ci-info@^3.2.0:
   version "3.4.0"
   resolved "https://registry.yarnpkg.com/ci-info/-/ci-info-3.4.0.tgz#b28484fd436cbc267900364f096c9dc185efb251"
@@ -3987,7 +3985,14 @@ cli-cursor@^3.1.0:
   dependencies:
     restore-cursor "^3.1.0"
 
-cli-spinners@^2.5.0:
+cli-cursor@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-4.0.0.tgz#3cecfe3734bf4fe02a8361cbdc0f6fe28c6a57ea"
+  integrity sha512-VGtlMu3x/4DOtIUwEkRezxUZ2lBacNJCHash0N0WeZDBS+7Ux1dm3XWAgWYxLJFMMdOeXMHXorshEFhbMSGelg==
+  dependencies:
+    restore-cursor "^4.0.0"
+
+cli-spinners@^2.5.0, cli-spinners@^2.9.0:
   version "2.9.2"
   resolved "https://registry.yarnpkg.com/cli-spinners/-/cli-spinners-2.9.2.tgz#1773a8f4b9c4d6ac31563df53b3fc1d79462fe41"
   integrity sha512-ywqV+5MmyL4E7ybXgKys4DugZbX0FC6LnwrhjuykIjnK9k8OQacQ7axGKnjDXWNhns0xot3bZI5h55H8yo9cJg==
@@ -4147,6 +4152,11 @@ core-js-compat@^3.30.1, core-js-compat@^3.30.2:
   dependencies:
     browserslist "^4.21.5"
 
+core-util-is@~1.0.0:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.3.tgz#a6042d3634c2b27e9328f837b965fac83808db85"
+  integrity sha512-ZQBvi1DcpJ4GDqanjucZ2Hj3wEO5pZDS89BWbkcrvdxksJorwUDDZamX9ldFkp9aw2lmBDLgkObEA4DWNJ9FYQ==
+
 create-require@^1.1.0:
   version "1.1.1"
   resolved "https://registry.yarnpkg.com/create-require/-/create-require-1.1.1.tgz#c1d7e8f1e5f6cfc9ff65f9cd352d37348756c333"
@@ -4231,11 +4241,23 @@ debug@4, debug@^4.1.0, debug@^4.1.1, debug@^4.3.1, debug@^4.3.2, debug@^4.3.3, d
   dependencies:
     ms "2.1.2"
 
+debug@^4.3.5:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
 decamelize@^1.2.0:
   version "1.2.0"
   resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-1.2.0.tgz#f6534d15148269b20352e7bee26f501f9a191290"
   integrity sha512-z2S+W9X73hAUUki+N+9Za2lBlun89zigOyGrsax+KUQ6wKW4ZoWpEYBkGhQjwAjjDCkWxhY0VKEhk8wzY7F5cA==
 
+decamelize@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-4.0.0.tgz#aa472d7bf660eb15f3494efd531cab7f2a709837"
+  integrity sha512-9iE1PgSik9HeIIw2JO94IidnE3eBoQrFJ3w7sFuzSX4DpmZ3v5sZpUiV5Swcf6mQEF+Y0ru8Neo+p+nyh2J+hQ==
+
 decimal.js@^10.3.1:
   version "10.4.1"
   resolved "https://registry.yarnpkg.com/decimal.js/-/decimal.js-10.4.1.tgz#be75eeac4a2281aace80c1a8753587c27ef053e7"
@@ -4311,6 +4333,11 @@ diff@^4.0.1:
   resolved "https://registry.yarnpkg.com/diff/-/diff-4.0.2.tgz#60f3aecb89d5fae520c11aa19efc2bb982aade7d"
   integrity sha512-58lmxKSA4BNyLz+HHMUzlOEpg09FV+ev6ZMe3vJihgdxzgcwZ8VoEEPmALCZG9LmqfVoNMMKpttIYTVG6uDY7A==
 
+diff@^5.2.0:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/diff/-/diff-5.2.0.tgz#26ded047cd1179b78b9537d5ef725503ce1ae531"
+  integrity sha512-uIFDxqpRZGZ6ThOk84hEfqWoHx2devRFvpTZcTHur85vImfaxUbTW9Ryh4CpCuDnToOP1CEtXKIgytHBPVff5A==
+
 difflib@~0.2.1:
   version "0.2.4"
   resolved "https://registry.yarnpkg.com/difflib/-/difflib-0.2.4.tgz#b5e30361a6db023176d562892db85940a718f47e"
@@ -4376,6 +4403,11 @@ emittery@^0.13.1:
   resolved "https://registry.yarnpkg.com/emittery/-/emittery-0.13.1.tgz#c04b8c3457490e0847ae51fced3af52d338e3dad"
   integrity sha512-DeWwawk6r5yR9jFgnDKYt4sLS0LmHJJi3ZOnb5/JdbYwj3nW+FxQnHIjhBKz8YLC7oRNPVM9NQ47I3CVx34eqQ==
 
+emoji-regex@^10.2.1:
+  version "10.4.0"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-10.4.0.tgz#03553afea80b3975749cfcb36f776ca268e413d4"
+  integrity sha512-EC+0oUMY1Rqm4O6LLrgjtYDvcVYTy7chDnM4Q7030tP4Kwj3u/pR6gP9ygnp2CJMK5Gq+9Q2oqmrFJAz01DXjw==
+
 emoji-regex@^8.0.0:
   version "8.0.0"
   resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37"
@@ -4391,6 +4423,14 @@ enabled@2.0.x:
   resolved "https://registry.yarnpkg.com/enabled/-/enabled-2.0.0.tgz#f9dd92ec2d6f4bbc0d5d1e64e21d61cd4665e7c2"
   integrity sha512-AKrN98kuwOzMIdAizXGI86UFBoo26CL21UM763y1h/GMSJ4/OHU9k2YlsmBpyScFo/wbLzWQJBMCW4+IO3/+OQ==
 
+enhanced-resolve@^5.15.0:
+  version "5.18.0"
+  resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-5.18.0.tgz#91eb1db193896b9801251eeff1c6980278b1e404"
+  integrity sha512-0/r0MySGYG8YqlayBZ6MuCfECmHFdJ5qyPh8s8wa5Hnm6SaFLSK1VYCbj+NKp090Nm1caZhD+QTnmxO7esYGyQ==
+  dependencies:
+    graceful-fs "^4.2.4"
+    tapable "^2.2.0"
+
 entities@^4.4.0:
   version "4.4.0"
   resolved "https://registry.yarnpkg.com/entities/-/entities-4.4.0.tgz#97bdaba170339446495e653cfd2db78962900174"
@@ -4408,36 +4448,6 @@ es5-ext@0.8.x:
   resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.8.2.tgz#aba8d9e1943a895ac96837a62a39b3f55ecd94ab"
   integrity sha512-H19ompyhnKiBdjHR1DPHvf5RHgHPmJaY9JNzFGbMbPgdsUkvnUCN1Ke8J4Y0IMyTwFM2M9l4h2GoHwzwpSmXbA==
 
-esbuild@^0.24.0:
-  version "0.24.0"
-  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.24.0.tgz#f2d470596885fcb2e91c21eb3da3b3c89c0b55e7"
-  integrity sha512-FuLPevChGDshgSicjisSooU0cemp/sGXR841D5LHMB7mTVOmsEHcAxaH3irL53+8YDIeVNQEySh4DaYU/iuPqQ==
-  optionalDependencies:
-    "@esbuild/aix-ppc64" "0.24.0"
-    "@esbuild/android-arm" "0.24.0"
-    "@esbuild/android-arm64" "0.24.0"
-    "@esbuild/android-x64" "0.24.0"
-    "@esbuild/darwin-arm64" "0.24.0"
-    "@esbuild/darwin-x64" "0.24.0"
-    "@esbuild/freebsd-arm64" "0.24.0"
-    "@esbuild/freebsd-x64" "0.24.0"
-    "@esbuild/linux-arm" "0.24.0"
-    "@esbuild/linux-arm64" "0.24.0"
-    "@esbuild/linux-ia32" "0.24.0"
-    "@esbuild/linux-loong64" "0.24.0"
-    "@esbuild/linux-mips64el" "0.24.0"
-    "@esbuild/linux-ppc64" "0.24.0"
-    "@esbuild/linux-riscv64" "0.24.0"
-    "@esbuild/linux-s390x" "0.24.0"
-    "@esbuild/linux-x64" "0.24.0"
-    "@esbuild/netbsd-x64" "0.24.0"
-    "@esbuild/openbsd-arm64" "0.24.0"
-    "@esbuild/openbsd-x64" "0.24.0"
-    "@esbuild/sunos-x64" "0.24.0"
-    "@esbuild/win32-arm64" "0.24.0"
-    "@esbuild/win32-ia32" "0.24.0"
-    "@esbuild/win32-x64" "0.24.0"
-
 esbuild@^0.25.0:
   version "0.25.0"
   resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.25.0.tgz#0de1787a77206c5a79eeb634a623d39b5006ce92"
@@ -4952,6 +4962,11 @@ flat-cache@^4.0.0:
     flatted "^3.2.9"
     keyv "^4.5.4"
 
+flat@^5.0.2:
+  version "5.0.2"
+  resolved "https://registry.yarnpkg.com/flat/-/flat-5.0.2.tgz#8ca6fe332069ffa9d324c327198c598259ceb241"
+  integrity sha512-b6suED+5/3rTpUBdG1gupIl8MPFCAMA0QXwmljLhvCUKcUvdE4gWky9zpuGCcXHOsz4J9wPGNWq6OKpmIzz3hQ==
+
 flatted@^3.1.0:
   version "3.2.7"
   resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.2.7.tgz#609f39207cb614b89d0765b477cb2d437fbf9787"
@@ -4993,6 +5008,14 @@ foreground-child@^3.1.0:
     cross-spawn "^7.0.0"
     signal-exit "^4.0.1"
 
+foreground-child@^3.1.1:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/foreground-child/-/foreground-child-3.3.0.tgz#0ac8644c06e431439f8561db8ecf29a7b5519c77"
+  integrity sha512-Ld2g8rrAyMYFXBhEqMz8ZAHBi4J4uS1i/CxGMDnjyFWddMXLVcDp051DZfu+t7+ab7Wv6SMqpWmyFIj5UbfFvg==
+  dependencies:
+    cross-spawn "^7.0.0"
+    signal-exit "^4.0.1"
+
 form-data@^4.0.0:
   version "4.0.0"
   resolved "https://registry.yarnpkg.com/form-data/-/form-data-4.0.0.tgz#93919daeaf361ee529584b9b31664dc12c9fa452"
@@ -5021,6 +5044,11 @@ fsevents@^2.3.2:
   resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-2.3.2.tgz#8a526f78b8fdf4623b709e0b975c52c24c02fd1a"
   integrity sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==
 
+fsevents@~2.3.2:
+  version "2.3.3"
+  resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-2.3.3.tgz#cac6407785d03675a2a5e1a5305c697b347d90d6"
+  integrity sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==
+
 function-bind@^1.1.1:
   version "1.1.1"
   resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d"
@@ -5055,7 +5083,7 @@ get-stream@^6.0.0:
   resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-6.0.1.tgz#a262d8eef67aced57c2852ad6167526a43cbf7b7"
   integrity sha512-ts6Wi+2j3jQjqi70w5AlN8DFnkSwC+MqmxEzdEALB2qXZYV3X/b1CTfgPLGJNMeAWxdPfU8FO1ms3NUfaHCPYg==
 
-glob-parent@^5.1.2:
+glob-parent@^5.1.2, glob-parent@~5.1.2:
   version "5.1.2"
   resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4"
   integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==
@@ -5080,7 +5108,7 @@ glob@^10.3.10:
     minipass "^5.0.0 || ^6.0.2 || ^7.0.0"
     path-scurry "^1.10.1"
 
-glob@^10.3.7:
+glob@^10.3.7, glob@^10.4.5:
   version "10.4.5"
   resolved "https://registry.yarnpkg.com/glob/-/glob-10.4.5.tgz#f4d9f0b90ffdbab09c9d77f5f29b4262517b0956"
   integrity sha512-7Bv8RF0k6xjo7d4A/PxYLbUCfb6c+Vpd2/mB2yRDlew7Jb5hEXiCD9ibfO7wpk8i4sevK6DFny9h7EYbM3/sHg==
@@ -5104,6 +5132,17 @@ glob@^7.1.3, glob@^7.1.4, glob@^7.1.6:
     once "^1.3.0"
     path-is-absolute "^1.0.0"
 
+glob@^8.1.0:
+  version "8.1.0"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-8.1.0.tgz#d388f656593ef708ee3e34640fdfb99a9fd1c33e"
+  integrity sha512-r8hpEjiQEYlF2QU0df3dS+nxxSIreXQS1qRhMJM0Q5NDdR386C7jb7Hwwod8Fgiuex+k0GFjgft18yvxm5XoCQ==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^5.0.1"
+    once "^1.3.0"
+
 global-modules@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/global-modules/-/global-modules-1.0.0.tgz#6d770f0eb523ac78164d72b5e71a8877265cc3ea"
@@ -5153,7 +5192,7 @@ globby@^11.1.0:
     merge2 "^1.4.1"
     slash "^3.0.0"
 
-graceful-fs@^4.1.2, graceful-fs@^4.1.6:
+graceful-fs@^4.1.2, graceful-fs@^4.1.6, graceful-fs@^4.2.4:
   version "4.2.11"
   resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.2.11.tgz#4183e4e8bf08bb6e05bbb2f7d2e0c8f712ca40e3"
   integrity sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==
@@ -5197,6 +5236,11 @@ has@^1.0.3:
   dependencies:
     function-bind "^1.1.1"
 
+he@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/he/-/he-1.2.0.tgz#84ae65fa7eafb165fddb61566ae14baf05664f0f"
+  integrity sha512-F/1DnUGPopORZi0ni+CvrCgHQ5FyEAHRLSApuYWMmrbSwoN2Mn/7k+Gl38gJnR7yyDZk6WLXwiGod1JOWNDKGw==
+
 "heap@>= 0.2.0":
   version "0.2.7"
   resolved "https://registry.yarnpkg.com/heap/-/heap-0.2.7.tgz#1e6adf711d3f27ce35a81fe3b7bd576c2260a8fc"
@@ -5263,6 +5307,14 @@ http-proxy-agent@^5.0.0:
     agent-base "6"
     debug "4"
 
+http-proxy-agent@^7.0.2:
+  version "7.0.2"
+  resolved "https://registry.yarnpkg.com/http-proxy-agent/-/http-proxy-agent-7.0.2.tgz#9a8b1f246866c028509486585f62b8f2c18c270e"
+  integrity sha512-T1gkAiYYDWYx3V5Bmyu7HcfcvL7mUrTWiM6yOfa3PIphViJ/gFPbvidQ+veqSOHci/PxBcDabeUNCzpOODJZig==
+  dependencies:
+    agent-base "^7.1.0"
+    debug "^4.3.4"
+
 https-proxy-agent@^5.0.1:
   version "5.0.1"
   resolved "https://registry.yarnpkg.com/https-proxy-agent/-/https-proxy-agent-5.0.1.tgz#c59ef224a04fe8b754f3db0063a25ea30d0005d6"
@@ -5271,6 +5323,14 @@ https-proxy-agent@^5.0.1:
     agent-base "6"
     debug "4"
 
+https-proxy-agent@^7.0.5:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/https-proxy-agent/-/https-proxy-agent-7.0.6.tgz#da8dfeac7da130b05c2ba4b59c9b6cd66611a6b9"
+  integrity sha512-vK9P5/iUfdl95AI+JVyUuIcVtd4ofvtrOr3HNtM2yxC9bnMbEdp3x01OhQNnjb8IJYi38VlTE3mBXwcfvywuSw==
+  dependencies:
+    agent-base "^7.1.2"
+    debug "4"
+
 human-signals@^2.1.0:
   version "2.1.0"
   resolved "https://registry.yarnpkg.com/human-signals/-/human-signals-2.1.0.tgz#dc91fcba42e4d06e4abaed33b3e7a3c02f514ea0"
@@ -5283,7 +5343,7 @@ iconv-lite@0.6.3:
   dependencies:
     safer-buffer ">= 2.1.2 < 3.0.0"
 
-ieee754@^1.1.13:
+ieee754@^1.1.13, ieee754@^1.2.1:
   version "1.2.1"
   resolved "https://registry.yarnpkg.com/ieee754/-/ieee754-1.2.1.tgz#8eb7a10a63fff25d15a57b001586d177d1b0d352"
   integrity sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==
@@ -5303,6 +5363,11 @@ ignore@^5.3.1:
   resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.2.tgz#3cd40e729f3643fd87cb04e50bf0eb722bc596f5"
   integrity sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==
 
+immediate@~3.0.5:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/immediate/-/immediate-3.0.6.tgz#9db1dbd0faf8de6fbe0f5dd5e56bb606280de69b"
+  integrity sha512-XXOFtyqDjNDAQxVfYxuF7g9Il/IbWmmlQg2MYKOH8ExIT1qg6xc4zyS3HaEEATgs1btfzxq15ciUiY7gjSXRGQ==
+
 import-fresh@^3.2.1:
   version "3.3.0"
   resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.0.tgz#37162c25fcb9ebaa2e6e53d5b4d88ce17d9e0c2b"
@@ -5332,7 +5397,7 @@ inflight@^1.0.4:
     once "^1.3.0"
     wrappy "1"
 
-inherits@2, inherits@^2.0.3, inherits@^2.0.4:
+inherits@2, inherits@^2.0.3, inherits@^2.0.4, inherits@~2.0.3:
   version "2.0.4"
   resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c"
   integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==
@@ -5359,6 +5424,13 @@ is-arrayish@^0.3.1:
   resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.3.2.tgz#4574a2ae56f7ab206896fb431eaeed066fdf8f03"
   integrity sha512-eVRqCvVlZbuw3GrM63ovNSNAeA1K16kaR/LRY/92w0zxQ5/1YzwblUX652i4Xs9RwAGjW9d9y6X88t8OaAJfWQ==
 
+is-binary-path@~2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-2.1.0.tgz#ea1f7f3b80f064236e83470f86c09c254fb45b09"
+  integrity sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==
+  dependencies:
+    binary-extensions "^2.0.0"
+
 is-core-module@^2.11.0:
   version "2.12.1"
   resolved "https://registry.yarnpkg.com/is-core-module/-/is-core-module-2.12.1.tgz#0c0b6885b6f80011c71541ce15c8d66cf5a4f9fd"
@@ -5388,7 +5460,7 @@ is-generator-fn@^2.0.0:
   resolved "https://registry.yarnpkg.com/is-generator-fn/-/is-generator-fn-2.1.0.tgz#7d140adc389aaf3011a8f2a2a4cfa6faadffb118"
   integrity sha512-cTIB4yPYL/Grw0EaSzASzg6bBy9gqCofvWN8okThAYIxKJZC+udlRAmGbM0XLeniEJSs8uEgHPGuHSe1XsOLSQ==
 
-is-glob@^4.0.0, is-glob@^4.0.1, is-glob@^4.0.3:
+is-glob@^4.0.0, is-glob@^4.0.1, is-glob@^4.0.3, is-glob@~4.0.1:
   version "4.0.3"
   resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
   integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
@@ -5400,6 +5472,11 @@ is-interactive@^1.0.0:
   resolved "https://registry.yarnpkg.com/is-interactive/-/is-interactive-1.0.0.tgz#cea6e6ae5c870a7b0a0004070b7b587e0252912e"
   integrity sha512-2HvIEKRoqS62guEC+qBjpvRubdX910WCMuJTZ+I9yvqKU2/12eSL549HMwtabb4oupdj2sMP50k+XJfB/8JE6w==
 
+is-interactive@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-interactive/-/is-interactive-2.0.0.tgz#40c57614593826da1100ade6059778d597f16e90"
+  integrity sha512-qP1vozQRI+BMOPcjFzrjXuQvdak2pHNUMZoeG2eRbiSqyvbEf/wQtEOTOX1guk6E3t36RkaqiSt8A/6YElNxLQ==
+
 is-number@^7.0.0:
   version "7.0.0"
   resolved "https://registry.yarnpkg.com/is-number/-/is-number-7.0.0.tgz#7535345b896734d5f80c4d06c50955527a14f12b"
@@ -5410,6 +5487,11 @@ is-path-inside@^3.0.3:
   resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-3.0.3.tgz#d231362e53a07ff2b0e0ea7fed049161ffd16283"
   integrity sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==
 
+is-plain-obj@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-2.1.0.tgz#45e42e37fccf1f40da8e5f76ee21515840c09287"
+  integrity sha512-YWnfyRwxL/+SsrWYfOpUtz5b3YD+nyfkHvjbcanzk8zgyO4ASD67uVMRt8k5bM4lLMDnXfriRhOpemw+NfT1eA==
+
 is-plain-object@^2.0.4:
   version "2.0.4"
   resolved "https://registry.yarnpkg.com/is-plain-object/-/is-plain-object-2.0.4.tgz#2c163b3fafb1b606d9d17928f05c2a1c38e07677"
@@ -5432,11 +5514,21 @@ is-unicode-supported@^0.1.0:
   resolved "https://registry.yarnpkg.com/is-unicode-supported/-/is-unicode-supported-0.1.0.tgz#3f26c76a809593b52bfa2ecb5710ed2779b522a7"
   integrity sha512-knxG2q4UC3u8stRGyAVJCOdxFmv5DZiRcdlIaAQXAbSfJya+OhopNotLQrstBhququ4ZpuKbDc/8S6mgXgPFPw==
 
+is-unicode-supported@^1.1.0, is-unicode-supported@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/is-unicode-supported/-/is-unicode-supported-1.3.0.tgz#d824984b616c292a2e198207d4a609983842f714"
+  integrity sha512-43r2mRvz+8JRIKnWJ+3j8JtjRKZ6GmjzfaE/qiBJnikNnYv/6bagRJ1kUhNk8R5EX/GkobD+r+sfxCPJsiKBLQ==
+
 is-windows@^1.0.1:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.2.tgz#d1850eb9791ecd18e6182ce12a30f396634bb19d"
   integrity sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==
 
+isarray@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
+  integrity sha512-VLghIWNM6ELQzo7zwmcg0NmTVyWKYjvIeM83yjp0wRDTmUnrM678fQbcKBo6n2CJEF0szoG//ytg+TKla89ALQ==
+
 isexe@^2.0.0:
   version "2.0.0"
   resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
@@ -5472,6 +5564,15 @@ istanbul-lib-report@^3.0.0:
     make-dir "^3.0.0"
     supports-color "^7.1.0"
 
+istanbul-lib-report@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-report/-/istanbul-lib-report-3.0.1.tgz#908305bac9a5bd175ac6a74489eafd0fc2445a7d"
+  integrity sha512-GCfE1mtsHGOELCU8e/Z7YWzpmybrx/+dSTfLrvY8qRmaY6zXTKWn6WQIjaAFw069icm6GVMNkgu0NzI4iPZUNw==
+  dependencies:
+    istanbul-lib-coverage "^3.0.0"
+    make-dir "^4.0.0"
+    supports-color "^7.1.0"
+
 istanbul-lib-source-maps@^4.0.0:
   version "4.0.1"
   resolved "https://registry.yarnpkg.com/istanbul-lib-source-maps/-/istanbul-lib-source-maps-4.0.1.tgz#895f3a709fcfba34c6de5a42939022f3e4358551"
@@ -5489,6 +5590,14 @@ istanbul-reports@^3.1.3:
     html-escaper "^2.0.0"
     istanbul-lib-report "^3.0.0"
 
+istanbul-reports@^3.1.6:
+  version "3.1.7"
+  resolved "https://registry.yarnpkg.com/istanbul-reports/-/istanbul-reports-3.1.7.tgz#daed12b9e1dca518e15c056e1e537e741280fa0b"
+  integrity sha512-BewmUXImeuRk2YY0PVbxgKAysvhRPUQE0h5QRM++nVWyubKGV0l8qQ5op8+B2DOmwSe63Jivj0BjkPQVf8fP5g==
+  dependencies:
+    html-escaper "^2.0.0"
+    istanbul-lib-report "^3.0.0"
+
 jackspeak@^2.3.5:
   version "2.3.6"
   resolved "https://registry.yarnpkg.com/jackspeak/-/jackspeak-2.3.6.tgz#647ecc472238aee4b06ac0e461acc21a8c505ca8"
@@ -6745,6 +6854,16 @@ jsonfile@^4.0.0:
   optionalDependencies:
     graceful-fs "^4.1.6"
 
+jszip@^3.10.1:
+  version "3.10.1"
+  resolved "https://registry.yarnpkg.com/jszip/-/jszip-3.10.1.tgz#34aee70eb18ea1faec2f589208a157d1feb091c2"
+  integrity sha512-xXDvecyTpGLrqFrvkrUSoxxfJI5AH7U8zxxtVclpsUtMCq4JQ290LY8AW5c7Ggnr/Y/oK+bQMbqK2qmtk3pN4g==
+  dependencies:
+    lie "~3.3.0"
+    pako "~1.0.2"
+    readable-stream "~2.3.6"
+    setimmediate "^1.0.5"
+
 keypress@~0.2.1:
   version "0.2.1"
   resolved "https://registry.yarnpkg.com/keypress/-/keypress-0.2.1.tgz#1e80454250018dbad4c3fe94497d6e67b6269c77"
@@ -6798,6 +6917,13 @@ levn@~0.3.0:
     prelude-ls "~1.1.2"
     type-check "~0.3.2"
 
+lie@~3.3.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/lie/-/lie-3.3.0.tgz#dcf82dee545f46074daf200c7c1c5a08e0f40f6a"
+  integrity sha512-UaiMJzeWRlEujzAuw5LokY1L5ecNQYZKfmyZ9L7wDHb/p5etKaxXhohBcrw0EYby+G/NA52vRSN4N39dxHAIwQ==
+  dependencies:
+    immediate "~3.0.5"
+
 lines-and-columns@^1.1.6:
   version "1.2.4"
   resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632"
@@ -6853,6 +6979,14 @@ log-symbols@^4.1.0:
     chalk "^4.1.0"
     is-unicode-supported "^0.1.0"
 
+log-symbols@^5.1.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-5.1.0.tgz#a20e3b9a5f53fac6aeb8e2bb22c07cf2c8f16d93"
+  integrity sha512-l0x2DvrW294C9uDCoQe1VSU4gf529FkSZ6leBl4TiqZH/e+0R7hSfHQBNut2mNygDgHwvYHfFLn6Oxb3VWj2rA==
+  dependencies:
+    chalk "^5.0.0"
+    is-unicode-supported "^1.1.0"
+
 logform@^2.6.0, logform@^2.7.0:
   version "2.7.0"
   resolved "https://registry.yarnpkg.com/logform/-/logform-2.7.0.tgz#cfca97528ef290f2e125a08396805002b2d060d1"
@@ -6916,6 +7050,13 @@ make-dir@^3.0.0:
   dependencies:
     semver "^6.0.0"
 
+make-dir@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-4.0.0.tgz#c3c2307a771277cd9638305f915c29ae741b614e"
+  integrity sha512-hXdUTZYIVOt1Ex//jAQi+wTZZpUpwBj/0QsOzqegb3rGMMeJiSEu5xLHnYfBrRV4RH2+OCSOO95Is/7x1WJ4bw==
+  dependencies:
+    semver "^7.5.3"
+
 make-error@1.x, make-error@^1.1.1:
   version "1.3.6"
   resolved "https://registry.yarnpkg.com/make-error/-/make-error-1.3.6.tgz#2eb2e37ea9b67c4891f684a1394799af484cf7a2"
@@ -6982,20 +7123,20 @@ minimatch@^3.0.4, minimatch@^3.0.5, minimatch@^3.1.1, minimatch@^3.1.2:
   dependencies:
     brace-expansion "^1.1.7"
 
-minimatch@^9.0.4:
-  version "9.0.5"
-  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-9.0.5.tgz#d74f9dd6b57d83d8e98cfb82133b03978bc929e5"
-  integrity sha512-G6T0ZX48xgozx7587koeX9Ys2NYy6Gmv//P89sEte9V9whIapMNF4idKxnW2QtCcLiTWlb/wfCabAtAFWhhBow==
-  dependencies:
-    brace-expansion "^2.0.1"
-
-minimatch@~5.1.2:
+minimatch@^5.0.1, minimatch@^5.1.6, minimatch@~5.1.2:
   version "5.1.6"
   resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-5.1.6.tgz#1cfcb8cf5522ea69952cd2af95ae09477f122a96"
   integrity sha512-lKwV/1brpG6mBUFHtb7NUmtABCb2WZZmm2wNiOA5hAb8VdCS4B3dtMWyvcoViccwAW/COERjXLt0zP1zXUN26g==
   dependencies:
     brace-expansion "^2.0.1"
 
+minimatch@^9.0.3, minimatch@^9.0.4:
+  version "9.0.5"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-9.0.5.tgz#d74f9dd6b57d83d8e98cfb82133b03978bc929e5"
+  integrity sha512-G6T0ZX48xgozx7587koeX9Ys2NYy6Gmv//P89sEte9V9whIapMNF4idKxnW2QtCcLiTWlb/wfCabAtAFWhhBow==
+  dependencies:
+    brace-expansion "^2.0.1"
+
 minimist@^1.2.0, minimist@^1.2.8:
   version "1.2.8"
   resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.8.tgz#c1a464e7693302e082a075cee0c057741ac4772c"
@@ -7016,6 +7157,58 @@ mkdirp@3.0.1:
   resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-3.0.1.tgz#e44e4c5607fb279c168241713cc6e0fea9adcb50"
   integrity sha512-+NsyUUAZDmo6YVHzL/stxSu3t9YS1iljliy3BSDrXJ/dkn1KYdmtZODGGjLcc9XLgVVpH4KshHB8XmZgMhaBXg==
 
+mocha@^10.2.0:
+  version "10.8.2"
+  resolved "https://registry.yarnpkg.com/mocha/-/mocha-10.8.2.tgz#8d8342d016ed411b12a429eb731b825f961afb96"
+  integrity sha512-VZlYo/WE8t1tstuRmqgeyBgCbJc/lEdopaa+axcKzTBJ+UIdlAB9XnmvTCAH4pwR4ElNInaedhEBmZD8iCSVEg==
+  dependencies:
+    ansi-colors "^4.1.3"
+    browser-stdout "^1.3.1"
+    chokidar "^3.5.3"
+    debug "^4.3.5"
+    diff "^5.2.0"
+    escape-string-regexp "^4.0.0"
+    find-up "^5.0.0"
+    glob "^8.1.0"
+    he "^1.2.0"
+    js-yaml "^4.1.0"
+    log-symbols "^4.1.0"
+    minimatch "^5.1.6"
+    ms "^2.1.3"
+    serialize-javascript "^6.0.2"
+    strip-json-comments "^3.1.1"
+    supports-color "^8.1.1"
+    workerpool "^6.5.1"
+    yargs "^16.2.0"
+    yargs-parser "^20.2.9"
+    yargs-unparser "^2.0.0"
+
+mocha@^11.0.1:
+  version "11.0.1"
+  resolved "https://registry.yarnpkg.com/mocha/-/mocha-11.0.1.tgz#85c1c0e806275fe2479245be4ac4a0d81f533aa8"
+  integrity sha512-+3GkODfsDG71KSCQhc4IekSW+ItCK/kiez1Z28ksWvYhKXV/syxMlerR/sC7whDp7IyreZ4YxceMLdTs5hQE8A==
+  dependencies:
+    ansi-colors "^4.1.3"
+    browser-stdout "^1.3.1"
+    chokidar "^3.5.3"
+    debug "^4.3.5"
+    diff "^5.2.0"
+    escape-string-regexp "^4.0.0"
+    find-up "^5.0.0"
+    glob "^10.4.5"
+    he "^1.2.0"
+    js-yaml "^4.1.0"
+    log-symbols "^4.1.0"
+    minimatch "^5.1.6"
+    ms "^2.1.3"
+    serialize-javascript "^6.0.2"
+    strip-json-comments "^3.1.1"
+    supports-color "^8.1.1"
+    workerpool "^6.5.1"
+    yargs "^16.2.0"
+    yargs-parser "^20.2.9"
+    yargs-unparser "^2.0.0"
+
 mri@1.1.4:
   version "1.1.4"
   resolved "https://registry.yarnpkg.com/mri/-/mri-1.1.4.tgz#7cb1dd1b9b40905f1fac053abe25b6720f44744a"
@@ -7026,7 +7219,7 @@ ms@2.1.2:
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009"
   integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==
 
-ms@^2.1.1:
+ms@^2.1.1, ms@^2.1.3:
   version "2.1.3"
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
   integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
@@ -7073,7 +7266,7 @@ node-releases@^2.0.19:
   resolved "https://registry.yarnpkg.com/node-releases/-/node-releases-2.0.19.tgz#9e445a52950951ec4d177d843af370b411caf314"
   integrity sha512-xxOWJsBKtzAq7DY0J+DTzuz58K8e7sJbdgwkbMWQe8UYB6ekmsQ45q0M/tJDsGaZmbC+l7n57UV8Hl5tHxO9uw==
 
-normalize-path@^3.0.0:
+normalize-path@^3.0.0, normalize-path@~3.0.0:
   version "3.0.0"
   resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-3.0.0.tgz#0dcd69ff23a1c9b11fd0978316644a0388216a65"
   integrity sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==
@@ -7219,6 +7412,21 @@ ora@5.4.1:
     strip-ansi "^6.0.0"
     wcwidth "^1.0.1"
 
+ora@^7.0.1:
+  version "7.0.1"
+  resolved "https://registry.yarnpkg.com/ora/-/ora-7.0.1.tgz#cdd530ecd865fe39e451a0e7697865669cb11930"
+  integrity sha512-0TUxTiFJWv+JnjWm4o9yvuskpEJLXTcng8MJuKd+SzAzp2o+OP3HWqNhB4OdJRt1Vsd9/mR0oyaEYlOnL7XIRw==
+  dependencies:
+    chalk "^5.3.0"
+    cli-cursor "^4.0.0"
+    cli-spinners "^2.9.0"
+    is-interactive "^2.0.0"
+    is-unicode-supported "^1.3.0"
+    log-symbols "^5.1.0"
+    stdin-discarder "^0.1.0"
+    string-width "^6.1.0"
+    strip-ansi "^7.1.0"
+
 p-limit@^2.0.0, p-limit@^2.2.0:
   version "2.3.0"
   resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-2.3.0.tgz#3dd33c647a214fdfffd835933eb086da0dc21db1"
@@ -7264,6 +7472,11 @@ package-json-from-dist@^1.0.0:
   resolved "https://registry.yarnpkg.com/package-json-from-dist/-/package-json-from-dist-1.0.1.tgz#4f1471a010827a86f94cfd9b0727e36d267de505"
   integrity sha512-UEZIS3/by4OC8vL3P2dTXRETpebLI2NiI5vIrjaD/5UtrkFX/tNbwjTSRAGC/+7CAo2pIcBaRgWmcBBHcsaCIw==
 
+pako@~1.0.2:
+  version "1.0.11"
+  resolved "https://registry.yarnpkg.com/pako/-/pako-1.0.11.tgz#6c9599d340d54dfd3946380252a35705a6b992bf"
+  integrity sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==
+
 parent-module@^1.0.0:
   version "1.0.1"
   resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
@@ -7356,7 +7569,7 @@ picocolors@^1.1.0:
   resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
   integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
 
-picomatch@^2.0.4, picomatch@^2.2.3, picomatch@^2.3.1:
+picomatch@^2.0.4, picomatch@^2.2.1, picomatch@^2.2.3, picomatch@^2.3.1:
   version "2.3.1"
   resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.3.1.tgz#3ba3833733646d9d3e4995946c1365a67fb07a42"
   integrity sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==
@@ -7456,6 +7669,11 @@ pretty-format@^29.5.0:
     ansi-styles "^5.0.0"
     react-is "^18.0.0"
 
+process-nextick-args@~2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.1.tgz#7820d9b16120cc55ca9ae7792680ae7dba6d7fe2"
+  integrity sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==
+
 prompt-promise@^1.0.3:
   version "1.0.3"
   resolved "https://registry.yarnpkg.com/prompt-promise/-/prompt-promise-1.0.3.tgz#78ce4fcb9a14a108c49174f2d808c440d1bde265"
@@ -7512,6 +7730,13 @@ queue-microtask@^1.2.2:
   resolved "https://registry.yarnpkg.com/queue-microtask/-/queue-microtask-1.2.3.tgz#4929228bbc724dfac43e0efb058caf7b6cfb6243"
   integrity sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==
 
+randombytes@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/randombytes/-/randombytes-2.1.0.tgz#df6f84372f0270dc65cdf6291349ab7a473d4f2a"
+  integrity sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==
+  dependencies:
+    safe-buffer "^5.1.0"
+
 react-dom@0.0.0-experimental-4beb1fd8-20241118:
   version "0.0.0-experimental-4beb1fd8-20241118"
   resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-0.0.0-experimental-4beb1fd8-20241118.tgz#bf51483d52faea0618abef7d7eab681eea328ac7"
@@ -7553,6 +7778,26 @@ readable-stream@^3.4.0, readable-stream@^3.6.2:
     string_decoder "^1.1.1"
     util-deprecate "^1.0.1"
 
+readable-stream@~2.3.6:
+  version "2.3.8"
+  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.8.tgz#91125e8042bba1b9887f49345f6277027ce8be9b"
+  integrity sha512-8p0AUk4XODgIewSi0l8Epjs+EVnWiK7NoDIEGU0HhE7+ZyY8D1IMY7odu5lRrFXGg71L15KG8QrPmum45RTtdA==
+  dependencies:
+    core-util-is "~1.0.0"
+    inherits "~2.0.3"
+    isarray "~1.0.0"
+    process-nextick-args "~2.0.0"
+    safe-buffer "~5.1.1"
+    string_decoder "~1.1.1"
+    util-deprecate "~1.0.1"
+
+readdirp@~3.6.0:
+  version "3.6.0"
+  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-3.6.0.tgz#74a370bd857116e245b29cc97340cd431a02a6c7"
+  integrity sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==
+  dependencies:
+    picomatch "^2.2.1"
+
 readline@^1.3.0:
   version "1.3.0"
   resolved "https://registry.yarnpkg.com/readline/-/readline-1.3.0.tgz#c580d77ef2cfc8752b132498060dc9793a7ac01c"
@@ -7682,6 +7927,14 @@ restore-cursor@^3.1.0:
     onetime "^5.1.0"
     signal-exit "^3.0.2"
 
+restore-cursor@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-4.0.0.tgz#519560a4318975096def6e609d44100edaa4ccb9"
+  integrity sha512-I9fPXU9geO9bHOt9pHHOhOkYerIMsmVaWB0rA2AI9ERh/+x/i7MV5HKBNrg+ljO5eoPVgCcnFuRjJ9uH6I/3eg==
+  dependencies:
+    onetime "^5.1.0"
+    signal-exit "^3.0.2"
+
 reusify@^1.0.4:
   version "1.0.4"
   resolved "https://registry.yarnpkg.com/reusify/-/reusify-1.0.4.tgz#90da382b1e126efc02146e90845a88db12925d76"
@@ -7713,16 +7966,16 @@ rxjs@^7.0.0, rxjs@^7.8.1:
   dependencies:
     tslib "^2.1.0"
 
-safe-buffer@~5.1.1:
-  version "5.1.2"
-  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d"
-  integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==
-
-safe-buffer@~5.2.0:
+safe-buffer@^5.1.0, safe-buffer@~5.2.0:
   version "5.2.1"
   resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.2.1.tgz#1eaf9fa9bdb1fdd4ec75f58f9cdb4e6b7827eec6"
   integrity sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==
 
+safe-buffer@~5.1.0, safe-buffer@~5.1.1:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d"
+  integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==
+
 safe-stable-stringify@^2.3.1:
   version "2.5.0"
   resolved "https://registry.yarnpkg.com/safe-stable-stringify/-/safe-stable-stringify-2.5.0.tgz#4ca2f8e385f2831c432a719b108a3bf7af42a1dd"
@@ -7774,11 +8027,18 @@ semver@^7.5.3, semver@^7.5.4:
   dependencies:
     lru-cache "^6.0.0"
 
-semver@^7.6.0:
+semver@^7.6.0, semver@^7.6.2:
   version "7.6.3"
   resolved "https://registry.yarnpkg.com/semver/-/semver-7.6.3.tgz#980f7b5550bc175fb4dc09403085627f9eb33143"
   integrity sha512-oVekP1cKtI+CTDvHWYFUcMtsK/00wmAEfyqKfNdARm8u1wNVhSgaX7A8d4UuIlUI5e84iEwOhs7ZPYRmzU9U6A==
 
+serialize-javascript@^6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/serialize-javascript/-/serialize-javascript-6.0.2.tgz#defa1e055c83bf6d59ea805d8da862254eb6a6c2"
+  integrity sha512-Saa1xPByTTq2gdeFZYLLo+RFE35NHZkAbqZeWNd3BpzppeVisAqpDjcp8dyf6uIvEqJRd46jemmyA4iFIeVk8g==
+  dependencies:
+    randombytes "^2.1.0"
+
 serializerr@^1.0.3:
   version "1.0.3"
   resolved "https://registry.yarnpkg.com/serializerr/-/serializerr-1.0.3.tgz#12d4c5aa1c3ffb8f6d1dc5f395aa9455569c3f91"
@@ -7791,6 +8051,11 @@ set-blocking@^2.0.0:
   resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7"
   integrity sha512-KiKBS8AnWGEyLzofFfmvKwpdPzqiy16LvQfK3yv/fVH7Bj13/wl3JSR1J+rfgRE9q7xUJK4qvgS8raSOeLUehw==
 
+setimmediate@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/setimmediate/-/setimmediate-1.0.5.tgz#290cbb232e306942d7d7ea9b83732ab7856f8285"
+  integrity sha512-MATJdZp8sLqDl/68LfQmbP8zKPLQNV6BIZoIgrscFDQ+RsvK/BxeDQOgyxKKoh0y/8h3BqVFnCqQ/gd+reiIXA==
+
 shallow-clone@^3.0.0:
   version "3.0.1"
   resolved "https://registry.yarnpkg.com/shallow-clone/-/shallow-clone-3.0.1.tgz#8f2981ad92531f55035b01fb230769a40e02efa3"
@@ -7890,6 +8155,13 @@ stack-utils@^2.0.3:
   dependencies:
     escape-string-regexp "^2.0.0"
 
+stdin-discarder@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/stdin-discarder/-/stdin-discarder-0.1.0.tgz#22b3e400393a8e28ebf53f9958f3880622efde21"
+  integrity sha512-xhV7w8S+bUwlPTb4bAOUQhv8/cSS5offJuX8GQGq32ONF0ZtDWKfkdomM3HMRA+LhX6um/FZ0COqlwsjD53LeQ==
+  dependencies:
+    bl "^5.0.0"
+
 string-length@^4.0.1:
   version "4.0.2"
   resolved "https://registry.yarnpkg.com/string-length/-/string-length-4.0.2.tgz#a8a8dc7bd5c1a82b9b3c8b87e125f66871b6e57a"
@@ -7925,6 +8197,15 @@ string-width@^5.0.1, string-width@^5.1.2:
     emoji-regex "^9.2.2"
     strip-ansi "^7.0.1"
 
+string-width@^6.1.0:
+  version "6.1.0"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-6.1.0.tgz#96488d6ed23f9ad5d82d13522af9e4c4c3fd7518"
+  integrity sha512-k01swCJAgQmuADB0YIc+7TuatfNvTBVOoaUWJjTB9R4VJzR5vNWzf5t42ESVZFPS8xTySF7CAdV4t/aaIm3UnQ==
+  dependencies:
+    eastasianwidth "^0.2.0"
+    emoji-regex "^10.2.1"
+    strip-ansi "^7.0.1"
+
 string_decoder@^1.1.1:
   version "1.3.0"
   resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.3.0.tgz#42f114594a46cf1a8e30b0a84f56c78c3edac21e"
@@ -7932,6 +8213,13 @@ string_decoder@^1.1.1:
   dependencies:
     safe-buffer "~5.2.0"
 
+string_decoder@~1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8"
+  integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==
+  dependencies:
+    safe-buffer "~5.1.0"
+
 "strip-ansi-cjs@npm:strip-ansi@^6.0.1":
   version "6.0.1"
   resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9"
@@ -7946,7 +8234,7 @@ strip-ansi@^6.0.0, strip-ansi@^6.0.1:
   dependencies:
     ansi-regex "^5.0.1"
 
-strip-ansi@^7.0.1:
+strip-ansi@^7.0.1, strip-ansi@^7.1.0:
   version "7.1.0"
   resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-7.1.0.tgz#d5b6568ca689d8561370b0707685d22434faff45"
   integrity sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==
@@ -7982,13 +8270,18 @@ supports-color@^7.0.0, supports-color@^7.1.0:
   dependencies:
     has-flag "^4.0.0"
 
-supports-color@^8.0.0, supports-color@^8.1.0:
+supports-color@^8.0.0, supports-color@^8.1.0, supports-color@^8.1.1:
   version "8.1.1"
   resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-8.1.1.tgz#cd6fc17e28500cff56c1b86c0a7fd4a54a73005c"
   integrity sha512-MpUEN2OodtUzxvKQl72cUF7RQ5EiHsGvSsVG0ia9c5RbWGL2CI4C7EpPS8UTBIplnlzZiNuV56w+FuNxy3ty2Q==
   dependencies:
     has-flag "^4.0.0"
 
+supports-color@^9.4.0:
+  version "9.4.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-9.4.0.tgz#17bfcf686288f531db3dea3215510621ccb55954"
+  integrity sha512-VL+lNrEoIXww1coLPOmiEmK/0sGigko5COxI09KzHc2VJXJsQ37UaQ+8quuxjDeA7+KnLGTWRyOXSLLR2Wb4jw==
+
 supports-hyperlinks@^2.0.0:
   version "2.3.0"
   resolved "https://registry.yarnpkg.com/supports-hyperlinks/-/supports-hyperlinks-2.3.0.tgz#3943544347c1ff90b15effb03fc14ae45ec10624"
@@ -8007,6 +8300,11 @@ symbol-tree@^3.2.4:
   resolved "https://registry.yarnpkg.com/symbol-tree/-/symbol-tree-3.2.4.tgz#430637d248ba77e078883951fb9aa0eed7c63fa2"
   integrity sha512-9QNk5KwDF+Bvz+PyObkmSYjI5ksVUYtjW7AU22r2NKcfLJcXp96hkDWU3+XndOsUb+AQ9QhfzfCT2O+CNWT5Tw==
 
+tapable@^2.2.0:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/tapable/-/tapable-2.2.1.tgz#1967a73ef4060a82f12ab96af86d52fdb76eeca0"
+  integrity sha512-GNzQvQTOIP6RyTfE2Qxb8ZVlNmw0n88vp1szwWRimP02mnTsx3Wtn5qRdqY9w2XduFNUgvOwhNnQsjwCp+kqaQ==
+
 terminal-link@^2.0.0:
   version "2.1.1"
   resolved "https://registry.yarnpkg.com/terminal-link/-/terminal-link-2.1.1.tgz#14a64a27ab3c0df933ea546fba55f2d078edc994"
@@ -8200,11 +8498,6 @@ typescript@^5.4.3:
   resolved "https://registry.yarnpkg.com/typescript/-/typescript-5.4.3.tgz#5c6fedd4c87bee01cd7a528a30145521f8e0feff"
   integrity sha512-KrPd3PKaCLr78MalgiwJnA25Nm8HAmdwN3mYUYZgG/wizIo9EainNVQI9/yDavtVFRN2h3k8uf3GLHuhDMgEHg==
 
-typescript@^5.7.2:
-  version "5.7.2"
-  resolved "https://registry.yarnpkg.com/typescript/-/typescript-5.7.2.tgz#3169cf8c4c8a828cde53ba9ecb3d2b1d5dd67be6"
-  integrity sha512-i5t66RHxDvVN40HfDd1PsEThGNnlMCMT3jMUuoh9/0TaqWevNontacunWyN02LA9/fIbEWlcHZcgTKb9QoaLfg==
-
 undici-types@~6.19.2:
   version "6.19.8"
   resolved "https://registry.yarnpkg.com/undici-types/-/undici-types-6.19.8.tgz#35111c9d1437ab83a7cdc0abae2f26d88eda0a02"
@@ -8274,7 +8567,7 @@ url-parse@^1.5.3:
     querystringify "^2.1.1"
     requires-port "^1.0.0"
 
-util-deprecate@^1.0.1:
+util-deprecate@^1.0.1, util-deprecate@~1.0.1:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
   integrity sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==
@@ -8284,6 +8577,15 @@ v8-compile-cache-lib@^3.0.1:
   resolved "https://registry.yarnpkg.com/v8-compile-cache-lib/-/v8-compile-cache-lib-3.0.1.tgz#6336e8d71965cb3d35a1bbb7868445a7c05264bf"
   integrity sha512-wa7YjyUGfNZngI/vtK0UHAN+lgDCxBPCylVXGp0zu59Fz5aiGtNXaq3DhIov063MorB+VfufLh3JlF2KdTK3xg==
 
+v8-to-istanbul@^9.0.0:
+  version "9.3.0"
+  resolved "https://registry.yarnpkg.com/v8-to-istanbul/-/v8-to-istanbul-9.3.0.tgz#b9572abfa62bd556c16d75fdebc1a411d5ff3175"
+  integrity sha512-kiGUalWN+rgBJ/1OHZsBtU4rXZOfj/7rKQxULKlIzwzQSvMJUUNgPwJEEh7gU6xEVxC0ahoOBvN2YI8GH6FNgA==
+  dependencies:
+    "@jridgewell/trace-mapping" "^0.3.12"
+    "@types/istanbul-lib-coverage" "^2.0.1"
+    convert-source-map "^2.0.0"
+
 v8-to-istanbul@^9.0.1:
   version "9.0.1"
   resolved "https://registry.yarnpkg.com/v8-to-istanbul/-/v8-to-istanbul-9.0.1.tgz#b6f994b0b5d4ef255e17a0d17dc444a9f5132fa4"
@@ -8427,6 +8729,11 @@ wordwrap@>=0.0.2:
   resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb"
   integrity sha512-gvVzJFlPycKc5dZN4yPkP8w7Dc37BtP1yczEneOb4uq34pXZcvrtRTmWV8W+Ume+XCxKgbjM+nevkyFPMybd4Q==
 
+workerpool@^6.5.1:
+  version "6.5.1"
+  resolved "https://registry.yarnpkg.com/workerpool/-/workerpool-6.5.1.tgz#060f73b39d0caf97c6db64da004cd01b4c099544"
+  integrity sha512-Fs4dNYcsdpYSAfVxhnl1L5zTksjvOJxtC5hzMNl+1t9B8hTJTdKDyZ5ju7ztgPy+ft9tBFXoOlDNiOT9WUXZlA==
+
 "wrap-ansi-cjs@npm:wrap-ansi@^7.0.0":
   version "7.0.0"
   resolved "https://registry.yarnpkg.com/wrap-ansi/-/wrap-ansi-7.0.0.tgz#67e145cff510a6a6984bdf1152911d69d2eb9e43"
@@ -8519,11 +8826,26 @@ yargs-parser@^18.1.2:
     camelcase "^5.0.0"
     decamelize "^1.2.0"
 
+yargs-parser@^20.2.2, yargs-parser@^20.2.9:
+  version "20.2.9"
+  resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-20.2.9.tgz#2eb7dc3b0289718fc295f362753845c41a0c94ee"
+  integrity sha512-y11nGElTIV+CT3Zv9t7VKl+Q3hTQoT9a1Qzezhhl6Rp21gJ/IVTW7Z3y9EWXhuUBC2Shnf+DX0antecpAwSP8w==
+
 yargs-parser@^21.0.0, yargs-parser@^21.0.1, yargs-parser@^21.1.1:
   version "21.1.1"
   resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-21.1.1.tgz#9096bceebf990d21bb31fa9516e0ede294a77d35"
   integrity sha512-tVpsJW7DdjecAiFpbIB1e3qxIQsE6NoPc5/eTdrbbIC4h0LVsWhnoa3g+m2HclBIujHzsxZ4VJVA+GUuc2/LBw==
 
+yargs-unparser@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/yargs-unparser/-/yargs-unparser-2.0.0.tgz#f131f9226911ae5d9ad38c432fe809366c2325eb"
+  integrity sha512-7pRTIA9Qc1caZ0bZ6RYRGbHJthJWuakf+WmHK0rVeLkNrrGhfoabBNdue6kdINI6r4if7ocq9aD/n7xwKOdzOA==
+  dependencies:
+    camelcase "^6.0.0"
+    decamelize "^4.0.0"
+    flat "^5.0.2"
+    is-plain-obj "^2.1.0"
+
 yargs@^15.3.1:
   version "15.4.1"
   resolved "https://registry.yarnpkg.com/yargs/-/yargs-15.4.1.tgz#0d87a16de01aee9d8bec2bfbf74f67851730f4f8"
@@ -8541,6 +8863,19 @@ yargs@^15.3.1:
     y18n "^4.0.0"
     yargs-parser "^18.1.2"
 
+yargs@^16.2.0:
+  version "16.2.0"
+  resolved "https://registry.yarnpkg.com/yargs/-/yargs-16.2.0.tgz#1c82bf0f6b6a66eafce7ef30e376f49a12477f66"
+  integrity sha512-D1mvvtDG0L5ft/jGWkLpG1+m0eQxOfaBvTNELraWj22wSVUMWxZUvYgJYcKh6jGGIkJFhH4IZPQhR4TKpc8mBw==
+  dependencies:
+    cliui "^7.0.2"
+    escalade "^3.1.1"
+    get-caller-file "^2.0.5"
+    require-directory "^2.1.1"
+    string-width "^4.2.0"
+    y18n "^5.0.5"
+    yargs-parser "^20.2.2"
+
 yargs@^17.3.1:
   version "17.5.1"
   resolved "https://registry.yarnpkg.com/yargs/-/yargs-17.5.1.tgz#e109900cab6fcb7fd44b1d8249166feb0b36e58e"

From 2e4db3344f030fe622152ecc231a7c99a81a9c9d Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Tue, 25 Feb 2025 12:45:18 -0500
Subject: [PATCH 59/73] Use valid CSS selectors in useId format (#32001)
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit

For the `useId` algorithm we used colon `:` before and after.
https://github.com/facebook/react/pull/23360

This avoids collisions in general by using an unusual characters. It
also avoids collisions when concatenated with some other ID.
Unfortunately, `:` is not a valid character in `view-transition-name`.

This PR swaps the format from:

```
:r123:
```

To the unicode:

```
«r123»
```

Which is valid CSS selectors. This also allows them being used for
`querySelector()` which we didn't really find a legit use for but seems
ok-ish.

That way you can get a view-transition-name that you can manually
reference. E.g. to generate styles:

```js
const id = useId();
return <>
  <style>{`
    ::view-transition-group(${id}) { ... }
    ::view-transition-old(${id}) { ... }
    ::view-transition-new(${id}) { ... }
  `}</style>
  <ViewTransition name={id}>...</ViewTransition>
</>;
```
---
 .../ReactHooksInspectionIntegration-test.js   |  2 +-
 .../src/server/ReactFizzConfigDOM.js          |  4 +--
 .../src/__tests__/ReactDOMUseId-test.js       | 30 +++++++++----------
 .../react-reconciler/src/ReactFiberHooks.js   | 11 +++++--
 4 files changed, 26 insertions(+), 21 deletions(-)

diff --git a/packages/react-debug-tools/src/__tests__/ReactHooksInspectionIntegration-test.js b/packages/react-debug-tools/src/__tests__/ReactHooksInspectionIntegration-test.js
index 87f98b99f2534..79ec20c3c2975 100644
--- a/packages/react-debug-tools/src/__tests__/ReactHooksInspectionIntegration-test.js
+++ b/packages/react-debug-tools/src/__tests__/ReactHooksInspectionIntegration-test.js
@@ -1553,7 +1553,7 @@ describe('ReactHooksInspectionIntegration', () => {
     expect(tree[0].id).toEqual(0);
     expect(tree[0].isStateEditable).toEqual(false);
     expect(tree[0].name).toEqual('Id');
-    expect(String(tree[0].value).startsWith(':r')).toBe(true);
+    expect(String(tree[0].value).startsWith('\u00ABr')).toBe(true);
 
     expect(normalizeSourceLoc(tree)[1]).toMatchInlineSnapshot(`
       {
diff --git a/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js b/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
index 6a86cbb2652fa..963f516b15308 100644
--- a/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
+++ b/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
@@ -858,7 +858,7 @@ export function makeId(
 ): string {
   const idPrefix = resumableState.idPrefix;
 
-  let id = ':' + idPrefix + 'R' + treeId;
+  let id = '\u00AB' + idPrefix + 'R' + treeId;
 
   // Unless this is the first id at this level, append a number at the end
   // that represents the position of this useId hook among all the useId
@@ -867,7 +867,7 @@ export function makeId(
     id += 'H' + localId.toString(32);
   }
 
-  return id + ':';
+  return id + '\u00BB';
 }
 
 function encodeHTMLTextNode(text: string): string {
diff --git a/packages/react-dom/src/__tests__/ReactDOMUseId-test.js b/packages/react-dom/src/__tests__/ReactDOMUseId-test.js
index af5dbdd355294..7738994fb1e1e 100644
--- a/packages/react-dom/src/__tests__/ReactDOMUseId-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMUseId-test.js
@@ -96,7 +96,7 @@ describe('useId', () => {
   }
 
   function normalizeTreeIdForTesting(id) {
-    const result = id.match(/:(R|r)([a-z0-9]*)(H([0-9]*))?:/);
+    const result = id.match(/\u00AB(R|r)([a-z0-9]*)(H([0-9]*))?\u00BB/);
     if (result === undefined) {
       throw new Error('Invalid id format');
     }
@@ -285,7 +285,7 @@ describe('useId', () => {
     // 'R:' prefix, and the first character after that, which may not correspond
     // to a complete set of 5 bits.
     //
-    // Example: :Rclalalalalalalala...:
+    // Example: «Rclalalalalalalala...:
     //
     // We can use this pattern to test large ids that exceed the bitwise
     // safe range (32 bits). The algorithm should theoretically support ids
@@ -320,8 +320,8 @@ describe('useId', () => {
 
     // Confirm that every id matches the expected pattern
     for (let i = 0; i < divs.length; i++) {
-      // Example: :Rclalalalalalalala...:
-      expect(divs[i].id).toMatch(/^:R.(((al)*a?)((la)*l?))*:$/);
+      // Example: «Rclalalalalalalala...:
+      expect(divs[i].id).toMatch(/^\u00ABR.(((al)*a?)((la)*l?))*\u00BB$/);
     }
   });
 
@@ -345,7 +345,7 @@ describe('useId', () => {
       <div
         id="container"
       >
-        :R0:, :R0H1:, :R0H2:
+        «R0», «R0H1», «R0H2»
       </div>
     `);
   });
@@ -370,7 +370,7 @@ describe('useId', () => {
       <div
         id="container"
       >
-        :R0:
+        «R0»
       </div>
     `);
   });
@@ -608,10 +608,10 @@ describe('useId', () => {
         id="container"
       >
         <div>
-          :custom-prefix-R1:
+          «custom-prefix-R1»
         </div>
         <div>
-          :custom-prefix-R2:
+          «custom-prefix-R2»
         </div>
       </div>
     `);
@@ -625,13 +625,13 @@ describe('useId', () => {
         id="container"
       >
         <div>
-          :custom-prefix-R1:
+          «custom-prefix-R1»
         </div>
         <div>
-          :custom-prefix-R2:
+          «custom-prefix-R2»
         </div>
         <div>
-          :custom-prefix-r0:
+          «custom-prefix-r0»
         </div>
       </div>
     `);
@@ -672,11 +672,11 @@ describe('useId', () => {
         id="container"
       >
         <div>
-          :R0:
+          «R0»
           <!-- -->
            
           <div>
-            :R7:
+            «R7»
           </div>
         </div>
       </div>
@@ -690,11 +690,11 @@ describe('useId', () => {
         id="container"
       >
         <div>
-          :R0:
+          «R0»
           <!-- -->
            
           <div>
-            :R7:
+            «R7»
           </div>
         </div>
       </div>
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index ddf051bcdb94f..50424e9d7b4db 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -3595,7 +3595,7 @@ function mountId(): string {
     const treeId = getTreeId();
 
     // Use a captial R prefix for server-generated ids.
-    id = ':' + identifierPrefix + 'R' + treeId;
+    id = '\u00AB' + identifierPrefix + 'R' + treeId;
 
     // Unless this is the first id at this level, append a number at the end
     // that represents the position of this useId hook among all the useId
@@ -3605,11 +3605,16 @@ function mountId(): string {
       id += 'H' + localId.toString(32);
     }
 
-    id += ':';
+    id += '\u00BB';
   } else {
     // Use a lowercase r prefix for client-generated ids.
     const globalClientId = globalClientIdCounter++;
-    id = ':' + identifierPrefix + 'r' + globalClientId.toString(32) + ':';
+    id =
+      '\u00AB' +
+      identifierPrefix +
+      'r' +
+      globalClientId.toString(32) +
+      '\u00BB';
   }
 
   hook.memoizedState = id;

From 403d4fb852384b820a8fe405413891d8c74bbf5d Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Tue, 25 Feb 2025 12:45:44 -0500
Subject: [PATCH 60/73] Move ViewTransitions helpers to
 ReactFiberCommitViewTransitions (#32462)

This doesn't change anything. It just moves some functions.

This moves the view transitions helper functions into its own file. This
is similar to how I already moved ReactFiberCommitEffects and
ReactFiberCommitHostEffects out of ReactFiberCommitWork.

This makes it a bit easier to navigate and get an overview of
ReactFiberCommitWork but another motivation is also so that I can refer
to these helpers from
[ReactFiberApplyGesture](https://github.com/facebook/react/pull/32451/files#diff-42297cf327dee8e01d83c85314b8965953b9674e7c4615ce6c430464dcc8550b).
---
 .../src/ReactFiberCommitViewTransitions.js    | 831 ++++++++++++++++++
 .../src/ReactFiberCommitWork.js               | 819 +----------------
 .../src/ReactFiberWorkLoop.js                 |   2 +-
 3 files changed, 861 insertions(+), 791 deletions(-)
 create mode 100644 packages/react-reconciler/src/ReactFiberCommitViewTransitions.js

diff --git a/packages/react-reconciler/src/ReactFiberCommitViewTransitions.js b/packages/react-reconciler/src/ReactFiberCommitViewTransitions.js
new file mode 100644
index 0000000000000..22b9d11ac67d2
--- /dev/null
+++ b/packages/react-reconciler/src/ReactFiberCommitViewTransitions.js
@@ -0,0 +1,831 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+import type {Instance, InstanceMeasurement, Props} from './ReactFiberConfig';
+import type {Fiber} from './ReactInternalTypes';
+import type {
+  ViewTransitionProps,
+  ViewTransitionState,
+} from './ReactFiberViewTransitionComponent';
+
+import {
+  HostComponent,
+  OffscreenComponent,
+  ViewTransitionComponent,
+} from './ReactWorkTags';
+import {
+  NoFlags,
+  Update,
+  ViewTransitionStatic,
+  AffectedParentLayout,
+  ViewTransitionNamedStatic,
+} from './ReactFiberFlags';
+import {
+  supportsMutation,
+  applyViewTransitionName,
+  restoreViewTransitionName,
+  measureInstance,
+  hasInstanceChanged,
+  hasInstanceAffectedParent,
+  wasInstanceInViewport,
+} from './ReactFiberConfig';
+import {scheduleViewTransitionEvent} from './ReactFiberWorkLoop';
+import {
+  getViewTransitionName,
+  getViewTransitionClassName,
+} from './ReactFiberViewTransitionComponent';
+
+export let shouldStartViewTransition: boolean = false;
+
+export function resetShouldStartViewTransition(): void {
+  shouldStartViewTransition = false;
+}
+
+// This tracks named ViewTransition components found in the accumulateSuspenseyCommit
+// phase that might need to find deleted pairs in the beforeMutation phase.
+let appearingViewTransitions: Map<string, ViewTransitionState> | null = null;
+
+export function resetAppearingViewTransitions(): void {
+  appearingViewTransitions = null;
+}
+
+export function trackAppearingViewTransition(
+  name: string,
+  state: ViewTransitionState,
+): void {
+  if (appearingViewTransitions === null) {
+    appearingViewTransitions = new Map();
+  }
+  appearingViewTransitions.set(name, state);
+}
+
+// We can't cancel view transition children until we know that their parent also
+// don't need to transition.
+export let viewTransitionCancelableChildren: null | Array<
+  Instance | string | Props,
+> = null; // tupled array where each entry is [instance: Instance, oldName: string, props: Props]
+
+export function setViewTransitionCancelableChildren(
+  children: null | Array<Instance | string | Props>,
+): void {
+  viewTransitionCancelableChildren = children;
+}
+
+let viewTransitionHostInstanceIdx = 0;
+
+function applyViewTransitionToHostInstances(
+  child: null | Fiber,
+  name: string,
+  className: ?string,
+  collectMeasurements: null | Array<InstanceMeasurement>,
+  stopAtNestedViewTransitions: boolean,
+): boolean {
+  if (!supportsMutation) {
+    return false;
+  }
+  let inViewport = false;
+  while (child !== null) {
+    if (child.tag === HostComponent) {
+      shouldStartViewTransition = true;
+      const instance: Instance = child.stateNode;
+      if (collectMeasurements !== null) {
+        const measurement = measureInstance(instance);
+        collectMeasurements.push(measurement);
+        if (wasInstanceInViewport(measurement)) {
+          inViewport = true;
+        }
+      } else if (!inViewport) {
+        if (wasInstanceInViewport(measureInstance(instance))) {
+          inViewport = true;
+        }
+      }
+      applyViewTransitionName(
+        instance,
+        viewTransitionHostInstanceIdx === 0
+          ? name
+          : // If we have multiple Host Instances below, we add a suffix to the name to give
+            // each one a unique name.
+            name + '_' + viewTransitionHostInstanceIdx,
+        className,
+      );
+      viewTransitionHostInstanceIdx++;
+    } else if (
+      child.tag === OffscreenComponent &&
+      child.memoizedState !== null
+    ) {
+      // Skip any hidden subtrees. They were or are effectively not there.
+    } else if (
+      child.tag === ViewTransitionComponent &&
+      stopAtNestedViewTransitions
+    ) {
+      // Skip any nested view transitions for updates since in that case the
+      // inner most one is the one that handles the update.
+    } else {
+      if (
+        applyViewTransitionToHostInstances(
+          child.child,
+          name,
+          className,
+          collectMeasurements,
+          stopAtNestedViewTransitions,
+        )
+      ) {
+        inViewport = true;
+      }
+    }
+    child = child.sibling;
+  }
+  return inViewport;
+}
+
+function restoreViewTransitionOnHostInstances(
+  child: null | Fiber,
+  stopAtNestedViewTransitions: boolean,
+): void {
+  if (!supportsMutation) {
+    return;
+  }
+  while (child !== null) {
+    if (child.tag === HostComponent) {
+      const instance: Instance = child.stateNode;
+      restoreViewTransitionName(instance, child.memoizedProps);
+    } else if (
+      child.tag === OffscreenComponent &&
+      child.memoizedState !== null
+    ) {
+      // Skip any hidden subtrees. They were or are effectively not there.
+    } else if (
+      child.tag === ViewTransitionComponent &&
+      stopAtNestedViewTransitions
+    ) {
+      // Skip any nested view transitions for updates since in that case the
+      // inner most one is the one that handles the update.
+    } else {
+      restoreViewTransitionOnHostInstances(
+        child.child,
+        stopAtNestedViewTransitions,
+      );
+    }
+    child = child.sibling;
+  }
+}
+
+function commitAppearingPairViewTransitions(placement: Fiber): void {
+  if ((placement.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
+    // This has no named view transitions in its subtree.
+    return;
+  }
+  let child = placement.child;
+  while (child !== null) {
+    if (child.tag === OffscreenComponent && child.memoizedState === null) {
+      // This tree was already hidden so we skip it.
+    } else {
+      commitAppearingPairViewTransitions(child);
+      if (
+        child.tag === ViewTransitionComponent &&
+        (child.flags & ViewTransitionNamedStatic) !== NoFlags
+      ) {
+        const instance: ViewTransitionState = child.stateNode;
+        if (instance.paired) {
+          const props: ViewTransitionProps = child.memoizedProps;
+          if (props.name == null || props.name === 'auto') {
+            throw new Error(
+              'Found a pair with an auto name. This is a bug in React.',
+            );
+          }
+          const name = props.name;
+          const className: ?string = getViewTransitionClassName(
+            props.className,
+            props.share,
+          );
+          if (className !== 'none') {
+            // We found a new appearing view transition with the same name as this deletion.
+            // We'll transition between them.
+            viewTransitionHostInstanceIdx = 0;
+            const inViewport = applyViewTransitionToHostInstances(
+              child.child,
+              name,
+              className,
+              null,
+              false,
+            );
+            if (!inViewport) {
+              // This boundary is exiting within the viewport but is going to leave the viewport.
+              // Instead, we treat this as an exit of the previous entry by reverting the new name.
+              // Ideally we could undo the old transition but it's now too late. It's also on its
+              // on snapshot. We have know was for it to paint onto the original group.
+              // TODO: This will lead to things unexpectedly having exit animations that normally
+              // wouldn't happen. Consider if we should just let this fly off the screen instead.
+              restoreViewTransitionOnHostInstances(child.child, false);
+            }
+          }
+        }
+      }
+    }
+    child = child.sibling;
+  }
+}
+
+export function commitEnterViewTransitions(placement: Fiber): void {
+  if (placement.tag === ViewTransitionComponent) {
+    const state: ViewTransitionState = placement.stateNode;
+    const props: ViewTransitionProps = placement.memoizedProps;
+    const name = getViewTransitionName(props, state);
+    const className: ?string = getViewTransitionClassName(
+      props.className,
+      state.paired ? props.share : props.enter,
+    );
+    if (className !== 'none') {
+      viewTransitionHostInstanceIdx = 0;
+      const inViewport = applyViewTransitionToHostInstances(
+        placement.child,
+        name,
+        className,
+        null,
+        false,
+      );
+      if (!inViewport) {
+        // TODO: If this was part of a pair we will still run the onShare callback.
+        // Revert the transition names. This boundary is not in the viewport
+        // so we won't bother animating it.
+        restoreViewTransitionOnHostInstances(placement.child, false);
+        // TODO: Should we still visit the children in case a named one was in the viewport?
+      } else {
+        commitAppearingPairViewTransitions(placement);
+
+        if (!state.paired) {
+          scheduleViewTransitionEvent(placement, props.onEnter);
+        }
+      }
+    } else {
+      commitAppearingPairViewTransitions(placement);
+    }
+  } else if ((placement.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
+    let child = placement.child;
+    while (child !== null) {
+      commitEnterViewTransitions(child);
+      child = child.sibling;
+    }
+  } else {
+    commitAppearingPairViewTransitions(placement);
+  }
+}
+
+function commitDeletedPairViewTransitions(deletion: Fiber): void {
+  if (
+    appearingViewTransitions === null ||
+    appearingViewTransitions.size === 0
+  ) {
+    // We've found all.
+    return;
+  }
+  const pairs = appearingViewTransitions;
+  if ((deletion.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
+    // This has no named view transitions in its subtree.
+    return;
+  }
+  let child = deletion.child;
+  while (child !== null) {
+    if (child.tag === OffscreenComponent && child.memoizedState === null) {
+      // This tree was already hidden so we skip it.
+    } else {
+      if (
+        child.tag === ViewTransitionComponent &&
+        (child.flags & ViewTransitionNamedStatic) !== NoFlags
+      ) {
+        const props: ViewTransitionProps = child.memoizedProps;
+        const name = props.name;
+        if (name != null && name !== 'auto') {
+          const pair = pairs.get(name);
+          if (pair !== undefined) {
+            const className: ?string = getViewTransitionClassName(
+              props.className,
+              props.share,
+            );
+            if (className !== 'none') {
+              // We found a new appearing view transition with the same name as this deletion.
+              viewTransitionHostInstanceIdx = 0;
+              const inViewport = applyViewTransitionToHostInstances(
+                child.child,
+                name,
+                className,
+                null,
+                false,
+              );
+              if (!inViewport) {
+                // This boundary is not in the viewport so we won't treat it as a matched pair.
+                // Revert the transition names. This avoids it flying onto the screen which can
+                // be disruptive and doesn't really preserve any continuity anyway.
+                restoreViewTransitionOnHostInstances(child.child, false);
+              } else {
+                // We'll transition between them.
+                const oldinstance: ViewTransitionState = child.stateNode;
+                const newInstance: ViewTransitionState = pair;
+                newInstance.paired = oldinstance;
+                // Note: If the other side ends up outside the viewport, we'll still run this.
+                // Therefore it's possible for onShare to be called with only an old snapshot.
+                scheduleViewTransitionEvent(child, props.onShare);
+              }
+            }
+            // Delete the entry so that we know when we've found all of them
+            // and can stop searching (size reaches zero).
+            pairs.delete(name);
+            if (pairs.size === 0) {
+              break;
+            }
+          }
+        }
+      }
+      commitDeletedPairViewTransitions(child);
+    }
+    child = child.sibling;
+  }
+}
+
+export function commitExitViewTransitions(deletion: Fiber): void {
+  if (deletion.tag === ViewTransitionComponent) {
+    const props: ViewTransitionProps = deletion.memoizedProps;
+    const name = getViewTransitionName(props, deletion.stateNode);
+    const pair =
+      appearingViewTransitions !== null
+        ? appearingViewTransitions.get(name)
+        : undefined;
+    const className: ?string = getViewTransitionClassName(
+      props.className,
+      pair !== undefined ? props.share : props.exit,
+    );
+    if (className !== 'none') {
+      viewTransitionHostInstanceIdx = 0;
+      const inViewport = applyViewTransitionToHostInstances(
+        deletion.child,
+        name,
+        className,
+        null,
+        false,
+      );
+      if (!inViewport) {
+        // Revert the transition names. This boundary is not in the viewport
+        // so we won't bother animating it.
+        restoreViewTransitionOnHostInstances(deletion.child, false);
+        // TODO: Should we still visit the children in case a named one was in the viewport?
+      } else if (pair !== undefined) {
+        // We found a new appearing view transition with the same name as this deletion.
+        // We'll transition between them instead of running the normal exit.
+        const oldinstance: ViewTransitionState = deletion.stateNode;
+        const newInstance: ViewTransitionState = pair;
+        newInstance.paired = oldinstance;
+        // Delete the entry so that we know when we've found all of them
+        // and can stop searching (size reaches zero).
+        // $FlowFixMe[incompatible-use]: Refined by the pair.
+        appearingViewTransitions.delete(name);
+        // Note: If the other side ends up outside the viewport, we'll still run this.
+        // Therefore it's possible for onShare to be called with only an old snapshot.
+        scheduleViewTransitionEvent(deletion, props.onShare);
+      } else {
+        scheduleViewTransitionEvent(deletion, props.onExit);
+      }
+    }
+    if (appearingViewTransitions !== null) {
+      // Look for more pairs deeper in the tree.
+      commitDeletedPairViewTransitions(deletion);
+    }
+  } else if ((deletion.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
+    let child = deletion.child;
+    while (child !== null) {
+      commitExitViewTransitions(child);
+      child = child.sibling;
+    }
+  } else {
+    if (appearingViewTransitions !== null) {
+      commitDeletedPairViewTransitions(deletion);
+    }
+  }
+}
+
+export function commitBeforeUpdateViewTransition(
+  current: Fiber,
+  finishedWork: Fiber,
+): void {
+  // The way we deal with multiple HostInstances as children of a View Transition in an
+  // update can get tricky. The important bit is that if you swap out n HostInstances
+  // from n HostInstances then they match up in order. Similarly, if you don't swap
+  // any HostInstances each instance just transitions as is.
+  //
+  // We call this function twice. First we apply the view transition names on the
+  // "current" tree in the snapshot phase. Then in the mutation phase we apply view
+  // transition names to the "finishedWork" tree.
+  //
+  // This means that if there were insertions or deletions before an updated Instance
+  // that same Instance might get different names in the "old" and the "new" state.
+  // For example if you swap two HostInstances inside a ViewTransition they don't
+  // animate to swap position but rather cross-fade into the other instance. This might
+  // be unexpected but it is in line with the semantics that the ViewTransition is its
+  // own layer that cross-fades its content when it updates. If you want to reorder then
+  // each child needs its own ViewTransition.
+  const oldProps: ViewTransitionProps = current.memoizedProps;
+  const oldName = getViewTransitionName(oldProps, current.stateNode);
+  const newProps: ViewTransitionProps = finishedWork.memoizedProps;
+  // This className applies only if there are fewer child DOM nodes than
+  // before or if this update should've been cancelled but we ended up with
+  // a parent animating so we need to animate the child too.
+  // For example, if update="foo" layout="none" and it turns out this was
+  // a layout only change, then the "foo" class will be applied even though
+  // it was not actually an update. Which is a bug.
+  let className: ?string = getViewTransitionClassName(
+    newProps.className,
+    newProps.update,
+  );
+  if (className === 'none') {
+    className = getViewTransitionClassName(newProps.className, newProps.layout);
+    if (className === 'none') {
+      // If both update and layout are both "none" then we don't have to
+      // apply a name. Since we won't animate this boundary.
+      return;
+    }
+  }
+  viewTransitionHostInstanceIdx = 0;
+  applyViewTransitionToHostInstances(
+    current.child,
+    oldName,
+    className,
+    (current.memoizedState = []),
+    true,
+  );
+}
+
+export function commitNestedViewTransitions(changedParent: Fiber): void {
+  let child = changedParent.child;
+  while (child !== null) {
+    if (child.tag === ViewTransitionComponent) {
+      // In this case the outer ViewTransition component wins but if there
+      // was an update through this component then the inner one wins.
+      const props: ViewTransitionProps = child.memoizedProps;
+      const name = getViewTransitionName(props, child.stateNode);
+      const className: ?string = getViewTransitionClassName(
+        props.className,
+        props.layout,
+      );
+      if (className !== 'none') {
+        viewTransitionHostInstanceIdx = 0;
+        applyViewTransitionToHostInstances(
+          child.child,
+          name,
+          className,
+          (child.memoizedState = []),
+          false,
+        );
+      }
+    } else if ((child.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
+      commitNestedViewTransitions(child);
+    }
+    child = child.sibling;
+  }
+}
+
+function restorePairedViewTransitions(parent: Fiber): void {
+  if ((parent.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
+    // This has no named view transitions in its subtree.
+    return;
+  }
+  let child = parent.child;
+  while (child !== null) {
+    if (child.tag === OffscreenComponent && child.memoizedState === null) {
+      // This tree was already hidden so we skip it.
+    } else {
+      if (
+        child.tag === ViewTransitionComponent &&
+        (child.flags & ViewTransitionNamedStatic) !== NoFlags
+      ) {
+        const instance: ViewTransitionState = child.stateNode;
+        if (instance.paired !== null) {
+          instance.paired = null;
+          restoreViewTransitionOnHostInstances(child.child, false);
+        }
+      }
+      restorePairedViewTransitions(child);
+    }
+    child = child.sibling;
+  }
+}
+
+export function restoreEnterViewTransitions(placement: Fiber): void {
+  if (placement.tag === ViewTransitionComponent) {
+    const instance: ViewTransitionState = placement.stateNode;
+    instance.paired = null;
+    restoreViewTransitionOnHostInstances(placement.child, false);
+    restorePairedViewTransitions(placement);
+  } else if ((placement.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
+    let child = placement.child;
+    while (child !== null) {
+      restoreEnterViewTransitions(child);
+      child = child.sibling;
+    }
+  } else {
+    restorePairedViewTransitions(placement);
+  }
+}
+
+export function restoreExitViewTransitions(deletion: Fiber): void {
+  if (deletion.tag === ViewTransitionComponent) {
+    const instance: ViewTransitionState = deletion.stateNode;
+    instance.paired = null;
+    restoreViewTransitionOnHostInstances(deletion.child, false);
+    restorePairedViewTransitions(deletion);
+  } else if ((deletion.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
+    let child = deletion.child;
+    while (child !== null) {
+      restoreExitViewTransitions(child);
+      child = child.sibling;
+    }
+  } else {
+    restorePairedViewTransitions(deletion);
+  }
+}
+
+export function restoreUpdateViewTransition(
+  current: Fiber,
+  finishedWork: Fiber,
+): void {
+  finishedWork.memoizedState = null;
+  restoreViewTransitionOnHostInstances(current.child, true);
+  restoreViewTransitionOnHostInstances(finishedWork.child, true);
+}
+
+export function restoreNestedViewTransitions(changedParent: Fiber): void {
+  let child = changedParent.child;
+  while (child !== null) {
+    if (child.tag === ViewTransitionComponent) {
+      child.memoizedState = null;
+      restoreViewTransitionOnHostInstances(child.child, false);
+    } else if ((child.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
+      restoreNestedViewTransitions(child);
+    }
+    child = child.sibling;
+  }
+}
+
+function cancelViewTransitionHostInstances(
+  currentViewTransition: Fiber,
+  child: null | Fiber,
+  stopAtNestedViewTransitions: boolean,
+): void {
+  if (!supportsMutation) {
+    return;
+  }
+  while (child !== null) {
+    if (child.tag === HostComponent) {
+      const instance: Instance = child.stateNode;
+      const oldName = getViewTransitionName(
+        currentViewTransition.memoizedProps,
+        currentViewTransition.stateNode,
+      );
+      if (viewTransitionCancelableChildren === null) {
+        viewTransitionCancelableChildren = [];
+      }
+      viewTransitionCancelableChildren.push(
+        instance,
+        oldName,
+        child.memoizedProps,
+      );
+      viewTransitionHostInstanceIdx++;
+    } else if (
+      child.tag === OffscreenComponent &&
+      child.memoizedState !== null
+    ) {
+      // Skip any hidden subtrees. They were or are effectively not there.
+    } else if (
+      child.tag === ViewTransitionComponent &&
+      stopAtNestedViewTransitions
+    ) {
+      // Skip any nested view transitions for updates since in that case the
+      // inner most one is the one that handles the update.
+    } else {
+      cancelViewTransitionHostInstances(
+        currentViewTransition,
+        child.child,
+        stopAtNestedViewTransitions,
+      );
+    }
+    child = child.sibling;
+  }
+}
+
+function measureViewTransitionHostInstances(
+  currentViewTransition: Fiber,
+  parentViewTransition: Fiber,
+  child: null | Fiber,
+  name: string,
+  className: ?string,
+  previousMeasurements: null | Array<InstanceMeasurement>,
+  stopAtNestedViewTransitions: boolean,
+): boolean {
+  if (!supportsMutation) {
+    return true;
+  }
+  let inViewport = false;
+  while (child !== null) {
+    if (child.tag === HostComponent) {
+      const instance: Instance = child.stateNode;
+      if (
+        previousMeasurements !== null &&
+        viewTransitionHostInstanceIdx < previousMeasurements.length
+      ) {
+        // The previous measurement of the Instance in this location within the ViewTransition.
+        // Note that this might not be the same exact Instance if the Instances within the
+        // ViewTransition changed.
+        const previousMeasurement =
+          previousMeasurements[viewTransitionHostInstanceIdx];
+        const nextMeasurement = measureInstance(instance);
+        if (
+          wasInstanceInViewport(previousMeasurement) ||
+          wasInstanceInViewport(nextMeasurement)
+        ) {
+          // If either the old or new state was within the viewport we have to animate this.
+          // But if it turns out that none of them were we'll be able to skip it.
+          inViewport = true;
+        }
+        if (
+          (parentViewTransition.flags & Update) === NoFlags &&
+          hasInstanceChanged(previousMeasurement, nextMeasurement)
+        ) {
+          parentViewTransition.flags |= Update;
+        }
+        if (hasInstanceAffectedParent(previousMeasurement, nextMeasurement)) {
+          // If this instance size within its parent has changed it might have caused the
+          // parent to relayout which needs a cross fade.
+          parentViewTransition.flags |= AffectedParentLayout;
+        }
+      } else {
+        // If there was an insertion of extra nodes, we have to assume they affected the parent.
+        // It should have already been marked as an Update due to the mutation.
+        parentViewTransition.flags |= AffectedParentLayout;
+      }
+      if ((parentViewTransition.flags & Update) !== NoFlags) {
+        // We might update this node so we need to apply its new name for the new state.
+        applyViewTransitionName(
+          instance,
+          viewTransitionHostInstanceIdx === 0
+            ? name
+            : // If we have multiple Host Instances below, we add a suffix to the name to give
+              // each one a unique name.
+              name + '_' + viewTransitionHostInstanceIdx,
+          className,
+        );
+      }
+      if (!inViewport || (parentViewTransition.flags & Update) === NoFlags) {
+        // It turns out that we had no other deeper mutations, the child transitions didn't
+        // affect the parent layout and this instance hasn't changed size. So we can skip
+        // animating it. However, in the current model this only works if the parent also
+        // doesn't animate. So we have to queue these and wait until we complete the parent
+        // to cancel them.
+        const oldName = getViewTransitionName(
+          currentViewTransition.memoizedProps,
+          currentViewTransition.stateNode,
+        );
+        if (viewTransitionCancelableChildren === null) {
+          viewTransitionCancelableChildren = [];
+        }
+        viewTransitionCancelableChildren.push(
+          instance,
+          oldName,
+          child.memoizedProps,
+        );
+      }
+      viewTransitionHostInstanceIdx++;
+    } else if (
+      child.tag === OffscreenComponent &&
+      child.memoizedState !== null
+    ) {
+      // Skip any hidden subtrees. They were or are effectively not there.
+    } else if (
+      child.tag === ViewTransitionComponent &&
+      stopAtNestedViewTransitions
+    ) {
+      // Skip any nested view transitions for updates since in that case the
+      // inner most one is the one that handles the update.
+      // If this inner boundary resized we need to bubble that information up.
+      parentViewTransition.flags |= child.flags & AffectedParentLayout;
+    } else {
+      if (
+        measureViewTransitionHostInstances(
+          currentViewTransition,
+          parentViewTransition,
+          child.child,
+          name,
+          className,
+          previousMeasurements,
+          stopAtNestedViewTransitions,
+        )
+      ) {
+        inViewport = true;
+      }
+    }
+    child = child.sibling;
+  }
+  return inViewport;
+}
+
+export function measureUpdateViewTransition(
+  current: Fiber,
+  finishedWork: Fiber,
+): boolean {
+  const props: ViewTransitionProps = finishedWork.memoizedProps;
+  const updateClassName: ?string = getViewTransitionClassName(
+    props.className,
+    props.update,
+  );
+  const layoutClassName: ?string = getViewTransitionClassName(
+    props.className,
+    props.layout,
+  );
+  let className: ?string;
+  if (updateClassName === 'none') {
+    if (layoutClassName === 'none') {
+      // If both update and layout class name were none, then we didn't apply any
+      // names in the before update phase so we shouldn't now neither.
+      return false;
+    }
+    // We don't care if this is mutated or children layout changed, but we still
+    // measure each instance to see if it moved and therefore should apply layout.
+    finishedWork.flags &= ~Update;
+    className = layoutClassName;
+  } else if ((finishedWork.flags & Update) !== NoFlags) {
+    // It was updated and we have an appropriate class name to apply.
+    className = updateClassName;
+  } else {
+    if (layoutClassName === 'none') {
+      // If we did not update, then all changes are considered a layout. We'll
+      // attempt to cancel.
+      viewTransitionHostInstanceIdx = 0;
+      cancelViewTransitionHostInstances(current, finishedWork.child, true);
+      return false;
+    }
+    // We didn't update but we might still apply layout so we measure each
+    // instance to see if it moved or resized.
+    className = layoutClassName;
+  }
+  const name = getViewTransitionName(props, finishedWork.stateNode);
+  // If nothing changed due to a mutation, or children changing size
+  // and the measurements end up unchanged, we should restore it to not animate.
+  viewTransitionHostInstanceIdx = 0;
+  const previousMeasurements = current.memoizedState;
+  const inViewport = measureViewTransitionHostInstances(
+    current,
+    finishedWork,
+    finishedWork.child,
+    name,
+    className,
+    previousMeasurements,
+    true,
+  );
+  const previousCount =
+    previousMeasurements === null ? 0 : previousMeasurements.length;
+  if (viewTransitionHostInstanceIdx !== previousCount) {
+    // If we found a different number of child DOM nodes we need to assume that
+    // the parent layout may have changed as a result. This is not necessarily
+    // true if those nodes were absolutely positioned.
+    finishedWork.flags |= AffectedParentLayout;
+  }
+  return inViewport;
+}
+
+export function measureNestedViewTransitions(changedParent: Fiber): void {
+  let child = changedParent.child;
+  while (child !== null) {
+    if (child.tag === ViewTransitionComponent) {
+      const current = child.alternate;
+      if (current !== null) {
+        const props: ViewTransitionProps = child.memoizedProps;
+        const name = getViewTransitionName(props, child.stateNode);
+        const className: ?string = getViewTransitionClassName(
+          props.className,
+          props.layout,
+        );
+        viewTransitionHostInstanceIdx = 0;
+        const inViewport = measureViewTransitionHostInstances(
+          current,
+          child,
+          child.child,
+          name,
+          className,
+          child.memoizedState,
+          false,
+        );
+        if ((child.flags & Update) === NoFlags || !inViewport) {
+          // Nothing changed.
+        } else {
+          scheduleViewTransitionEvent(child, props.onLayout);
+        }
+      }
+    } else if ((child.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
+      measureNestedViewTransitions(child);
+    }
+    child = child.sibling;
+  }
+}
diff --git a/packages/react-reconciler/src/ReactFiberCommitWork.js b/packages/react-reconciler/src/ReactFiberCommitWork.js
index 850f3c67067ff..f5d0987393046 100644
--- a/packages/react-reconciler/src/ReactFiberCommitWork.js
+++ b/packages/react-reconciler/src/ReactFiberCommitWork.js
@@ -14,7 +14,6 @@ import type {
   Container,
   HoistableRoot,
   FormInstance,
-  InstanceMeasurement,
   Props,
 } from './ReactFiberConfig';
 import type {Fiber, FiberRoot} from './ReactInternalTypes';
@@ -112,9 +111,7 @@ import {
   PerformedWork,
   ForceClientRender,
   DidCapture,
-  ViewTransitionStatic,
   AffectedParentLayout,
-  ViewTransitionNamedStatic,
 } from './ReactFiberFlags';
 import {
   commitStartTime,
@@ -163,15 +160,9 @@ import {
   suspendResource,
   resetFormInstance,
   registerSuspenseInstanceRetry,
-  applyViewTransitionName,
-  restoreViewTransitionName,
   cancelViewTransitionName,
   cancelRootViewTransitionName,
   restoreRootViewTransitionName,
-  measureInstance,
-  hasInstanceChanged,
-  hasInstanceAffectedParent,
-  wasInstanceInViewport,
   isSingletonScope,
 } from './ReactFiberConfig';
 import {
@@ -203,10 +194,6 @@ import {
   OffscreenDetached,
   OffscreenPassiveEffectsConnected,
 } from './ReactFiberActivityComponent';
-import {
-  getViewTransitionName,
-  getViewTransitionClassName,
-} from './ReactFiberViewTransitionComponent';
 import {
   TransitionRoot,
   TransitionTracingMarker,
@@ -249,6 +236,23 @@ import {
   commitHostSingletonAcquisition,
   commitHostSingletonRelease,
 } from './ReactFiberCommitHostEffects';
+import {
+  commitEnterViewTransitions,
+  commitExitViewTransitions,
+  commitBeforeUpdateViewTransition,
+  commitNestedViewTransitions,
+  restoreEnterViewTransitions,
+  restoreExitViewTransitions,
+  restoreUpdateViewTransition,
+  restoreNestedViewTransitions,
+  measureUpdateViewTransition,
+  measureNestedViewTransitions,
+  resetShouldStartViewTransition,
+  resetAppearingViewTransitions,
+  trackAppearingViewTransition,
+  viewTransitionCancelableChildren,
+  setViewTransitionCancelableChildren,
+} from './ReactFiberCommitViewTransitions';
 import {
   viewTransitionMutationContext,
   pushMutationContext,
@@ -274,19 +278,9 @@ let inProgressRoot: FiberRoot | null = null;
 let focusedInstanceHandle: null | Fiber = null;
 export let shouldFireAfterActiveInstanceBlur: boolean = false;
 
-export let shouldStartViewTransition: boolean = false;
-
-// This tracks named ViewTransition components found in the accumulateSuspenseyCommit
-// phase that might need to find deleted pairs in the beforeMutation phase.
-let appearingViewTransitions: Map<string, ViewTransitionState> | null = null;
-
 // Used during the commit phase to track whether a parent ViewTransition component
 // might have been affected by any mutations / relayouts below.
 let viewTransitionContextChanged: boolean = false;
-// We can't cancel view transition children until we know that their parent also
-// don't need to transition.
-let viewTransitionCancelableChildren: null | Array<Instance | string | Props> =
-  null; // tupled array where each entry is [instance: Instance, oldName: string, props: Props]
 
 export function commitBeforeMutationEffects(
   root: FiberRoot,
@@ -295,7 +289,8 @@ export function commitBeforeMutationEffects(
 ): void {
   focusedInstanceHandle = prepareForCommit(root.containerInfo);
   shouldFireAfterActiveInstanceBlur = false;
-  shouldStartViewTransition = false;
+
+  resetShouldStartViewTransition();
 
   const isViewTransitionEligible =
     enableViewTransition &&
@@ -307,7 +302,7 @@ export function commitBeforeMutationEffects(
   // We no longer need to track the active instance fiber
   focusedInstanceHandle = null;
   // We've found any matched pairs and can now reset.
-  appearingViewTransitions = null;
+  resetAppearingViewTransitions();
 }
 
 function commitBeforeMutationEffects_begin(isViewTransitionEligible: boolean) {
@@ -542,759 +537,6 @@ function commitBeforeMutationEffectsDeletion(
   }
 }
 
-let viewTransitionHostInstanceIdx = 0;
-
-function applyViewTransitionToHostInstances(
-  child: null | Fiber,
-  name: string,
-  className: ?string,
-  collectMeasurements: null | Array<InstanceMeasurement>,
-  stopAtNestedViewTransitions: boolean,
-): boolean {
-  if (!supportsMutation) {
-    return false;
-  }
-  let inViewport = false;
-  while (child !== null) {
-    if (child.tag === HostComponent) {
-      shouldStartViewTransition = true;
-      const instance: Instance = child.stateNode;
-      if (collectMeasurements !== null) {
-        const measurement = measureInstance(instance);
-        collectMeasurements.push(measurement);
-        if (wasInstanceInViewport(measurement)) {
-          inViewport = true;
-        }
-      } else if (!inViewport) {
-        if (wasInstanceInViewport(measureInstance(instance))) {
-          inViewport = true;
-        }
-      }
-      applyViewTransitionName(
-        instance,
-        viewTransitionHostInstanceIdx === 0
-          ? name
-          : // If we have multiple Host Instances below, we add a suffix to the name to give
-            // each one a unique name.
-            name + '_' + viewTransitionHostInstanceIdx,
-        className,
-      );
-      viewTransitionHostInstanceIdx++;
-    } else if (
-      child.tag === OffscreenComponent &&
-      child.memoizedState !== null
-    ) {
-      // Skip any hidden subtrees. They were or are effectively not there.
-    } else if (
-      child.tag === ViewTransitionComponent &&
-      stopAtNestedViewTransitions
-    ) {
-      // Skip any nested view transitions for updates since in that case the
-      // inner most one is the one that handles the update.
-    } else {
-      if (
-        applyViewTransitionToHostInstances(
-          child.child,
-          name,
-          className,
-          collectMeasurements,
-          stopAtNestedViewTransitions,
-        )
-      ) {
-        inViewport = true;
-      }
-    }
-    child = child.sibling;
-  }
-  return inViewport;
-}
-
-function restoreViewTransitionOnHostInstances(
-  child: null | Fiber,
-  stopAtNestedViewTransitions: boolean,
-): void {
-  if (!supportsMutation) {
-    return;
-  }
-  while (child !== null) {
-    if (child.tag === HostComponent) {
-      const instance: Instance = child.stateNode;
-      restoreViewTransitionName(instance, child.memoizedProps);
-    } else if (
-      child.tag === OffscreenComponent &&
-      child.memoizedState !== null
-    ) {
-      // Skip any hidden subtrees. They were or are effectively not there.
-    } else if (
-      child.tag === ViewTransitionComponent &&
-      stopAtNestedViewTransitions
-    ) {
-      // Skip any nested view transitions for updates since in that case the
-      // inner most one is the one that handles the update.
-    } else {
-      restoreViewTransitionOnHostInstances(
-        child.child,
-        stopAtNestedViewTransitions,
-      );
-    }
-    child = child.sibling;
-  }
-}
-
-function commitAppearingPairViewTransitions(placement: Fiber): void {
-  if ((placement.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
-    // This has no named view transitions in its subtree.
-    return;
-  }
-  let child = placement.child;
-  while (child !== null) {
-    if (child.tag === OffscreenComponent && child.memoizedState === null) {
-      // This tree was already hidden so we skip it.
-    } else {
-      commitAppearingPairViewTransitions(child);
-      if (
-        child.tag === ViewTransitionComponent &&
-        (child.flags & ViewTransitionNamedStatic) !== NoFlags
-      ) {
-        const instance: ViewTransitionState = child.stateNode;
-        if (instance.paired) {
-          const props: ViewTransitionProps = child.memoizedProps;
-          if (props.name == null || props.name === 'auto') {
-            throw new Error(
-              'Found a pair with an auto name. This is a bug in React.',
-            );
-          }
-          const name = props.name;
-          const className: ?string = getViewTransitionClassName(
-            props.className,
-            props.share,
-          );
-          if (className !== 'none') {
-            // We found a new appearing view transition with the same name as this deletion.
-            // We'll transition between them.
-            viewTransitionHostInstanceIdx = 0;
-            const inViewport = applyViewTransitionToHostInstances(
-              child.child,
-              name,
-              className,
-              null,
-              false,
-            );
-            if (!inViewport) {
-              // This boundary is exiting within the viewport but is going to leave the viewport.
-              // Instead, we treat this as an exit of the previous entry by reverting the new name.
-              // Ideally we could undo the old transition but it's now too late. It's also on its
-              // on snapshot. We have know was for it to paint onto the original group.
-              // TODO: This will lead to things unexpectedly having exit animations that normally
-              // wouldn't happen. Consider if we should just let this fly off the screen instead.
-              restoreViewTransitionOnHostInstances(child.child, false);
-            }
-          }
-        }
-      }
-    }
-    child = child.sibling;
-  }
-}
-
-function commitEnterViewTransitions(placement: Fiber): void {
-  if (placement.tag === ViewTransitionComponent) {
-    const state: ViewTransitionState = placement.stateNode;
-    const props: ViewTransitionProps = placement.memoizedProps;
-    const name = getViewTransitionName(props, state);
-    const className: ?string = getViewTransitionClassName(
-      props.className,
-      state.paired ? props.share : props.enter,
-    );
-    if (className !== 'none') {
-      viewTransitionHostInstanceIdx = 0;
-      const inViewport = applyViewTransitionToHostInstances(
-        placement.child,
-        name,
-        className,
-        null,
-        false,
-      );
-      if (!inViewport) {
-        // TODO: If this was part of a pair we will still run the onShare callback.
-        // Revert the transition names. This boundary is not in the viewport
-        // so we won't bother animating it.
-        restoreViewTransitionOnHostInstances(placement.child, false);
-        // TODO: Should we still visit the children in case a named one was in the viewport?
-      } else {
-        commitAppearingPairViewTransitions(placement);
-
-        if (!state.paired) {
-          scheduleViewTransitionEvent(placement, props.onEnter);
-        }
-      }
-    } else {
-      commitAppearingPairViewTransitions(placement);
-    }
-  } else if ((placement.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
-    let child = placement.child;
-    while (child !== null) {
-      commitEnterViewTransitions(child);
-      child = child.sibling;
-    }
-  } else {
-    commitAppearingPairViewTransitions(placement);
-  }
-}
-
-function commitDeletedPairViewTransitions(deletion: Fiber): void {
-  if (
-    appearingViewTransitions === null ||
-    appearingViewTransitions.size === 0
-  ) {
-    // We've found all.
-    return;
-  }
-  const pairs = appearingViewTransitions;
-  if ((deletion.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
-    // This has no named view transitions in its subtree.
-    return;
-  }
-  let child = deletion.child;
-  while (child !== null) {
-    if (child.tag === OffscreenComponent && child.memoizedState === null) {
-      // This tree was already hidden so we skip it.
-    } else {
-      if (
-        child.tag === ViewTransitionComponent &&
-        (child.flags & ViewTransitionNamedStatic) !== NoFlags
-      ) {
-        const props: ViewTransitionProps = child.memoizedProps;
-        const name = props.name;
-        if (name != null && name !== 'auto') {
-          const pair = pairs.get(name);
-          if (pair !== undefined) {
-            const className: ?string = getViewTransitionClassName(
-              props.className,
-              props.share,
-            );
-            if (className !== 'none') {
-              // We found a new appearing view transition with the same name as this deletion.
-              viewTransitionHostInstanceIdx = 0;
-              const inViewport = applyViewTransitionToHostInstances(
-                child.child,
-                name,
-                className,
-                null,
-                false,
-              );
-              if (!inViewport) {
-                // This boundary is not in the viewport so we won't treat it as a matched pair.
-                // Revert the transition names. This avoids it flying onto the screen which can
-                // be disruptive and doesn't really preserve any continuity anyway.
-                restoreViewTransitionOnHostInstances(child.child, false);
-              } else {
-                // We'll transition between them.
-                const oldinstance: ViewTransitionState = child.stateNode;
-                const newInstance: ViewTransitionState = pair;
-                newInstance.paired = oldinstance;
-                // Note: If the other side ends up outside the viewport, we'll still run this.
-                // Therefore it's possible for onShare to be called with only an old snapshot.
-                scheduleViewTransitionEvent(child, props.onShare);
-              }
-            }
-            // Delete the entry so that we know when we've found all of them
-            // and can stop searching (size reaches zero).
-            pairs.delete(name);
-            if (pairs.size === 0) {
-              break;
-            }
-          }
-        }
-      }
-      commitDeletedPairViewTransitions(child);
-    }
-    child = child.sibling;
-  }
-}
-
-function commitExitViewTransitions(deletion: Fiber): void {
-  if (deletion.tag === ViewTransitionComponent) {
-    const props: ViewTransitionProps = deletion.memoizedProps;
-    const name = getViewTransitionName(props, deletion.stateNode);
-    const pair =
-      appearingViewTransitions !== null
-        ? appearingViewTransitions.get(name)
-        : undefined;
-    const className: ?string = getViewTransitionClassName(
-      props.className,
-      pair !== undefined ? props.share : props.exit,
-    );
-    if (className !== 'none') {
-      viewTransitionHostInstanceIdx = 0;
-      const inViewport = applyViewTransitionToHostInstances(
-        deletion.child,
-        name,
-        className,
-        null,
-        false,
-      );
-      if (!inViewport) {
-        // Revert the transition names. This boundary is not in the viewport
-        // so we won't bother animating it.
-        restoreViewTransitionOnHostInstances(deletion.child, false);
-        // TODO: Should we still visit the children in case a named one was in the viewport?
-      } else if (pair !== undefined) {
-        // We found a new appearing view transition with the same name as this deletion.
-        // We'll transition between them instead of running the normal exit.
-        const oldinstance: ViewTransitionState = deletion.stateNode;
-        const newInstance: ViewTransitionState = pair;
-        newInstance.paired = oldinstance;
-        // Delete the entry so that we know when we've found all of them
-        // and can stop searching (size reaches zero).
-        // $FlowFixMe[incompatible-use]: Refined by the pair.
-        appearingViewTransitions.delete(name);
-        // Note: If the other side ends up outside the viewport, we'll still run this.
-        // Therefore it's possible for onShare to be called with only an old snapshot.
-        scheduleViewTransitionEvent(deletion, props.onShare);
-      } else {
-        scheduleViewTransitionEvent(deletion, props.onExit);
-      }
-    }
-    if (appearingViewTransitions !== null) {
-      // Look for more pairs deeper in the tree.
-      commitDeletedPairViewTransitions(deletion);
-    }
-  } else if ((deletion.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
-    let child = deletion.child;
-    while (child !== null) {
-      commitExitViewTransitions(child);
-      child = child.sibling;
-    }
-  } else {
-    if (appearingViewTransitions !== null) {
-      commitDeletedPairViewTransitions(deletion);
-    }
-  }
-}
-
-function commitBeforeUpdateViewTransition(
-  current: Fiber,
-  finishedWork: Fiber,
-): void {
-  // The way we deal with multiple HostInstances as children of a View Transition in an
-  // update can get tricky. The important bit is that if you swap out n HostInstances
-  // from n HostInstances then they match up in order. Similarly, if you don't swap
-  // any HostInstances each instance just transitions as is.
-  //
-  // We call this function twice. First we apply the view transition names on the
-  // "current" tree in the snapshot phase. Then in the mutation phase we apply view
-  // transition names to the "finishedWork" tree.
-  //
-  // This means that if there were insertions or deletions before an updated Instance
-  // that same Instance might get different names in the "old" and the "new" state.
-  // For example if you swap two HostInstances inside a ViewTransition they don't
-  // animate to swap position but rather cross-fade into the other instance. This might
-  // be unexpected but it is in line with the semantics that the ViewTransition is its
-  // own layer that cross-fades its content when it updates. If you want to reorder then
-  // each child needs its own ViewTransition.
-  const oldProps: ViewTransitionProps = current.memoizedProps;
-  const oldName = getViewTransitionName(oldProps, current.stateNode);
-  const newProps: ViewTransitionProps = finishedWork.memoizedProps;
-  // This className applies only if there are fewer child DOM nodes than
-  // before or if this update should've been cancelled but we ended up with
-  // a parent animating so we need to animate the child too.
-  // For example, if update="foo" layout="none" and it turns out this was
-  // a layout only change, then the "foo" class will be applied even though
-  // it was not actually an update. Which is a bug.
-  let className: ?string = getViewTransitionClassName(
-    newProps.className,
-    newProps.update,
-  );
-  if (className === 'none') {
-    className = getViewTransitionClassName(newProps.className, newProps.layout);
-    if (className === 'none') {
-      // If both update and layout are both "none" then we don't have to
-      // apply a name. Since we won't animate this boundary.
-      return;
-    }
-  }
-  viewTransitionHostInstanceIdx = 0;
-  applyViewTransitionToHostInstances(
-    current.child,
-    oldName,
-    className,
-    (current.memoizedState = []),
-    true,
-  );
-}
-
-function commitNestedViewTransitions(changedParent: Fiber): void {
-  let child = changedParent.child;
-  while (child !== null) {
-    if (child.tag === ViewTransitionComponent) {
-      // In this case the outer ViewTransition component wins but if there
-      // was an update through this component then the inner one wins.
-      const props: ViewTransitionProps = child.memoizedProps;
-      const name = getViewTransitionName(props, child.stateNode);
-      const className: ?string = getViewTransitionClassName(
-        props.className,
-        props.layout,
-      );
-      if (className !== 'none') {
-        viewTransitionHostInstanceIdx = 0;
-        applyViewTransitionToHostInstances(
-          child.child,
-          name,
-          className,
-          (child.memoizedState = []),
-          false,
-        );
-      }
-    } else if ((child.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
-      commitNestedViewTransitions(child);
-    }
-    child = child.sibling;
-  }
-}
-
-function restorePairedViewTransitions(parent: Fiber): void {
-  if ((parent.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
-    // This has no named view transitions in its subtree.
-    return;
-  }
-  let child = parent.child;
-  while (child !== null) {
-    if (child.tag === OffscreenComponent && child.memoizedState === null) {
-      // This tree was already hidden so we skip it.
-    } else {
-      if (
-        child.tag === ViewTransitionComponent &&
-        (child.flags & ViewTransitionNamedStatic) !== NoFlags
-      ) {
-        const instance: ViewTransitionState = child.stateNode;
-        if (instance.paired !== null) {
-          instance.paired = null;
-          restoreViewTransitionOnHostInstances(child.child, false);
-        }
-      }
-      restorePairedViewTransitions(child);
-    }
-    child = child.sibling;
-  }
-}
-
-function restoreEnterViewTransitions(placement: Fiber): void {
-  if (placement.tag === ViewTransitionComponent) {
-    const instance: ViewTransitionState = placement.stateNode;
-    instance.paired = null;
-    restoreViewTransitionOnHostInstances(placement.child, false);
-    restorePairedViewTransitions(placement);
-  } else if ((placement.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
-    let child = placement.child;
-    while (child !== null) {
-      restoreEnterViewTransitions(child);
-      child = child.sibling;
-    }
-  } else {
-    restorePairedViewTransitions(placement);
-  }
-}
-
-function restoreExitViewTransitions(deletion: Fiber): void {
-  if (deletion.tag === ViewTransitionComponent) {
-    const instance: ViewTransitionState = deletion.stateNode;
-    instance.paired = null;
-    restoreViewTransitionOnHostInstances(deletion.child, false);
-    restorePairedViewTransitions(deletion);
-  } else if ((deletion.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
-    let child = deletion.child;
-    while (child !== null) {
-      restoreExitViewTransitions(child);
-      child = child.sibling;
-    }
-  } else {
-    restorePairedViewTransitions(deletion);
-  }
-}
-
-function restoreUpdateViewTransition(
-  current: Fiber,
-  finishedWork: Fiber,
-): void {
-  finishedWork.memoizedState = null;
-  restoreViewTransitionOnHostInstances(current.child, true);
-  restoreViewTransitionOnHostInstances(finishedWork.child, true);
-}
-
-function restoreNestedViewTransitions(changedParent: Fiber): void {
-  let child = changedParent.child;
-  while (child !== null) {
-    if (child.tag === ViewTransitionComponent) {
-      child.memoizedState = null;
-      restoreViewTransitionOnHostInstances(child.child, false);
-    } else if ((child.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
-      restoreNestedViewTransitions(child);
-    }
-    child = child.sibling;
-  }
-}
-
-function cancelViewTransitionHostInstances(
-  currentViewTransition: Fiber,
-  child: null | Fiber,
-  stopAtNestedViewTransitions: boolean,
-): void {
-  if (!supportsMutation) {
-    return;
-  }
-  while (child !== null) {
-    if (child.tag === HostComponent) {
-      const instance: Instance = child.stateNode;
-      const oldName = getViewTransitionName(
-        currentViewTransition.memoizedProps,
-        currentViewTransition.stateNode,
-      );
-      if (viewTransitionCancelableChildren === null) {
-        viewTransitionCancelableChildren = [];
-      }
-      viewTransitionCancelableChildren.push(
-        instance,
-        oldName,
-        child.memoizedProps,
-      );
-      viewTransitionHostInstanceIdx++;
-    } else if (
-      child.tag === OffscreenComponent &&
-      child.memoizedState !== null
-    ) {
-      // Skip any hidden subtrees. They were or are effectively not there.
-    } else if (
-      child.tag === ViewTransitionComponent &&
-      stopAtNestedViewTransitions
-    ) {
-      // Skip any nested view transitions for updates since in that case the
-      // inner most one is the one that handles the update.
-    } else {
-      cancelViewTransitionHostInstances(
-        currentViewTransition,
-        child.child,
-        stopAtNestedViewTransitions,
-      );
-    }
-    child = child.sibling;
-  }
-}
-
-function measureViewTransitionHostInstances(
-  currentViewTransition: Fiber,
-  parentViewTransition: Fiber,
-  child: null | Fiber,
-  name: string,
-  className: ?string,
-  previousMeasurements: null | Array<InstanceMeasurement>,
-  stopAtNestedViewTransitions: boolean,
-): boolean {
-  if (!supportsMutation) {
-    return true;
-  }
-  let inViewport = false;
-  while (child !== null) {
-    if (child.tag === HostComponent) {
-      const instance: Instance = child.stateNode;
-      if (
-        previousMeasurements !== null &&
-        viewTransitionHostInstanceIdx < previousMeasurements.length
-      ) {
-        // The previous measurement of the Instance in this location within the ViewTransition.
-        // Note that this might not be the same exact Instance if the Instances within the
-        // ViewTransition changed.
-        const previousMeasurement =
-          previousMeasurements[viewTransitionHostInstanceIdx];
-        const nextMeasurement = measureInstance(instance);
-        if (
-          wasInstanceInViewport(previousMeasurement) ||
-          wasInstanceInViewport(nextMeasurement)
-        ) {
-          // If either the old or new state was within the viewport we have to animate this.
-          // But if it turns out that none of them were we'll be able to skip it.
-          inViewport = true;
-        }
-        if (
-          (parentViewTransition.flags & Update) === NoFlags &&
-          hasInstanceChanged(previousMeasurement, nextMeasurement)
-        ) {
-          parentViewTransition.flags |= Update;
-        }
-        if (hasInstanceAffectedParent(previousMeasurement, nextMeasurement)) {
-          // If this instance size within its parent has changed it might have caused the
-          // parent to relayout which needs a cross fade.
-          parentViewTransition.flags |= AffectedParentLayout;
-        }
-      } else {
-        // If there was an insertion of extra nodes, we have to assume they affected the parent.
-        // It should have already been marked as an Update due to the mutation.
-        parentViewTransition.flags |= AffectedParentLayout;
-      }
-      if ((parentViewTransition.flags & Update) !== NoFlags) {
-        // We might update this node so we need to apply its new name for the new state.
-        applyViewTransitionName(
-          instance,
-          viewTransitionHostInstanceIdx === 0
-            ? name
-            : // If we have multiple Host Instances below, we add a suffix to the name to give
-              // each one a unique name.
-              name + '_' + viewTransitionHostInstanceIdx,
-          className,
-        );
-      }
-      if (!inViewport || (parentViewTransition.flags & Update) === NoFlags) {
-        // It turns out that we had no other deeper mutations, the child transitions didn't
-        // affect the parent layout and this instance hasn't changed size. So we can skip
-        // animating it. However, in the current model this only works if the parent also
-        // doesn't animate. So we have to queue these and wait until we complete the parent
-        // to cancel them.
-        const oldName = getViewTransitionName(
-          currentViewTransition.memoizedProps,
-          currentViewTransition.stateNode,
-        );
-        if (viewTransitionCancelableChildren === null) {
-          viewTransitionCancelableChildren = [];
-        }
-        viewTransitionCancelableChildren.push(
-          instance,
-          oldName,
-          child.memoizedProps,
-        );
-      }
-      viewTransitionHostInstanceIdx++;
-    } else if (
-      child.tag === OffscreenComponent &&
-      child.memoizedState !== null
-    ) {
-      // Skip any hidden subtrees. They were or are effectively not there.
-    } else if (
-      child.tag === ViewTransitionComponent &&
-      stopAtNestedViewTransitions
-    ) {
-      // Skip any nested view transitions for updates since in that case the
-      // inner most one is the one that handles the update.
-      // If this inner boundary resized we need to bubble that information up.
-      parentViewTransition.flags |= child.flags & AffectedParentLayout;
-    } else {
-      if (
-        measureViewTransitionHostInstances(
-          currentViewTransition,
-          parentViewTransition,
-          child.child,
-          name,
-          className,
-          previousMeasurements,
-          stopAtNestedViewTransitions,
-        )
-      ) {
-        inViewport = true;
-      }
-    }
-    child = child.sibling;
-  }
-  return inViewport;
-}
-
-function measureUpdateViewTransition(
-  current: Fiber,
-  finishedWork: Fiber,
-): boolean {
-  const props: ViewTransitionProps = finishedWork.memoizedProps;
-  const updateClassName: ?string = getViewTransitionClassName(
-    props.className,
-    props.update,
-  );
-  const layoutClassName: ?string = getViewTransitionClassName(
-    props.className,
-    props.layout,
-  );
-  let className: ?string;
-  if (updateClassName === 'none') {
-    if (layoutClassName === 'none') {
-      // If both update and layout class name were none, then we didn't apply any
-      // names in the before update phase so we shouldn't now neither.
-      return false;
-    }
-    // We don't care if this is mutated or children layout changed, but we still
-    // measure each instance to see if it moved and therefore should apply layout.
-    finishedWork.flags &= ~Update;
-    className = layoutClassName;
-  } else if ((finishedWork.flags & Update) !== NoFlags) {
-    // It was updated and we have an appropriate class name to apply.
-    className = updateClassName;
-  } else {
-    if (layoutClassName === 'none') {
-      // If we did not update, then all changes are considered a layout. We'll
-      // attempt to cancel.
-      viewTransitionHostInstanceIdx = 0;
-      cancelViewTransitionHostInstances(current, finishedWork.child, true);
-      return false;
-    }
-    // We didn't update but we might still apply layout so we measure each
-    // instance to see if it moved or resized.
-    className = layoutClassName;
-  }
-  const name = getViewTransitionName(props, finishedWork.stateNode);
-  // If nothing changed due to a mutation, or children changing size
-  // and the measurements end up unchanged, we should restore it to not animate.
-  viewTransitionHostInstanceIdx = 0;
-  const previousMeasurements = current.memoizedState;
-  const inViewport = measureViewTransitionHostInstances(
-    current,
-    finishedWork,
-    finishedWork.child,
-    name,
-    className,
-    previousMeasurements,
-    true,
-  );
-  const previousCount =
-    previousMeasurements === null ? 0 : previousMeasurements.length;
-  if (viewTransitionHostInstanceIdx !== previousCount) {
-    // If we found a different number of child DOM nodes we need to assume that
-    // the parent layout may have changed as a result. This is not necessarily
-    // true if those nodes were absolutely positioned.
-    finishedWork.flags |= AffectedParentLayout;
-  }
-  return inViewport;
-}
-
-function measureNestedViewTransitions(changedParent: Fiber): void {
-  let child = changedParent.child;
-  while (child !== null) {
-    if (child.tag === ViewTransitionComponent) {
-      const current = child.alternate;
-      if (current !== null) {
-        const props: ViewTransitionProps = child.memoizedProps;
-        const name = getViewTransitionName(props, child.stateNode);
-        const className: ?string = getViewTransitionClassName(
-          props.className,
-          props.layout,
-        );
-        viewTransitionHostInstanceIdx = 0;
-        const inViewport = measureViewTransitionHostInstances(
-          current,
-          child,
-          child.child,
-          name,
-          className,
-          child.memoizedState,
-          false,
-        );
-        if ((child.flags & Update) === NoFlags || !inViewport) {
-          // Nothing changed.
-        } else {
-          scheduleViewTransitionEvent(child, props.onLayout);
-        }
-      }
-    } else if ((child.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
-      measureNestedViewTransitions(child);
-    }
-    child = child.sibling;
-  }
-}
-
 function commitLayoutEffectOnFiber(
   finishedRoot: FiberRoot,
   current: Fiber | null,
@@ -3204,14 +2446,14 @@ function commitAfterMutationEffectsOnFiber(
   switch (finishedWork.tag) {
     case HostRoot: {
       viewTransitionContextChanged = false;
-      viewTransitionCancelableChildren = null;
+      setViewTransitionCancelableChildren(null);
       recursivelyTraverseAfterMutationEffects(root, finishedWork, lanes);
       if (!viewTransitionContextChanged) {
         // If we didn't leak any resizing out to the root, we don't have to transition
         // the root itself. This means that we can now safely cancel any cancellations
         // that bubbled all the way up.
         const cancelableChildren = viewTransitionCancelableChildren;
-        viewTransitionCancelableChildren = null;
+        setViewTransitionCancelableChildren(null);
         if (cancelableChildren !== null) {
           for (let i = 0; i < cancelableChildren.length; i += 3) {
             cancelViewTransitionName(
@@ -3264,7 +2506,7 @@ function commitAfterMutationEffectsOnFiber(
         const prevContextChanged = viewTransitionContextChanged;
         const prevCancelableChildren = viewTransitionCancelableChildren;
         viewTransitionContextChanged = false;
-        viewTransitionCancelableChildren = null;
+        setViewTransitionCancelableChildren(null);
         recursivelyTraverseAfterMutationEffects(root, finishedWork, lanes);
 
         if (viewTransitionContextChanged) {
@@ -3287,7 +2529,7 @@ function commitAfterMutationEffectsOnFiber(
               prevCancelableChildren,
               viewTransitionCancelableChildren,
             );
-            viewTransitionCancelableChildren = prevCancelableChildren;
+            setViewTransitionCancelableChildren(prevCancelableChildren);
           }
           // TODO: If this doesn't end up canceled, because a parent animates,
           // then we should probably issue an event since this instance is part of it.
@@ -3301,7 +2543,7 @@ function commitAfterMutationEffectsOnFiber(
           );
 
           // If this boundary did update, we cannot cancel its children so those are dropped.
-          viewTransitionCancelableChildren = prevCancelableChildren;
+          setViewTransitionCancelableChildren(prevCancelableChildren);
         }
 
         if ((finishedWork.flags & AffectedParentLayout) !== NoFlags) {
@@ -4810,7 +4052,7 @@ export function commitPassiveUnmountEffects(finishedWork: Fiber): void {
 // pairs.
 let suspenseyCommitFlag = ShouldSuspendCommit;
 export function accumulateSuspenseyCommit(finishedWork: Fiber): void {
-  appearingViewTransitions = null;
+  resetAppearingViewTransitions();
   accumulateSuspenseyCommitOnFiber(finishedWork);
 }
 
@@ -4897,14 +4139,11 @@ function accumulateSuspenseyCommitOnFiber(fiber: Fiber) {
           if (name != null && name !== 'auto') {
             // This is a named ViewTransition being mounted or reappearing. Let's add it to
             // the map so we can match it with deletions later.
-            if (appearingViewTransitions === null) {
-              appearingViewTransitions = new Map();
-            }
+            const state: ViewTransitionState = fiber.stateNode;
             // Reset the pair in case we didn't end up restoring the instance in previous commits.
             // This shouldn't really happen anymore but just in case. We could maybe add an invariant.
-            const instance: ViewTransitionState = fiber.stateNode;
-            instance.paired = null;
-            appearingViewTransitions.set(name, instance);
+            state.paired = null;
+            trackAppearingViewTransition(name, state);
           }
         }
         recursivelyAccumulateSuspenseyCommit(fiber);
diff --git a/packages/react-reconciler/src/ReactFiberWorkLoop.js b/packages/react-reconciler/src/ReactFiberWorkLoop.js
index b3d1e5371c06c..d5ef003e3dc61 100644
--- a/packages/react-reconciler/src/ReactFiberWorkLoop.js
+++ b/packages/react-reconciler/src/ReactFiberWorkLoop.js
@@ -226,8 +226,8 @@ import {
   invokeLayoutEffectUnmountInDEV,
   invokePassiveEffectUnmountInDEV,
   accumulateSuspenseyCommit,
-  shouldStartViewTransition,
 } from './ReactFiberCommitWork';
+import {shouldStartViewTransition} from './ReactFiberCommitViewTransitions';
 import {enqueueUpdate} from './ReactFiberClassUpdateQueue';
 import {resetContextDependencies} from './ReactFiberNewContext';
 import {

From 92e65ca68f6bfc6be515ccacaa918e33b63911df Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 25 Feb 2025 18:55:49 -0500
Subject: [PATCH 61/73] [forgive] Add basic codelens provider (#32476)
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit

Adds a first codelens provider for successfully compiled functions. A
later PR will add an actual command that will fire when the codelens is
clicked

![Screenshot 2025-02-25 at 6 40
20 PM](https://github.com/user-attachments/assets/924586e0-f70a-45d1-b0e6-a89af9371c8d)
---
 .../src/Entrypoint/Options.ts                 | 77 ++++++++++--------
 .../server/src/compiler/compat.ts             | 22 +++++
 .../server/src/compiler/index.ts              | 12 ++-
 .../react-forgive/server/src/index.ts         | 80 +++++++++++++------
 4 files changed, 129 insertions(+), 62 deletions(-)
 create mode 100644 compiler/packages/react-forgive/server/src/compiler/compat.ts

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
index 35c2c4134eb44..781abd05f35da 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
@@ -176,41 +176,48 @@ export type CompilationMode = z.infer<typeof CompilationModeSchema>;
  *   babel or other unhandled exceptions).
  */
 export type LoggerEvent =
-  | {
-      kind: 'CompileError';
-      fnLoc: t.SourceLocation | null;
-      detail: CompilerErrorDetailOptions;
-    }
-  | {
-      kind: 'CompileDiagnostic';
-      fnLoc: t.SourceLocation | null;
-      detail: Omit<Omit<CompilerErrorDetailOptions, 'severity'>, 'suggestions'>;
-    }
-  | {
-      kind: 'CompileSkip';
-      fnLoc: t.SourceLocation | null;
-      reason: string;
-      loc: t.SourceLocation | null;
-    }
-  | {
-      kind: 'CompileSuccess';
-      fnLoc: t.SourceLocation | null;
-      fnName: string | null;
-      memoSlots: number;
-      memoBlocks: number;
-      memoValues: number;
-      prunedMemoBlocks: number;
-      prunedMemoValues: number;
-    }
-  | {
-      kind: 'PipelineError';
-      fnLoc: t.SourceLocation | null;
-      data: string;
-    }
-  | {
-      kind: 'Timing';
-      measurement: PerformanceMeasure;
-    };
+  | CompileSuccessEvent
+  | CompileErrorEvent
+  | CompileDiagnosticEvent
+  | CompileSkipEvent
+  | PipelineErrorEvent
+  | TimingEvent;
+
+export type CompileErrorEvent = {
+  kind: 'CompileError';
+  fnLoc: t.SourceLocation | null;
+  detail: CompilerErrorDetailOptions;
+};
+export type CompileDiagnosticEvent = {
+  kind: 'CompileDiagnostic';
+  fnLoc: t.SourceLocation | null;
+  detail: Omit<Omit<CompilerErrorDetailOptions, 'severity'>, 'suggestions'>;
+};
+export type CompileSuccessEvent = {
+  kind: 'CompileSuccess';
+  fnLoc: t.SourceLocation | null;
+  fnName: string | null;
+  memoSlots: number;
+  memoBlocks: number;
+  memoValues: number;
+  prunedMemoBlocks: number;
+  prunedMemoValues: number;
+};
+export type CompileSkipEvent = {
+  kind: 'CompileSkip';
+  fnLoc: t.SourceLocation | null;
+  reason: string;
+  loc: t.SourceLocation | null;
+};
+export type PipelineErrorEvent = {
+  kind: 'PipelineError';
+  fnLoc: t.SourceLocation | null;
+  data: string;
+};
+export type TimingEvent = {
+  kind: 'Timing';
+  measurement: PerformanceMeasure;
+};
 
 export type Logger = {
   logEvent: (filename: string | null, event: LoggerEvent) => void;
diff --git a/compiler/packages/react-forgive/server/src/compiler/compat.ts b/compiler/packages/react-forgive/server/src/compiler/compat.ts
new file mode 100644
index 0000000000000..8b13f1df886ea
--- /dev/null
+++ b/compiler/packages/react-forgive/server/src/compiler/compat.ts
@@ -0,0 +1,22 @@
+import {SourceLocation} from 'babel-plugin-react-compiler/src';
+import {type Range} from 'vscode-languageserver';
+
+export function babelLocationToRange(loc: SourceLocation): Range | null {
+  if (typeof loc === 'symbol') {
+    return null;
+  }
+  return {
+    start: {line: loc.start.line - 1, character: loc.start.column},
+    end: {line: loc.end.line - 1, character: loc.end.column},
+  };
+}
+
+/**
+ * Refine range to only the first character.
+ */
+export function getRangeFirstCharacter(range: Range): Range {
+  return {
+    start: range.start,
+    end: range.start,
+  };
+}
diff --git a/compiler/packages/react-forgive/server/src/compiler/index.ts b/compiler/packages/react-forgive/server/src/compiler/index.ts
index be2cca94ca154..3723785cfbebd 100644
--- a/compiler/packages/react-forgive/server/src/compiler/index.ts
+++ b/compiler/packages/react-forgive/server/src/compiler/index.ts
@@ -11,10 +11,12 @@ import BabelPluginReactCompiler, {
   type PluginOptions,
 } from 'babel-plugin-react-compiler/src';
 import * as babelParser from 'prettier/plugins/babel.js';
-import * as estreeParser from 'prettier/plugins/estree';
+import estreeParser from 'prettier/plugins/estree';
 import * as typescriptParser from 'prettier/plugins/typescript';
 import * as prettier from 'prettier/standalone';
 
+export let lastResult: BabelCore.BabelFileResult | null = null;
+
 type CompileOptions = {
   text: string;
   file: string;
@@ -24,7 +26,7 @@ export async function compile({
   text,
   file,
   options,
-}: CompileOptions): Promise<BabelCore.BabelFileResult> {
+}: CompileOptions): Promise<BabelCore.BabelFileResult | null> {
   const ast = await parseAsync(text, {
     sourceFileName: file,
     parserOpts: {
@@ -32,6 +34,9 @@ export async function compile({
     },
     sourceType: 'module',
   });
+  if (ast == null) {
+    return null;
+  }
   const plugins =
     options != null
       ? [[BabelPluginReactCompiler, options]]
@@ -54,5 +59,8 @@ export async function compile({
     parser: 'babel-ts',
     plugins: [babelParser, estreeParser, typescriptParser],
   });
+  if (result.code != null) {
+    lastResult = result;
+  }
   return result;
 }
diff --git a/compiler/packages/react-forgive/server/src/index.ts b/compiler/packages/react-forgive/server/src/index.ts
index 057df617c8d10..395969c5e06bf 100644
--- a/compiler/packages/react-forgive/server/src/index.ts
+++ b/compiler/packages/react-forgive/server/src/index.ts
@@ -7,6 +7,7 @@
 
 import {TextDocument} from 'vscode-languageserver-textdocument';
 import {
+  CodeLens,
   createConnection,
   type InitializeParams,
   type InitializeResult,
@@ -14,10 +15,15 @@ import {
   TextDocuments,
   TextDocumentSyncKind,
 } from 'vscode-languageserver/node';
-import {compile} from './compiler';
+import {compile, lastResult} from './compiler';
 import {type PluginOptions} from 'babel-plugin-react-compiler/src';
 import {resolveReactConfig} from './compiler/options';
-import {type BabelFileResult} from '@babel/core';
+import {
+  CompileSuccessEvent,
+  defaultOptions,
+  LoggerEvent,
+} from 'babel-plugin-react-compiler/src/Entrypoint/Options';
+import {babelLocationToRange, getRangeFirstCharacter} from './compiler/compat';
 
 const SUPPORTED_LANGUAGE_IDS = new Set([
   'javascript',
@@ -30,11 +36,21 @@ const connection = createConnection(ProposedFeatures.all);
 const documents = new TextDocuments(TextDocument);
 
 let compilerOptions: PluginOptions | null = null;
-let lastResult: BabelFileResult | null = null;
+let compiledFns: Set<CompileSuccessEvent> = new Set();
 
 connection.onInitialize((_params: InitializeParams) => {
   // TODO(@poteto) get config fr
-  compilerOptions = resolveReactConfig('.');
+  compilerOptions = resolveReactConfig('.') ?? defaultOptions;
+  compilerOptions = {
+    ...compilerOptions,
+    logger: {
+      logEvent(_filename: string | null, event: LoggerEvent) {
+        if (event.kind === 'CompileSuccess') {
+          compiledFns.add(event);
+        }
+      },
+    },
+  };
   const result: InitializeResult = {
     capabilities: {
       textDocumentSync: TextDocumentSyncKind.Full,
@@ -48,44 +64,58 @@ connection.onInitialized(() => {
   connection.console.log('initialized');
 });
 
-documents.onDidOpen(async event => {
-  if (SUPPORTED_LANGUAGE_IDS.has(event.document.languageId)) {
-    const text = event.document.getText();
-    const result = await compile({
-      text,
-      file: event.document.uri,
-      options: compilerOptions,
-    });
-    if (result.code != null) {
-      lastResult = result;
-    }
-  }
-});
-
 documents.onDidChangeContent(async event => {
+  connection.console.info(`Changed: ${event.document.uri}`);
+  compiledFns.clear();
   if (SUPPORTED_LANGUAGE_IDS.has(event.document.languageId)) {
     const text = event.document.getText();
-    const result = await compile({
+    await compile({
       text,
       file: event.document.uri,
       options: compilerOptions,
     });
-    if (result.code != null) {
-      lastResult = result;
-    }
   }
 });
 
 connection.onDidChangeWatchedFiles(change => {
+  compiledFns.clear();
   connection.console.log(
     change.changes.map(c => `File changed: ${c.uri}`).join('\n'),
   );
 });
 
 connection.onCodeLens(params => {
-  connection.console.log('lastResult: ' + JSON.stringify(lastResult, null, 2));
-  connection.console.log('params: ' + JSON.stringify(params, null, 2));
-  return [];
+  connection.console.info(`Handling codelens for: ${params.textDocument.uri}`);
+  if (compiledFns.size === 0) {
+    return;
+  }
+  const lenses: Array<CodeLens> = [];
+  for (const compiled of compiledFns) {
+    if (compiled.fnLoc != null) {
+      const fnLoc = babelLocationToRange(compiled.fnLoc);
+      if (fnLoc === null) continue;
+      const lens = CodeLens.create(
+        getRangeFirstCharacter(fnLoc),
+        compiled.fnLoc,
+      );
+      if (lastResult?.code != null) {
+        lens.command = {
+          title: 'Optimized by React Compiler',
+          command: 'todo',
+        };
+      }
+      lenses.push(lens);
+    }
+  }
+  return lenses;
+});
+
+connection.onCodeLensResolve(lens => {
+  connection.console.info(`Resolving codelens for: ${JSON.stringify(lens)}`);
+  if (lastResult?.code != null) {
+    connection.console.log(lastResult.code);
+  }
+  return lens;
 });
 
 documents.listen(connection);

From ebc22ef7e15bf38dc91b7033782cedc2f43f7d6e Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 25 Feb 2025 19:09:21 -0500
Subject: [PATCH 62/73] [forgive][ez] Ignore test file (#32477)

---
 compiler/packages/react-forgive/.vscodeignore | 1 +
 1 file changed, 1 insertion(+)

diff --git a/compiler/packages/react-forgive/.vscodeignore b/compiler/packages/react-forgive/.vscodeignore
index 91f9572794cd5..9ef76302ed597 100644
--- a/compiler/packages/react-forgive/.vscodeignore
+++ b/compiler/packages/react-forgive/.vscodeignore
@@ -2,3 +2,4 @@
 client
 server
 scripts
+.vscode-test.mjs

From 2df96224779237f532ca64c8c7e8a8605c06f067 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Thu, 27 Feb 2025 11:24:30 -0500
Subject: [PATCH 63/73] [release] Update publishing scripts to make publishing
 allowlisted packages easier (#32486)

It's getting unwieldy to list every single package to skip in these
commands when you only want to publish one, ie
eslint-plugin-react-hooks.

This adds a new `onlyPackages` and `publishVersion` option to the
publish commands to make that easier.
---
 .../parse-params.js                                  |  7 +++++++
 scripts/release/prepare-release-from-npm.js          |  3 +++
 scripts/release/publish-commands/parse-params.js     | 12 ++++++++++++
 scripts/release/publish.js                           | 12 +++++++++---
 4 files changed, 31 insertions(+), 3 deletions(-)

diff --git a/scripts/release/prepare-release-from-npm-commands/parse-params.js b/scripts/release/prepare-release-from-npm-commands/parse-params.js
index b9aa1a4f5e7e8..b08d81e89dc18 100644
--- a/scripts/release/prepare-release-from-npm-commands/parse-params.js
+++ b/scripts/release/prepare-release-from-npm-commands/parse-params.js
@@ -13,6 +13,13 @@ const paramDefinitions = [
       'Skip NPM and use the build already present in "build/node_modules".',
     defaultValue: false,
   },
+  {
+    name: 'onlyPackages',
+    type: String,
+    multiple: true,
+    description: 'Packages to include in publishing',
+    defaultValue: [],
+  },
   {
     name: 'skipPackages',
     type: String,
diff --git a/scripts/release/prepare-release-from-npm.js b/scripts/release/prepare-release-from-npm.js
index e23ffb39bc1c0..8220fda220b65 100755
--- a/scripts/release/prepare-release-from-npm.js
+++ b/scripts/release/prepare-release-from-npm.js
@@ -28,6 +28,9 @@ const run = async () => {
 
     params.packages = await getPublicPackages(isExperimental);
     params.packages = params.packages.filter(packageName => {
+      if (params.onlyPackages.length > 0) {
+        return params.onlyPackages.includes(packageName);
+      }
       return !params.skipPackages.includes(packageName);
     });
 
diff --git a/scripts/release/publish-commands/parse-params.js b/scripts/release/publish-commands/parse-params.js
index b7196447d4da8..ce9a9b7825c1a 100644
--- a/scripts/release/publish-commands/parse-params.js
+++ b/scripts/release/publish-commands/parse-params.js
@@ -19,6 +19,13 @@ const paramDefinitions = [
     description: 'NPM tags to point to the new release.',
     defaultValue: ['untagged'],
   },
+  {
+    name: 'onlyPackages',
+    type: String,
+    multiple: true,
+    description: 'Packages to include in publishing',
+    defaultValue: [],
+  },
   {
     name: 'skipPackages',
     type: String,
@@ -32,6 +39,11 @@ const paramDefinitions = [
     description: 'Run in automated environment, without interactive prompts.',
     defaultValue: false,
   },
+  {
+    name: 'publishVersion',
+    type: String,
+    description: 'Version to publish',
+  },
 ];
 
 module.exports = () => {
diff --git a/scripts/release/publish.js b/scripts/release/publish.js
index dcd31f1de7796..87b9940636b18 100755
--- a/scripts/release/publish.js
+++ b/scripts/release/publish.js
@@ -23,14 +23,20 @@ const run = async () => {
   try {
     const params = parseParams();
 
-    const version = readJsonSync(
-      './build/node_modules/react/package.json'
-    ).version;
+    const version =
+      params.publishVersion ??
+      readJsonSync('./build/node_modules/react/package.json').version;
     const isExperimental = version.includes('experimental');
 
     params.cwd = join(__dirname, '..', '..');
     params.packages = await getPublicPackages(isExperimental);
 
+    if (params.onlyPackages.length > 0) {
+      params.packages = params.packages.filter(packageName => {
+        return params.onlyPackages.includes(packageName);
+      });
+    }
+
     // Pre-filter any skipped packages to simplify the following commands.
     // As part of doing this we can also validate that none of the skipped packages were misspelled.
     params.skipPackages.forEach(packageName => {

From 227e8414cc5af227b5de339cace2447d4a81c995 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Thu, 27 Feb 2025 13:07:52 -0500
Subject: [PATCH 64/73] [ci] Add workflow to publish releases (#32487)

Adds a new workflow to publish runtime releases from NPM. Note that I
commented out the actual publish command so I can test it out first.
---
 .../runtime_releases_from_npm_manual.yml      | 91 +++++++++++++++++++
 1 file changed, 91 insertions(+)
 create mode 100644 .github/workflows/runtime_releases_from_npm_manual.yml

diff --git a/.github/workflows/runtime_releases_from_npm_manual.yml b/.github/workflows/runtime_releases_from_npm_manual.yml
new file mode 100644
index 0000000000000..0851b38ff97b0
--- /dev/null
+++ b/.github/workflows/runtime_releases_from_npm_manual.yml
@@ -0,0 +1,91 @@
+name: (Runtime) Publish Releases from NPM Manual
+
+on:
+  workflow_dispatch:
+    inputs:
+      version_to_promote:
+        required: true
+        description: Current npm version (non-experimental) to promote
+        type: string
+      version_to_publish:
+        required: true
+        description: Version to publish for the specified packages
+        type: string
+      only_packages:
+        description: Space separated list of packages to publish on NPM. Use this OR skip_packages, not together.
+        type: string
+      skip_packages:
+        description: Space separated list of packages to NOT publish on NPM. Use this OR only_packages, not together.
+        type: string
+      tags:
+        description: Space separated list of tags to tag the release with on NPM
+        type: string
+        default: "['untagged']"
+      dry:
+        required: true
+        description: Don't actually publish, just run a dry run
+        type: boolean
+        default: true
+      force_notify:
+        description: Force a Discord notification
+        type: boolean
+        default: false
+
+env:
+  TZ: /usr/share/zoneinfo/America/Los_Angeles
+  # https://github.com/actions/cache/blob/main/tips-and-workarounds.md#cache-segment-restore-timeout
+  SEGMENT_DOWNLOAD_TIMEOUT_MINS: 1
+  GH_TOKEN: ${{ github.token }}
+  NPM_TOKEN: ${{ secrets.NPM_TOKEN }}
+
+jobs:
+  notify:
+    if: ${{ inputs.force_notify || inputs.dry == false || inputs.dry == 'false' }}
+    runs-on: ubuntu-latest
+    steps:
+      - name: Discord Webhook Action
+        uses: tsickert/discord-webhook@v6.0.0
+        with:
+          webhook-url: ${{ secrets.DISCORD_WEBHOOK_URL }}
+          embed-author-name: ${{ github.event.sender.login }}
+          embed-author-url: ${{ github.event.sender.html_url }}
+          embed-author-icon-url: ${{ github.event.sender.avatar_url }}
+          embed-title: '⚠️ Publishing release from NPM'
+          embed-description: |
+            ```
+            inputs: ${{ toJson(inputs) }}
+            ```
+          embed-url: https://github.com/facebook/react/actions/runs/${{ github.run_id }}
+
+  publish:
+    name: Publish releases
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v4
+      - uses: actions/setup-node@v4
+        with:
+          node-version-file: '.nvmrc'
+          cache: yarn
+          cache-dependency-path: yarn.lock
+      - name: Restore cached node_modules
+        uses: actions/cache@v4
+        id: node_modules
+        with:
+          path: "**/node_modules"
+          key: runtime-release-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock', 'scripts/release/yarn.lock') }}
+      - name: Ensure clean build directory
+        run: rm -rf build
+      - run: yarn install --frozen-lockfile
+      - run: yarn install --frozen-lockfile
+        working-directory: scripts/release
+      - run: cp ./scripts/release/ci-npmrc ~/.npmrc
+      - if: '${{ inputs.only_packages }}'
+        run: |
+          scripts/release/prepare-release-from-npm.js --skipTests --version=${{ inputs.version_to_promote }} --onlyPackages=${{ inputs.only_packages }}
+          ls -R build/node_modules
+          # scripts/release/publish.js --ci --tags=${{ inputs.tags }} --publishVersion=${{ inputs.version_to_publish }} --onlyPackages=${{ inputs.only_packages }} --dry=${{ inputs.dry || 'false' }}
+      - if: '${{ inputs.skip_packages }}'
+        run: |
+          scripts/release/prepare-release-from-npm.js --skipTests --version=${{ inputs.version_to_promote }} --skipPackages=${{ inputs.skip_packages }}
+          ls -R build/node_modules
+          # scripts/release/publish.js --ci --tags=${{ inputs.tags }} --publishVersion=${{ inputs.version_to_publish }} --skipPackages=${{ inputs.skip_packages }} --dry=${{ inputs.dry || 'false' }}

From 4c9392b43e9f39e17c18ef1c2cd0f0a14e85669c Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Thu, 27 Feb 2025 15:24:57 -0500
Subject: [PATCH 65/73] [ci] Prepare publish workflow (#32488)

Fixes up a few things in the script and workflow to make it possible to
run in CI without interactive prompts.
---
 .../runtime_releases_from_npm_manual.yml      | 56 +++++++++++----
 .../confirm-stable-version-numbers.js         | 72 ++++++++++---------
 .../guess-stable-version-numbers.js           | 56 +++++++++------
 .../parse-params.js                           | 11 +++
 .../update-stable-version-numbers.js          | 10 ++-
 scripts/release/prepare-release-from-npm.js   |  7 ++
 .../confirm-version-and-tags.js               |  3 +
 .../publish-commands/publish-to-npm.js        |  4 +-
 scripts/release/publish.js                    |  7 ++
 9 files changed, 154 insertions(+), 72 deletions(-)

diff --git a/.github/workflows/runtime_releases_from_npm_manual.yml b/.github/workflows/runtime_releases_from_npm_manual.yml
index 0851b38ff97b0..2759b4e4d8737 100644
--- a/.github/workflows/runtime_releases_from_npm_manual.yml
+++ b/.github/workflows/runtime_releases_from_npm_manual.yml
@@ -12,22 +12,22 @@ on:
         description: Version to publish for the specified packages
         type: string
       only_packages:
-        description: Space separated list of packages to publish on NPM. Use this OR skip_packages, not together.
+        description: Packages to publish (space separated)
         type: string
       skip_packages:
-        description: Space separated list of packages to NOT publish on NPM. Use this OR only_packages, not together.
+        description: Packages to NOT publish (space separated)
         type: string
       tags:
-        description: Space separated list of tags to tag the release with on NPM
+        description: NPM tags (space separated)
         type: string
-        default: "['untagged']"
+        default: untagged
       dry:
         required: true
-        description: Don't actually publish, just run a dry run
+        description: Dry run instead of publish?
         type: boolean
         default: true
       force_notify:
-        description: Force a Discord notification
+        description: Force a Discord notification?
         type: boolean
         default: false
 
@@ -52,8 +52,8 @@ jobs:
           embed-author-icon-url: ${{ github.event.sender.avatar_url }}
           embed-title: '⚠️ Publishing release from NPM'
           embed-description: |
-            ```
-            inputs: ${{ toJson(inputs) }}
+            ```json
+            ${{ toJson(inputs) }}
             ```
           embed-url: https://github.com/facebook/react/actions/runs/${{ github.run_id }}
 
@@ -80,12 +80,44 @@ jobs:
         working-directory: scripts/release
       - run: cp ./scripts/release/ci-npmrc ~/.npmrc
       - if: '${{ inputs.only_packages }}'
+        name: 'Prepare and publish ${{ inputs.only_packages }}'
         run: |
-          scripts/release/prepare-release-from-npm.js --skipTests --version=${{ inputs.version_to_promote }} --onlyPackages=${{ inputs.only_packages }}
+          echo -e "===== Preparing release from NPM =====\n"
+          scripts/release/prepare-release-from-npm.js \
+            --ci \
+            --skipTests \
+            --version=${{ inputs.version_to_promote }} \
+            --publishVersion=${{ inputs.version_to_publish }} \
+            --onlyPackages=${{ inputs.only_packages }}
+
+          echo -e "\n\n===== Check prepared files =====\n"
           ls -R build/node_modules
-          # scripts/release/publish.js --ci --tags=${{ inputs.tags }} --publishVersion=${{ inputs.version_to_publish }} --onlyPackages=${{ inputs.only_packages }} --dry=${{ inputs.dry || 'false' }}
+
+          echo -e "\n\n===== Publishing to NPM =====\n"
+          scripts/release/publish.js \
+            --ci \
+            --tags=${{ inputs.tags }} \
+            --publishVersion=${{ inputs.version_to_publish }} \
+            --onlyPackages=${{ inputs.only_packages }} \
+            --dry=${{ inputs.dry }}
       - if: '${{ inputs.skip_packages }}'
+        name: 'Prepare and publish all packages EXCEPT ${{ inputs.skip_packages }}'
         run: |
-          scripts/release/prepare-release-from-npm.js --skipTests --version=${{ inputs.version_to_promote }} --skipPackages=${{ inputs.skip_packages }}
+          echo -e "===== Preparing release from NPM =====\n"
+          scripts/release/prepare-release-from-npm.js \
+            --ci \
+            --skipTests \
+            --version=${{ inputs.version_to_promote }} \
+            --publishVersion=${{ inputs.version_to_publish }} \
+            --skipPackages=${{ inputs.skip_packages }}
+
+          echo -e "\n\n===== Check prepared files =====\n"
           ls -R build/node_modules
-          # scripts/release/publish.js --ci --tags=${{ inputs.tags }} --publishVersion=${{ inputs.version_to_publish }} --skipPackages=${{ inputs.skip_packages }} --dry=${{ inputs.dry || 'false' }}
+
+          echo -e "\n\n===== Publishing to NPM =====\n"
+          scripts/release/publish.js \
+            --ci \
+            --tags=${{ inputs.tags }} \
+            --publishVersion=${{ inputs.version_to_publish }} \
+            --skipPackages=${{ inputs.skip_packages }} \
+            --dry=${{ inputs.dry }}
diff --git a/scripts/release/prepare-release-from-npm-commands/confirm-stable-version-numbers.js b/scripts/release/prepare-release-from-npm-commands/confirm-stable-version-numbers.js
index 0b93fba2fc12b..6bf49132149a8 100644
--- a/scripts/release/prepare-release-from-npm-commands/confirm-stable-version-numbers.js
+++ b/scripts/release/prepare-release-from-npm-commands/confirm-stable-version-numbers.js
@@ -7,7 +7,7 @@ const semver = require('semver');
 const theme = require('../theme');
 const {confirm} = require('../utils');
 
-const run = async ({skipPackages}, versionsMap) => {
+const run = async ({ci, skipPackages}, versionsMap) => {
   const groupedVersionsMap = new Map();
 
   // Group packages with the same source versions.
@@ -22,44 +22,46 @@ const run = async ({skipPackages}, versionsMap) => {
     }
   });
 
-  // Prompt user to confirm or override each version group.
-  const entries = [...groupedVersionsMap.entries()];
-  for (let i = 0; i < entries.length; i++) {
-    const [bestGuessVersion, packages] = entries[i];
-    const packageNames = packages.map(name => theme.package(name)).join(', ');
+  if (ci !== true) {
+    // Prompt user to confirm or override each version group if not running in CI.
+    const entries = [...groupedVersionsMap.entries()];
+    for (let i = 0; i < entries.length; i++) {
+      const [bestGuessVersion, packages] = entries[i];
+      const packageNames = packages.map(name => theme.package(name)).join(', ');
 
-    let version = bestGuessVersion;
-    if (
-      skipPackages.some(skipPackageName => packages.includes(skipPackageName))
-    ) {
-      await confirm(
-        theme`{spinnerSuccess ✓} Version for ${packageNames} will remain {version ${bestGuessVersion}}`
-      );
-    } else {
-      const defaultVersion = bestGuessVersion
-        ? theme.version(` (default ${bestGuessVersion})`)
-        : '';
-      version =
-        (await prompt(
-          theme`{spinnerSuccess ✓} Version for ${packageNames}${defaultVersion}: `
-        )) || bestGuessVersion;
-      prompt.done();
-    }
+      let version = bestGuessVersion;
+      if (
+        skipPackages.some(skipPackageName => packages.includes(skipPackageName))
+      ) {
+        await confirm(
+          theme`{spinnerSuccess ✓} Version for ${packageNames} will remain {version ${bestGuessVersion}}`
+        );
+      } else {
+        const defaultVersion = bestGuessVersion
+          ? theme.version(` (default ${bestGuessVersion})`)
+          : '';
+        version =
+          (await prompt(
+            theme`{spinnerSuccess ✓} Version for ${packageNames}${defaultVersion}: `
+          )) || bestGuessVersion;
+        prompt.done();
+      }
 
-    // Verify a valid version has been supplied.
-    try {
-      semver(version);
+      // Verify a valid version has been supplied.
+      try {
+        semver(version);
 
-      packages.forEach(packageName => {
-        versionsMap.set(packageName, version);
-      });
-    } catch (error) {
-      console.log(
-        theme`{spinnerError ✘} Version {version ${version}} is invalid.`
-      );
+        packages.forEach(packageName => {
+          versionsMap.set(packageName, version);
+        });
+      } catch (error) {
+        console.log(
+          theme`{spinnerError ✘} Version {version ${version}} is invalid.`
+        );
 
-      // Prompt again
-      i--;
+        // Prompt again
+        i--;
+      }
     }
   }
 };
diff --git a/scripts/release/prepare-release-from-npm-commands/guess-stable-version-numbers.js b/scripts/release/prepare-release-from-npm-commands/guess-stable-version-numbers.js
index a3cde5d1c4fce..c0072b6637177 100644
--- a/scripts/release/prepare-release-from-npm-commands/guess-stable-version-numbers.js
+++ b/scripts/release/prepare-release-from-npm-commands/guess-stable-version-numbers.js
@@ -5,7 +5,10 @@
 const semver = require('semver');
 const {execRead, logPromise} = require('../utils');
 
-const run = async ({cwd, packages, skipPackages}, versionsMap) => {
+const run = async (
+  {cwd, packages, skipPackages, ci, publishVersion},
+  versionsMap
+) => {
   const branch = await execRead('git branch | grep \\* | cut -d " " -f2', {
     cwd,
   });
@@ -13,30 +16,41 @@ const run = async ({cwd, packages, skipPackages}, versionsMap) => {
   for (let i = 0; i < packages.length; i++) {
     const packageName = packages[i];
 
-    try {
-      // In case local package JSONs are outdated,
-      // guess the next version based on the latest NPM release.
-      const version = await execRead(`npm show ${packageName} version`);
-
-      if (skipPackages.includes(packageName)) {
-        versionsMap.set(packageName, version);
+    if (ci === true) {
+      if (publishVersion != null) {
+        versionsMap.set(packageName, publishVersion);
       } else {
-        const {major, minor, patch} = semver(version);
-
-        // Guess the next version by incrementing patch.
-        // The script will confirm this later.
-        // By default, new releases from mains should increment the minor version number,
-        // and patch releases should be done from branches.
-        if (branch === 'main') {
-          versionsMap.set(packageName, `${major}.${minor + 1}.0`);
+        console.error(
+          'When running in CI mode, a publishVersion must be supplied'
+        );
+        process.exit(1);
+      }
+    } else {
+      try {
+        // In case local package JSONs are outdated,
+        // guess the next version based on the latest NPM release.
+        const version = await execRead(`npm show ${packageName} version`);
+
+        if (skipPackages.includes(packageName)) {
+          versionsMap.set(packageName, version);
         } else {
-          versionsMap.set(packageName, `${major}.${minor}.${patch + 1}`);
+          const {major, minor, patch} = semver(version);
+
+          // Guess the next version by incrementing patch.
+          // The script will confirm this later.
+          // By default, new releases from mains should increment the minor version number,
+          // and patch releases should be done from branches.
+          if (branch === 'main') {
+            versionsMap.set(packageName, `${major}.${minor + 1}.0`);
+          } else {
+            versionsMap.set(packageName, `${major}.${minor}.${patch + 1}`);
+          }
         }
+      } catch (error) {
+        // If the package has not yet been published,
+        // we'll require a version number to be entered later.
+        versionsMap.set(packageName, null);
       }
-    } catch (error) {
-      // If the package has not yet been published,
-      // we'll require a version number to be entered later.
-      versionsMap.set(packageName, null);
     }
   }
 };
diff --git a/scripts/release/prepare-release-from-npm-commands/parse-params.js b/scripts/release/prepare-release-from-npm-commands/parse-params.js
index b08d81e89dc18..ef9c4979b2030 100644
--- a/scripts/release/prepare-release-from-npm-commands/parse-params.js
+++ b/scripts/release/prepare-release-from-npm-commands/parse-params.js
@@ -39,6 +39,17 @@ const paramDefinitions = [
     description:
       'Version of published "next" release (e.g. 0.0.0-0e526bcec-20210202)',
   },
+  {
+    name: 'publishVersion',
+    type: String,
+    description: 'Version to publish',
+  },
+  {
+    name: 'ci',
+    type: Boolean,
+    description: 'Run in automated environment, without interactive prompts.',
+    defaultValue: false,
+  },
 ];
 
 module.exports = () => {
diff --git a/scripts/release/prepare-release-from-npm-commands/update-stable-version-numbers.js b/scripts/release/prepare-release-from-npm-commands/update-stable-version-numbers.js
index a41d83ac69dbb..f201118890456 100644
--- a/scripts/release/prepare-release-from-npm-commands/update-stable-version-numbers.js
+++ b/scripts/release/prepare-release-from-npm-commands/update-stable-version-numbers.js
@@ -9,7 +9,7 @@ const {join, relative} = require('path');
 const {confirm, execRead, printDiff} = require('../utils');
 const theme = require('../theme');
 
-const run = async ({cwd, packages, version}, versionsMap) => {
+const run = async ({cwd, packages, version, ci}, versionsMap) => {
   const nodeModulesPath = join(cwd, 'build/node_modules');
 
   // Cache all package JSONs for easy lookup below.
@@ -107,7 +107,9 @@ const run = async ({cwd, packages, version}, versionsMap) => {
     printDependencies(packageJSON.dependencies, 'dependency');
     printDependencies(packageJSON.peerDependencies, 'peer');
   }
-  await confirm('Do the versions above look correct?');
+  if (ci !== true) {
+    await confirm('Do the versions above look correct?');
+  }
 
   clear();
 
@@ -167,7 +169,9 @@ const run = async ({cwd, packages, version}, versionsMap) => {
     console.log(
       theme`A full diff is available at {path ${relative(cwd, diffPath)}}.`
     );
-    await confirm('Do the changes above look correct?');
+    if (ci !== true) {
+      await confirm('Do the changes above look correct?');
+    }
   } else {
     console.log(
       theme`Skipping React renderer version update because React is not included in the release.`
diff --git a/scripts/release/prepare-release-from-npm.js b/scripts/release/prepare-release-from-npm.js
index 8220fda220b65..bb67fddd37803 100755
--- a/scripts/release/prepare-release-from-npm.js
+++ b/scripts/release/prepare-release-from-npm.js
@@ -26,6 +26,13 @@ const run = async () => {
       params.version = await getLatestNextVersion();
     }
 
+    if (params.onlyPackages.length > 0 && params.skipPackages.length > 0) {
+      console.error(
+        '--onlyPackages and --skipPackages cannot be used together'
+      );
+      process.exit(1);
+    }
+
     params.packages = await getPublicPackages(isExperimental);
     params.packages = params.packages.filter(packageName => {
       if (params.onlyPackages.length > 0) {
diff --git a/scripts/release/publish-commands/confirm-version-and-tags.js b/scripts/release/publish-commands/confirm-version-and-tags.js
index 6900878da02f6..2c6fed58d1937 100644
--- a/scripts/release/publish-commands/confirm-version-and-tags.js
+++ b/scripts/release/publish-commands/confirm-version-and-tags.js
@@ -38,6 +38,9 @@ const run = async ({cwd, packages, tags, ci}) => {
     console.log(
       theme`• {package ${packageName}} {version ${packageJSON.version}}`
     );
+    if (ci) {
+      console.log(packageJSON);
+    }
   }
 
   if (!ci) {
diff --git a/scripts/release/publish-commands/publish-to-npm.js b/scripts/release/publish-commands/publish-to-npm.js
index d9e3b1902383f..f1e62657c0c38 100644
--- a/scripts/release/publish-commands/publish-to-npm.js
+++ b/scripts/release/publish-commands/publish-to-npm.js
@@ -27,7 +27,9 @@ const run = async ({cwd, dry, tags, ci}, packageName, otp) => {
       await confirm('Is this expected?');
     }
   } else {
-    console.log(theme`{spinnerSuccess ✓} Publishing {package ${packageName}}`);
+    console.log(
+      theme`{spinnerSuccess ✓} Publishing {package ${packageName}}${dry ? ' (dry-run)' : ''}`
+    );
 
     // Publish the package and tag it.
     if (!dry) {
diff --git a/scripts/release/publish.js b/scripts/release/publish.js
index 87b9940636b18..f9e450b559208 100755
--- a/scripts/release/publish.js
+++ b/scripts/release/publish.js
@@ -31,6 +31,13 @@ const run = async () => {
     params.cwd = join(__dirname, '..', '..');
     params.packages = await getPublicPackages(isExperimental);
 
+    if (params.onlyPackages.length > 0 && params.skipPackages.length > 0) {
+      console.error(
+        '--onlyPackages and --skipPackages cannot be used together'
+      );
+      process.exit(1);
+    }
+
     if (params.onlyPackages.length > 0) {
       params.packages = params.packages.filter(packageName => {
         return params.onlyPackages.includes(packageName);

From 5eb20b3007a8fafaf032c2e028c335ab09217d9f Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Thu, 27 Feb 2025 16:01:31 -0500
Subject: [PATCH 66/73] [ci] Fix --dry not being passed correctly (#32489)

Boolean params for dry runs are true if the param exists at all, so only
add it if we're in dry run mode.
---
 .../runtime_releases_from_npm_manual.yml      | 42 +++++++++----------
 1 file changed, 19 insertions(+), 23 deletions(-)

diff --git a/.github/workflows/runtime_releases_from_npm_manual.yml b/.github/workflows/runtime_releases_from_npm_manual.yml
index 2759b4e4d8737..3c8cec7f7ac1b 100644
--- a/.github/workflows/runtime_releases_from_npm_manual.yml
+++ b/.github/workflows/runtime_releases_from_npm_manual.yml
@@ -50,7 +50,7 @@ jobs:
           embed-author-name: ${{ github.event.sender.login }}
           embed-author-url: ${{ github.event.sender.html_url }}
           embed-author-icon-url: ${{ github.event.sender.avatar_url }}
-          embed-title: '⚠️ Publishing release from NPM'
+          embed-title: "⚠️ Publishing release from NPM${{ inputs.dry && ' (dry run)' }}"
           embed-description: |
             ```json
             ${{ toJson(inputs) }}
@@ -80,44 +80,40 @@ jobs:
         working-directory: scripts/release
       - run: cp ./scripts/release/ci-npmrc ~/.npmrc
       - if: '${{ inputs.only_packages }}'
-        name: 'Prepare and publish ${{ inputs.only_packages }}'
+        name: 'Prepare ${{ inputs.only_packages }} from NPM'
         run: |
-          echo -e "===== Preparing release from NPM =====\n"
           scripts/release/prepare-release-from-npm.js \
             --ci \
             --skipTests \
             --version=${{ inputs.version_to_promote }} \
             --publishVersion=${{ inputs.version_to_publish }} \
             --onlyPackages=${{ inputs.only_packages }}
-
-          echo -e "\n\n===== Check prepared files =====\n"
-          ls -R build/node_modules
-
-          echo -e "\n\n===== Publishing to NPM =====\n"
-          scripts/release/publish.js \
-            --ci \
-            --tags=${{ inputs.tags }} \
-            --publishVersion=${{ inputs.version_to_publish }} \
-            --onlyPackages=${{ inputs.only_packages }} \
-            --dry=${{ inputs.dry }}
       - if: '${{ inputs.skip_packages }}'
-        name: 'Prepare and publish all packages EXCEPT ${{ inputs.skip_packages }}'
+        name: 'Prepare all packages EXCEPT ${{ inputs.skip_packages }} from NPM'
         run: |
-          echo -e "===== Preparing release from NPM =====\n"
           scripts/release/prepare-release-from-npm.js \
             --ci \
             --skipTests \
             --version=${{ inputs.version_to_promote }} \
             --publishVersion=${{ inputs.version_to_publish }} \
             --skipPackages=${{ inputs.skip_packages }}
-
-          echo -e "\n\n===== Check prepared files =====\n"
-          ls -R build/node_modules
-
-          echo -e "\n\n===== Publishing to NPM =====\n"
+      - name: Check prepared files
+        run: ls -R build/node_modules
+      - if: '${{ inputs.only_packages }}'
+        name: 'Publish ${{ inputs.only_packages }}'
+        run: |
+          scripts/release/publish.js \
+            --ci \
+            --tags=${{ inputs.tags }} \
+            --publishVersion=${{ inputs.version_to_publish }} \
+            --onlyPackages=${{ inputs.only_packages }} ${{ (inputs.dry && '') || '\'}}
+            ${{ inputs.dry && '--dry'}}
+      - if: '${{ inputs.skip_packages }}'
+        name: 'Publish all packages EXCEPT ${{ inputs.skip_packages }}'
+        run: |
           scripts/release/publish.js \
             --ci \
             --tags=${{ inputs.tags }} \
             --publishVersion=${{ inputs.version_to_publish }} \
-            --skipPackages=${{ inputs.skip_packages }} \
-            --dry=${{ inputs.dry }}
+            --skipPackages=${{ inputs.skip_packages }} ${{ (inputs.dry && '') || '\'}}
+            ${{ inputs.dry && '--dry'}}

From 3607f4838a8f4a87160da36aa26bb1432d7a5f11 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Thu, 27 Feb 2025 16:45:18 -0500
Subject: [PATCH 67/73] Add Commit Scaffolding for Gestures (#32451)

This adds a `ReactFiberApplyGesture` which is basically intended to be a
fork of the phases in `ReactFiberCommitWork` except for the fake commit
that `useSwipeTransition` does. So far none of the phases are actually
implemented yet. This is just the scaffolding around them so I can fill
them in later.

The important bit is that we call `startViewTransition` (via the
`startGestureTransition` Config) when a gesture starts. We add a paused
animation to prevent the transition from committing (even if the
ScrollTimeline goes to 100%). This also locks the documents so that we
can't commit any other Transitions until it completes.

When the gesture completes (scroll end) then we stop the gesture View
Transition. If there's no new work scheduled we do that immediately but
if there was any new work already scheduled, then we assume that this
will potentially commit the new state. So we wait for that to finish.
This lets us lock the animation in its state instead of snapping back
and then applying the real update.

Using this technique we can't actually run a View Transition from the
current state to the actual committed state because it would snap back
to the beginning and then run the View Transition from there. Therefore
any new commit needs to skip View Transitions even if it should've
technically animated to that state. We assume that the new state is the
same as the optimistic state you already swiped to. An alternative to
this technique could be to commit the optimistic state when we cancel
and then apply any new updates o top of that. I might explore that in
the future.

Regardless it's important that the `action` associated with the swipe
schedules some work before we cancel. Otherwise it risks reverting
first. So I had to update this in the fixture.
---
 .../src/components/SwipeRecognizer.js         |  10 +-
 packages/react-art/src/ReactFiberConfigART.js |   6 +
 .../src/client/ReactFiberConfigDOM.js         |  74 ++++++-
 .../src/ReactFiberConfigNative.js             |  15 ++
 .../src/createReactNoop.js                    |  15 ++
 .../src/ReactFiberApplyGesture.js             |  42 ++++
 .../src/ReactFiberConfigWithNoMutation.js     |   3 +
 .../src/ReactFiberGestureScheduler.js         |  80 ++++++--
 .../react-reconciler/src/ReactFiberHooks.js   |   2 +-
 .../react-reconciler/src/ReactFiberRoot.js    |   3 +-
 .../src/ReactFiberWorkLoop.js                 | 180 +++++++++++++++---
 .../src/ReactInternalTypes.js                 |   3 +-
 .../src/forks/ReactFiberConfig.custom.js      |   3 +
 .../src/ReactFiberConfigTestHost.js           |  15 ++
 14 files changed, 401 insertions(+), 50 deletions(-)
 create mode 100644 packages/react-reconciler/src/ReactFiberApplyGesture.js

diff --git a/fixtures/view-transition/src/components/SwipeRecognizer.js b/fixtures/view-transition/src/components/SwipeRecognizer.js
index f332796fc8cdf..8e913dfb4e55f 100644
--- a/fixtures/view-transition/src/components/SwipeRecognizer.js
+++ b/fixtures/view-transition/src/components/SwipeRecognizer.js
@@ -33,11 +33,6 @@ export default function SwipeRecognizer({
     });
   }
   function onScrollEnd() {
-    if (activeGesture.current !== null) {
-      const cancelGesture = activeGesture.current;
-      activeGesture.current = null;
-      cancelGesture();
-    }
     let changed;
     const scrollElement = scrollRef.current;
     if (axis === 'x') {
@@ -60,6 +55,11 @@ export default function SwipeRecognizer({
       // Trigger side-effects
       startTransition(action);
     }
+    if (activeGesture.current !== null) {
+      const cancelGesture = activeGesture.current;
+      activeGesture.current = null;
+      cancelGesture();
+    }
   }
 
   useEffect(() => {
diff --git a/packages/react-art/src/ReactFiberConfigART.js b/packages/react-art/src/ReactFiberConfigART.js
index a011bdf5c71c7..dc746b0e17d88 100644
--- a/packages/react-art/src/ReactFiberConfigART.js
+++ b/packages/react-art/src/ReactFiberConfigART.js
@@ -500,6 +500,12 @@ export function startViewTransition() {
   return false;
 }
 
+export type RunningGestureTransition = null;
+
+export function startGestureTransition() {}
+
+export function stopGestureTransition(transition: RunningGestureTransition) {}
+
 export type ViewTransitionInstance = null | {name: string, ...};
 
 export function createViewTransitionInstance(
diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index 52560d0b006b0..2b288efe46c3f 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -1394,7 +1394,10 @@ export function startViewTransition(
     transition.ready.then(spawnedWorkCallback, spawnedWorkCallback);
     transition.finished.then(() => {
       // $FlowFixMe[prop-missing]
-      ownerDocument.__reactViewTransition = null;
+      if (ownerDocument.__reactViewTransition === transition) {
+        // $FlowFixMe[prop-missing]
+        ownerDocument.__reactViewTransition = null;
+      }
       passiveCallback();
     });
     return true;
@@ -1409,6 +1412,75 @@ export function startViewTransition(
   }
 }
 
+export type RunningGestureTransition = {
+  skipTransition(): void,
+  ...
+};
+
+export function startGestureTransition(
+  rootContainer: Container,
+  transitionTypes: null | TransitionTypes,
+  mutationCallback: () => void,
+  animateCallback: () => void,
+): null | RunningGestureTransition {
+  const ownerDocument: Document =
+    rootContainer.nodeType === DOCUMENT_NODE
+      ? (rootContainer: any)
+      : rootContainer.ownerDocument;
+  try {
+    // $FlowFixMe[prop-missing]
+    const transition = ownerDocument.startViewTransition({
+      update: mutationCallback,
+      types: transitionTypes,
+    });
+    // $FlowFixMe[prop-missing]
+    ownerDocument.__reactViewTransition = transition;
+    let blockingAnim = null;
+    const readyCallback = () => {
+      // View Transitions with ScrollTimeline has a quirk where they end if the
+      // ScrollTimeline ever reaches 100% but that doesn't mean we're done because
+      // you can swipe back again. We can prevent this by adding a paused Animation
+      // that never stops. This seems to keep all running Animations alive until
+      // we explicitly abort (or something forces the View Transition to cancel).
+      const documentElement: Element = (ownerDocument.documentElement: any);
+      blockingAnim = documentElement.animate([{}, {}], {
+        pseudoElement: '::view-transition',
+        duration: 1,
+      });
+      blockingAnim.pause();
+      animateCallback();
+    };
+    transition.ready.then(readyCallback, readyCallback);
+    transition.finished.then(() => {
+      if (blockingAnim !== null) {
+        // In Safari, we need to manually clear this or it'll block future transitions.
+        blockingAnim.cancel();
+      }
+      // $FlowFixMe[prop-missing]
+      if (ownerDocument.__reactViewTransition === transition) {
+        // $FlowFixMe[prop-missing]
+        ownerDocument.__reactViewTransition = null;
+      }
+    });
+    return transition;
+  } catch (x) {
+    // We use the error as feature detection.
+    // The only thing that should throw is if startViewTransition is missing
+    // or if it doesn't accept the object form. Other errors are async.
+    // I.e. it's before the View Transitions v2 spec. We only support View
+    // Transitions v2 otherwise we fallback to not animating to ensure that
+    // we're not animating with the wrong animation mapped.
+    // Run through the sequence to put state back into a consistent state.
+    mutationCallback();
+    animateCallback();
+    return null;
+  }
+}
+
+export function stopGestureTransition(transition: RunningGestureTransition) {
+  transition.skipTransition();
+}
+
 interface ViewTransitionPseudoElementType extends Animatable {
   _scope: HTMLElement;
   _selector: string;
diff --git a/packages/react-native-renderer/src/ReactFiberConfigNative.js b/packages/react-native-renderer/src/ReactFiberConfigNative.js
index 00385547f23e7..4a9064c82a83b 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigNative.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigNative.js
@@ -597,6 +597,21 @@ export function startViewTransition(
   return false;
 }
 
+export type RunningGestureTransition = null;
+
+export function startGestureTransition(
+  rootContainer: Container,
+  transitionTypes: null | TransitionTypes,
+  mutationCallback: () => void,
+  animateCallback: () => void,
+): RunningGestureTransition {
+  mutationCallback();
+  animateCallback();
+  return null;
+}
+
+export function stopGestureTransition(transition: RunningGestureTransition) {}
+
 export type ViewTransitionInstance = null | {name: string, ...};
 
 export function createViewTransitionInstance(
diff --git a/packages/react-noop-renderer/src/createReactNoop.js b/packages/react-noop-renderer/src/createReactNoop.js
index 43853a864fb5e..e392ad7b0c04f 100644
--- a/packages/react-noop-renderer/src/createReactNoop.js
+++ b/packages/react-noop-renderer/src/createReactNoop.js
@@ -93,6 +93,8 @@ export type TransitionStatus = mixed;
 
 export type FormInstance = Instance;
 
+export type RunningGestureTransition = null;
+
 export type ViewTransitionInstance = null | {name: string, ...};
 
 export type GestureTimeline = null;
@@ -792,6 +794,19 @@ function createReactNoop(reconciler: Function, useMutation: boolean) {
           return false;
         },
 
+        startGestureTransition(
+          rootContainer: Container,
+          transitionTypes: null | TransitionTypes,
+          mutationCallback: () => void,
+          animateCallback: () => void,
+        ): RunningGestureTransition {
+          mutationCallback();
+          animateCallback();
+          return null;
+        },
+
+        stopGestureTransition(transition: RunningGestureTransition) {},
+
         createViewTransitionInstance(name: string): ViewTransitionInstance {
           return null;
         },
diff --git a/packages/react-reconciler/src/ReactFiberApplyGesture.js b/packages/react-reconciler/src/ReactFiberApplyGesture.js
new file mode 100644
index 0000000000000..46af2ca4309fa
--- /dev/null
+++ b/packages/react-reconciler/src/ReactFiberApplyGesture.js
@@ -0,0 +1,42 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+import type {Fiber, FiberRoot} from './ReactInternalTypes';
+
+import {
+  cancelRootViewTransitionName,
+  restoreRootViewTransitionName,
+} from './ReactFiberConfig';
+
+// Clone View Transition boundaries that have any mutations or might have had their
+// layout affected by child insertions.
+export function insertDestinationClones(
+  root: FiberRoot,
+  finishedWork: Fiber,
+): void {
+  // TODO
+}
+
+// Revert insertions and apply view transition names to the "new" (current) state.
+export function applyDepartureTransitions(
+  root: FiberRoot,
+  finishedWork: Fiber,
+): void {
+  // TODO
+  cancelRootViewTransitionName(root.containerInfo);
+}
+
+// Revert transition names and start/adjust animations on the started View Transition.
+export function startGestureAnimations(
+  root: FiberRoot,
+  finishedWork: Fiber,
+): void {
+  // TODO
+  restoreRootViewTransitionName(root.containerInfo);
+}
diff --git a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
index da34b26084de5..430ad02abc1b1 100644
--- a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
+++ b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
@@ -46,6 +46,9 @@ export const wasInstanceInViewport = shim;
 export const hasInstanceChanged = shim;
 export const hasInstanceAffectedParent = shim;
 export const startViewTransition = shim;
+export type RunningGestureTransition = null;
+export const startGestureTransition = shim;
+export const stopGestureTransition = shim;
 export type ViewTransitionInstance = null | {name: string, ...};
 export const createViewTransitionInstance = shim;
 export type GestureTimeline = any;
diff --git a/packages/react-reconciler/src/ReactFiberGestureScheduler.js b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
index fffb7d524d9e4..33d477f07daec 100644
--- a/packages/react-reconciler/src/ReactFiberGestureScheduler.js
+++ b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
@@ -8,11 +8,21 @@
  */
 
 import type {FiberRoot} from './ReactInternalTypes';
-import type {GestureTimeline} from './ReactFiberConfig';
+import type {
+  GestureTimeline,
+  RunningGestureTransition,
+} from './ReactFiberConfig';
 
-import {GestureLane} from './ReactFiberLane';
+import {
+  GestureLane,
+  includesBlockingLane,
+  includesTransitionLane,
+} from './ReactFiberLane';
 import {ensureRootIsScheduled} from './ReactFiberRootScheduler';
-import {subscribeToGestureDirection} from './ReactFiberConfig';
+import {
+  subscribeToGestureDirection,
+  stopGestureTransition,
+} from './ReactFiberConfig';
 
 // This type keeps track of any scheduled or active gestures.
 export type ScheduledGesture = {
@@ -23,6 +33,7 @@ export type ScheduledGesture = {
   rangeCurrent: number, // The starting offset along the timeline.
   rangeNext: number, // The end along the timeline where the next state is reached.
   cancel: () => void, // Cancel the subscription to direction change.
+  running: null | RunningGestureTransition, // Used to cancel the running transition after we're done.
   prev: null | ScheduledGesture, // The previous scheduled gesture in the queue for this root.
   next: null | ScheduledGesture, // The next scheduled gesture in the queue for this root.
 };
@@ -35,7 +46,7 @@ export function scheduleGesture(
   rangeCurrent: number,
   rangeNext: number,
 ): ScheduledGesture {
-  let prev = root.gestures;
+  let prev = root.pendingGestures;
   while (prev !== null) {
     if (prev.provider === provider) {
       // Existing instance found.
@@ -59,16 +70,16 @@ export function scheduleGesture(
       }
       if (gesture.direction !== direction) {
         gesture.direction = direction;
-        if (gesture.prev === null && root.gestures !== gesture) {
+        if (gesture.prev === null && root.pendingGestures !== gesture) {
           // This gesture is not in the schedule, meaning it was already rendered.
           // We need to rerender in the new direction. Insert it into the first slot
           // in case other gestures are queued after the on-going one.
-          const existing = root.gestures;
+          const existing = root.pendingGestures;
           gesture.next = existing;
           if (existing !== null) {
             existing.prev = gesture;
           }
-          root.gestures = gesture;
+          root.pendingGestures = gesture;
           // Schedule the lane on the root. The Fibers will already be marked as
           // long as the gesture is active on that Hook.
           root.pendingLanes |= GestureLane;
@@ -86,11 +97,12 @@ export function scheduleGesture(
     rangeCurrent: rangeCurrent,
     rangeNext: rangeNext,
     cancel: cancel,
+    running: null,
     prev: prev,
     next: null,
   };
   if (prev === null) {
-    root.gestures = gesture;
+    root.pendingGestures = gesture;
   } else {
     prev.next = gesture;
   }
@@ -106,10 +118,35 @@ export function cancelScheduledGesture(
   if (gesture.count === 0) {
     const cancelDirectionSubscription = gesture.cancel;
     cancelDirectionSubscription();
-    // Delete the scheduled gesture from the queue.
+    // Delete the scheduled gesture from the pending queue.
     deleteScheduledGesture(root, gesture);
     // TODO: If we're currently rendering this gesture, we need to restart the render
     // on a different gesture or cancel the render..
+    // TODO: We might want to pause the View Transition at this point since you should
+    // no longer be able to update the position of anything but it might be better to
+    // just commit the gesture state.
+    const runningTransition = gesture.running;
+    if (runningTransition !== null) {
+      const pendingLanesExcludingGestureLane = root.pendingLanes & ~GestureLane;
+      if (
+        includesBlockingLane(pendingLanesExcludingGestureLane) ||
+        includesTransitionLane(pendingLanesExcludingGestureLane)
+      ) {
+        // If we have pending work we schedule the gesture to be stopped at the next commit.
+        // This ensures that we don't snap back to the previous state until we have
+        // had a chance to commit any resulting updates.
+        const existing = root.stoppingGestures;
+        if (existing !== null) {
+          gesture.next = existing;
+          existing.prev = gesture;
+        }
+        root.stoppingGestures = gesture;
+      } else {
+        gesture.running = null;
+        // If there's no work scheduled so we can stop the View Transition right away.
+        stopGestureTransition(runningTransition);
+      }
+    }
   }
 }
 
@@ -118,15 +155,19 @@ export function deleteScheduledGesture(
   gesture: ScheduledGesture,
 ): void {
   if (gesture.prev === null) {
-    if (root.gestures === gesture) {
-      root.gestures = gesture.next;
-      if (root.gestures === null) {
+    if (root.pendingGestures === gesture) {
+      root.pendingGestures = gesture.next;
+      if (root.pendingGestures === null) {
         // Gestures don't clear their lanes while the gesture is still active but it
         // might not be scheduled to do any more renders and so we shouldn't schedule
         // any more gesture lane work until a new gesture is scheduled.
         root.pendingLanes &= ~GestureLane;
       }
     }
+    if (root.stoppingGestures === gesture) {
+      // This should not really happen the way we use it now but just in case we start.
+      root.stoppingGestures = gesture.next;
+    }
   } else {
     gesture.prev.next = gesture.next;
     if (gesture.next !== null) {
@@ -136,3 +177,18 @@ export function deleteScheduledGesture(
     gesture.next = null;
   }
 }
+
+export function stopCompletedGestures(root: FiberRoot) {
+  let gesture = root.stoppingGestures;
+  root.stoppingGestures = null;
+  while (gesture !== null) {
+    if (gesture.running !== null) {
+      stopGestureTransition(gesture.running);
+      gesture.running = null;
+    }
+    const nextGesture = gesture.next;
+    gesture.next = null;
+    gesture.prev = null;
+    gesture = nextGesture;
+  }
+}
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 50424e9d7b4db..270cd87d4941c 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -4126,7 +4126,7 @@ function updateSwipeTransition<T>(
         );
       }
       // We assume that the currently rendering gesture is the one first in the queue.
-      const rootRenderGesture = root.gestures;
+      const rootRenderGesture = root.pendingGestures;
       if (rootRenderGesture !== null) {
         let update = queue.pending;
         while (update !== null) {
diff --git a/packages/react-reconciler/src/ReactFiberRoot.js b/packages/react-reconciler/src/ReactFiberRoot.js
index 03ddde7a5ab5b..41401bac2bd8f 100644
--- a/packages/react-reconciler/src/ReactFiberRoot.js
+++ b/packages/react-reconciler/src/ReactFiberRoot.js
@@ -99,7 +99,8 @@ function FiberRootNode(
   this.formState = formState;
 
   if (enableSwipeTransition) {
-    this.gestures = null;
+    this.pendingGestures = null;
+    this.stoppingGestures = null;
   }
 
   this.incompleteTransitions = new Map();
diff --git a/packages/react-reconciler/src/ReactFiberWorkLoop.js b/packages/react-reconciler/src/ReactFiberWorkLoop.js
index d5ef003e3dc61..bf611f73275a7 100644
--- a/packages/react-reconciler/src/ReactFiberWorkLoop.js
+++ b/packages/react-reconciler/src/ReactFiberWorkLoop.js
@@ -100,6 +100,7 @@ import {
   resolveUpdatePriority,
   trackSchedulerEvent,
   startViewTransition,
+  startGestureTransition,
   createViewTransitionInstance,
 } from './ReactFiberConfig';
 
@@ -228,6 +229,11 @@ import {
   accumulateSuspenseyCommit,
 } from './ReactFiberCommitWork';
 import {shouldStartViewTransition} from './ReactFiberCommitViewTransitions';
+import {
+  insertDestinationClones,
+  applyDepartureTransitions,
+  startGestureAnimations,
+} from './ReactFiberApplyGesture';
 import {enqueueUpdate} from './ReactFiberClassUpdateQueue';
 import {resetContextDependencies} from './ReactFiberNewContext';
 import {
@@ -341,7 +347,10 @@ import {
 import {getMaskedContext, getUnmaskedContext} from './ReactFiberContext';
 import {peekEntangledActionLane} from './ReactFiberAsyncAction';
 import {logUncaughtError} from './ReactFiberErrorLogger';
-import {deleteScheduledGesture} from './ReactFiberGestureScheduler';
+import {
+  deleteScheduledGesture,
+  stopCompletedGestures,
+} from './ReactFiberGestureScheduler';
 
 const PossiblyWeakMap = typeof WeakMap === 'function' ? WeakMap : Map;
 
@@ -644,7 +653,9 @@ const PENDING_LAYOUT_PHASE = 2;
 const PENDING_AFTER_MUTATION_PHASE = 3;
 const PENDING_SPAWNED_WORK = 4;
 const PENDING_PASSIVE_PHASE = 5;
-let pendingEffectsStatus: 0 | 1 | 2 | 3 | 4 | 5 = 0;
+const PENDING_GESTURE_MUTATION_PHASE = 6;
+const PENDING_GESTURE_ANIMATION_PHASE = 7;
+let pendingEffectsStatus: 0 | 1 | 2 | 3 | 4 | 5 | 6 | 7 = 0;
 let pendingEffectsRoot: FiberRoot = (null: any);
 let pendingFinishedWork: Fiber = (null: any);
 let pendingEffectsLanes: Lanes = NoLanes;
@@ -1424,11 +1435,12 @@ function commitRootWhenReady(
   const subtreeFlags = finishedWork.subtreeFlags;
   const isViewTransitionEligible =
     enableViewTransition && includesOnlyViewTransitionEligibleLanes(lanes); // TODO: Use a subtreeFlag to optimize.
+  const isGestureTransition = enableSwipeTransition && isGestureRender(lanes);
   const maySuspendCommit =
     subtreeFlags & ShouldSuspendCommit ||
     (subtreeFlags & BothVisibilityAndMaySuspendCommit) ===
       BothVisibilityAndMaySuspendCommit;
-  if (isViewTransitionEligible || maySuspendCommit) {
+  if (isViewTransitionEligible || maySuspendCommit || isGestureTransition) {
     // Before committing, ask the renderer whether the host tree is ready.
     // If it's not, we'll wait until it notifies us.
     startSuspendingCommit();
@@ -1439,8 +1451,12 @@ function commitRootWhenReady(
     // This will also track any newly added or appearing ViewTransition
     // components for the purposes of forming pairs.
     accumulateSuspenseyCommit(finishedWork);
-    if (isViewTransitionEligible) {
-      suspendOnActiveViewTransition(root.containerInfo);
+    if (isViewTransitionEligible || isGestureTransition) {
+      // If we're stopping gestures we don't have to wait for any pending
+      // view transition. We'll stop it when we commit.
+      if (!enableSwipeTransition || root.stoppingGestures === null) {
+        suspendOnActiveViewTransition(root.containerInfo);
+      }
     }
     // At the end, ask the renderer if it's ready to commit, or if we should
     // suspend. If it's not ready, it will return a callback to subscribe to
@@ -3263,6 +3279,12 @@ function commitRoot(
     if (enableSchedulingProfiler) {
       markCommitStopped();
     }
+    if (enableSwipeTransition) {
+      // Stop any gestures that were completed and is now being reverted.
+      if (root.stoppingGestures !== null) {
+        stopCompletedGestures(root);
+      }
+    }
     return;
   } else {
     if (__DEV__) {
@@ -3291,7 +3313,7 @@ function commitRoot(
   const concurrentlyUpdatedLanes = getConcurrentlyUpdatedLanes();
   remainingLanes = mergeLanes(remainingLanes, concurrentlyUpdatedLanes);
 
-  if (enableSwipeTransition && root.gestures === null) {
+  if (enableSwipeTransition && root.pendingGestures === null) {
     // Gestures don't clear their lanes while the gesture is still active but it
     // might not be scheduled to do any more renders and so we shouldn't schedule
     // any more gesture lane work until a new gesture is scheduled.
@@ -3321,21 +3343,6 @@ function commitRoot(
     // times out.
   }
 
-  if (enableSwipeTransition && isGestureRender(lanes)) {
-    // This is a special kind of render that doesn't commit regular effects.
-    commitGestureOnRoot(
-      root,
-      finishedWork,
-      recoverableErrors,
-      enableProfilerTimer
-        ? suspendedCommitReason === IMMEDIATE_COMMIT
-          ? completedRenderEndTime
-          : commitStartTime
-        : 0,
-    );
-    return;
-  }
-
   // workInProgressX might be overwritten, so we want
   // to store it in pendingPassiveX until they get processed
   // We need to pass this through as an argument to commitRoot
@@ -3354,6 +3361,21 @@ function commitRoot(
     pendingSuspendedCommitReason = suspendedCommitReason;
   }
 
+  if (enableSwipeTransition && isGestureRender(lanes)) {
+    // This is a special kind of render that doesn't commit regular effects.
+    commitGestureOnRoot(
+      root,
+      finishedWork,
+      recoverableErrors,
+      enableProfilerTimer
+        ? suspendedCommitReason === IMMEDIATE_COMMIT
+          ? completedRenderEndTime
+          : commitStartTime
+        : 0,
+    );
+    return;
+  }
+
   // If there are pending passive effects, schedule a callback to process them.
   // Do this as early as possible, so it is queued before anything else that
   // might get scheduled in the commit phase. (See #16714.)
@@ -3461,10 +3483,23 @@ function commitRoot(
       ReactSharedInternals.T = prevTransition;
     }
   }
+
+  let willStartViewTransition = shouldStartViewTransition;
+  if (enableSwipeTransition) {
+    // Stop any gestures that were completed and is now being committed.
+    if (root.stoppingGestures !== null) {
+      stopCompletedGestures(root);
+      // If we are in the process of stopping some gesture we shouldn't start
+      // a View Transition because that would start from the previous state to
+      // the next state.
+      willStartViewTransition = false;
+    }
+  }
+
   pendingEffectsStatus = PENDING_MUTATION_PHASE;
   const startedViewTransition =
     enableViewTransition &&
-    shouldStartViewTransition &&
+    willStartViewTransition &&
     startViewTransition(
       root.containerInfo,
       pendingTransitionTypes,
@@ -3633,6 +3668,7 @@ function flushSpawnedWork(): void {
   } else {
     pendingEffectsStatus = NO_PENDING_EFFECTS;
     pendingEffectsRoot = (null: any); // Clear for GC purposes.
+    pendingFinishedWork = (null: any); // Clear for GC purposes.
     // There were no passive effects, so we can immediately release the cache
     // pool for this render.
     releaseRootPooledCache(root, root.pendingLanes);
@@ -3830,20 +3866,103 @@ function flushSpawnedWork(): void {
 
 function commitGestureOnRoot(
   root: FiberRoot,
-  finishedWork: null | Fiber,
+  finishedWork: Fiber,
   recoverableErrors: null | Array<CapturedValue<mixed>>,
   renderEndTime: number, // Profiling-only
 ): void {
   // We assume that the gesture we just rendered was the first one in the queue.
-  const finishedGesture = root.gestures;
+  const finishedGesture = root.pendingGestures;
   if (finishedGesture === null) {
-    throw new Error(
-      'Finished rendering the gesture lane but there were no pending gestures. ' +
-        'React should not have started a render in this case. This is a bug in React.',
-    );
+    // We must have already cancelled this gesture before we had a chance to
+    // render it. Let's schedule work on the next set of lanes.
+    ensureRootIsScheduled(root);
+    return;
   }
   deleteScheduledGesture(root, finishedGesture);
-  // TODO: Run the gesture
+
+  const prevTransition = ReactSharedInternals.T;
+  ReactSharedInternals.T = null;
+  const previousPriority = getCurrentUpdatePriority();
+  setCurrentUpdatePriority(DiscreteEventPriority);
+  const prevExecutionContext = executionContext;
+  executionContext |= CommitContext;
+  try {
+    insertDestinationClones(root, finishedWork);
+  } finally {
+    // Reset the priority to the previous non-sync value.
+    executionContext = prevExecutionContext;
+    setCurrentUpdatePriority(previousPriority);
+    ReactSharedInternals.T = prevTransition;
+  }
+  // TODO: Collect transition types.
+  pendingTransitionTypes = null;
+  pendingEffectsStatus = PENDING_GESTURE_MUTATION_PHASE;
+
+  finishedGesture.running = startGestureTransition(
+    root.containerInfo,
+    pendingTransitionTypes,
+    flushGestureMutations,
+    flushGestureAnimations,
+  );
+}
+
+function flushGestureMutations(): void {
+  if (pendingEffectsStatus !== PENDING_GESTURE_MUTATION_PHASE) {
+    return;
+  }
+  pendingEffectsStatus = NO_PENDING_EFFECTS;
+  const root = pendingEffectsRoot;
+  const finishedWork = pendingFinishedWork;
+
+  const prevTransition = ReactSharedInternals.T;
+  ReactSharedInternals.T = null;
+  const previousPriority = getCurrentUpdatePriority();
+  setCurrentUpdatePriority(DiscreteEventPriority);
+  const prevExecutionContext = executionContext;
+  executionContext |= CommitContext;
+  try {
+    applyDepartureTransitions(root, finishedWork);
+  } finally {
+    // Reset the priority to the previous non-sync value.
+    executionContext = prevExecutionContext;
+    setCurrentUpdatePriority(previousPriority);
+    ReactSharedInternals.T = prevTransition;
+  }
+
+  pendingEffectsStatus = PENDING_GESTURE_ANIMATION_PHASE;
+}
+
+function flushGestureAnimations(): void {
+  // If we get canceled before we start we might not have applied
+  // mutations yet. We need to apply them first.
+  flushGestureMutations();
+  if (pendingEffectsStatus !== PENDING_GESTURE_ANIMATION_PHASE) {
+    return;
+  }
+  pendingEffectsStatus = NO_PENDING_EFFECTS;
+  const root = pendingEffectsRoot;
+  const finishedWork = pendingFinishedWork;
+  pendingEffectsRoot = (null: any); // Clear for GC purposes.
+  pendingFinishedWork = (null: any); // Clear for GC purposes.
+  pendingEffectsLanes = NoLanes;
+
+  const prevTransition = ReactSharedInternals.T;
+  ReactSharedInternals.T = null;
+  const previousPriority = getCurrentUpdatePriority();
+  setCurrentUpdatePriority(DiscreteEventPriority);
+  const prevExecutionContext = executionContext;
+  executionContext |= CommitContext;
+  try {
+    startGestureAnimations(root, finishedWork);
+  } finally {
+    // Reset the priority to the previous non-sync value.
+    executionContext = prevExecutionContext;
+    setCurrentUpdatePriority(previousPriority);
+    ReactSharedInternals.T = prevTransition;
+  }
+
+  // Now that we've rendered this lane. Start working on the next lane.
+  ensureRootIsScheduled(root);
 }
 
 function makeErrorInfo(componentStack: ?string) {
@@ -3879,6 +3998,8 @@ function releaseRootPooledCache(root: FiberRoot, remainingLanes: Lanes) {
 
 export function flushPendingEffects(wasDelayedCommit?: boolean): boolean {
   // Returns whether passive effects were flushed.
+  flushGestureMutations();
+  flushGestureAnimations();
   flushMutationEffects();
   flushLayoutEffects();
   // Skip flushAfterMutation if we're forcing this early.
@@ -3932,6 +4053,7 @@ function flushPassiveEffectsImpl(wasDelayedCommit: void | boolean) {
   const lanes = pendingEffectsLanes;
   pendingEffectsStatus = NO_PENDING_EFFECTS;
   pendingEffectsRoot = (null: any); // Clear for GC purposes.
+  pendingFinishedWork = (null: any); // Clear for GC purposes.
   // TODO: This is sometimes out of sync with pendingEffectsRoot.
   // Figure out why and fix it. It's not causing any known issues (probably
   // because it's only used for profiling), but it's a refactor hazard.
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 3479eba1b9dd3..be5e9a5c0da69 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -284,7 +284,8 @@ type BaseFiberRootProperties = {
   formState: ReactFormState<any, any> | null,
 
   // enableSwipeTransition only
-  gestures: null | ScheduledGesture,
+  pendingGestures: null | ScheduledGesture,
+  stoppingGestures: null | ScheduledGesture,
 };
 
 // The following attributes are only used by DevTools and are only present in DEV builds.
diff --git a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
index 6b2781c0ab2a5..9569b4a896cee 100644
--- a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
+++ b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
@@ -40,6 +40,7 @@ export opaque type NoTimeout = mixed;
 export opaque type RendererInspectionConfig = mixed;
 export opaque type TransitionStatus = mixed;
 export opaque type FormInstance = mixed;
+export type RunningGestureTransition = mixed;
 export type ViewTransitionInstance = null | {name: string, ...};
 export opaque type InstanceMeasurement = mixed;
 export type EventResponder = any;
@@ -145,6 +146,8 @@ export const wasInstanceInViewport = $$$config.wasInstanceInViewport;
 export const hasInstanceChanged = $$$config.hasInstanceChanged;
 export const hasInstanceAffectedParent = $$$config.hasInstanceAffectedParent;
 export const startViewTransition = $$$config.startViewTransition;
+export const startGestureTransition = $$$config.startGestureTransition;
+export const stopGestureTransition = $$$config.stopGestureTransition;
 export const getCurrentGestureOffset = $$$config.getCurrentGestureOffset;
 export const subscribeToGestureDirection =
   $$$config.subscribeToGestureDirection;
diff --git a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
index 8f4f81cabb9ce..48939e9ff45ad 100644
--- a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
+++ b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
@@ -375,6 +375,21 @@ export function startViewTransition(
   return false;
 }
 
+export type RunningGestureTransition = null;
+
+export function startGestureTransition(
+  rootContainer: Container,
+  transitionTypes: null | TransitionTypes,
+  mutationCallback: () => void,
+  animateCallback: () => void,
+): RunningGestureTransition {
+  mutationCallback();
+  animateCallback();
+  return null;
+}
+
+export function stopGestureTransition(transition: RunningGestureTransition) {}
+
 export type ViewTransitionInstance = null | {name: string, ...};
 
 export function createViewTransitionInstance(

From 7e2ea902f839264fd327b0df5fae4f6ad8359952 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 28 Feb 2025 10:58:28 -0500
Subject: [PATCH 68/73] [ci] Fix discord notification title (#32491)

fun times
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32491).
* #32492
* __->__ #32491
---
 .github/workflows/runtime_releases_from_npm_manual.yml | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/.github/workflows/runtime_releases_from_npm_manual.yml b/.github/workflows/runtime_releases_from_npm_manual.yml
index 3c8cec7f7ac1b..2e1047b55df50 100644
--- a/.github/workflows/runtime_releases_from_npm_manual.yml
+++ b/.github/workflows/runtime_releases_from_npm_manual.yml
@@ -50,7 +50,7 @@ jobs:
           embed-author-name: ${{ github.event.sender.login }}
           embed-author-url: ${{ github.event.sender.html_url }}
           embed-author-icon-url: ${{ github.event.sender.avatar_url }}
-          embed-title: "⚠️ Publishing release from NPM${{ inputs.dry && ' (dry run)' }}"
+          embed-title: "⚠️ Publishing release from NPM${{ (inputs.dry && ' (dry run)') || '' }}"
           embed-description: |
             ```json
             ${{ toJson(inputs) }}

From 56c7d1070aabe42b955ea0006477ea1ca02dd0c5 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 28 Feb 2025 10:58:39 -0500
Subject: [PATCH 69/73] [ci] Upload release for easier debugging (#32492)

Uploads the releases that were published in case to help with debugging
or verifying a dry run.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32492).
* __->__ #32492
* #32491
---
 .github/workflows/runtime_releases_from_npm_manual.yml | 6 ++++++
 1 file changed, 6 insertions(+)

diff --git a/.github/workflows/runtime_releases_from_npm_manual.yml b/.github/workflows/runtime_releases_from_npm_manual.yml
index 2e1047b55df50..c0b3867e03da0 100644
--- a/.github/workflows/runtime_releases_from_npm_manual.yml
+++ b/.github/workflows/runtime_releases_from_npm_manual.yml
@@ -117,3 +117,9 @@ jobs:
             --publishVersion=${{ inputs.version_to_publish }} \
             --skipPackages=${{ inputs.skip_packages }} ${{ (inputs.dry && '') || '\'}}
             ${{ inputs.dry && '--dry'}}
+      - name: Archive released package for debugging
+        uses: actions/upload-artifact@v4
+        with:
+          name: build
+          path: |
+            ./build/node_modules

From 11ca4f6b6934292168f49cc78d3b2360a602febe Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Fri, 28 Feb 2025 10:07:13 -0600
Subject: [PATCH 70/73] feat(eslint-plugin-react-hooks): update `engines`
 declaration (#32458)

In preparation for the merging of the compiler plugin into this one
(#32416), this change proactively updates the plugin's `engines`
declaration to require Node versions greater than or equal to 18

BREAKING CHANGE

Co-authored-by: lauren <poteto@users.noreply.github.com>
---
 packages/eslint-plugin-react-hooks/package.json | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/packages/eslint-plugin-react-hooks/package.json b/packages/eslint-plugin-react-hooks/package.json
index d3717b9dee61c..48cb7ae452a8d 100644
--- a/packages/eslint-plugin-react-hooks/package.json
+++ b/packages/eslint-plugin-react-hooks/package.json
@@ -31,7 +31,7 @@
   "main": "./index.js",
   "types": "./index.d.ts",
   "engines": {
-    "node": ">=10"
+    "node": ">=18"
   },
   "homepage": "https://react.dev/",
   "peerDependencies": {

From d55cc79bcf5cd3bd4cb406381b067d72842f368e Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Fri, 28 Feb 2025 10:12:10 -0600
Subject: [PATCH 71/73] refactor(eslint-plugin-react-hooks): move rules to
 `rules` folder (#32411)

Since the compiler plugin is going to be merged into the hooks plugin,
and ultimately decomposed into several more rules, it would be good to
start creating a more traditional folder structure for the plugin. This
change just moves the rules into a `rules` folder.

Co-authored-by: lauren <poteto@users.noreply.github.com>
---
 packages/eslint-plugin-react-hooks/README.md                  | 4 ++--
 packages/eslint-plugin-react-hooks/src/index.ts               | 4 ++--
 .../src/{ => rules}/ExhaustiveDeps.ts                         | 0
 .../eslint-plugin-react-hooks/src/{ => rules}/RulesOfHooks.ts | 0
 4 files changed, 4 insertions(+), 4 deletions(-)
 rename packages/eslint-plugin-react-hooks/src/{ => rules}/ExhaustiveDeps.ts (100%)
 rename packages/eslint-plugin-react-hooks/src/{ => rules}/RulesOfHooks.ts (100%)

diff --git a/packages/eslint-plugin-react-hooks/README.md b/packages/eslint-plugin-react-hooks/README.md
index 36f63722f7268..cf54caec986f5 100644
--- a/packages/eslint-plugin-react-hooks/README.md
+++ b/packages/eslint-plugin-react-hooks/README.md
@@ -36,7 +36,7 @@ If you are still using ESLint below 9.0.0, please continue to use `recommended-l
 For [ESLint 9.0.0 and above](https://eslint.org/blog/2024/04/eslint-v9.0.0-released/) users, add the `recommended-latest` config.
 
 ```js
-import reactHooks from 'eslint-plugin-react-hooks';
+import * as reactHooks from 'eslint-plugin-react-hooks';
 
 export default [
   // ...
@@ -67,7 +67,7 @@ If you want more fine-grained configuration, you can instead add a snippet like
 #### Flat Config (eslint.config.js)
 
 ```js
-import reactHooks from 'eslint-plugin-react-hooks';
+import * as reactHooks from 'eslint-plugin-react-hooks';
 
 export default [
   {
diff --git a/packages/eslint-plugin-react-hooks/src/index.ts b/packages/eslint-plugin-react-hooks/src/index.ts
index 42b55320fcd89..5ddbbcbb806fb 100644
--- a/packages/eslint-plugin-react-hooks/src/index.ts
+++ b/packages/eslint-plugin-react-hooks/src/index.ts
@@ -4,8 +4,8 @@
  * This source code is licensed under the MIT license found in the
  * LICENSE file in the root directory of this source tree.
  */
-import RulesOfHooks from './RulesOfHooks';
-import ExhaustiveDeps from './ExhaustiveDeps';
+import RulesOfHooks from './rules/RulesOfHooks';
+import ExhaustiveDeps from './rules/ExhaustiveDeps';
 import type {ESLint, Linter, Rule} from 'eslint';
 
 // All rules
diff --git a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts b/packages/eslint-plugin-react-hooks/src/rules/ExhaustiveDeps.ts
similarity index 100%
rename from packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
rename to packages/eslint-plugin-react-hooks/src/rules/ExhaustiveDeps.ts
diff --git a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts b/packages/eslint-plugin-react-hooks/src/rules/RulesOfHooks.ts
similarity index 100%
rename from packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
rename to packages/eslint-plugin-react-hooks/src/rules/RulesOfHooks.ts

From ca12911d1fbe755b9b2b7d1bf548589317311a82 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Fri, 28 Feb 2025 10:22:08 -0600
Subject: [PATCH 72/73] feat(eslint-plugin-react-hooks): make flat config the
 `recommended` config (#32457)

This change swaps which config `recommended` is aliasing. In 5.2.0, the
new flat config was introduced as `recommended-latest`, while
`recommended` still pointed at the legacy rc-based config, with a note
that in the next major version `recommended` would be updated to point
at `recommend-latest`. This change makes that swap, and make the default
`recommended` experience the flat config. To continue using the legacy
rc recommended config, please make the following change in your config

```diff
- extends: ['plugin:react-hooks/recommended']
+ extends: ['plugin:react-hooks/recommended-legacy']
```

This change also deprecates `recommended-latest` in favor of
`recommended`. `recommended-latest` will be removed in a future major
version.

The README has been updated to reflect the new usage, and to put the
flat config sections before the legacy config sections.

I also took the opportunity to change the v9 fixture to use a typescript
config, serving as a demonstration for usage as well as a way to
validate the types are correct.

BREAKING CHANGE

---------

Co-authored-by: lauren <poteto@users.noreply.github.com>
---
 .../{eslint.config.mjs => eslint.config.ts}   |  5 +-
 fixtures/eslint-v9/package.json               |  5 +-
 fixtures/eslint-v9/tsconfig.json              |  2 +
 fixtures/eslint-v9/yarn.lock                  | 76 +++++++++----------
 packages/eslint-plugin-react-hooks/README.md  | 59 +++++++-------
 .../eslint-plugin-react-hooks/src/index.ts    | 35 +++++----
 6 files changed, 91 insertions(+), 91 deletions(-)
 rename fixtures/eslint-v9/{eslint.config.mjs => eslint.config.ts} (76%)
 create mode 100644 fixtures/eslint-v9/tsconfig.json

diff --git a/fixtures/eslint-v9/eslint.config.mjs b/fixtures/eslint-v9/eslint.config.ts
similarity index 76%
rename from fixtures/eslint-v9/eslint.config.mjs
rename to fixtures/eslint-v9/eslint.config.ts
index ffc8375265c2b..62ef68671639e 100644
--- a/fixtures/eslint-v9/eslint.config.mjs
+++ b/fixtures/eslint-v9/eslint.config.ts
@@ -1,3 +1,4 @@
+import type {Linter} from 'eslint';
 import * as reactHooks from 'eslint-plugin-react-hooks';
 
 export default [
@@ -12,10 +13,10 @@ export default [
       },
     },
   },
-  reactHooks.configs['recommended-latest'],
+  reactHooks.configs['recommended'],
   {
     rules: {
       'react-hooks/exhaustive-deps': 'error',
     },
   },
-];
+] satisfies Linter.Config[];
diff --git a/fixtures/eslint-v9/package.json b/fixtures/eslint-v9/package.json
index 58d0a94c0c58c..80827a0d1730a 100644
--- a/fixtures/eslint-v9/package.json
+++ b/fixtures/eslint-v9/package.json
@@ -2,8 +2,9 @@
   "private": true,
   "name": "eslint-v9",
   "dependencies": {
-    "eslint": "^9",
-    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
+    "eslint": "^9.18.0",
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks",
+    "jiti": "^2.4.2"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v9/tsconfig.json b/fixtures/eslint-v9/tsconfig.json
new file mode 100644
index 0000000000000..2c63c0851048d
--- /dev/null
+++ b/fixtures/eslint-v9/tsconfig.json
@@ -0,0 +1,2 @@
+{
+}
diff --git a/fixtures/eslint-v9/yarn.lock b/fixtures/eslint-v9/yarn.lock
index 1583b73f14e21..a473b3a4ce165 100644
--- a/fixtures/eslint-v9/yarn.lock
+++ b/fixtures/eslint-v9/yarn.lock
@@ -14,7 +14,7 @@
   resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
   integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
 
-"@eslint/config-array@^0.19.0":
+"@eslint/config-array@^0.19.2":
   version "0.19.2"
   resolved "https://registry.yarnpkg.com/@eslint/config-array/-/config-array-0.19.2.tgz#3060b809e111abfc97adb0bb1172778b90cb46aa"
   integrity sha512-GNKqxfHG2ySmJOBSHg7LxeUx4xpuCoFjacmlCoYWEbaPXLwvfIjixRI12xCQZeULksQb23uiA8F40w5TojpV7w==
@@ -23,24 +23,17 @@
     debug "^4.3.1"
     minimatch "^3.1.2"
 
-"@eslint/core@^0.10.0":
-  version "0.10.0"
-  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.10.0.tgz#23727063c21b335f752dbb3a16450f6f9cbc9091"
-  integrity sha512-gFHJ+xBOo4G3WRlR1e/3G8A6/KZAH6zcE/hkLRCZTi/B9avAG365QhFA8uOGzTMqgTghpn7/fSnscW++dpMSAw==
+"@eslint/core@^0.12.0":
+  version "0.12.0"
+  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.12.0.tgz#5f960c3d57728be9f6c65bd84aa6aa613078798e"
+  integrity sha512-cmrR6pytBuSMTaBweKoGMwu3EiHiEC+DoyupPmlZ0HxBJBtIxwe+j/E4XPIKNx+Q74c8lXKPwYawBf5glsTkHg==
   dependencies:
     "@types/json-schema" "^7.0.15"
 
-"@eslint/core@^0.11.0":
-  version "0.11.0"
-  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.11.0.tgz#7a9226e850922e42cbd2ba71361eacbe74352a12"
-  integrity sha512-DWUB2pksgNEb6Bz2fggIy1wh6fGgZP4Xyy/Mt0QZPiloKKXerbqq9D3SBQTlCRYOrcRPu4vuz+CGjwdfqxnoWA==
-  dependencies:
-    "@types/json-schema" "^7.0.15"
-
-"@eslint/eslintrc@^3.2.0":
-  version "3.2.0"
-  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-3.2.0.tgz#57470ac4e2e283a6bf76044d63281196e370542c"
-  integrity sha512-grOjVNN8P3hjJn/eIETF1wwd12DdnwFDoyceUJLYYdkpbwq3nLi+4fqrTAONx7XDALqlL220wC/RHSC/QTI/0w==
+"@eslint/eslintrc@^3.3.0":
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-3.3.0.tgz#96a558f45842989cca7ea1ecd785ad5491193846"
+  integrity sha512-yaVPAiNAalnCZedKLdR21GOGILMLKPyqSLWaAjQFvYA2i/ciDi8ArYVr69Anohb6cH2Ukhqti4aFnYyPm8wdwQ==
   dependencies:
     ajv "^6.12.4"
     debug "^4.3.2"
@@ -52,22 +45,22 @@
     minimatch "^3.1.2"
     strip-json-comments "^3.1.1"
 
-"@eslint/js@9.20.0":
-  version "9.20.0"
-  resolved "https://registry.yarnpkg.com/@eslint/js/-/js-9.20.0.tgz#7421bcbe74889fcd65d1be59f00130c289856eb4"
-  integrity sha512-iZA07H9io9Wn836aVTytRaNqh00Sad+EamwOVJT12GTLw1VGMFV/4JaME+JjLtr9fiGaoWgYnS54wrfWsSs4oQ==
+"@eslint/js@9.21.0":
+  version "9.21.0"
+  resolved "https://registry.yarnpkg.com/@eslint/js/-/js-9.21.0.tgz#4303ef4e07226d87c395b8fad5278763e9c15c08"
+  integrity sha512-BqStZ3HX8Yz6LvsF5ByXYrtigrV5AXADWLAGc7PH/1SxOb7/FIYYMszZZWiUou/GB9P2lXWk2SV4d+Z8h0nknw==
 
 "@eslint/object-schema@^2.1.6":
   version "2.1.6"
   resolved "https://registry.yarnpkg.com/@eslint/object-schema/-/object-schema-2.1.6.tgz#58369ab5b5b3ca117880c0f6c0b0f32f6950f24f"
   integrity sha512-RBMg5FRL0I0gs51M/guSAj5/e14VQ4tpZnQNWwuDT66P14I43ItmPfIZRhO9fUVIPOAQXU47atlywZ/czoqFPA==
 
-"@eslint/plugin-kit@^0.2.5":
-  version "0.2.5"
-  resolved "https://registry.yarnpkg.com/@eslint/plugin-kit/-/plugin-kit-0.2.5.tgz#ee07372035539e7847ef834e3f5e7b79f09e3a81"
-  integrity sha512-lB05FkqEdUg2AA0xEbUz0SnkXT1LcCTa438W4IWTUh4hdOnVbQyOJ81OrDXsJk/LSiJHubgGEFoR5EHq1NsH1A==
+"@eslint/plugin-kit@^0.2.7":
+  version "0.2.7"
+  resolved "https://registry.yarnpkg.com/@eslint/plugin-kit/-/plugin-kit-0.2.7.tgz#9901d52c136fb8f375906a73dcc382646c3b6a27"
+  integrity sha512-JubJ5B2pJ4k4yGxaNLdbjrnk9d/iDz6/q8wOilpIowd6PJPgaxCuHBnBszq7Ce2TyMrywm5r4PnKm6V3iiZF+g==
   dependencies:
-    "@eslint/core" "^0.10.0"
+    "@eslint/core" "^0.12.0"
     levn "^0.4.1"
 
 "@humanfs/core@^0.19.1":
@@ -93,10 +86,10 @@
   resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.3.1.tgz#c72a5c76a9fbaf3488e231b13dc52c0da7bab42a"
   integrity sha512-JBxkERygn7Bv/GbN5Rv8Ul6LVknS+5Bp6RgDC/O8gEBU/yeH5Ui5C/OlWrTb6qct7LjjfT6Re2NxB0ln0yYybA==
 
-"@humanwhocodes/retry@^0.4.1":
-  version "0.4.1"
-  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.4.1.tgz#9a96ce501bc62df46c4031fbd970e3cc6b10f07b"
-  integrity sha512-c7hNEllBlenFTHBky65mhq8WD2kbN9Q6gk0bTk8lSBvc554jpXSkST1iePudpt7+A/AQvuHs9EMqjHDXMY1lrA==
+"@humanwhocodes/retry@^0.4.2":
+  version "0.4.2"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.4.2.tgz#1860473de7dfa1546767448f333db80cb0ff2161"
+  integrity sha512-xeO57FpIu4p1Ri3Jq/EXq4ClRm86dVF2z/+kvFnyqVYRavTZmaFaUBbWCOuuTh0o/g7DSsk6kc2vrS4Vl5oPOQ==
 
 "@types/estree@^1.0.6":
   version "1.0.6"
@@ -231,21 +224,21 @@ eslint-visitor-keys@^4.2.0:
   resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-4.2.0.tgz#687bacb2af884fcdda8a6e7d65c606f46a14cd45"
   integrity sha512-UyLnSehNt62FFhSwjZlHmeokpRK59rcz29j+F1/aDgbkbRTk7wIc9XzdoasMUbRNKDM0qQt/+BJ4BrpFeABemw==
 
-eslint@^9:
-  version "9.20.1"
-  resolved "https://registry.yarnpkg.com/eslint/-/eslint-9.20.1.tgz#923924c078f5226832449bac86662dd7e53c91d6"
-  integrity sha512-m1mM33o6dBUjxl2qb6wv6nGNwCAsns1eKtaQ4l/NPHeTvhiUPbtdfMyktxN4B3fgHIgsYh1VT3V9txblpQHq+g==
+eslint@^9.18.0:
+  version "9.21.0"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-9.21.0.tgz#b1c9c16f5153ff219791f627b94ab8f11f811591"
+  integrity sha512-KjeihdFqTPhOMXTt7StsDxriV4n66ueuF/jfPNC3j/lduHwr/ijDwJMsF+wyMJethgiKi5wniIE243vi07d3pg==
   dependencies:
     "@eslint-community/eslint-utils" "^4.2.0"
     "@eslint-community/regexpp" "^4.12.1"
-    "@eslint/config-array" "^0.19.0"
-    "@eslint/core" "^0.11.0"
-    "@eslint/eslintrc" "^3.2.0"
-    "@eslint/js" "9.20.0"
-    "@eslint/plugin-kit" "^0.2.5"
+    "@eslint/config-array" "^0.19.2"
+    "@eslint/core" "^0.12.0"
+    "@eslint/eslintrc" "^3.3.0"
+    "@eslint/js" "9.21.0"
+    "@eslint/plugin-kit" "^0.2.7"
     "@humanfs/node" "^0.16.6"
     "@humanwhocodes/module-importer" "^1.0.1"
-    "@humanwhocodes/retry" "^0.4.1"
+    "@humanwhocodes/retry" "^0.4.2"
     "@types/estree" "^1.0.6"
     "@types/json-schema" "^7.0.15"
     ajv "^6.12.4"
@@ -399,6 +392,11 @@ isexe@^2.0.0:
   resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
   integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
 
+jiti@^2.4.2:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/jiti/-/jiti-2.4.2.tgz#d19b7732ebb6116b06e2038da74a55366faef560"
+  integrity sha512-rg9zJN+G4n2nfJl5MW3BMygZX56zKPNVEYYqq7adpmMh4Jn2QNEwhvQlFy6jPVdcod7txZtKHWnyZiA3a0zP7A==
+
 js-yaml@^4.1.0:
   version "4.1.0"
   resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-4.1.0.tgz#c1fb65f8f5017901cdd2c951864ba18458a10602"
diff --git a/packages/eslint-plugin-react-hooks/README.md b/packages/eslint-plugin-react-hooks/README.md
index cf54caec986f5..e4223c18b20e0 100644
--- a/packages/eslint-plugin-react-hooks/README.md
+++ b/packages/eslint-plugin-react-hooks/README.md
@@ -18,9 +18,22 @@ npm install eslint-plugin-react-hooks --save-dev
 yarn add eslint-plugin-react-hooks --dev
 ```
 
+### Flat Config (eslint.config.js|ts)
+
+For [ESLint 9.0.0 and above](https://eslint.org/blog/2024/04/eslint-v9.0.0-released/), add the `recommended` config.
+
+```js
+import * as reactHooks from 'eslint-plugin-react-hooks';
+
+export default [
+  // ...
+  reactHooks.configs['recommended'],
+];
+```
+
 ### Legacy Config (.eslintrc)
 
-If you are still using ESLint below 9.0.0, please continue to use `recommended-legacy`. To avoid breaking changes, we still support `recommended` as well, but note that this will be changed to alias the flat recommended config in v6.
+If you are still using ESLint below 9.0.0, you can use `recommended-legacy` for accessing the recommended config.
 
 ```js
 {
@@ -31,25 +44,29 @@ If you are still using ESLint below 9.0.0, please continue to use `recommended-l
 }
 ```
 
-### Flat Config (eslint.config.js)
+### Custom Configuration
 
-For [ESLint 9.0.0 and above](https://eslint.org/blog/2024/04/eslint-v9.0.0-released/) users, add the `recommended-latest` config.
+If you want more fine-grained configuration, you can instead add a snippet like this to your ESLint configuration file:
+
+#### Flat Config (eslint.config.js|ts)
 
 ```js
 import * as reactHooks from 'eslint-plugin-react-hooks';
 
 export default [
-  // ...
-  reactHooks.configs['recommended-latest'],
+  {
+    files: ['**/*.{js,jsx}'],
+    plugins: { 'react-hooks': reactHooks },
+    // ...
+    rules: {
+      'react-hooks/rules-of-hooks': 'error',
+      'react-hooks/exhaustive-deps': 'warn',
+    }
+  },
 ];
 ```
 
-### Custom Configuration
-
-If you want more fine-grained configuration, you can instead add a snippet like this to your ESLint configuration file:
-
 #### Legacy Config (.eslintrc)
-
 ```js
 {
   "plugins": [
@@ -64,24 +81,6 @@ If you want more fine-grained configuration, you can instead add a snippet like
 }
 ```
 
-#### Flat Config (eslint.config.js)
-
-```js
-import * as reactHooks from 'eslint-plugin-react-hooks';
-
-export default [
-  {
-    files: ['**/*.{js,jsx}'],
-    plugins: { 'react-hooks': reactHooks },
-    // ...
-    rules: {
-      'react-hooks/rules-of-hooks': 'error',
-      'react-hooks/exhaustive-deps': 'warn',
-    }
-  },
-];
-```
-
 ## Advanced Configuration
 
 `exhaustive-deps` can be configured to validate dependencies of custom Hooks with the `additionalHooks` option.
@@ -89,10 +88,10 @@ This option accepts a regex to match the names of custom Hooks that have depende
 
 ```js
 {
-  "rules": {
+  rules: {
     // ...
     "react-hooks/exhaustive-deps": ["warn", {
-      "additionalHooks": "(useMyCustomHook|useMyOtherCustomHook)"
+      additionalHooks: "(useMyCustomHook|useMyOtherCustomHook)"
     }]
   }
 }
diff --git a/packages/eslint-plugin-react-hooks/src/index.ts b/packages/eslint-plugin-react-hooks/src/index.ts
index 5ddbbcbb806fb..61ac62912ddc2 100644
--- a/packages/eslint-plugin-react-hooks/src/index.ts
+++ b/packages/eslint-plugin-react-hooks/src/index.ts
@@ -20,11 +20,16 @@ const configRules = {
   'react-hooks/exhaustive-deps': 'warn',
 } satisfies Linter.RulesRecord;
 
-// Legacy config
-const legacyRecommendedConfig = {
-  plugins: ['react-hooks'],
+// Flat config
+const recommendedConfig = {
+  name: 'react-hooks/recommended',
+  plugins: {
+    get 'react-hooks'(): ESLint.Plugin {
+      return plugin;
+    },
+  },
   rules: configRules,
-} satisfies Linter.LegacyConfig;
+};
 
 // Plugin object
 const plugin = {
@@ -34,24 +39,18 @@ const plugin = {
   rules,
   configs: {
     /** Legacy recommended config, to be used with rc-based configurations */
-    'recommended-legacy': legacyRecommendedConfig,
+    'recommended-legacy': {
+      plugins: ['react-hooks'],
+      rules: configRules,
+    },
 
     /**
-     * 'recommended' is currently aliased to the legacy / rc recommended config) to maintain backwards compatibility.
-     * This is deprecated and in v6, it will switch to alias the flat recommended config.
+     * Recommended config, to be used with flat configs.
      */
-    recommended: legacyRecommendedConfig,
+    recommended: recommendedConfig,
 
-    /** Latest recommended config, to be used with flat configurations */
-    'recommended-latest': {
-      name: 'react-hooks/recommended',
-      plugins: {
-        get 'react-hooks'(): ESLint.Plugin {
-          return plugin;
-        },
-      },
-      rules: configRules,
-    },
+    /** @deprecated please use `recommended`; will be removed in v7  */
+    'recommended-latest': recommendedConfig,
   },
 } satisfies ESLint.Plugin;
 

From eda36a1c75ff8ac09fb127f6e04d4af16e49f50f Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 28 Feb 2025 13:06:40 -0500
Subject: [PATCH 73/73] [ci] Don't erroneously mark failures as successes
 (#32493)

Randomly noticed this when I looked at a recent [DevTools regression
test run](https://github.com/facebook/react/actions/runs/13578385011).

I don't recall why we added `continue-on-error` previously, but I
believe it was to keep all jobs in the matrix running even if one were
to fail, in order to fully identify any failures from code changes like
build or test failures.

There is now a `fail-fast` option which does this.
[`continue-on-error`](https://docs.github.com/en/actions/writing-workflows/workflow-syntax-for-github-actions#jobsjob_idcontinue-on-error)
now means:

> Prevents a workflow run from failing when a job fails. Set to true to
allow a workflow run to pass when this job fails.

so it's not correct to use it.
---
 .github/workflows/compiler_typescript.yml       | 2 +-
 .github/workflows/devtools_regression_tests.yml | 4 ++--
 .github/workflows/runtime_build_and_test.yml    | 8 +++++---
 .github/workflows/runtime_eslint_plugin_e2e.yml | 2 +-
 4 files changed, 9 insertions(+), 7 deletions(-)

diff --git a/.github/workflows/compiler_typescript.yml b/.github/workflows/compiler_typescript.yml
index 6d9fa973350af..65fb789eccf17 100644
--- a/.github/workflows/compiler_typescript.yml
+++ b/.github/workflows/compiler_typescript.yml
@@ -75,8 +75,8 @@ jobs:
     name: Test ${{ matrix.workspace_name }}
     needs: discover_yarn_workspaces
     runs-on: ubuntu-latest
-    continue-on-error: true
     strategy:
+      fail-fast: false
       matrix:
         workspace_name: ${{ fromJSON(needs.discover_yarn_workspaces.outputs.matrix) }}
     steps:
diff --git a/.github/workflows/devtools_regression_tests.yml b/.github/workflows/devtools_regression_tests.yml
index 64d6707aa3688..4babfeefb0f2c 100644
--- a/.github/workflows/devtools_regression_tests.yml
+++ b/.github/workflows/devtools_regression_tests.yml
@@ -100,6 +100,7 @@ jobs:
     needs: build_devtools_and_process_artifacts
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         version:
           - "16.0"
@@ -108,7 +109,6 @@ jobs:
           - "17.0"
           - "18.0"
           - "18.2" # compiler polyfill
-    continue-on-error: true
     steps:
       - uses: actions/checkout@v4
       - uses: actions/setup-node@v4
@@ -135,6 +135,7 @@ jobs:
     needs: build_devtools_and_process_artifacts
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         version:
           - "16.0"
@@ -142,7 +143,6 @@ jobs:
           - "16.8" # hooks
           - "17.0"
           - "18.0"
-    continue-on-error: true
     steps:
       - uses: actions/checkout@v4
       - uses: actions/setup-node@v4
diff --git a/.github/workflows/runtime_build_and_test.yml b/.github/workflows/runtime_build_and_test.yml
index 12e341a86fd96..d53e352fbb266 100644
--- a/.github/workflows/runtime_build_and_test.yml
+++ b/.github/workflows/runtime_build_and_test.yml
@@ -38,8 +38,8 @@ jobs:
     name: Flow check ${{ matrix.flow_inline_config_shortname }}
     needs: discover_flow_inline_configs
     runs-on: ubuntu-latest
-    continue-on-error: true
     strategy:
+      fail-fast: false
       matrix:
         flow_inline_config_shortname: ${{ fromJSON(needs.discover_flow_inline_configs.outputs.matrix) }}
     steps:
@@ -117,6 +117,7 @@ jobs:
     name: yarn test ${{ matrix.params }} (Shard ${{ matrix.shard }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         params:
           - "-r=stable --env=development"
@@ -144,7 +145,6 @@ jobs:
           - 3/5
           - 4/5
           - 5/5
-    continue-on-error: true
     steps:
       - uses: actions/checkout@v4
         with:
@@ -170,6 +170,7 @@ jobs:
     name: yarn build and lint
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         # yml is dumb. update the --total arg to yarn build if you change the number of workers
         worker_id: [0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19]
@@ -215,6 +216,7 @@ jobs:
     name: yarn test-build
     needs: build_and_lint
     strategy:
+      fail-fast: false
       matrix:
         test_params: [
           # Intentionally passing these as strings instead of creating a
@@ -250,7 +252,6 @@ jobs:
           - 1/3
           - 2/3
           - 3/3
-    continue-on-error: true
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v4
@@ -500,6 +501,7 @@ jobs:
     needs: build_and_lint
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         browser: [chrome, firefox, edge]
     steps:
diff --git a/.github/workflows/runtime_eslint_plugin_e2e.yml b/.github/workflows/runtime_eslint_plugin_e2e.yml
index edc188f38622e..f8878548c0597 100644
--- a/.github/workflows/runtime_eslint_plugin_e2e.yml
+++ b/.github/workflows/runtime_eslint_plugin_e2e.yml
@@ -20,13 +20,13 @@ jobs:
     name: ESLint v${{ matrix.eslint_major }}
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         eslint_major:
           - "6"
           - "7"
           - "8"
           - "9"
-    continue-on-error: true
     steps:
       - uses: actions/checkout@v4
         with: